Roblox hack script | Roblox Sky Block Script Mine ores GUI

Roblox hack script | Sky Block Script Mine ores GUI

Script By DavezHacking

--[[
IronBrew:tm: obfuscation; Version 2.7.2
]]
return(function(fuckSkyBlock_IIlIIIllIIIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_lllIIlllIIl)local fuckSkyBlock_IlllIIIl=string.char;local fuckSkyBlock_IIIIlllIIlIlllIlllIlI=string.sub;local fuckSkyBlock_IIIllIlIIlllIIIIlIIlI=table.concat;local fuckSkyBlock_IllIlIIlllI=math.ldexp;local fuckSkyBlock_IIllIIllIIlIlIIlIllIll=getfenv or function()return _ENV end;local fuckSkyBlock_IIIIIIllIIlIIIIll=select;local fuckSkyBlock_IIlIllIIIllIlIlIl=unpack or table.unpack;local fuckSkyBlock_lIIlIllIIl=tonumber;local function fuckSkyBlock_IIIIIlIIIIllIlIIIlIlllIl(fuckSkyBlock_IIlIIIllIIIIl)local fuckSkyBlock_IllIlIIlI,fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl="","",{}local fuckSkyBlock_llIIIIIIlll=256;local fuckSkyBlock_IIlIllIIIllIlIlIl={}for fuckSkyBlock_llIIIIllIIllIlllII=0,fuckSkyBlock_llIIIIIIlll-1 do fuckSkyBlock_IIlIllIIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII]=fuckSkyBlock_IlllIIIl(fuckSkyBlock_llIIIIllIIllIlllII)end;local fuckSkyBlock_llIIIIllIIllIlllII=1;local function fuckSkyBlock_IIlIllIlllIl()local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_IIIIlllIIlIlllIlllIlI(fuckSkyBlock_IIlIIIllIIIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII),36)fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII+1;local fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_IIIIlllIIlIlllIlllIlI(fuckSkyBlock_IIlIIIllIIIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII+fuckSkyBlock_IllIlIIlI-1),36)fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII+fuckSkyBlock_IllIlIIlI;return fuckSkyBlock_IllIIlllllIllI end;fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IlllIIIl(fuckSkyBlock_IIlIllIlllIl())fuckSkyBlock_lIIllIIlIIllIlIlIl[1]=fuckSkyBlock_IllIlIIlI;while fuckSkyBlock_llIIIIllIIllIlllII<#fuckSkyBlock_IIlIIIllIIIIl do local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IIlIllIlllIl()if fuckSkyBlock_IIlIllIIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII]then fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_IIlIllIIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII]else fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_IllIlIIlI..fuckSkyBlock_IIIIlllIIlIlllIlllIlI(fuckSkyBlock_IllIlIIlI,1,1)end;fuckSkyBlock_IIlIllIIIllIlIlIl[fuckSkyBlock_llIIIIIIlll]=fuckSkyBlock_IllIlIIlI..fuckSkyBlock_IIIIlllIIlIlllIlllIlI(fuckSkyBlock_IllIIlllllIllI,1,1)fuckSkyBlock_lIIllIIlIIllIlIlIl[#fuckSkyBlock_lIIllIIlIIllIlIlIl+1],fuckSkyBlock_IllIlIIlI,fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIIIlll+1 end;return table.concat(fuckSkyBlock_lIIllIIlIIllIlIlIl)end;local fuckSkyBlock_lIIlIllIIl=fuckSkyBlock_IIIIIlIIIIllIlIIIlIlllIl('22M1H2751G1P2751H22G23J22Q22T23423J2362381G1I27923J23822U1G1O27921U23622R23823823J22E22S23C1G1K27922F22R23423G27I1R27921X23822X22T22B22S22T22T23I23J27P28A28C22T22L23423723823H1G1N27921T23427U23J22T1G1L27923A28627I1M27922A23I27U27Y2801V27922327B23928C22B23823D23422V23C29B29227922C23J22S23G1G29827521U23C23723H23C23J23A29S27522N29629Y27922K2342A522E21W22G28U27922823622T23C22V2381I1G1G1127922B23423623E23A22R23I22S23J23929A23H29B1Y2AK2752B72B92AC27523B2B223G21V22E22B1J27927524122N22927728W23I22Q23C2AO28J28127921W22D23C23G1Z1J24026Y24423521I22C26221A2BN2BO2791J21821Y24025S24022N24A21A2A81H2A122Z2382CG27924123G2292CX27923C2BS29Z1H21Z23C2BW2A32AR1H2BT27522K2A523822G2B223J2D227522D2D122P24F21L24X102112592CF24S24625H23223S23S24O2CF2CH1H2202D12E622G2BS29327522F28J2912D622A28Y28I2BZ2ED1H28B28D1G1S2AD2DH21D23423H23H21D23C2DK1G2892752EP22T2BD22R2BA2782F428N2CU2CW2E621P2BS2AV2DF2B322Q23828F28H28J1W22D23I22U28K2D623628J27M2AN2DE1H2DG27M29A2EW1J131K21723522C25D26P2CR2ES2DF2EU2EW2EY2FW2EW2BF2G12DH2282EX1J28B23R21A1R25I25M2GE2ET27M2EV2EX21D29B23822Q28L2GG27M21U28I27M1G29F2H82382H12EY27D28J2FE2BO22921X2D124823Y21W1E22S22623Z2CF25G23K2102412181R26U2E52BO26P23E2BS2F32CT2B322R27H21U27F2H621K28A23D2D921D23A27Z21D22U23422Q21D23G23429J21D23722W21D22D29O23822Z22H2AY23E2A523A2H323J21D22V1Y22R29X1Q2992B82FL2FN2HB2DM26P2352D124L26T25725Q22P21V25Y2I527925T2372E92CH2112BS2822BC22L22M21U22C2CS22M22P27W1G1T2AW29B29J22R2F71Y2DM1H2162K22BO22C2KR2BP22J2D121K26223P26M22722D24Z2CF1122S26D26M22U24J25N2JY27921B2I92792KD27W2JL28J1J23C1225R21D24426Y25S2CF1025R1R24X2E22602LD27521V2KU2751Z2EC2LH21T22C22N28V2752GF2DD2EN2IQ2BX1J23V2E22ML2E42C02752A323I2AZ2CS2952872F227922E23822T21U23822R29P27H2H71H21Y29B23E22Q22P2AY27I2FI2N723C23H2KK27M22Q22Q22B2B82AZ2H62FA1H2B22AZ2DJ2BZ1027921V23822P2A423623422T2382392HA29B23423A2972NY23823G23I2O52H627Q2EE2B42AN29Q27C1G122AW2K822A22I22622B21V22C2282OU2OX21S21W22C21U21X2KG27927B22V23I23E2382N12N32N22BO1B279132162791G2PJ2NX2PN2D22KH2752BN2BN1N182792PX2PN2751L1E2PY2DD27521A2CH2PN1321O2Q52EN21D2762Q52821327527K2MC2BO2PN27K2BN2QE2Q52PN2982QQ2PN2PN2782QU2Q52782NF1H27K2Q92QF2QD2QF2PN2QH2QJ1H2OJ2QM2R21H2QP2R71H2892QY2PN2JH2RK1H2KH2QQ2BN2PN2ME1H2EN2CH2BN2932PN2RV2QF1H2182PM2BO2ME2CS2MH22T2MJ2ML2E22MN2K61H2MQ2MS2EN2MU2882MX2MZ2PE2N427I2RC2N822R2NA2NC2N52NF21Y2NH2NJ2H52NM2NO2NA2G02NT23E2G428T2NX2M22O02O22O42O62O82852OB2GM2NZ2OF2OH2N622F2OL2BY2OO2OQ27522B2OS2OU2OW2OY2P022C2P22P42P62PS27A23J2PA2PC2SN2PG2792PI2752PK2S42UC2PP2RF2BO2U32PU1H2PW2Q42Q02RU2Q32752PZ2Q62Q81H2QA2QC2792RN2R92RE2QL2S42QO1H2RN2QT2RH2QX2V81H2R12R32UV2R52UY2RH2V027K2RC2V32UH2RN2RJ2RH2RM2RH2RP2PT2Q52RT2S02CI2RU2UX2UU2S22UE2751U2PM2MG2AF2S92MK2SB2SD2792SG23E2MT2AB2IA2MY2N02N22SO2N62SR2ST2ND2AU2792SX2NI2N22NK2T12MR2T32NR2T52NV28K2T91H2NZ2O123C2O32O52O728I2TG2OC2TA2TK2H52TM2TO2ON2H62TR1H2TT22M2OT2OV2OX2OZ2262P12P32P52P72752P92PB2PD2WK2N22T42WX2T72N62T52O827M2HM2PJ2PL2S12UV2UG2PR2VX2PV2PX2UT2UO2Q22792Q72Q02Q72RD132122VZ2V52VH2VE2V12E62QN2VM2RH2V72QR1H2V92Z52R02BO2VD2QI2YV2UZ2YY2VJ2Z02RE2RG2Z52VO2Z52VQ2Z52VS2UH2RS2BO2VW2VT2RY2BO2CX2R42RE2R62RE27K2V02822V22RA2822ZJ27K27K2Z431091H29F2QQ310C29F2FI2BN310C2ZC27K3100310C31032RB2E631022Z231012RI2YW310U2ZN310C2ZP29327K2RT28V2KO29328V2UO2VY2QF2ZC2823100282311E2YY29831051H2822982ZJ311F2Z4311F2W42QQ311P2VB2Q12RE310P311D311J311Y2ZC2982VK275311K310T311F2ZL311F2ZN311F2ZP28V2822RT2782VW28V2782RZ2ZH2W12YE1H2S62W62MI2W92MM2CR2SE2WD2WF2MV2WH2SM2WK2X72SP2WR2N92NB2WP2SW2SY2WU2T02NN2WX2OI2792Y82HB27I2X32X52TC2X92TF2OA2XD2X42OE2OG2XG2RC2TN27G2TP2XK2OR2XO2TV2XR2TY2U02XW2U32XZ2U72Y222R2PH2YC2W2132YG2UI2YI2UL2YK1H2US2Q12UQ314J2Q51H2YR2S42UW312J2752ZE310L2UL2ZH2V42V6310W2QV2Z631512QZ311T2792ZB2VF314U2YX314W31222Q5314Z2RH2ZL31522ZN31522ZP2RR312N2ZS2E62ZU2YV2UE2S3312M27K2762D62D82DA23H2AR27J2CH2SE1H219315P1X2RD2KO2UO31682VL2W02RA315W279315Y2A231602AS315V279316431662E6316C2QF316A279316R315E312K27523K2Q02G72W22QQ2ZW2YY2Z1315P2UK2ZC3152315A2Z52BN2ZC2RX2ZH31782VT2UO2RQ2UH317D31062E62UK317M2RE317J2RA2V42ZC29331642RA317H2VY317S2VY293317Q311F2CH31832UH311B314O310W311F317Q312C2E63107318827531172VG314X3114311G314X2CH318M317Q2983181298311L2YY278317X1H318V317Q312I318K278278317Q27Q2VW3195318H310Q318127Q27Q317Q289318Y319E319A2892NR2QQ28928927Q2R12982892ZC2892JH317B319N310V319M310V2KH2R1319X316C2ZR310H2QF2D631A41H2W42AV319T2YY310W319X2OQ2ZC2JH152PJ2752KH31AK2UC2MD1H31AO2BO2892ES2BN2FI2PN2NX319S27528917318K319X317Q2JH1631AL2RO1H1931B92ES314I2ZC29F31BC2CH28929F31AW2QF14310V31AD31B3319W310V31B631BB31B92KH1A31BD31BV31AP310D1H1D2E631BK2UH31AX1H2PI28931A91C1H1F1H316C2BN2ES2Q3310I318Z2Q531AD2ZC31AF310V31AH2752ZN2YY2ZP2UV21P315N317327931AU31C72VT31AZ2YY31B231B431BT2YY2JH21C31BW31C02YY2ES21F31B931BH31C531C231AW318M31BO319S2JH31D731BS28931BU31BI31CV1H21E31BZ31DV31BG1H21H31DK31BL31562BN31CA31D61H319V31CQ28921G2V531B3319X21J2VB31AK2BN31EE31CB2VT21I1H21L31E931CP319Z28931CS31EA31DE2ZC2KH31E031AQ31DV31D1315N31BM2UH2II31EN2UH21N1H21M31EF31D931CY21D3168319X2QB1J29F2U327931FD2892KH2PN316C31121H21R3156310A31CN31B131AE31EU1H31EW31CU31EZ310W31DF31G731F431AV31FX1H31D51331DQ1H31BR31EC319A2JH21Q31DD31F1315N31DH31C131DJ31BJ31DL31GC31DO31E931GI31G2317D2NX2JH31E02NX2KH31DY2UC31B82ES31GO29F31E331GT31E52FI27K31E831AD31EB31G231EE31G231EI31HF1H31EM31CG2RA31EP316831CO2UY31EG31CR2UV31DH31H231GN31DZ31DK31GB31HO31F831HR2RE31FB31FD319Z27K31FG31G028931FK31FM318A31FC31A02Q5316C2932ES1W3156293318S31ES31D831EV31DA31G731G631732ZC2ES31D031G031I5311U31GE31GG31GY31IF31GK1H31GM31C131F031BZ1Z31DI31DE31F431HE311U31GW31BQ31IV318831H131EY31H431DX2PJ31H831EY27531HB31E431D32VY31HH31G031HJ31JA31HL31JA31HN311U31HQ31IN1H31EP1Y31IU314U31HX31IW1331I031JX31BA31GO31H931I431K129331I731KC31IA31CQ29331IE310V31IG2RF31II2D231FP31BA31FS3123315N211315631242ZY31B031DS31G331IX31J031AM31IY31AQ31J3310V31J5311Y31J7310V31J931KZ31JB31DC31JE31KM2ES31JH31GR31JJ31G031JL311Y31JN31G031LR31B52YF31EX31H331BA31H62UV31JW31HA31E231K031F628231K3310V31K531LS31K731LS31K9311Y31KB31L731EP21031KG31FE31AG31HZ31M931I231C131KP31GT31LN28231KT31L731KV319Z28231KY31FJ31L131BA316M1H31BY31FQ2Q52FI28V31IT31HV31LE31G41H21331DD31NS31N231NR31KQ31F628V31GE31M531JP31BU2YU31LV31KO1H21531JI31F331M131K128V31M431LQ31O231IX31GO2KH21431I331LZ31HC31AT31GU31NL31C931BP31K431JP31MO319X217315628V31MS314X31EP2PL31NO31GJ31NQ31OI31LW31M031LM31OC1H31N7314X31KV316C2982ES31662FI318U31FZ31OS31NP31IX315T31DW31PQ31J1312L31OO31LN29831O031OF31LE31BU21B31N131G831MF31OA310V31M229831OE31DR31GJ31DU31DD314Q31PT31MF22931MH315629831MK319U31OU31GJ31MQ29831P029831EP22831MW31G231P631Q331QG31NX31QK31PC310V31PG1H31N931G029831NC310V2QB1N31BO2KH2ZV2CG31FB2752NR31R62W2311T31NJ31L631532ES22B315627831A831RJ31AA311T31P431QX31OH31QZ31F231R111312H31GD31BP31EI31LD31P531IX22D31DD22C31BZ22F31S431RW22A31PN31QB31GZ31IX22E2PO31KN2PJ31IO1H22H31O931QJ2FI27831QA31GH31OG31AI31KM31H531OL2YY29F22G2BO31Q231C631DM315331E821D31HX27Q31FG31FI31RB2UL31RE311Y2PQ27531RI31IJ31TR31RK31L431FR31I827Q2ES22J315627Q29827831RZ31JA31NQ31AS31G631U831AQ31AS31GA31K127Q31LP31SM31JA31BU22I31S2315N22L31SW31HD31UE1H31T031M631D9314D31N02UF31BA22K31JV315N31MF22N31SX27527Q31QM31EX31LE31OV310V31MQ27Q31P027Q31EP27431RZ31KI31LF1331ER31I131O531T631UD31F627Q31PD27Q31KV316E1H');local fuckSkyBlock_llIIIIllIIllIlllII=(bit or bit32);local fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_llIIIIllIIllIlllII and fuckSkyBlock_llIIIIllIIllIlllII.bxor or function(fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IllIlIIlI)local fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIIIlll,fuckSkyBlock_IIIIlllIIlIlllIlllIlI=1,0,10 while fuckSkyBlock_llIIIIllIIllIlllII>0 and fuckSkyBlock_IllIlIIlI>0 do local fuckSkyBlock_lIIllIIlIIllIlIlIl,fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII%2,fuckSkyBlock_IllIlIIlI%2 if fuckSkyBlock_lIIllIIlIIllIlIlIl~=fuckSkyBlock_IIIIlllIIlIlllIlllIlI then fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_llIIIIIIlll+fuckSkyBlock_IllIIlllllIllI end fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IllIlIIlI,fuckSkyBlock_IllIIlllllIllI=(fuckSkyBlock_llIIIIllIIllIlllII-fuckSkyBlock_lIIllIIlIIllIlIlIl)/2,(fuckSkyBlock_IllIlIIlI-fuckSkyBlock_IIIIlllIIlIlllIlllIlI)/2,fuckSkyBlock_IllIIlllllIllI*2 end if fuckSkyBlock_llIIIIllIIllIlllII<fuckSkyBlock_IllIlIIlI then fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IllIlIIlI end while fuckSkyBlock_llIIIIllIIllIlllII>0 do local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII%2 if fuckSkyBlock_IllIlIIlI>0 then fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_llIIIIIIlll+fuckSkyBlock_IllIIlllllIllI end fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IllIIlllllIllI=(fuckSkyBlock_llIIIIllIIllIlllII-fuckSkyBlock_IllIlIIlI)/2,fuckSkyBlock_IllIIlllllIllI*2 end return fuckSkyBlock_llIIIIIIlll end local function fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IllIlIIlI)if fuckSkyBlock_IllIlIIlI then local fuckSkyBlock_llIIIIllIIllIlllII=(fuckSkyBlock_IllIIlllllIllI/2^(fuckSkyBlock_llIIIIllIIllIlllII-1))%2^((fuckSkyBlock_IllIlIIlI-1)-(fuckSkyBlock_llIIIIllIIllIlllII-1)+1);return fuckSkyBlock_llIIIIllIIllIlllII-fuckSkyBlock_llIIIIllIIllIlllII%1;else local fuckSkyBlock_llIIIIllIIllIlllII=2^(fuckSkyBlock_llIIIIllIIllIlllII-1);return(fuckSkyBlock_IllIIlllllIllI%(fuckSkyBlock_llIIIIllIIllIlllII+fuckSkyBlock_llIIIIllIIllIlllII)>=fuckSkyBlock_llIIIIllIIllIlllII)and 1 or 0;end;end;local fuckSkyBlock_llIIIIllIIllIlllII=1;local function fuckSkyBlock_IllIlIIlI()local fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IllIlIIlI,fuckSkyBlock_lIIllIIlIIllIlIlIl,fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_IIlIIIllIIIIl(fuckSkyBlock_lIIlIllIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII+3);fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IllIIlllllIllI,17)fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IllIlIIlI,17)fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_lIIllIIlIIllIlIlIl,17)fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IIIIlllIIlIlllIlllIlI,17)fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII+4;return(fuckSkyBlock_IIIIlllIIlIlllIlllIlI*16777216)+(fuckSkyBlock_lIIllIIlIIllIlIlIl*65536)+(fuckSkyBlock_IllIlIIlI*256)+fuckSkyBlock_IllIIlllllIllI;end;local function fuckSkyBlock_IIlIllIlllIl()local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IIlIIIllIIIIl(fuckSkyBlock_lIIlIllIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII),17);fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII+1;return fuckSkyBlock_IllIlIIlI;end;local function fuckSkyBlock_lIIllIIlIIllIlIlIl()local fuckSkyBlock_IllIlIIlI,fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_IIlIIIllIIIIl(fuckSkyBlock_lIIlIllIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII+2);fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IllIlIIlI,17)fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IllIIlllllIllI,17)fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII+2;return(fuckSkyBlock_IllIIlllllIllI*256)+fuckSkyBlock_IllIlIIlI;end;local function fuckSkyBlock_llIIlIlIIIlIllIIIIlllIII()local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IllIlIIlI();local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI();local fuckSkyBlock_IIIIlllIIlIlllIlllIlI=1;local fuckSkyBlock_llIIIIIIlll=(fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IllIlIIlI,1,20)*(2^32))+fuckSkyBlock_llIIIIllIIllIlllII;local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IllIlIIlI,21,31);local fuckSkyBlock_IllIlIIlI=((-1)^fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IllIlIIlI,32));if(fuckSkyBlock_llIIIIllIIllIlllII==0)then if(fuckSkyBlock_llIIIIIIlll==0)then return fuckSkyBlock_IllIlIIlI*0;else fuckSkyBlock_llIIIIllIIllIlllII=1;fuckSkyBlock_IIIIlllIIlIlllIlllIlI=0;end;elseif(fuckSkyBlock_llIIIIllIIllIlllII==2047)then return(fuckSkyBlock_llIIIIIIlll==0)and(fuckSkyBlock_IllIlIIlI*(1/0))or(fuckSkyBlock_IllIlIIlI*(0/0));end;return fuckSkyBlock_IllIlIIlllI(fuckSkyBlock_IllIlIIlI,fuckSkyBlock_llIIIIllIIllIlllII-1023)*(fuckSkyBlock_IIIIlllIIlIlllIlllIlI+(fuckSkyBlock_llIIIIIIlll/(2^52)));end;local fuckSkyBlock_IIIIIlIIIIllIlIIIlIlllIl=fuckSkyBlock_IllIlIIlI;local function fuckSkyBlock_IllIlIIlllI(fuckSkyBlock_IllIlIIlI)local fuckSkyBlock_IllIIlllllIllI;if(not fuckSkyBlock_IllIlIIlI)then fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IIIIIlIIIIllIlIIIlIlllIl();if(fuckSkyBlock_IllIlIIlI==0)then return'';end;end;fuckSkyBlock_IllIIlllllIllI=fuckSkyBlock_IIIIlllIIlIlllIlllIlI(fuckSkyBlock_lIIlIllIIl,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII+fuckSkyBlock_IllIlIIlI-1);fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII+fuckSkyBlock_IllIlIIlI;local fuckSkyBlock_IllIlIIlI={}for fuckSkyBlock_llIIIIllIIllIlllII=1,#fuckSkyBlock_IllIIlllllIllI do fuckSkyBlock_IllIlIIlI[fuckSkyBlock_llIIIIllIIllIlllII]=fuckSkyBlock_IlllIIIl(fuckSkyBlock_llIIIIIIlll(fuckSkyBlock_IIlIIIllIIIIl(fuckSkyBlock_IIIIlllIIlIlllIlllIlI(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_llIIIIllIIllIlllII)),17))end return fuckSkyBlock_IIIllIlIIlllIIIIlIIlI(fuckSkyBlock_IllIlIIlI);end;local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IllIlIIlI;local function fuckSkyBlock_IIIllIlIIlllIIIIlIIlI(...)return{...},fuckSkyBlock_IIIIIIllIIlIIIIll('#',...)end local function fuckSkyBlock_IlllIIIl()local fuckSkyBlock_IIlIIIllIIIIl={};local fuckSkyBlock_llIIIIIIlll={};local fuckSkyBlock_llIIIIllIIllIlllII={};local fuckSkyBlock_lIIlIllIIl={[#{{387;418;413;257};"1 + 1 = 111";}]=fuckSkyBlock_llIIIIIIlll,[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=nil,[#{{589;603;228;435};{930;130;527;858};{208;586;815;65};"1 + 1 = 111";}]=fuckSkyBlock_llIIIIllIIllIlllII,[#{{85;936;918;715};}]=fuckSkyBlock_IIlIIIllIIIIl,};local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IllIlIIlI()local fuckSkyBlock_IIIIlllIIlIlllIlllIlI={}for fuckSkyBlock_IllIIlllllIllI=1,fuckSkyBlock_llIIIIllIIllIlllII do local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IIlIllIlllIl();local fuckSkyBlock_llIIIIllIIllIlllII;if(fuckSkyBlock_IllIlIIlI==3)then fuckSkyBlock_llIIIIllIIllIlllII=(fuckSkyBlock_IIlIllIlllIl()~=0);elseif(fuckSkyBlock_IllIlIIlI==2)then fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIlIlIIIlIllIIIIlllIII();elseif(fuckSkyBlock_IllIlIIlI==1)then fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IllIlIIlllI();end;fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_IllIIlllllIllI]=fuckSkyBlock_llIIIIllIIllIlllII;end;for fuckSkyBlock_llIIIIllIIllIlllII=1,fuckSkyBlock_IllIlIIlI()do fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_llIIIIllIIllIlllII-1]=fuckSkyBlock_IlllIIIl();end;for fuckSkyBlock_lIIlIllIIl=1,fuckSkyBlock_IllIlIIlI()do local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IIlIllIlllIl();if(fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_llIIIIllIIllIlllII,1,1)==0)then local fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_llIIIIllIIllIlllII,2,3);local fuckSkyBlock_IIlIllIIIllIlIlIl=fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_llIIIIllIIllIlllII,4,6);local fuckSkyBlock_llIIIIllIIllIlllII={fuckSkyBlock_lIIllIIlIIllIlIlIl(),fuckSkyBlock_lIIllIIlIIllIlIlIl(),nil,nil};if(fuckSkyBlock_llIIIIIIlll==0)then fuckSkyBlock_llIIIIllIIllIlllII[#("6B0")]=fuckSkyBlock_lIIllIIlIIllIlIlIl();fuckSkyBlock_llIIIIllIIllIlllII[#("36Hd")]=fuckSkyBlock_lIIllIIlIIllIlIlIl();elseif(fuckSkyBlock_llIIIIIIlll==1)then fuckSkyBlock_llIIIIllIIllIlllII[#("XRJ")]=fuckSkyBlock_IllIlIIlI();elseif(fuckSkyBlock_llIIIIIIlll==2)then fuckSkyBlock_llIIIIllIIllIlllII[#("Ry5")]=fuckSkyBlock_IllIlIIlI()-(2^16)elseif(fuckSkyBlock_llIIIIIIlll==3)then fuckSkyBlock_llIIIIllIIllIlllII[#("aTu")]=fuckSkyBlock_IllIlIIlI()-(2^16)fuckSkyBlock_llIIIIllIIllIlllII[#("YaXo")]=fuckSkyBlock_lIIllIIlIIllIlIlIl();end;if(fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IIlIllIIIllIlIlIl,1,1)==1)then fuckSkyBlock_llIIIIllIIllIlllII[#("Og")]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("07")]]end if(fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IIlIllIIIllIlIlIl,2,2)==1)then fuckSkyBlock_llIIIIllIIllIlllII[#("VHb")]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("1Rk")]]end if(fuckSkyBlock_IllIIlllllIllI(fuckSkyBlock_IIlIllIIIllIlIlIl,3,3)==1)then fuckSkyBlock_llIIIIllIIllIlllII[#("lQCM")]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("oA59")]]end fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_lIIlIllIIl]=fuckSkyBlock_llIIIIllIIllIlllII;end end;fuckSkyBlock_lIIlIllIIl[3]=fuckSkyBlock_IIlIllIlllIl();return fuckSkyBlock_lIIlIllIIl;end;local function fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IIlIllIlllIl,fuckSkyBlock_IIIIlllIIlIlllIlllIlI)fuckSkyBlock_llIIIIllIIllIlllII=(fuckSkyBlock_llIIIIllIIllIlllII==true and fuckSkyBlock_IlllIIIl())or fuckSkyBlock_llIIIIllIIllIlllII;return(function(...)local fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_llIIIIllIIllIlllII[1];local fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[3];local fuckSkyBlock_IlllIIIl=fuckSkyBlock_llIIIIllIIllIlllII[2];local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IIIllIlIIlllIIIIlIIlI local fuckSkyBlock_IllIlIIlI=1;local fuckSkyBlock_llIIIIllIIllIlllII=-1;local fuckSkyBlock_IIIIIlIIIIllIlIIIlIlllIl={};local fuckSkyBlock_IIlIIIllIIIIl={...};local fuckSkyBlock_IIIllIlIIlllIIIIlIIlI=fuckSkyBlock_IIIIIIllIIlIIIIll('#',...)-1;local fuckSkyBlock_IIIIIIllIIlIIIIll={};local fuckSkyBlock_IllIIlllllIllI={};for fuckSkyBlock_llIIIIllIIllIlllII=0,fuckSkyBlock_IIIllIlIIlllIIIIlIIlI do if(fuckSkyBlock_llIIIIllIIllIlllII>=fuckSkyBlock_lIIllIIlIIllIlIlIl)then fuckSkyBlock_IIIIIlIIIIllIlIIIlIlllIl[fuckSkyBlock_llIIIIllIIllIlllII-fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII+1];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII+#{"1 + 1 = 111";}];end;end;local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_IIIllIlIIlllIIIIlIIlI-fuckSkyBlock_lIIllIIlIIllIlIlIl+1 local fuckSkyBlock_llIIIIllIIllIlllII;local fuckSkyBlock_lIIllIIlIIllIlIlIl;while true do fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("U")];if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("dAJSGNItA6fFDszCSasJike9yTzQobl")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("FnhyB6qqZx2EBbQ")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("HzZ7hDJ")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("vJt")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("n")then if fuckSkyBlock_lIIllIIlIIllIlIlIl==#("")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("s7")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Isi")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("zHKq")];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3j")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("rcd")]][fuckSkyBlock_llIIIIllIIllIlllII[#("qv9A")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Zt")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("WAJ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("e6")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("lL1")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("IW")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{461;472;884;512};"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2O")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("OtE")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("DJ")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("fce")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("lL")]][fuckSkyBlock_llIIIIllIIllIlllII[#("0AZ")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("iWO9")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bT")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("pAU")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("MV")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("I49")]][fuckSkyBlock_llIIIIllIIllIlllII[#("TK47")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Me")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("tA2")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl==#{"1 + 1 = 111";{849;479;19;214};}then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4r")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("kCh")]][fuckSkyBlock_llIIIIllIIllIlllII[#("MhEi")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2g")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("P87")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{295;965;36;561};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{254;812;481;819};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ZP")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("ZJJ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("EO")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("8tP")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{718;257;225;759};}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("LtN")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4x")]][fuckSkyBlock_llIIIIllIIllIlllII[#("1yF")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("DEs3")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ah")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("1ZN")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("72")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("C3z")]][fuckSkyBlock_llIIIIllIIllIlllII[#("k9Kj")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bm")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("44e")];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CD")]]=fuckSkyBlock_IIlIllIlllIl[fuckSkyBlock_llIIIIllIIllIlllII[#("CZa")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bN")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("vxqi")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("La")]]=fuckSkyBlock_IIlIllIlllIl[fuckSkyBlock_llIIIIllIIllIlllII[#("vTQ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("TU")]][fuckSkyBlock_llIIIIllIIllIlllII[#("UGa")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("DaxC")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];do return end;end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("aolaa")then if fuckSkyBlock_lIIllIIlIIllIlIlIl==#("TcTV")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Zx")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Zvt")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("WH")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("DAi")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("KHW")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0R")]][fuckSkyBlock_llIIIIllIIllIlllII[#("k4u")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("zcDr")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("04")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{533;736;943;823};{820;822;51;834};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("84")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sKh")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{534;373;640;265};"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("KR")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("TGk")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4x")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("iOE")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("JD")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("2IZ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{445;115;861;841};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("LWz")];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3k")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{{162;886;813;427};"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("mk")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("USY")]][fuckSkyBlock_llIIIIllIIllIlllII[#("rdCA")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Bl")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("yMT")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("vS")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("LoI")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("kk")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("n8I")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Wdgq")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uN")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("p9p")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{232;867;945;117};{161;898;547;877};}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("c0d")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{914;693;452;234};"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fWD")]][fuckSkyBlock_llIIIIllIIllIlllII[#("imFC")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{684;630;714;889};{643;42;552;199};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("y2f")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("n6")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("dO")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("gbL")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("AH")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{941;191;402;616};{640;114;949;469};{924;810;220;946};}]][fuckSkyBlock_llIIIIllIIllIlllII[#("xtVA")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2o")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("4It")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("hv")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("By")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("aKu")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("rm")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oCW")]][fuckSkyBlock_llIIIIllIIllIlllII[#("LUbr")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("QK")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("vGd")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("UR")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("Pmu")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("rr")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("iqJ")]][fuckSkyBlock_llIIIIllIIllIlllII[#("BbaZ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Su")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("j1h")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("og")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("95")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("yHp")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("pTc")]][fuckSkyBlock_llIIIIllIIllIlllII[#("PakX")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("c5")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("GzL")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("os")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("WW")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("B1o")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gH")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gzu")]][fuckSkyBlock_llIIIIllIIllIlllII[#("r41S")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("FD")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("7Rv")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("EP")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("VL")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("ziy")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("dz")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("8LF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("z4gZ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{375;318;692;473};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Cio")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Vs")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("hu")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("mqB")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("iI")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("EIx")]][fuckSkyBlock_llIIIIllIIllIlllII[#("mHbt")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("QF")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("MZk")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("iF")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1])fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("xL")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("cNM")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("rU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HHo")]][fuckSkyBlock_llIIIIllIIllIlllII[#("uVJq")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("kVg")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ibk7")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qL")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("vzH")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("69")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4Ce")]][fuckSkyBlock_llIIIIllIIllIlllII[#("VdqV")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ii")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NGT")]][fuckSkyBlock_llIIIIllIIllIlllII[#("hbSl")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ib")]][fuckSkyBlock_llIIIIllIIllIlllII[#("7Sg")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CDcO")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("r9")]][fuckSkyBlock_llIIIIllIIllIlllII[#("tf2")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("QNlJ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ov")]][fuckSkyBlock_llIIIIllIIllIlllII[#("8fL")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3aQh")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("pY")]][fuckSkyBlock_llIIIIllIIllIlllII[#("9UM")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("4C3b")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("BM")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("4HI")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CR")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("juq")]][fuckSkyBlock_llIIIIllIIllIlllII[#("qU3S")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oZ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{91;769;441;485};"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NS")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("U2P")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("b1")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("3WX")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("rl")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("BZx")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ti")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{685;973;961;685};"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{497;172;166;771};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sL")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("Xk5")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("be")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Zjy")]][fuckSkyBlock_llIIIIllIIllIlllII[#("kZZO")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Kc")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{934;66;74;536};"1 + 1 = 111";{16;77;62;145};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("TX")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Bay")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fZ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("TSZ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("TE")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{217;41;843;827};"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("St")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("6XD")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("O4")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2S5J")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Qq")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("las")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("E7")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Hmt")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{770;59;619;238};{965;680;400;98};"1 + 1 = 111";{46;523;349;400};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vG")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("EKI")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Yi")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("gky")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("BFv")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("lP")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Sc0")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("e4")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("TTm")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("f6")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{687;516;988;721};"1 + 1 = 111";{293;19;687;984};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{58;656;387;116};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{635;824;77;391};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("UdB")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{795;369;439;905};"1 + 1 = 111";{762;288;611;697};"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qa")]][fuckSkyBlock_llIIIIllIIllIlllII[#("RIu")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("SJuN")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cO")]][fuckSkyBlock_llIIIIllIIllIlllII[#("zoM")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("brt9")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ku")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("H0g")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ef")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("AcO")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{435;356;742;211};"1 + 1 = 111";{237;497;400;934};{825;537;968;848};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("gy4")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("br")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("kLg")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("KJxcri")then local fuckSkyBlock_IIlIIIllIIIIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("8g")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("9r3")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{323;527;307;918};"1 + 1 = 111";}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Pc1")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("lGu6")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HK")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{906;902;963;886};{920;184;323;260};{572;804;932;532};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("kYV")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fT")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Aak")]][fuckSkyBlock_llIIIIllIIllIlllII[#("BjlM")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("De")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("MAN")]][fuckSkyBlock_llIIIIllIIllIlllII[#("9GTY")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0W")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ppz")]][fuckSkyBlock_llIIIIllIIllIlllII[#("cjvo")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("tC")]][fuckSkyBlock_llIIIIllIIllIlllII[#("iqq")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("txrm")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{308;783;256;877};{804;100;495;795};}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("BHI")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("R1")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uCk")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Od")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("9dc")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("uW")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("sVF")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("OL")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NBU")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("kF")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Bok")]][fuckSkyBlock_llIIIIllIIllIlllII[#("kXTP")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{953;419;745;663};{209;220;465;510};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("PoF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("IyTy")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Dy")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NG4")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("GJGg")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("RU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("QNC")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Vk")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("qOi")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("ZP3")];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("mO")]][fuckSkyBlock_llIIIIllIIllIlllII[#("yjv")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{225;797;161;583};{343;284;764;589};{5;841;897;54};"1 + 1 = 111";}]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("loFbOnc1NEc")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("sEU8bC5Gy")then if fuckSkyBlock_lIIllIIlIIllIlIlIl==#{"1 + 1 = 111";{19;349;600;528};{621;672;298;327};{484;72;306;580};"1 + 1 = 111";{996;572;755;896};{973;747;985;694};{966;66;703;60};}then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("71")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("UgT")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Yoi3")]];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fZ")]]=fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_IlllIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("HgP")]],nil,fuckSkyBlock_IIIIlllIIlIlllIlllIlI);end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("6TolF79L78")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ET")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("v8C")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("QV")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("6V1")]][fuckSkyBlock_llIIIIllIIllIlllII[#("5IIK")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("5Y")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("iKW")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bQ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("t2b")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("AN")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("rWu")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uv")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("uMl")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("la")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("2MP")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("n3")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Xl5")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Opz6")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("jh")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("7pq")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("XR")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("mba")]][fuckSkyBlock_llIIIIllIIllIlllII[#("pARq")]];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Pe")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{{580;809;289;592};"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("hpaVDY0LvLvNC")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("bAq0Oq1QTgne")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vm")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yPK")]];else local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{501;764;918;460};}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII+1])end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("obb08Ho67f8vV6")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("BV")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("eUA")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ZU")]][fuckSkyBlock_llIIIIllIIllIlllII[#("V41")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("5O4Z")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oW")]][fuckSkyBlock_llIIIIllIIllIlllII[#("X7n")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("d9FL")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{36;680;939;327};"1 + 1 = 111";}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("ftQ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("G4")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("OlT")]][fuckSkyBlock_llIIIIllIIllIlllII[#("WI5x")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Lq")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{945;35;782;863};{1;387;987;774};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NH")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Wq7")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Yi")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("lyg")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Tv")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("cXD")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Le")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{354;732;638;173};"1 + 1 = 111";{859;574;485;963};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{930;833;842;290};"1 + 1 = 111";{73;974;121;363};"1 + 1 = 111";}]];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Kg")]]=fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_IlllIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]],nil,fuckSkyBlock_IIIIlllIIlIlllIlllIlI);end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("LjKgWeEHSUsSrBG3IyHLJtU")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("gnkdurF2uCfKHhsnUEt")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("PZ6GClB7ou0qzlaI3")then if fuckSkyBlock_lIIllIIlIIllIlIlIl==#("lAoBy0v6xBfs0f9O")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("QV")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("YQ8")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("my")]][fuckSkyBlock_llIIIIllIIllIlllII[#("UEi")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{697;177;344;45};{724;124;48;940};"1 + 1 = 111";{386;302;621;53};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("z4")]][fuckSkyBlock_llIIIIllIIllIlllII[#("6Gq")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("pjJy")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gX")]][fuckSkyBlock_llIIIIllIIllIlllII[#("9j8")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("FhGu")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("66J")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0U")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0as")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oK")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("1Ok")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("9M")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("xPP")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Xf")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("2N")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("LA")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("o4q")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("qqPMj1IN9LYkuhUtts")then local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIllIIllIlllII[#("6Z")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII](fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII+1])else local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("Jz")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IllIlIIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("Gid")]))end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("1oBfjFYa15EVqVETqoYcI")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("YyoHVcsv9GXfWE0lFgu1")then local fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IlllIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("mtg")]];local fuckSkyBlock_IIlIllIIIllIlIlIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl={};fuckSkyBlock_IIlIllIIIllIlIlIl=fuckSkyBlock_lllIIlllIIl({},{__index=function(fuckSkyBlock_IllIlIIlI,fuckSkyBlock_llIIIIllIIllIlllII)local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII];return fuckSkyBlock_llIIIIllIIllIlllII[1][fuckSkyBlock_llIIIIllIIllIlllII[2]];end,__newindex=function(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IllIlIIlI)local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII]fuckSkyBlock_llIIIIllIIllIlllII[1][fuckSkyBlock_llIIIIllIIllIlllII[2]]=fuckSkyBlock_IllIlIIlI;end;});for fuckSkyBlock_IIIIlllIIlIlllIlllIlI=1,fuckSkyBlock_llIIIIllIIllIlllII[#("5d7D")]do fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];if fuckSkyBlock_llIIIIllIIllIlllII[#("V")]==42 then fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_IIIIlllIIlIlllIlllIlI-1]={fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIllIIllIlllII[#("7fz")]};else fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_IIIIlllIIlIlllIlllIlI-1]={fuckSkyBlock_IIlIllIlllIl,fuckSkyBlock_llIIIIllIIllIlllII[#("xQN")]};end;fuckSkyBlock_IIIIIIllIIlIIIIll[#fuckSkyBlock_IIIIIIllIIlIIIIll+1]=fuckSkyBlock_lIIllIIlIIllIlIlIl;end;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Qo")]]=fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_IIlIIIllIIIIl,fuckSkyBlock_IIlIllIIIllIlIlIl,fuckSkyBlock_IIIIlllIIlIlllIlllIlI);else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sR")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{311;638;556;786};{265;713;110;206};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fub4")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cE")]][fuckSkyBlock_llIIIIllIIllIlllII[#("0mg")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("LKnn")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CV")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("S2n")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Eu")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("V1j")]][fuckSkyBlock_llIIIIllIIllIlllII[#("gGlg")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sR")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("UWW")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Nz")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("KJq")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("VG")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("NG")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("gOT")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ks")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Zez")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3BhY")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("aq")]][fuckSkyBlock_llIIIIllIIllIlllII[#("e8Q")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("PbKu")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl==#("RF0IA1zDfFpvjAc1NTWRF6")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("eJ")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bK4")]][fuckSkyBlock_llIIIIllIIllIlllII[#("MvEt")]];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("OQ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("fMR")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sV")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{619;284;503;130};"1 + 1 = 111";{413;547;668;783};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("lA")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("34G")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yg")]][fuckSkyBlock_llIIIIllIIllIlllII[#("zWS")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("61QZ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{980;854;670;24};"1 + 1 = 111";}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("f7x")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("a6")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("4hPK")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("K5")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("DK2")]][fuckSkyBlock_llIIIIllIIllIlllII[#("43sv")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uP")]][fuckSkyBlock_llIIIIllIIllIlllII[#("fDR")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Oile")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("6C")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{950;301;869;114};{301;510;822;431};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("E6i0")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("1B")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("Gbm")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("7l892fTRRRag2z9vl424aHUNdXt")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("xJklVI2xC1GyvYJPjtjCOyLWN")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#{{340;830;921;166};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{893;390;22;513};{559;302;90;675};{548;917;441;444};{953;121;273;370};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{538;184;595;695};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{194;134;868;649};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{982;915;909;740};{94;813;125;295};}then if fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("8A")]]then fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;else fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("LhR")];end;else do return end;end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("UN2o98yJTLC5f5BMFDAiu7Y6bE")then local fuckSkyBlock_IIlIIIllIIIIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("kO")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("JOk")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("pdn")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("eURb")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("QJ")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{257;605;591;453};"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("zp")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("8bM")]][fuckSkyBlock_llIIIIllIIllIlllII[#("og4f")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sM")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("LrF")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ma")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("nFe")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vE")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("ZWg")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Nt")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#{{648;802;134;571};{257;660;237;572};"1 + 1 = 111";}]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{364;766;487;392};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#{{82;224;567;730};{382;397;51;800};{953;208;297;330};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{814;889;377;797};"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Au")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("AKF")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("zA")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{624;629;255;946};}]][fuckSkyBlock_llIIIIllIIllIlllII[#("VWHN")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sX")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("VD7")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{142;559;850;884};{150;133;221;832};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("z1c")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("x3")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("MqS")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("M5")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{633;928;588;314};"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("WO")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("6kt")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HP")]][fuckSkyBlock_llIIIIllIIllIlllII[#("yiJ")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("WToA")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("jM")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("4Y5")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("hI")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{713;448;837;952};"1 + 1 = 111";"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("Dkze")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("9F")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("RqS")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("tq")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("YMO")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("h9")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("QiA")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("T9")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("aco")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Of")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("ibf")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("S9")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("aS0K")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ra")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("4RL")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("N6")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("5bH")]][fuckSkyBlock_llIIIIllIIllIlllII[#("jBNz")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("D2")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fhx")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Y8ns")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ip")]][fuckSkyBlock_llIIIIllIIllIlllII[#("9fP")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ZWRR")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ul")]][fuckSkyBlock_llIIIIllIIllIlllII[#("GzX")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("SzGi")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ph")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("T5p")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Od")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Jm2")]][fuckSkyBlock_llIIIIllIIllIlllII[#("vGrX")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("hF")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("xgr")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Jd")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("0fC")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("c2")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("ad8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("mB")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("LpI")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uZ")]][fuckSkyBlock_llIIIIllIIllIlllII[#("P6T")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("eRZC")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("6v")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{870;379;215;548};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{514;92;65;325};{519;861;619;594};{623;396;242;707};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("r0")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Gk2")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("uihQ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("JJ")]][fuckSkyBlock_llIIIIllIIllIlllII[#("CTc")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("XF5S")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("c8")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("jVW")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("J8")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Z8D")]][fuckSkyBlock_llIIIIllIIllIlllII[#("QDSL")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("5e")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("NIt")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("8k")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("BjO")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ce")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("xvm")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("cB")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("EZz")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{804;85;741;402};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("Jy2")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("MmRh")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("lA")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("mEP")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("RT")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("apF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Oj0R")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Uv")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("EKd")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oI")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("D0A")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("lG")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("BeD")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{118;710;700;495};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("GAM")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Lr")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Qx")]][fuckSkyBlock_llIIIIllIIllIlllII[#("vkA")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("hjWr")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cF")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("fWQ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Op")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3bC")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ZaWE")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yD")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("PY9")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("51")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("rGj")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("C1")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("AMk")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ml")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("5Hj")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("TT")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("2JV")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Jp")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ajE")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("KrZo")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Zk")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("kNL")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gF")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("jp4")]][fuckSkyBlock_llIIIIllIIllIlllII[#("0KJy")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NrR")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{333;158;696;291};"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{105;957;920;78};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("AYX")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("trOT")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Df")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{856;278;309;501};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("lsBZ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("X1")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("95G")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{453;859;411;66};"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("N2r")]][fuckSkyBlock_llIIIIllIIllIlllII[#("NTOI")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Gz")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("q0k")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Oy")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("uRN")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{699;517;474;540};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("4DE")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("cD")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("RV1")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("UZ")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ZCy")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("QRnD")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#{{215;710;438;779};{534;16;558;372};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("txDC")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("kF")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oTs")]][fuckSkyBlock_llIIIIllIIllIlllII[#("dLCP")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("GV")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gbd")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("i6o1")]];else local fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IlllIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("8Ji")]];local fuckSkyBlock_IIlIllIIIllIlIlIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl={};fuckSkyBlock_IIlIllIIIllIlIlIl=fuckSkyBlock_lllIIlllIIl({},{__index=function(fuckSkyBlock_IllIlIIlI,fuckSkyBlock_llIIIIllIIllIlllII)local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII];return fuckSkyBlock_llIIIIllIIllIlllII[1][fuckSkyBlock_llIIIIllIIllIlllII[2]];end,__newindex=function(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIllIIllIlllII,fuckSkyBlock_IllIlIIlI)local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII]fuckSkyBlock_llIIIIllIIllIlllII[1][fuckSkyBlock_llIIIIllIIllIlllII[2]]=fuckSkyBlock_IllIlIIlI;end;});for fuckSkyBlock_IIIIlllIIlIlllIlllIlI=1,fuckSkyBlock_llIIIIllIIllIlllII[#("Hvd4")]do fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;local fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];if fuckSkyBlock_llIIIIllIIllIlllII[#("Y")]==42 then fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_IIIIlllIIlIlllIlllIlI-1]={fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_llIIIIllIIllIlllII[#("hmx")]};else fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_IIIIlllIIlIlllIlllIlI-1]={fuckSkyBlock_IIlIllIlllIl,fuckSkyBlock_llIIIIllIIllIlllII[#("lhf")]};end;fuckSkyBlock_IIIIIIllIIlIIIIll[#fuckSkyBlock_IIIIIIllIIlIIIIll+1]=fuckSkyBlock_lIIllIIlIIllIlIlIl;end;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cT")]]=fuckSkyBlock_lIIlIllIIl(fuckSkyBlock_IIlIIIllIIIIl,fuckSkyBlock_IIlIllIIIllIlIlIl,fuckSkyBlock_IIIIlllIIlIlllIlllIlI);end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("yhEUCx2lC3NujipNUeRYz82dTI6hX")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("6mFSaBo19JmU8T1ipaftd1tP1AoA")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{139;941;596;727};}]]=fuckSkyBlock_IIlIllIlllIl[fuckSkyBlock_llIIIIllIIllIlllII[#("hVc")]];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("G2")]]={};end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#{{913;691;864;766};"1 + 1 = 111";{524;242;223;257};"1 + 1 = 111";"1 + 1 = 111";{985;653;114;623};"1 + 1 = 111";{968;764;620;951};"1 + 1 = 111";"1 + 1 = 111";{920;817;528;502};"1 + 1 = 111";{505;344;6;882};{662;562;25;8};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{899;777;546;289};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{745;647;215;546};{588;982;868;44};"1 + 1 = 111";{286;779;356;714};{66;116;146;873};{857;398;549;128};{858;299;547;292};{248;741;632;357};}then fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("e2U")];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3t")]]=fuckSkyBlock_IIlIllIlllIl[fuckSkyBlock_llIIIIllIIllIlllII[#("FnJ")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("mZ1fiCvvWCsY1q6kWkdlBfnzMFS522H9LIMIcaajtNyUsEd")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("HKsSWOjhMCDNTAE35smtPyhVk42XRDghB7zrJYn")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("yF6LHxA3iFZ9rUgiDHH1WvAjvvmWbmtgfp5")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("BHoYE8PmNh0Q0pYcqvlbeXolkO26kT3cZ")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("R6sTxXRnGoFG5VzrZTd3fOrcO0gTb4nY")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("xC")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("FVp")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7W")]][fuckSkyBlock_llIIIIllIIllIlllII[#("yyJ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("r1aD")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("AO")]][fuckSkyBlock_llIIIIllIIllIlllII[#("zmk")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{113;651;786;254};{974;925;542;163};{759;554;601;972};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("8T")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("NfG")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cx")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("eO1")]][fuckSkyBlock_llIIIIllIIllIlllII[#("5VUl")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("iH")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("PJr")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("s9")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Qek")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yM")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("r3W")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("ae")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("aNr")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{567;545;282;780};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("6Vu")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{925;867;584;427};{422;483;129;327};"1 + 1 = 111";"1 + 1 = 111";}]];else if fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("p1")]]then fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;else fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("Jmy")];end;end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("3I2TI9zt1qaQOShI23k851cOpfHQ8lLaRP")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;local fuckSkyBlock_IIIIlllIIlIlllIlllIlI;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("se")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("K4L")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0n")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("xhf")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Zf")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("v50")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("bd")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("EX6")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{371;512;484;557};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("nuM")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("L0VJ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ry")]][fuckSkyBlock_llIIIIllIIllIlllII[#("BBh")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("QEXQ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("nL")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("YiP")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("i8")];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("see")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1]=fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{71;651;783;472};"1 + 1 = 111";}]];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;local fuckSkyBlock_IIIIlllIIlIlllIlllIlI;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("C6")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("lv2")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("GP")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Dl0")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("KS")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("X5y")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("VU")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#{{710;178;321;597};"1 + 1 = 111";{42;715;88;771};}]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Us")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ZbK")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gJOt")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("dD")]][fuckSkyBlock_llIIIIllIIllIlllII[#("L2F")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("yldV")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Gv")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("WMk")]][fuckSkyBlock_llIIIIllIIllIlllII[#("RiRz")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("Pl")];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CVH")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1]=fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII[#("BfBZ")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{633;544;838;316};{557;256;451;727};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{178;68;873;362};"1 + 1 = 111";{105;580;187;426};"1 + 1 = 111";"1 + 1 = 111";{63;940;27;552};{514;342;411;562};{817;353;31;544};{427;94;381;206};{248;130;777;40};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{287;466;237;98};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{13;160;87;717};{957;432;13;897};{874;73;558;695};{659;531;196;260};{926;722;661;402};{950;516;80;747};"1 + 1 = 111";}then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("BsvNPy3fzRXdK71SaRse0r7nJSqxaCejYAMH")then local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("CD")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IllIlIIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("1yU")]))else local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("pb")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IllIlIIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("4k0")]))end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("z0ZKvdaILeciqQnTpViuhd6hHf6NOokutiL1DE")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;local fuckSkyBlock_IIIIlllIIlIlllIlllIlI;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("lj")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{302;46;183;225};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{344;528;338;336};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("cdl")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("at")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("pGF")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("aC")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("EZ1")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("hd")]][fuckSkyBlock_llIIIIllIIllIlllII[#("1T8")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NjuV")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qH")]][fuckSkyBlock_llIIIIllIIllIlllII[#("aMR")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{516;663;984;641};"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{902;426;25;599};"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("K0Xg")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("zN")];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("LWp")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1]=fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_lIIllIIlIIllIlIlIl[fuckSkyBlock_llIIIIllIIllIlllII[#("bmCo")]];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sX")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("kIU")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ld")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("j9g")]][fuckSkyBlock_llIIIIllIIllIlllII[#("EAbV")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7t")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("AT8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("MJ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("qpY")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("mW")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("bc")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("m9b")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("EF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("VQh")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("l64j")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("mH")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("1W0")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Rl")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("p1g")]][fuckSkyBlock_llIIIIllIIllIlllII[#("y5jc")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("en")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("fTi")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("n7Q7NnoUW0BJOElCu3Sdphx3x3RYhexpVq5yCgs4ruj")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("mQH1hQq7VBnfKXLTGAMSElXxIYaoKXV48KRQxZQCX")then if fuckSkyBlock_lIIllIIlIIllIlIlIl==#("EucZXPFKy2TCsb2jtsQcy7Pshag4xRUk4fRDtTbv")then local fuckSkyBlock_IIIIlllIIlIlllIlllIlI;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("iX")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("MpB")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("DQ")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("NUV")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HY")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("rk3")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IIIIlllIIlIlllIlllIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("nc")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IIIIlllIIlIlllIlllIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IIIIlllIIlIlllIlllIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("GfC")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("OG")]][fuckSkyBlock_llIIIIllIIllIlllII[#("G2x")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7o2s")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oe")]][fuckSkyBlock_llIIIIllIIllIlllII[#("2j2")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{42;538;329;633};{291;330;74;499};{558;187;521;205};"1 + 1 = 111";}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];do return end;else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("kb")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("2FQ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("85")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("i17")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Sg")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("syI")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("IUn")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("1vKa")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("q3")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{{233;892;366;118};{346;520;300;93};"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0E")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3Q7")]][fuckSkyBlock_llIIIIllIIllIlllII[#("oNlK")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("z5A")]][fuckSkyBlock_llIIIIllIIllIlllII[#("mhJz")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#("xPa")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uHfF")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3q")]][fuckSkyBlock_llIIIIllIIllIlllII[#("yXz")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("OQVF")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("VI")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("dv9")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl==#("aA3lGrPYmGxVVaHPTRXJLmQhJHmuA0KrttyHWhMSBg")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ng1")]];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("j4")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("HFN")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Sj")]][fuckSkyBlock_llIIIIllIIllIlllII[#("PvI")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Wtjm")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("zU")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ElU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HF3A")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("t4")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("IGa")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("y6")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CVA")]][fuckSkyBlock_llIIIIllIIllIlllII[#("0x4Y")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bY")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("yfJ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{710;12;234;591};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("vg7")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("P0")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("9pD")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("5f")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("YYO")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Q6")]][fuckSkyBlock_llIIIIllIIllIlllII[#("rPH")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("UTKk")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("kxzjekXKcoXiXUVN9euyx5fCBN92MfehEdFVjyikMpIdH")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("KXbFMOgTXpr7SCk586jPOUo9DM6kVgyc4pcl1hDBbVpp")then local fuckSkyBlock_IIlIIIllIIIIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("p9")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{161;949;449;221};{666;361;683;603};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{980;988;73;817};"1 + 1 = 111";}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("dmK")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("0PED")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4h")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("uV8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("4O")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("QoV")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ga")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("52A")]][fuckSkyBlock_llIIIIllIIllIlllII[#("y1B3")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3F")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("y83")]][fuckSkyBlock_llIIIIllIIllIlllII[#("lLfJ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("S8x")]][fuckSkyBlock_llIIIIllIIllIlllII[#("4E9p")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("84")]][fuckSkyBlock_llIIIIllIIllIlllII[#("1g5")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Soj4")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("WE")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("nzG")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{179;227;344;107};}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("gxR")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("8Nrg")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{603;68;64;961};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Gzo")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("bd")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("qaf")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qN")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cl8")]][fuckSkyBlock_llIIIIllIIllIlllII[#("5fKf")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("jh")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("p8N")]][fuckSkyBlock_llIIIIllIIllIlllII[#("g0QF")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("SY")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("nUE")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Pd9T")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("ui")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{457;645;872;98};{318;574;62;783};{935;156;97;667};}]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("pqup")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("6b")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Zlo")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("tx")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("TFv")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("lqc")];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Yq")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("TP7")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{694;338;658;159};{194;827;95;45};}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("2XQ")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("5o")]][fuckSkyBlock_llIIIIllIIllIlllII[#("iHH")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qUtZ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oQ")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("Vxd")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("mF")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2Ms")]][fuckSkyBlock_llIIIIllIIllIlllII[#("MGKE")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("PN")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Sbz")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Fj")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{{79;671;891;990};{674;68;915;593};{665;391;420;39};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("dq")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("0zn")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{695;885;496;485};"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("6OA")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("nT")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("WXm")]))end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("mPR9RrL31I0JbbaS67Q1pcDz8d0ETO2E8Gp6okdYWicSmN")then local fuckSkyBlock_IIlIIIllIIIIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("E3")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{108;519;408;376};{325;9;885;906};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Km")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("PaG")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("VKtz")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ZF")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("C8Q")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("ln")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("7xq")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vD")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("q25")]][fuckSkyBlock_llIIIIllIIllIlllII[#("faa8")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Nh")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{574;293;428;168};"1 + 1 = 111";{185;741;393;242};}]][fuckSkyBlock_llIIIIllIIllIlllII[#("eXFu")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3q")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sIr")]][fuckSkyBlock_llIIIIllIIllIlllII[#("OoAK")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("SZ")]][fuckSkyBlock_llIIIIllIIllIlllII[#("7FL")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("RsbO")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("LV")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{208;311;602;634};{199;518;626;699};}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("5fA")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("kWVz")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("rS")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("rFg")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("JU")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("TOb")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("JM")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ySr")]][fuckSkyBlock_llIIIIllIIllIlllII[#("LplV")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("i0")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("1hg")]][fuckSkyBlock_llIIIIllIIllIlllII[#("eUK7")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ns")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{111;745;96;552};}]][fuckSkyBlock_llIIIIllIIllIlllII[#("pqxY")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("TR")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Tzz")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("Dp9j")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7f")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yLk")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Ru")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("0IW")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("DkX")];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("xW")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("b79")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{390;237;208;510};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("HSU")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("X0")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("mRn")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("h4")]][fuckSkyBlock_llIIIIllIIllIlllII[#("jFH")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{743;233;384;457};{710;2;708;731};{330;42;828;638};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vW")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("fsb")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ud")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fjE")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{304;929;235;327};"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("DtT")]][fuckSkyBlock_llIIIIllIIllIlllII[#("soL9")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qE")]][fuckSkyBlock_llIIIIllIIllIlllII[#("5gB")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ZMTj")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("r1")]][fuckSkyBlock_llIIIIllIIllIlllII[#("tP9")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("4PDv")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{753;56;319;65};}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("vtL")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("fCSfYJyojmsaOBhjnPvKFVeDV31fgaUlvmVcbIe4KrgU6jAxP9Yc1cv")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("ypt4SshjChOCQeiPLBanPuGLEEAglStt1BOVojmqj7rZG7RK1jB")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("bhOdUTAn3b7UXuKoAxBCnTdScQfHXZocq2rTWLbFU9yh9Hcky")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("jES9nsd6adN3AeW5E4c1CZv5Rnv6SGO4jvPUtqP9P0L821Ks")then fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{53;272;20;745};}];else local fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_llIIIIllIIllIlllII[#("lL")];local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("x2H")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIIIlll+1]=fuckSkyBlock_IllIlIIlI;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIIIlll]=fuckSkyBlock_IllIlIIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("A5no")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl==#("edhiG9uiWs96hoFzSUezbLmpclMnydZOcKNDHWNvuMI8QdIMgJ")then local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("em")];local fuckSkyBlock_llIIIIIIlll=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bmf")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI+1]=fuckSkyBlock_llIIIIIIlll;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI]=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_llIIIIllIIllIlllII[#("5XLv")]];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("TB")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("i5u")]][fuckSkyBlock_llIIIIllIIllIlllII[#("GqCS")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2v")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("E1m")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Qf")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("84s")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ax")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("qG8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fN")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Ftn")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{707;551;106;28};"1 + 1 = 111";}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("Ran")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bf")]][fuckSkyBlock_llIIIIllIIllIlllII[#("AXV")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Geyv")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("IZ")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("XyX")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("xL")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("aqI")]][fuckSkyBlock_llIIIIllIIllIlllII[#("aPy7")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("E6")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("thU")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("hF4tE01fuygVTDu3ILc16hTeAdoJ9NahY4SjipjMPQr8n0YGvjaad")then if fuckSkyBlock_lIIllIIlIIllIlIlIl==#("maWZ4BMsgRx86YUlUrCAmpZU1JoTnZN9dhRSxsuSaxKKLo4aVjzS")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("ir")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("hyd")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("UM")]][fuckSkyBlock_llIIIIllIIllIlllII[#("0NA")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("1GZJ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("2D")]][fuckSkyBlock_llIIIIllIIllIlllII[#("4c0")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("SMNp")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CL")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("8uD")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("g2")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("RzC")]][fuckSkyBlock_llIIIIllIIllIlllII[#("GuBC")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ig")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("fLA")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("5v")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("gKg")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Xd")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("8Kk")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Qk")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("KSN")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("FF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("7Ef")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("GOpx")]];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("jl")]][fuckSkyBlock_llIIIIllIIllIlllII[#("x5R")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("IjaB")]];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("OF6kb8vm3fqey4ZhcYC6TA0QpjMPo7dB5AANUHuu9FhrtGmtf2Su7V")then local fuckSkyBlock_IIlIIIllIIIIl;local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("fr")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("IfU")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("YAR")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#{{534;657;482;231};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{16;433;125;323};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("Pdz")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("lJ")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("8DN")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4C")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HA2")]][fuckSkyBlock_llIIIIllIIllIlllII[#("UIqP")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Oo")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("1Ci")]][fuckSkyBlock_llIIIIllIIllIlllII[#("z7bo")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("BJ")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Rjk")]][fuckSkyBlock_llIIIIllIIllIlllII[#("3Nlf")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("eu")]][fuckSkyBlock_llIIIIllIIllIlllII[#("tQs")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("lO6Q")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ce")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("3Pb")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("ax")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{25;538;200;717};"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("vAaN")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Or")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("2pT")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("na")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("tgu")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("zW")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0Yp")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{792;746;506;421};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yG")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cx3")]][fuckSkyBlock_llIIIIllIIllIlllII[#("CFnV")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vM")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7E8")]][fuckSkyBlock_llIIIIllIIllIlllII[#("8eVI")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("OV")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("pEM")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("JNaC")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("O0")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("UoN")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("qS")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("CMC")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Kb")]]={};fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("05")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("nuC")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Jz")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("SM7")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("584p")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4H")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("ZQx")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("dQ")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("Avh")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("xp")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("W4e")]][fuckSkyBlock_llIIIIllIIllIlllII[#("mtBa")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Sd")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("CHs")]][fuckSkyBlock_llIIIIllIIllIlllII[#("tHOO")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{260;301;211;32};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NUW")]][fuckSkyBlock_llIIIIllIIllIlllII[#("3JG6")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("VX")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{206;497;561;831};{893;579;329;489};}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yABn")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Tx")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("vjT")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Rx")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4ry")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("h2zz")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("YO")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("HyZ")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("NI")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("ggJ")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("FZ")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ggH")]][fuckSkyBlock_llIIIIllIIllIlllII[#("TzJl")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("YC")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("HhO")]][fuckSkyBlock_llIIIIllIIllIlllII[#{{724;639;163;428};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("bd8")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{823;394;103;440};"1 + 1 = 111";"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("02h")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("BAgx")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("YI")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Oii")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Jz")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("NAM")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("of")]]={};fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7Z")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("GTX")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{917;401;354;854};"1 + 1 = 111";}];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{192;966;745;686};{938;656;936;30};"1 + 1 = 111";}]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("ahe9")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Rp")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("ky8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{325;290;390;548};}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("EFR")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Ln")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("FcQ")]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{197;775;947;509};{313;886;373;311};}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("6x")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("sAF")]][fuckSkyBlock_llIIIIllIIllIlllII[#("t5ck")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("NI")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("pc4")]][fuckSkyBlock_llIIIIllIIllIlllII[#("48CJ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("oB")]][fuckSkyBlock_llIIIIllIIllIlllII[#("8sU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("rA21")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{890;671;166;672};{117;2;655;26};}]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("Eca")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("4o")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("tK8")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("smYQ")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Rz")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("WCX")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("TH")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("3Ut")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("eU")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("B4V")]][fuckSkyBlock_llIIIIllIIllIlllII[#("RWba")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4F")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("TVl")]][fuckSkyBlock_llIIIIllIIllIlllII[#("MuJh")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("b0")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{437;825;566;395};}]][fuckSkyBlock_llIIIIllIIllIlllII[#("l4h3")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("2m")];fuckSkyBlock_IIlIIIllIIIIl=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("0tI")]];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl+1]=fuckSkyBlock_IIlIIIllIIIIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IIlIIIllIIIIl[fuckSkyBlock_llIIIIllIIllIlllII[#("mccm")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("BM")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Or3")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{511;884;584;874};"1 + 1 = 111";}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("F34")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("dze")];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("3T")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("NdV")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("oPq42vR85b0i7FlxFEg7nsIvU7sJvoSDjKl8END8rHlpExoZ3Gn10YL6g5k")then if fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("dhNQsx8xtn32aiPRgs2ySEQZb1Mv8p2ICI4k4F6gy1GPNu0Si4ZYcXmKC")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("PCVNzdvuADnFXLvV907alQa4neAdGPuuSg0EvVDCts5yENhnCrXvMCM8")then local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("7h")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("SVI")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vX")]]=fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{830;197;82;282};}];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#{{439;693;55;435};{258;214;939;936};}]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("14J")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("o1")]][fuckSkyBlock_llIIIIllIIllIlllII[#("VsC")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("C7I4")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("o1")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("35X")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("cT")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("12O")]][fuckSkyBlock_llIIIIllIIllIlllII[#("KonP")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{970;913;508;756};"1 + 1 = 111";}]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("90I")]][fuckSkyBlock_llIIIIllIIllIlllII[#("sTan")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Hd")]][fuckSkyBlock_llIIIIllIIllIlllII[#("QtD")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{436;763;110;17};{527;288;346;381};"1 + 1 = 111";}]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ED")]][fuckSkyBlock_llIIIIllIIllIlllII[#("xs7")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("KAu8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("nP")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#{{852;10;14;985};"1 + 1 = 111";"1 + 1 = 111";}]];else local fuckSkyBlock_lIIllIIlIIllIlIlIl;fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("50")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ujK")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ys8e")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Lh")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("uTj")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("4J")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("7M8")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("to")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("pjO")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("hae")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_lIIllIIlIIllIlIlIl=fuckSkyBlock_llIIIIllIIllIlllII[#("Ol")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_lIIllIIlIIllIlIlIl](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_lIIllIIlIIllIlIlIl+1,fuckSkyBlock_llIIIIllIIllIlllII[#("LMc")]))fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("z9")]][fuckSkyBlock_llIIIIllIIllIlllII[#("ByZ")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("qkMc")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Fa")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("vxR")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("XB")]]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Lsq")]][fuckSkyBlock_llIIIIllIIllIlllII[#("Tng3")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{817;927;882;95};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("sdm")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("0ztNrZVh3WRV1AoxGQ2VNBK6mMn19SqE2cFvjYcEkpK1BDL2J8fVTmZAZx")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("yK")]]=fuckSkyBlock_IIIIlllIIlIlllIlllIlI[fuckSkyBlock_llIIIIllIIllIlllII[#("RYx")]];else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][fuckSkyBlock_llIIIIllIIllIlllII[#{"1 + 1 = 111";{150;494;63;160};{335;361;854;351};}]]=fuckSkyBlock_llIIIIllIIllIlllII[#("xh4y")];end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl<=#("QL3ikFm2Z42nSOzLx0TGTbvraMGUPnfHWxv3qhzvnKW7RUyguMCJg1SPoLiJ9")then if fuckSkyBlock_lIIllIIlIIllIlIlIl>#("nLYuCurGtpBxripyLpnAAcVGB4PROP80xWxkjxscYYrliTJJz0a3uJbkZr3I")then do return end;else fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#{{684;918;897;246};"1 + 1 = 111";}]]=fuckSkyBlock_IIlIllIlllIl[fuckSkyBlock_llIIIIllIIllIlllII[#("Ph7")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("ah")]][fuckSkyBlock_llIIIIllIIllIlllII[#("zN4")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("D330")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("uK")]]=fuckSkyBlock_IIlIllIlllIl[fuckSkyBlock_llIIIIllIIllIlllII[#("hcj")]];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("Fr")]][fuckSkyBlock_llIIIIllIIllIlllII[#("4Ry")]]=fuckSkyBlock_llIIIIllIIllIlllII[#("taSy")];fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;fuckSkyBlock_llIIIIllIIllIlllII=fuckSkyBlock_llIIIIIIlll[fuckSkyBlock_IllIlIIlI];do return end;end;elseif fuckSkyBlock_lIIllIIlIIllIlIlIl>#("K1OqL9GWeon7kLLUJyRufrXPfGXUlu1DUxn6O5IUdWuMW5j8AAp4lmKse9kelW")then fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_llIIIIllIIllIlllII[#("vZ")]]={};else local fuckSkyBlock_IllIlIIlI=fuckSkyBlock_llIIIIllIIllIlllII[#("1Y")]fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI]=fuckSkyBlock_IllIIlllllIllI[fuckSkyBlock_IllIlIIlI](fuckSkyBlock_IIlIllIIIllIlIlIl(fuckSkyBlock_IllIIlllllIllI,fuckSkyBlock_IllIlIIlI+1,fuckSkyBlock_llIIIIllIIllIlllII[#("5Jh")]))end;fuckSkyBlock_IllIlIIlI=fuckSkyBlock_IllIlIIlI+1;end;end);end;return fuckSkyBlock_lIIlIllIIl(true,{},fuckSkyBlock_IIllIIllIIlIlIIlIllIll())();end)(string.byte,table.insert,setmetatable);
%d bloggers like this: