Roblox Prison Break Script Inf Ammo

Roblox Prison Break Script Inf Ammo

Script by Jakekill871

--[[
IronBrew:tm: obfuscation; Version 2.7.2
]]
return(function(byjakekill871pbinfammo_IllIllIlIIlIlIlIIII,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IIIllIlIIlllIlIllIIII)local byjakekill871pbinfammo_IlIIIllIIllIIllIIllI=string.char;local byjakekill871pbinfammo_IIIIlllllI=string.sub;local byjakekill871pbinfammo_lIIllIlllIlIllI=table.concat;local byjakekill871pbinfammo_llIIllIIlIlllllllIIlllI=math.ldexp;local byjakekill871pbinfammo_IlllllIlllIIIIIIlll=getfenv or function()return _ENV end;local byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll=select;local byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII=unpack or table.unpack;local byjakekill871pbinfammo_lllllIIIIlII=tonumber;local function byjakekill871pbinfammo_IIIllllIlll(byjakekill871pbinfammo_IllIllIlIIlIlIlIIII)local byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII="","",{}local byjakekill871pbinfammo_IlIIlIlIlIll=256;local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl={}for byjakekill871pbinfammo_IlIlIlIlIIllllIl=0,byjakekill871pbinfammo_IlIIlIlIlIll-1 do byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_IlIlIlIlIIllllIl]=byjakekill871pbinfammo_IlIIIllIIllIIllIIllI(byjakekill871pbinfammo_IlIlIlIlIIllllIl)end;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=1;local function byjakekill871pbinfammo_llIIIIlIlllll()local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lllllIIIIlII(byjakekill871pbinfammo_IIIIlllllI(byjakekill871pbinfammo_IllIllIlIIlIlIlIIII,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl),36)byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl+1;local byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_lllllIIIIlII(byjakekill871pbinfammo_IIIIlllllI(byjakekill871pbinfammo_IllIllIlIIlIlIlIIII,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl+byjakekill871pbinfammo_lIIllIlllllIlIIIllII-1),36)byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl+byjakekill871pbinfammo_lIIllIlllllIlIIIllII;return byjakekill871pbinfammo_IlIIllIIllIIIIlIll end;byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIIIllIIllIIllIIllI(byjakekill871pbinfammo_llIIIIlIlllll())byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII[1]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII;while byjakekill871pbinfammo_IlIlIlIlIIllllIl<#byjakekill871pbinfammo_IllIllIlIIlIlIlIIII do local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_llIIIIlIlllll()if byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_IlIlIlIlIIllllIl]then byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_IlIlIlIlIIllllIl]else byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_lIIllIlllllIlIIIllII..byjakekill871pbinfammo_IIIIlllllI(byjakekill871pbinfammo_lIIllIlllllIlIIIllII,1,1)end;byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_IlIIlIlIlIll]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII..byjakekill871pbinfammo_IIIIlllllI(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,1,1)byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII[#byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII+1],byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIIlIlIlIll=byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIIlIlIlIll+1 end;return table.concat(byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII)end;local byjakekill871pbinfammo_llIIIIlIlllll=byjakekill871pbinfammo_IIIllllIlll('24Q24S27524U24O27524S25N25P25D25L24U24R27927025C25P25X25L26626724U24N27926825F25R25P25C27I27K27M24U24P27926726425P26325E27727926325P25H26027928E22K24326G27925A25127924T27923W28N28E24U24S28P28E24S24V24S28K24S28N27827524Q25524S28S27528N28Q23K28V27924G29029629F28Z29127929429G29929F24S29B29C24S29E28N28S28N29I24S29224S29L28S29V29O29Q29C29T29M28Y28L29J29329528S28X29N29P29R29S29F2A329X29Z2A129Y29F29A2AI2A72AL2AA2AP2AC29G2812AG2A528V2AT29H2AV2AN2AD2A02AQ2752B128E2B329W2B529K2B727G2B02AS2AK2B429F2B629G24K2B92AH29R2BD2A92BN2BG29G24L2BR2BB29D2BL2BE2BW2AX28S24M2C02BK29U2BM2AB2A02B727Q2BJ2BT2C32BV2CD2AO2A72AR2CI2CB2C42CL2B724H2C92CP2A82AM2BX28S24I2CV29C2782CQ28Y29824S28127525A2762B828V2D529Z28W29O23Q28M28E24J2792C827629Z28A28C28827527B27D24U2DO24S26J25L26027327M26225H25R27E2BZ27526Z25F26625J28325P2E72DT24S26A27C27E29E27527025F25C2E625L26R26J26125E26R24D24U28X27526W25H2642EI26L25D25D25F28027926Y27V26125L29R26T26K2DB2DA28L2D727923T2DK28S24Q2592792AZ2BN2FK2D82FW2792FT2C42DC27523W25828V28X2FK28S2DG28R29G2DK28E23W2D728N2D929C28N2GG28V2742GM28E27G2GP2792BQ24C28E2BZ2C82GB2DI2GE29C2DY2EI2DR2602EI2DV27E2DY2E02E22E42ES24U2E924S2EB2ED2EF2EH29Z2EK2DW2EN24S2EP2ER2E72EU2EW26R24E2F02792F32F529Z2F72F92FB2752FD25C2FF2FH26K2FT2FL2H124S2FP2D72FR2CU2752G628Q29Y2FX2IL2BV2G328T2G628E2G82DC2GZ2DC2972FN28O2GH2FY29R2GL29C2GO29C2GR29C2GU2GW24S2GY2GK2752DJ2J028V2H32DQ28B2H629Z2H82DX2792HB2E32662E52EH2HG2HI2EE2842HL2792HN2EM27H2EQ2ES2HU2EX24F2HY2F22F42F62F82FA2GJ2I72I929C2FI2FX28Z2JI2IG2BL2FS2FU2B924O2FX2FV2KU2G02BM2IR2G52G72D629G2IX29G2IZ29O2J12B92GJ2DE28T2J62LD28V2J928V2JB2792GX2AW28E28Q2JH2L82JJ2792H42JM2H72EL2JQ2752JS2HD2JW2792JY2HK27E2HM2LW2HP2HR2K72EV2EX2482KB24S2I02KE2I42KH2FE2FG2KK2IB28J2FM2LQ2KP2CB24Q2IJ24S2IP2752KX2IK2KZ2GD2IS2L22G92LM28V2A22LN28V2GM29N2LB2N82GS2932LF2GQ2NG2GT24S2GV2LK2JD2N52FN2LP2IM2LR2DP2892LU2JO2LW2HA2E12JT2JV2E82M22EC2JZ2EG2M52K22M72K52HS2ET2MB26R2492ME2MG2I22KF2I524S2KI2ML28V2FI2IC2IQ2MQ2FQ2A02MU2MW2IN2792IP2KN2N12L12IU2L32GA2AI2N72IE2LF2NB2AI2J52GN2NI2752LH28E2LJ2752LL2GZ2LO2P82DN2LS2JL2DS2NW2DW2NY2HC2JU2HE2JX2O42M42EI2K324U2M82K62HT2OD24A2OG2KD2OI2MI2FC2MK2IA2KM2MP2NR2MR29G2KR2752FV2912KV2FZ2752G12OR2IZ2P22792IV2L42P62N12LQ2P929F2NC2DK2NE2B82R62PG2NJ2NL2PJ2NN2PL2JG2PN2752JK2NU2PR2792JP2PU2O02PX2O32HJ2K02O72752Q22Q42OB2K826R24B2Q92I12792I32KG2QD2I82ON28E2KL2MO2IE2QJ2FR2OQ2QN2OX2QM2QQ24S2QS2P02QU2IT2QW2P42NO2LS2R02NR2R22GI2PB2PE2R72J82SY2PI24S2PK2JF24S2NQ2AI2RI2752H52LV2PT2JR2NZ2M02O22EA2PZ2RS2Q12LW2D127526N26625H25D25H25E27V2RY2EZ2F12MF2QA2S32OJ2MJ2S72QF2SB2KO2OT2QL2FY29N2MY2UA2SH2SK2N02SN2N32IW2QZ2L72SU2NA2R32SX2R62J72LG2T12NK2JC2JE2LC2T62RG2NN2NT2TA2NV2RL2NX2TE2PV2O12HF2RQ2O52K12RU2TM2792TP2TR2TT2TV2OD2HX2TY2OH2U12QC2I62QE2MM2OQ2P02QI2U82OV2L82UC2OZ2MP2UH2P32N42L52P72JI2SV2J32JF2UQ2SY2R92752T22T42UX2T729R2T924S2TB2PS2H92V62RO2M12TI2RR2O62TL2DW2TN24S2VG2TS2TU25C2RY2KA2VM2U02752S42OK2OM2U52ID2U72IH2A02SF2KT2QP2QO2KY2G22P12SO2752QX2P529R2W62R12UN2SW2J42SY2UR2NH2R62WF2RD2T52WI2H22PP2RJ2JN2V42TD2LY2TF2PW2WR2HH2TJ2WU2M62WW2VF2TQ2X02VJ2HV2MD2X52S22X72U22S62KJ2OO2MN2XC2OS2XE2MT2OY2VY2IO2UG28O2XN2DH2W42UK2N82GF2J22R42D72WB2R82UT2RB2T32Y22WH2UZ2WK2WM2Y92WO2YB2V72RP2WS2VB2RT2EJ2VE2TO2YL2VI2X22OD2OF2YQ2MH2S52VQ2U42VS2U62YZ2KQ2VX2IM2VZ2Z52G42Z72XP2SR2IY2ZB2L92PA2XW2ZG2T02Y02UU2NM2UW2ZB2Y42NS2962PQ2Y82DU2V52ZS2WQ2TH2YF2WT2VC2ZY2YJ31002VH2X12RY2Q831062QB31082OL2VR2YW2VT2QH28E2SD2OU2Z2310G2Z42XL2W22SP2Z92XR2ST2N92ZD2UP2LE2ZH310U2ZJ2WG310Y2ZN2Y62V22RK31142YA2DZ2YC2V82PY311A2ZX2Q22WX2WZ31022RY2S0311J2VO311L2XA310B2YY2VV2Z0310F279310H311X2Z62UI2QY31212UL31232LA31252PD31272JA310V2RC310X2GE310Z28E2ZO2V3312G2ZR312I2ZT2YE2M32TK2YI27E2WX2M92HT26W25P26727M2EY2S131072X9311N28E23S2YX2OR3130310E311U3133311W2QT31362W32UJ3139310O2G43124310R3126310T313G31292ZL312B2W7279');local byjakekill871pbinfammo_IlIlIlIlIIllllIl=(bit or bit32);local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl and byjakekill871pbinfammo_IlIlIlIlIIllllIl.bxor or function(byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIIllIIllIIIIlIll)local byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl,byjakekill871pbinfammo_IIIIlllllI=1,0,10 while byjakekill871pbinfammo_IlIlIlIlIIllllIl>0 and byjakekill871pbinfammo_IlIIllIIllIIIIlIll>0 do local byjakekill871pbinfammo_IlIIlIlIlIll,byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl%2,byjakekill871pbinfammo_IlIIllIIllIIIIlIll%2 if byjakekill871pbinfammo_IlIIlIlIlIll~=byjakekill871pbinfammo_IIIIlllllI then byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl+byjakekill871pbinfammo_lIIllIlllllIlIIIllII end byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_lIIllIlllllIlIIIllII=(byjakekill871pbinfammo_IlIlIlIlIIllllIl-byjakekill871pbinfammo_IlIIlIlIlIll)/2,(byjakekill871pbinfammo_IlIIllIIllIIIIlIll-byjakekill871pbinfammo_IIIIlllllI)/2,byjakekill871pbinfammo_lIIllIlllllIlIIIllII*2 end if byjakekill871pbinfammo_IlIlIlIlIIllllIl<byjakekill871pbinfammo_IlIIllIIllIIIIlIll then byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIIllIIllIIIIlIll end while byjakekill871pbinfammo_IlIlIlIlIIllllIl>0 do local byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_IlIlIlIlIIllllIl%2 if byjakekill871pbinfammo_IlIIllIIllIIIIlIll>0 then byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl+byjakekill871pbinfammo_lIIllIlllllIlIIIllII end byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_lIIllIlllllIlIIIllII=(byjakekill871pbinfammo_IlIlIlIlIIllllIl-byjakekill871pbinfammo_IlIIllIIllIIIIlIll)/2,byjakekill871pbinfammo_lIIllIlllllIlIIIllII*2 end return byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl end local function byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIIllIIllIIIIlIll)if byjakekill871pbinfammo_IlIIllIIllIIIIlIll then local byjakekill871pbinfammo_IlIlIlIlIIllllIl=(byjakekill871pbinfammo_lIIllIlllllIlIIIllII/2^(byjakekill871pbinfammo_IlIlIlIlIIllllIl-1))%2^((byjakekill871pbinfammo_IlIIllIIllIIIIlIll-1)-(byjakekill871pbinfammo_IlIlIlIlIIllllIl-1)+1);return byjakekill871pbinfammo_IlIlIlIlIIllllIl-byjakekill871pbinfammo_IlIlIlIlIIllllIl%1;else local byjakekill871pbinfammo_IlIlIlIlIIllllIl=2^(byjakekill871pbinfammo_IlIlIlIlIIllllIl-1);return(byjakekill871pbinfammo_lIIllIlllllIlIIIllII%(byjakekill871pbinfammo_IlIlIlIlIIllllIl+byjakekill871pbinfammo_IlIlIlIlIIllllIl)>=byjakekill871pbinfammo_IlIlIlIlIIllllIl)and 1 or 0;end;end;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=1;local function byjakekill871pbinfammo_lIIllIlllllIlIIIllII()local byjakekill871pbinfammo_IIIIlllllI,byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIIlIlIlIll=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII(byjakekill871pbinfammo_llIIIIlIlllll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl+3);byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_IIIIlllllI,172)byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_lIIllIlllllIlIIIllII,172)byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,172)byjakekill871pbinfammo_IlIIlIlIlIll=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_IlIIlIlIlIll,172)byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl+4;return(byjakekill871pbinfammo_IlIIlIlIlIll*16777216)+(byjakekill871pbinfammo_IlIIllIIllIIIIlIll*65536)+(byjakekill871pbinfammo_lIIllIlllllIlIIIllII*256)+byjakekill871pbinfammo_IIIIlllllI;end;local function byjakekill871pbinfammo_lllllIIIIlII()local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_IllIllIlIIlIlIlIIII(byjakekill871pbinfammo_llIIIIlIlllll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl),172);byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl+1;return byjakekill871pbinfammo_lIIllIlllllIlIIIllII;end;local function byjakekill871pbinfammo_IlIIlIlIlIll()local byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII(byjakekill871pbinfammo_llIIIIlIlllll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl+2);byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_lIIllIlllllIlIIIllII,172)byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,172)byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl+2;return(byjakekill871pbinfammo_IlIIllIIllIIIIlIll*256)+byjakekill871pbinfammo_lIIllIlllllIlIIIllII;end;local function byjakekill871pbinfammo_IIIllllIlll()local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_lIIllIlllllIlIIIllII();local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_lIIllIlllllIlIIIllII();local byjakekill871pbinfammo_IIIIlllllI=1;local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=(byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,1,20)*(2^32))+byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl;local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,21,31);local byjakekill871pbinfammo_IlIlIlIlIIllllIl=((-1)^byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,32));if(byjakekill871pbinfammo_lIIllIlllllIlIIIllII==0)then if(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl==0)then return byjakekill871pbinfammo_IlIlIlIlIIllllIl*0;else byjakekill871pbinfammo_lIIllIlllllIlIIIllII=1;byjakekill871pbinfammo_IIIIlllllI=0;end;elseif(byjakekill871pbinfammo_lIIllIlllllIlIIIllII==2047)then return(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl==0)and(byjakekill871pbinfammo_IlIlIlIlIIllllIl*(1/0))or(byjakekill871pbinfammo_IlIlIlIlIIllllIl*(0/0));end;return byjakekill871pbinfammo_llIIllIIlIlllllllIIlllI(byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_lIIllIlllllIlIIIllII-1023)*(byjakekill871pbinfammo_IIIIlllllI+(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl/(2^52)));end;local byjakekill871pbinfammo_lIlIllIIlIIIlIIII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII;local function byjakekill871pbinfammo_llIIllIIlIlllllllIIlllI(byjakekill871pbinfammo_lIIllIlllllIlIIIllII)local byjakekill871pbinfammo_IlIIllIIllIIIIlIll;if(not byjakekill871pbinfammo_lIIllIlllllIlIIIllII)then byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIlIllIIlIIIlIIII();if(byjakekill871pbinfammo_lIIllIlllllIlIIIllII==0)then return'';end;end;byjakekill871pbinfammo_IlIIllIIllIIIIlIll=byjakekill871pbinfammo_IIIIlllllI(byjakekill871pbinfammo_llIIIIlIlllll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl+byjakekill871pbinfammo_lIIllIlllllIlIIIllII-1);byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl+byjakekill871pbinfammo_lIIllIlllllIlIIIllII;local byjakekill871pbinfammo_lIIllIlllllIlIIIllII={}for byjakekill871pbinfammo_IlIlIlIlIIllllIl=1,#byjakekill871pbinfammo_IlIIllIIllIIIIlIll do byjakekill871pbinfammo_lIIllIlllllIlIIIllII[byjakekill871pbinfammo_IlIlIlIlIIllllIl]=byjakekill871pbinfammo_IlIIIllIIllIIllIIllI(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl(byjakekill871pbinfammo_IllIllIlIIlIlIlIIII(byjakekill871pbinfammo_IIIIlllllI(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIlIlIlIIllllIl)),172))end return byjakekill871pbinfammo_lIIllIlllIlIllI(byjakekill871pbinfammo_lIIllIlllllIlIIIllII);end;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_lIIllIlllllIlIIIllII;local function byjakekill871pbinfammo_lIlIllIIlIIIlIIII(...)return{...},byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll('#',...)end local function byjakekill871pbinfammo_IlIIIllIIllIIllIIllI()local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII={};local byjakekill871pbinfammo_llIIIIlIlllll={};local byjakekill871pbinfammo_IlIlIlIlIIllllIl={};local byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll={[#{"1 + 1 = 111";"1 + 1 = 111";}]=byjakekill871pbinfammo_llIIIIlIlllll,[#{{349;65;762;710};{360;297;684;598};"1 + 1 = 111";}]=nil,[#{{381;35;528;835};{574;732;598;552};{600;840;786;712};{350;255;906;380};}]=byjakekill871pbinfammo_IlIlIlIlIIllllIl,[#{"1 + 1 = 111";}]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII,};local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_lIIllIlllllIlIIIllII()local byjakekill871pbinfammo_IIIIlllllI={}for byjakekill871pbinfammo_IlIIllIIllIIIIlIll=1,byjakekill871pbinfammo_IlIlIlIlIIllllIl do local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lllllIIIIlII();local byjakekill871pbinfammo_IlIlIlIlIIllllIl;if(byjakekill871pbinfammo_lIIllIlllllIlIIIllII==1)then byjakekill871pbinfammo_IlIlIlIlIIllllIl=(byjakekill871pbinfammo_lllllIIIIlII()~=0);elseif(byjakekill871pbinfammo_lIIllIlllllIlIIIllII==0)then byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IIIllllIlll();elseif(byjakekill871pbinfammo_lIIllIlllllIlIIIllII==2)then byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_llIIllIIlIlllllllIIlllI();end;byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIIllIIllIIIIlIll]=byjakekill871pbinfammo_IlIlIlIlIIllllIl;end;for byjakekill871pbinfammo_llIIIIlIlllll=1,byjakekill871pbinfammo_lIIllIlllllIlIIIllII()do local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_lllllIIIIlII();if(byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,1,1)==0)then local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,2,3);local byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,4,6);local byjakekill871pbinfammo_IlIlIlIlIIllllIl={byjakekill871pbinfammo_IlIIlIlIlIll(),byjakekill871pbinfammo_IlIIlIlIlIll(),nil,nil};if(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl==0)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("R0V")]=byjakekill871pbinfammo_IlIIlIlIlIll();byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("PW1x")]=byjakekill871pbinfammo_IlIIlIlIlIll();elseif(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl==1)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Oju")]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII();elseif(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl==2)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("XJD")]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII()-(2^16)elseif(byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl==3)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("qnM")]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII()-(2^16)byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("HqPN")]=byjakekill871pbinfammo_IlIIlIlIlIll();end;if(byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII,1,1)==1)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2e")]=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("3j")]]end if(byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII,2,2)==1)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mYz")]=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ETz")]]end if(byjakekill871pbinfammo_IlIIllIIllIIIIlIll(byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII,3,3)==1)then byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("KU9b")]=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("y3sg")]]end byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_llIIIIlIlllll]=byjakekill871pbinfammo_IlIlIlIlIIllllIl;end end;byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll[3]=byjakekill871pbinfammo_lllllIIIIlII();for byjakekill871pbinfammo_IlIlIlIlIIllllIl=1,byjakekill871pbinfammo_lIIllIlllllIlIIIllII()do byjakekill871pbinfammo_llIIIIlIlllll[byjakekill871pbinfammo_IlIlIlIlIIllllIl-1]=byjakekill871pbinfammo_IlIIIllIIllIIllIIllI();end;return byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll;end;local function byjakekill871pbinfammo_llIIIIlIlllll(byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_IlIIlIlIlIll,byjakekill871pbinfammo_IllIllIlIIlIlIlIIII)byjakekill871pbinfammo_IlIlIlIlIIllllIl=(byjakekill871pbinfammo_IlIlIlIlIIllllIl==true and byjakekill871pbinfammo_IlIIIllIIllIIllIIllI())or byjakekill871pbinfammo_IlIlIlIlIIllllIl;return(function(...)local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl[1];local byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[3];local byjakekill871pbinfammo_lIIllIlllIlIllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[2];local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_lIlIllIIlIIIlIIII local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=1;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=-1;local byjakekill871pbinfammo_llIIllIIlIlllllllIIlllI={};local byjakekill871pbinfammo_IIIllllIlll={...};local byjakekill871pbinfammo_IlIIIllIIllIIllIIllI=byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll('#',...)-1;local byjakekill871pbinfammo_lllllIIIIlII={};local byjakekill871pbinfammo_IlIIllIIllIIIIlIll={};for byjakekill871pbinfammo_IlIlIlIlIIllllIl=0,byjakekill871pbinfammo_IlIIIllIIllIIllIIllI do if(byjakekill871pbinfammo_IlIlIlIlIIllllIl>=byjakekill871pbinfammo_IIIIlllllI)then byjakekill871pbinfammo_llIIllIIlIlllllllIIlllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl-byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IIIllllIlll[byjakekill871pbinfammo_IlIlIlIlIIllllIl+1];else byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl]=byjakekill871pbinfammo_IIIllllIlll[byjakekill871pbinfammo_IlIlIlIlIIllllIl+#{"1 + 1 = 111";}];end;end;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIIIllIIllIIllIIllI-byjakekill871pbinfammo_IIIIlllllI+1 local byjakekill871pbinfammo_IlIlIlIlIIllllIl;local byjakekill871pbinfammo_IIIIlllllI;while true do byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{862;941;697;882};}];if byjakekill871pbinfammo_IIIIlllllI<=#("BJXL6abPOoU5mWNsGlcy6y")then if byjakekill871pbinfammo_IIIIlllllI<=#("AbPjCYuiLS")then if byjakekill871pbinfammo_IIIIlllllI<=#("PQYF")then if byjakekill871pbinfammo_IIIIlllllI<=#("L")then if byjakekill871pbinfammo_IIIIlllllI>#("")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xK")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("rTi")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("dQ3K")]];else local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Wo")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("lSZ")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("edWl")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("J6")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kLh")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("E8")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pBK")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZaE")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("W67")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZQrN")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("VJ")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("LSt")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("daMW")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("aB")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("eel")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("U1hK")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("q3")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Bly")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pI1z")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4g")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("aVg")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZNpE")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4r")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{412;71;796;230};{830;343;505;362};"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("82qI")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("f0G")];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("6v")then if not byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("B6")]]then byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;else byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("nXe")];end;elseif byjakekill871pbinfammo_IIIIlllllI==#("DsP")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("yR")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pkX")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("DFDA")];else local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("q9")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1])byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Yl")]]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("VQ8")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Uf")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("y6R")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ko")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1])byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("LbBd5Sd")then if byjakekill871pbinfammo_IIIIlllllI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{104;718;304;278};"1 + 1 = 111";}then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ph")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{770;910;292;994};"1 + 1 = 111";"1 + 1 = 111";}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4Cxz")]];elseif byjakekill871pbinfammo_IIIIlllllI==#("sfinZh")then local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Lx")];local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{771;930;296;237};"1 + 1 = 111";"1 + 1 = 111";}]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1]=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_lIIllIlllllIlIIIllII]=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xrHN")]];else local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("JG")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{651;892;590;537};"1 + 1 = 111";"1 + 1 = 111";}]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mJt0")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("PO")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mIP")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zJ")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9RS")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Qk")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("yck")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4p")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("WNS")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("HmyG")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("JF")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("akp")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mBYu")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ll")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("GCS")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kTeP")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9G")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("naK")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";{827;631;996;307};"1 + 1 = 111";}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pu")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("PSQ")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("XkCc")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sp")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("tnq")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("HgNc")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("qAg")];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("EbUCjFBh")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Z0")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("DdQ")]];elseif byjakekill871pbinfammo_IIIIlllllI==#("IxFlntSHW")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9Z")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{557;677;857;581};}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("8M")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("QSe")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("SA")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("cCo")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("je")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Zgd")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("fP")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("h0M")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ph7c")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ng")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xR9")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("DObV")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9z")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("x1H")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("On1N")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4J")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("dHC")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Z1ia")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("IA")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("WQe")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("vVun")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9f")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ssl")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("gXVp")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("NkA")];else byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9Ga")];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("LKC5kUPKNqtpEHtg")then if byjakekill871pbinfammo_IIIIlllllI<=#{{430;760;2;627};"1 + 1 = 111";{174;98;667;684};"1 + 1 = 111";"1 + 1 = 111";{131;656;517;742};"1 + 1 = 111";{302;765;342;230};{526;148;915;46};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{570;777;833;603};}then if byjakekill871pbinfammo_IIIIlllllI<=#("MBjGxcfJRF4")then local byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("H0")];local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xhK")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl+1]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Mrfe")]];elseif byjakekill871pbinfammo_IIIIlllllI==#("1Os372gtb5bC")then local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("75")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl](byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl+1])else if byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("QL")]]then byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;else byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("B9P")];end;end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("Nc3ryr6O2RZta6")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pD")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("qU4")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("iBP8")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("NZ")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kFB")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2j")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9V8")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("1Q")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bgq")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("GZ")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("OPd")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jiR1")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zf")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("qhI")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("toa2")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mA")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("1xm")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("IBBm")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bT")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7Zb")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("FWTl")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("rM")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("brQ")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{854;890;393;875};{781;899;257;455};{133;328;12;174};"1 + 1 = 111";}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ki")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zxW")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("viX2")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("T43")];elseif byjakekill871pbinfammo_IIIIlllllI>#{{271;379;934;48};"1 + 1 = 111";{428;299;249;590};"1 + 1 = 111";"1 + 1 = 111";{557;292;356;25};{753;812;432;281};{446;127;99;556};{199;434;764;155};{837;219;164;436};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{388;24;274;902};"1 + 1 = 111";}then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("J6")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("H1i")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("VU")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("1V8")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zq")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("6DH")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("IQ")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ld7")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Oh")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sFI")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mdEK")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kb")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Umh")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2X39")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{649;842;217;25};"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ArA")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("k12Z")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kE")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("25C")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xRD2")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Qn")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ntt")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("qxjr")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Cv")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("n6f")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("lBh0")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("1oZ")];else byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mr")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("VHX")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("vrWL")]]];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("ARHT9lrtn7j86EJ65bA")then if byjakekill871pbinfammo_IIIIlllllI<=#("bUilHrkr8Wz8GbzNE")then if not byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{194;439;527;563};"1 + 1 = 111";}]]then byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;else byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("A8Z")];end;elseif byjakekill871pbinfammo_IIIIlllllI==#("eSZKcvOgYpBDKFpCPP")then byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xUE")];else byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("OV")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Uz1")]];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("umRb9uCJlD5e6CS7ReBS")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{677;514;672;236};}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("vR4")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];elseif byjakekill871pbinfammo_IIIIlllllI>#("IAE41Gl3TevUdibxQZoLX")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("FO")]]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{332;634;730;857};"1 + 1 = 111";{607;310;11;654};}]];else local byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll=byjakekill871pbinfammo_lIIllIlllIlIllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("U8K")]];local byjakekill871pbinfammo_IlIIIllIIllIIllIIllI;local byjakekill871pbinfammo_IIIIlllllI={};byjakekill871pbinfammo_IlIIIllIIllIIllIIllI=byjakekill871pbinfammo_IIIllIlIIlllIlIllIIII({},{__index=function(byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIlIlIlIIllllIl)local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl];return byjakekill871pbinfammo_IlIlIlIlIIllllIl[1][byjakekill871pbinfammo_IlIlIlIlIIllllIl[2]];end,__newindex=function(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_lIIllIlllllIlIIIllII)local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl]byjakekill871pbinfammo_IlIlIlIlIIllllIl[1][byjakekill871pbinfammo_IlIlIlIlIIllllIl[2]]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII;end;});for byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII=1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("29W1")]do byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];if byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Z")]==44 then byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII-1]={byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Axr")]};else byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII-1]={byjakekill871pbinfammo_IlIIlIlIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xJ9")]};end;byjakekill871pbinfammo_lllllIIIIlII[#byjakekill871pbinfammo_lllllIIIIlII+1]=byjakekill871pbinfammo_IIIIlllllI;end;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5x")]]=byjakekill871pbinfammo_llIIIIlIlllll(byjakekill871pbinfammo_IIllIlIIlIllIIIIIlIll,byjakekill871pbinfammo_IlIIIllIIllIIllIIllI,byjakekill871pbinfammo_IllIllIlIIlIlIlIIII);end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("O2lEa2IIyo6WXWmgiZpPCyKt2tQKbolh9f")then if byjakekill871pbinfammo_IIIIlllllI<=#("MTyGtukQgXruokJRAvhaps1LQl8H")then if byjakekill871pbinfammo_IIIIlllllI<=#("dZWSaLyVt5trRDGL8CACHVW1e")then if byjakekill871pbinfammo_IIIIlllllI<=#("s2WZixNId8FNoJl6gAYTI0u")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("3g")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Fe1")];elseif byjakekill871pbinfammo_IIIIlllllI==#("SUJfLrd5NFrF8EX7OjzIgvm0")then do return end;else byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("nQ")]]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("fn9")]];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("LPvdv7DHWgzYI6V5K9UqQ7MN1e")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4z")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("09o")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Fp8N")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("te")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("eG0")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("k6")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("uYH")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Hu")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("M5L")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pS")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("yDY")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("RTq7")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("QH")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("C97")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Z3lr")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5y")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("z8e")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("BQdi")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bP")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Z95")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("3erW")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("BV")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kCb")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("dJYP")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jI")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("TVr")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("qKs2")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Hhk")];elseif byjakekill871pbinfammo_IIIIlllllI==#("BX3xHS0aNR1rIZ8myyignNNGvDK")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("M9")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("czq")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5CFk")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Bb")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("EAH")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pu")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("z9b")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Jt")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bdA")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{327;219;825;111};{383;161;638;117};}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("NaZo")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xQ")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2Uz")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Hg0s")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Un")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4ZR")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("l6OI")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("vr")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("l5D")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("A8lZ")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("b2")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Zzi")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("i4Mi")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("O2")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{816;796;137;984};"1 + 1 = 111";{110;806;817;465};}]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Dsy")];else local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Pb")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("BkT")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9l28")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Q5")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ulB")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("WY")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("XZP")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7B")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9gP")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Jv")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("T3B")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2pcK")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("HRb")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("6SG2")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ge")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5Az")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("t6Vx")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("W52")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("6pPJ")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Pq")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xnT")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{71;3;399;108};"1 + 1 = 111";{489;206;562;563};"1 + 1 = 111";}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sA")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("gbs")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("6Xu2")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("OcTlrJbT2U1fS6inSSmCRVooS8kYkya")then if byjakekill871pbinfammo_IIIIlllllI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{776;544;710;431};{842;696;163;948};{474;922;8;751};{910;394;8;164};{189;935;180;469};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{170;313;488;729};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{529;647;743;381};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{204;455;168;279};{54;439;588;722};{472;399;214;270};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jM")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("T0a")];elseif byjakekill871pbinfammo_IIIIlllllI==#("JFUX7BKIpcSnOCBMSPK2sVJvYazDXE")then local byjakekill871pbinfammo_IlIIIllIIllIIllIIllI=byjakekill871pbinfammo_lIIllIlllIlIllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("0iQ")]];local byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI={};byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII=byjakekill871pbinfammo_IIIllIlIIlllIlIllIIII({},{__index=function(byjakekill871pbinfammo_lIIllIlllllIlIIIllII,byjakekill871pbinfammo_IlIlIlIlIIllllIl)local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl];return byjakekill871pbinfammo_IlIlIlIlIIllllIl[1][byjakekill871pbinfammo_IlIlIlIlIIllllIl[2]];end,__newindex=function(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl,byjakekill871pbinfammo_lIIllIlllllIlIIIllII)local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IlIlIlIlIIllllIl]byjakekill871pbinfammo_IlIlIlIlIIllllIl[1][byjakekill871pbinfammo_IlIlIlIlIIllllIl[2]]=byjakekill871pbinfammo_lIIllIlllllIlIIIllII;end;});for byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII=1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("adQ1")]do byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];if byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("h")]==44 then byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII-1]={byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("23O")]};else byjakekill871pbinfammo_IIIIlllllI[byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII-1]={byjakekill871pbinfammo_IlIIlIlIlIll,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("igV")]};end;byjakekill871pbinfammo_lllllIIIIlII[#byjakekill871pbinfammo_lllllIIIIlII+1]=byjakekill871pbinfammo_IIIIlllllI;end;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("y4")]]=byjakekill871pbinfammo_llIIIIlIlllll(byjakekill871pbinfammo_IlIIIllIIllIIllIIllI,byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII,byjakekill871pbinfammo_IllIllIlIIlIlIlIIII);else local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Qm")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_lIIllIlllllIlIIIllII]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_lIIllIlllllIlIIIllII](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("XEl")]))end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("QLJQY2Tf7S7jV6cDzClWYTG5X6y86bgV")then local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{412;942;675;192};"1 + 1 = 111";}]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl](byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl+1])elseif byjakekill871pbinfammo_IIIIlllllI==#("0bNeWNT8JMkvMXzVHabLSy7eO32FUj5Lm")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("8X")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7f5")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("k6MI")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("yX")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("y5H")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("oG")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("LA9")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bh")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{61;510;494;510};{642;84;530;86};}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("nD")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{619;36;757;279};"1 + 1 = 111";}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("BzTF")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("cb")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("psR")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("t06i")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ND")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("K9L")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("TGt6")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("IX")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("EJ3M")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Uk")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{476;823;993;205};{188;485;687;749};}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jxNf")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("VZ")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5om")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pp3U")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("L87")];else local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("OJ")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl]()end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("55AyNYDXohuKli9nzbfjdDeIB3VonAQJin2Evjxn")then if byjakekill871pbinfammo_IIIIlllllI<=#("4iZUeRTFHU3GcuC127UdoJZBWB7pG1pP1biuo")then if byjakekill871pbinfammo_IIIIlllllI<=#("vlbTRQWcg3BMElMj3uty7OTE9PFoOblhMdL")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mn")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("3LK")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9Oh3")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Jr")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("mRG")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("We")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xIM")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zi")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zCl")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Pj")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("tHB")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("tPlx")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("RN")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("m9T")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("g0my")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("yu")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9pi")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{979;387;427;372};{444;875;975;661};{135;916;838;7};}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("EB")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Llc")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Md9n")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{923;148;376;938};"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("uoJ")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("dWO2")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ED")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zEY")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("d6m6")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2oN")];elseif byjakekill871pbinfammo_IIIIlllllI==#("bF2iOTueZ3ydcShXb00SCITbkIzeSt9AKdhz")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Yx")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ezo")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("fzAv")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sb")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("dYL")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("aE")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{224;788;769;832};"1 + 1 = 111";}]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("l0")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2hg")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Dj")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ivy")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("YxG8")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("te")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Gvs")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sjob")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{664;30;499;299};{189;647;23;82};}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2m9")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("GHaK")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Vq")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("T1v")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("6O3z")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("xS")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("x7z")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Iat0")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("MK")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bPg")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jOq3")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("L7S")];else local byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("1s")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl]()end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("kUotPOgrBl64yfWn3gEW17gupxG37E9KTu1gMy")then local byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("nK")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_lIIllIlllllIlIIIllII]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_lIIllIlllllIlIIIllII](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9Pf")]))elseif byjakekill871pbinfammo_IIIIlllllI>#("4NTUvCktnnmR7OMMmN3dshmt6mxkdoPLFsKjhnU")then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5v")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("y1b")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ftyn")]]];else local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("kR")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("0Cp")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("oHba")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Bm")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("feK")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ua")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("YVu")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("vO")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zrH")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("LC")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("TG5")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4HNT")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Fc")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("oLJ")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{762;696;86;125};"1 + 1 = 111";"1 + 1 = 111";}]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("u6")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("NRk")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("CGbY")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Dz")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("gSC")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("XdQz")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("gu")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZZh")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{319;997;370;360};"1 + 1 = 111";{400;425;212;615};}]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Wp")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("SQF")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";{794;286;464;768};"1 + 1 = 111";}];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("fp8")];end;elseif byjakekill871pbinfammo_IIIIlllllI<=#("ecsQVXb5gSODStFWAAYjf9q8ILlOeDF93b9qZHIjkBe")then if byjakekill871pbinfammo_IIIIlllllI<=#("Km3kYXURALXeVthkLy1NnPKRuo721O8O56yvSa0qT")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("3y")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Mam")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("AN3l")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("20")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ikJ")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("cu")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5jr")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{374;802;477;484};"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2Rf")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Gp")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4xU")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ayKZ")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ep")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sD2")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{580;548;306;746};{39;646;94;118};"1 + 1 = 111";}]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("lT")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jMn")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("KrKh")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("PL")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{381;976;674;465};{165;622;213;570};{643;628;755;960};}]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("l1M6")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZR")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("NT6")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("alKQ")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("pt")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("FDe")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("zix9")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("jK6")];elseif byjakekill871pbinfammo_IIIIlllllI>#("Ksn4FFAyIXKBg5NlZKZ10VMijZ5WCKHK4BfqDBTCDE")then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("67")];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("H1b")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZMZl")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("RC")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";"1 + 1 = 111";{453;233;502;449};}];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("0T")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("G1I")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("cC")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("iNI")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("cK")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7G1")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("AE0v")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("L7")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("vsN")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("N89G")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7c")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("VD3")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4JPS")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{966;707;83;112};"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sX7")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Ia6P")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("co")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Hmc")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("YX4a")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("sc")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("LlD")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("fO4m")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7eE")];else do return end;end;elseif byjakekill871pbinfammo_IIIIlllllI<=#{"1 + 1 = 111";{106;585;85;783};"1 + 1 = 111";{20;16;387;525};"1 + 1 = 111";{723;452;758;730};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{669;328;877;960};{340;367;418;38};{373;125;788;772};{966;463;464;161};{636;566;821;330};{266;155;796;129};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{776;877;491;164};{155;102;202;968};"1 + 1 = 111";{200;42;773;763};"1 + 1 = 111";{54;165;30;891};{496;619;338;893};"1 + 1 = 111";{884;53;483;850};"1 + 1 = 111";{745;266;748;47};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{722;521;928;81};"1 + 1 = 111";{610;395;337;480};"1 + 1 = 111";{503;299;49;478};"1 + 1 = 111";{50;947;432;375};{909;589;840;648};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("eW")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("lXD")]];elseif byjakekill871pbinfammo_IIIIlllllI>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{982;525;483;81};{210;742;583;71};{642;684;986;237};{490;808;898;425};"1 + 1 = 111";"1 + 1 = 111";{214;19;326;352};{292;833;592;57};{233;233;506;333};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{186;7;656;711};{799;748;997;660};"1 + 1 = 111";{204;60;836;562};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{33;312;455;616};{113;115;897;32};{744;127;41;897};{620;35;365;30};"1 + 1 = 111";{848;115;93;468};"1 + 1 = 111";{424;605;589;412};{816;366;380;701};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{110;948;691;802};"1 + 1 = 111";{605;223;352;693};{484;565;198;578};"1 + 1 = 111";"1 + 1 = 111";{827;162;53;46};"1 + 1 = 111";"1 + 1 = 111";}then local byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;local byjakekill871pbinfammo_IIIIlllllI;byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{"1 + 1 = 111";{776;456;648;546};}];byjakekill871pbinfammo_IllIllIlIIlIlIlIIII=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5I9")]];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI+1]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII;byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IllIllIlIIlIlIlIIII[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("7Cya")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("6Y")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("S9t")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IIIIlllllI=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Po")]byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IIIIlllllI](byjakekill871pbinfammo_IIIIlIIllIIlIIIIIIlIlIIII(byjakekill871pbinfammo_IlIIllIIllIIIIlIll,byjakekill871pbinfammo_IIIIlllllI+1,byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("o2q")]))byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("oi")]]=byjakekill871pbinfammo_IlIIlIlIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("nLA")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZM")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("4ZM")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Rbqh")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#{{573;991;906;121};"1 + 1 = 111";}]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Lp5")]][byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("bmdl")]]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("js")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("c89")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("ZDPZ")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Xo")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Z18")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("YQkJ")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("nP")]]=byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("abH")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("MJZR")]];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("EH")]][byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("Yta")]]=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("9eWY")];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;byjakekill871pbinfammo_IlIlIlIlIIllllIl=byjakekill871pbinfammo_IllIlIIIIlIlIIIllIIIIIIIl[byjakekill871pbinfammo_lIIllIlllllIlIIIllII];byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("2Yd")];else if byjakekill871pbinfammo_IlIIllIIllIIIIlIll[byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("D8")]]then byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;else byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_IlIlIlIlIIllllIl[#("5xQ")];end;end;byjakekill871pbinfammo_lIIllIlllllIlIIIllII=byjakekill871pbinfammo_lIIllIlllllIlIIIllII+1;end;end);end;return byjakekill871pbinfammo_llIIIIlIlllll(true,{},byjakekill871pbinfammo_IlllllIlllIIIIIIlll())();end)(string.byte,table.insert,setmetatable);
%d bloggers like this: