Roblox FootBall Fusion Script GUI

Roblox FootBall Fusion Script GUI

Script By Spectroxis

IronBrew:tm: obfuscation; Version 2.7.2
return(function(IlIIIlIll,IIIlIIIlllIIlIIlIlII,lIlllIlIIIlIl)local IllIIIlIIlIlIllIlIll=string.char;local IIlIlIlllI=string.sub;local llIlIlIIlIlllIIllIllI=table.concat;local llIllIlIlIlIlIIlIIl=math.ldexp;local lIIlIIIIIIIllI=getfenv or function()return _ENV end;local llllIIIIIlllllIIlIIlIl=select;local llIIllIlI=unpack or table.unpack;local llIllIIIll=tonumber;local function IIIIlllIllll(IIlllIIllllI)local IllllIIllllllII,lIlIllIIlIIIllllIll,lIIlIIIllIlllllIlIlIllllI="","",{}local llIIllIlI=256;local IIlIIIIIIllIlIIIlllll={}for IIIlIIIlllIIlIIlIlII=0,llIIllIlI-1 do IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII]=IllIIIlIIlIlIllIlIll(IIIlIIIlllIIlIIlIlII)end;local IIIlIIIlllIIlIIlIlII=1;local function IlIIIlIll()local IllllIIllllllII=llIllIIIll(IIlIlIlllI(IIlllIIllllI,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII),36)IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+1;local lIlIllIIlIIIllllIll=llIllIIIll(IIlIlIlllI(IIlllIIllllI,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII+IllllIIllllllII-1),36)IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+IllllIIllllllII;return lIlIllIIlIIIllllIll end;IllllIIllllllII=IllIIIlIIlIlIllIlIll(IlIIIlIll())lIIlIIIllIlllllIlIlIllllI[1]=IllllIIllllllII;while IIIlIIIlllIIlIIlIlII<#IIlllIIllllI do local IIIlIIIlllIIlIIlIlII=IlIIIlIll()if IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII]then lIlIllIIlIIIllllIll=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII]else lIlIllIIlIIIllllIll=IllllIIllllllII..IIlIlIlllI(IllllIIllllllII,1,1)end;IIlIIIIIIllIlIIIlllll[llIIllIlI]=IllllIIllllllII..IIlIlIlllI(lIlIllIIlIIIllllIll,1,1)lIIlIIIllIlllllIlIlIllllI[#lIIlIIIllIlllllIlIlIllllI+1],IllllIIllllllII,llIIllIlI=lIlIllIIlIIIllllIll,lIlIllIIlIIIllllIll,llIIllIlI+1 end;return table.concat(lIIlIIIllIlllllIlIlIllllI)end;local IIlllIIllllI=IIIIlllIllll('23S25X27525W25T27525X24Y25025424W25W26727924224W24H23Q24W24N24J25825227E25U27923P25525024S27M24M25W26627924925625225025527U27W27M25W26527H27J24825624G24M27E25H27923K28I24N24C25724L24G27K27M27O27Q25W26427924625925024N25025224H28A28Y27528827X24N24224G25827929G26D24529G27924C24528B29L25724M24H25025728W25Y27925724W24I28X27923Q25224N24W24W25729D25825W26127923R24W28I24H24A25723Q24L25024I25729W27727924B27C27E28C27524H25629R24N25825724Y2AQ27525425024H25925W25V27929325724X25625425X26823V23324C26125Z21126I25X24H26P21U21621625821929N2BB2992922A724H2AB27924125824M24L27V24S24A24N24X27M29K25X1L23X29N2632792B625A24W24725028I24129324Y23K24C27F2CN2502CP23Q2552582CF24N2CZ2B52D12CQ28S2AX2572A12D92CP24925025324W2552DF25X2CO24W24329327D25W25S28L2C725426F25X2272242E22E21S2BQ2CH2791O1P2EA2EA192BQ2E92EB1P21D2BQ26E2EK2EL1626I25W25D2AR2842D424L27124B26G2412562AN27027124826G23K24L2702E72BP25W2602ER2522ET26T2C826T24A2432432D825X2472B025225A2462562552562D72AC2752432FU2AF24H26T24Y2A52A72DU28Z2FS2FU2BA2G72FT24N26E2E02E32E21C2EO25G27928F28H2DB24H2DD26C2462D42FP25W27S27525225625729Y29525X24Z2H42H5132EO25L27923L2DL24W24L2FU24H27123L26G24225628626T26F2F123W2HJ2HL25526T26C27025W25J2HA2HC2HE24N24H2B124Y2FF24M2FH2FJ2GA2752462DR2AT25X23P24925U22D24X22425U29J2CH25D29J21B21K21Q1L23023O24W29J25123O21S1A26A27125Z1L2E724X1L2DN23M2FU25A2C929427E29825X2492B124W2HK28626C2C527523L2BD2JE2A529U24S25X2EF2EB21L2EO2FW2FM2582552552532HL2CE2A92B425X23Q25824V24W2E726K29N28127524425524I27W24M2AI23L25624L25Y25W2DN2HB24T24H2DI2DK2DM2782JQ24W2KZ2IA25X24224A2442492HU2FL2KY24H2FR2GC26E2GV28Z2B025424M2GZ25W25F2HZ2KZ23Q24H24N2562CP2JR29T2JT2A725224S2LF2L627K28525524W24X2LR2792CR2FP2G328G2BE2M029Q2AL2JU2M42DN2JJ29Y2JM25526F2802AD24W28625524S26T25325524G27E2C02L92LB2LD2MU2FB2752402MA2952FO2N12N327E2CM2GX24Z2DS24W2KS23L29224Y27J2HX2792522NM2AT2NP2NR27J23P2922C42K22NQ2FP2MA2HH23P2HJ2HW2622HA29425A2D42B22I62I82FK25I2GL2D526T24425824N26T2462B72522592O926G24D2HW2EQ2752482OO2OQ2OS2OU24H2OW2OJ2FI2432E721H2EO2GW25X2462A524X25824H27Z26U2GL2502CF2N12N023P24G24N2CA24W26T2592562562CF24X2Q024W2FP25626Y2OU27D2LX2DE2NB2BR2OF2MA2OU24N2B028A2AV2QG2CP2CR2K52G627524L2B02572C426W27924023X2IG24A24C23L26T23R23K24B24B24C24B24226S26T2482PR2PZ2532N02CF2PR2OH24W26E26B26826F2QA2AT2QD25W2NK25X2LG24725624T2FY2522GN2MC2P22RY2M72S02S228428H2AE2MA2CS2MB2FL28P28R24H24724W27B2DE27G27523R24G2AJ28U27P27E2QF2AE2BE27M2LV2HD24L2MB25X2GK27526Y27929O27528P29R29T29V29X29Z2QS25X2ID2DT2OD2752S02CE2T12KE24W23P25824T2DL2E72762LS2TO2OF2MH2ST24X2MK2M22JV25X2EL2EM2EO28K2U12MG2LX2U42LI2FU2LK2N62UI2GD2KB2KD2KF2TB2IF2AY2PM2582LQ2SQ2S82KZ2472DC2LQ2L425X2AS2DT25Z27924H2DE2DV27523K2DX2DZ2JY2EA2K02U92UA26E1M2EO2V32LG2M62LU2M92MB2KV2MD2L52LU2LW2LY2NO2JS2MM2M32M52UX2LG2UM2LK2UX2FN27P2FQ2G82FV2792FY2A529R2G22G42VA2GB2G92V32FY2QW2KB24025724G2542LL2FX29T29S24M2M52V72AW24T2GF2GG2302EO25W2792722WW25X23N2C82582N224W29W2F82EJ2VK21Q2VN2GL25624J27R2NV2GZ2H12C42UD25X2GM28I2V02GP2GZ26C2EY2AN2RW2XP2GN2Y12GQ2F525W2T72XY28G2Y02V12572GR2GT25A2KX24I2A62AJ2TS2KW27923X2TJ2A32862KG2E12GG23G2EO2XJ25X24A28S2L82MQ2MX24N2X52E32GI25Y2V32UX2VU2QN23P2UT2I32LQ2VB25X2VD2582DY25W2Z329Y2A02V32UP27E2X92752YU2ZN2YW2MA2TY29J2YZ2E32Z12YS27523W29K25R29G2ZN29G26R23K2792782X92X925T2F7275310L25X310O27925O25X2ZZ2ZN2ZZ25X25J25A310W25X2Z326T27631132V325X2V7310Z3116311A311E2DV311D2V72V72BB311H311E2PH311E2X225X311L2V72QN3114311E275311D29W29W2N6310S3113311W310Q3121311G3124278311K312725X311N2782V3311D312D25X2JH25X2DV311P311D2DV2DV2UX3113312K25X2XX311E2ZZ2V3310Z2TY311U2792T931172792692TY312W312Y2792Z325X31312CH31342E73136275310E2752AP2JH23L2YO2A72ZX2TJ2ZP2ZR2ZT2TI2ZW2YR310Z31012A22VS313731072E231092Z32Z52C42N62Z82922ZB2GH2EE2EG1P2VI2CH2BP314A2242X72XC2XE24M2XG2MA2KB2VP310Z2XB2W52M72W72FL2WA2FP2UM2JP2TK2FZ2WI2G32YP2TJ2UM2VJ2UA2VM2VU310Z23U3151314Y25A26T27X2K52EZ29K24K310F2E7310I310K3113310N310P3121315T2792BQ310X2TA2792HN29K2V72HY311E3115275311I312131383122311Q313I311U3126311U311Z316D316H312B311031242QN31652DV2JH31652BB311T316825X2BB3164316E2UX31652782KK316M312J25X2K22792BB312X29G31792CH312L317D31742V73167311O3121316529W2QF317125X316O2752DV2RX316S317P317F316X317429W317031243173316P31762CH317C2E7318629G317I29G316Y31663161316V2V7278317L25X2TN3174278317Q3175317T275316T317W311E318I318031213182317R318429K31883190316C315R27526D29G28K317A31933137316B319529G2GK3165318927931652X92S7311D310M317K316V25C2CH2X93169319M31132LS312T2OM310N29G24L3122310Y316125B3163318B3175275318U319I318131AB31753177318Q319A317831AH317E31A63165317H318E317J318H316E317N316N31AD2DV25E31AD318R31A6317X31AA31A931AC31B231AE318531AH31AG3199318A279318C31AN312331AP317Y318J31AD318M31AU25X31AW31B431AY31A731B0316Z31BI25X318X31B53192319931B82CH2V3319627928K25P319B31C5312Z25X31C12752GK310V29K2Z3319J25X319L3117319Z31AM25X313H29G319S311E319U2X9319W29G319Y3124313225X23329G29J3139318L316C312F3121318C2DV31D1316W313531D92V731C1312G2DV31DD31D927S31832JH312M3175318C2BB2ZN316527S31DP27528C310G318Y28C2V72UD31BJ2DV31DZ25X2UX31E22812X93183311C318Y312R317U31AF316L3119318Y27S31DC318Y2FB2CM317U318K311D2BB31BQ316L2XX316531DU31AD28Y2YE316527G31DV31D927G31DY318Y27G2BB2UD2DV2HY31EI31752OM2EQ31C12DV319Q31DF318Y31F631742BB31BM316J31EP318T27527S31C43192319T31AG2BB310V31F725X2LS2BB317U25Q31AO31FO310E31EO31D92H931FY310E31G131BY31BE31FO318C27S31ED28C31EF31D931DX31C831AG2FB25K317427S31EN31FQ316L318C28C25N31EV31A8317427G31EX27528131F027S28131F331F1316L31DQ31BH31BE27S31EH317428C31ES27528Y31DS31E331H0316531H52CH31H7311E2UD2BB28127S31C131GC25M31GN31D931FC31I12BB31FG31I431D928K31HC31FM311D31HF31FP317V31FS29G31HG2V731IC316L31FX31AG2LS31DI31GU31G331HE316L31G631GU27S31G92AC2BB310E31DI26N316L31E9316L31HG31ET31C727928Y31GK27S28Y31FA27S27831FH316L311626S31I127S31FJ31J731DK31DT317V318C31HL31AD31EZ31AD31HQ29K28C31H8312S31GU28C28C31J731GT317V31GM316528Y26V31JU31HO31H425X2PP31B42AC31F028C2AC31H927S27G31K431JQ31K631K331IE31JT31B431JV31B428131H3318431KJ318431KM31BT317V279316U31J92TY27G31J427G27G26P316J31LC25X26O316W2H92K22X92XJ23N31L827931LO31CV275256316027925331HN2AC2X926T27231HN2DV26R311Q2BB31LG31LI25V31LK315S312231LR312H29G31LX27G31LZ311Q31M231JV26Q31M631HN27G31M931MB311B31MD31LP27531MH318431M031ML31D927131MO31M831LJ31842AP31D92XD31L629G31ME311931ME310G31ME312031ME311N31ME313928K31MI3113311D27G2782F731652AC31K62AC31KL316J2FB27827G311D2FB2FB27331NY25X2FB31M231652CM31HM2OD26X31AD28K31F02AC28K318C2FB2QY31B42CM26Z31AD2OD313B31C231AH27G319831LF317531NS27531NU31AO31NW31IE2FB31HJ25X31OB31OQ25X31KB31B431OG2CH31OI31P425X31OM317431OO31P931OS27531OW29K31OV31NO27531F525X31OZ318431NV31L231742FB31GY31ON31KD31BH31PB317431PD29K31PF31OK31PH31AD31PK31B431OR2CH31PO29G31PQ312X28C319931HG2E7310Z31CC310W2JH2DP2TL2KG2CH26T29N2V32V527E2UX28G29624N31QU313P2VE2ZS2TH24I2XK31402GG314J2E629K2PF314I2GI2FL2B129Y31R52NN2FL2DP2YA2GZ314I2Z12E72IP2UR2ZJ314N2ZL2DE313W2YV313Z31BZ2J931CN2UL2WD2W82ME2FO2WC2GC31512WG2G02WJ31562ZN31502JH24X2CV31QU313926J319I2CM31N729K31GK318Y3199317X31B431QN319H31HG31C1311Y319O315V2CH31D731AX31H031G731FO31HC2PH31J7318N28Y316R31PS31L5317B31HN31GG31TC31IV31D931TH31GZ318N31LG31KX31TM27931HS31GW31L431SW31JR31I127829W2AC31832QF31AI2V331HC2ZN31IK31JM31HH31P731TU31KC318K31HP31TY31GU31K031J731UE31JQ28C312931MF29W28K311D31TJ2T6316J31UZ2HY31UY31MF28Y31EY31TM31UM2OM31KH31UN317V31NX31K931CG31KC319Q31BE31LG31GC31L4318N2AC318N2FB31L727G2FB318C2812U0316J28128131VL2AC31FM27931K031IJ31KE28131C431NT31VC2DV31NX31FE311U31QQ31DM2TY310Z2YE2UR2TD29S29U27E313S2A0314U2UZ2YI2UO2YR31VW2MF25A2U32MJ2W12C22JV25W318K2TP2D62ZX2TU2TW255312Y314Q2M72VV2UY27K2VY2LZ31X12MN2W42LT2LH31SA31RY2ZK2UV2DE2WO2GZ2C42V32WS2WU2XC2432WY2CS2M52XX31WX31WZ24X314W31WR2M82YX24X2KV311N2S725J24631J331AO31ID31U131D8312I31IH31MF31L3310R2UD31DR31D931C131UG27S31YT317V29W31YW31MF31YY31GU31NQ31K1316L31UP31JQ2QF311D31KS2AC31ZC317V2CM31YZ31VO31Z731GS317531Z228K2YE31GV31WH27931WJ2QN31WL2TF31WO31RA2KX2M72L12DL31WU2UQ31WW2U22UG31X02M12W231X331X52FU31X72TS31X92TX31WH2VO31XE31VW2LG2LV2LX31XJ320931X22MO31YA314W2ZI31XR2V22WF31XV2WR2WT2WV2PH31Y12QW31Y325W31Y532062MI31Y831XP31YA31032VT2XC31VG31A931YI27S31J431YL31UH31YN2TY31JC31HT31GU31YS31GU2DV2BB31Z22BB31Z4316L28C31Z131GU28Y321Z31KN312131YZ31Z9317V31ZB31US318431ZF28C31ZH31GU31ZJ31YZ2OD31JH31Z431ZP31T229K310Z2UX31WK29Q31WM2TG2752ZU2TJ31R6313U2UQ320C2TQ24N31X82TV320H31QO32052UF321A2U6320A2MO320V31S031XS32172ME32192UH31XP31S92LJ3119319G25J315N310R31BE312G31D631J831AG313E31DB31Z7312G2X931DG321V3241316L31UW31AT323W2UX31DL31EB31FV31AD31UG31B431UT31T931U431E231KU3124311P322P3194311U31XD2L72K224B2ES25824L2PB24B2FA2FC2FE2FG2PC29K2RX31H0310H310J3124319N310T325B310S315U28Y2ZZ313B312X313D324J31CW26D26M31BB311U325D31O7312231PM31332TY31A33195325P316V2L4313F316A324R320J2L72YE2HB2MA2I12I32OI32543250319G32692HD2HF2I42PB2FJ29K31UA31F025X26R22E31NA325C315U31QL2T831LV275325L29K325Y31C83260318D325S31MJ313A2TY3270315O325N3274318G31LS310Z2H9316E323I27524D2WU29T2562D523R2Q224H2O22I22L82IC31RP31WP31XQ323G2LQ2N62442B22MA24M31XC2V32B62B825W311P24L29F2E729N2ZN2B729T2MU310Z23Z310A25X23X2E721P22Y2KB27B2DT2UX27I28T27N2SW2FL2SS2SU328Z28W2PH2T224L2T42MC2V323M2502PM2XC29A27Y2MV2752832M9329G2D72JH29029229431R42UR327L2B6257327O2MC3173329P2B224W2LV2B731QV29K26R29N310Z24L2DN2RG24Y2572PM24G2CF2VU29G248315O317A315Q319Z326U315R315W27526G31A231MC311W328P319N31BC31C7311R3264324R31AO31T631W5316K310G3169318C31T631BE31T631VL27831TG31DW31AO312N31MF27932BJ31BE32BJ27G317U2QN31TD31L431IK31P029G326W31BE31KS32B631KS29W322E318Z31TR28C31ZF27531UA325H31AO31UZ32B631UZ32C231HK31MF31UA31KS312I318R324O32BJ31VL321Y2CH316I324O316929W318I317I31T631AQ312132BG317532D02BB3257316E31T0318F311U2UD31LM31IE2X931K6319N31I9316E31ZP311729W32B6319N31V331CI25X31VA311731MT31CF32DD31132EQ31CQ25X319Q32DW2LS32DW31AW32DW31W8316E31WF32DI32AU319N311W2GE32AY316J319N32CF31MC31IU311V31CL31CN311332DK311331G331M5311324F311331NQ315U32ER315Z32AM310J2X932EV25X2H9325S32F0325S31322T9319931343199326331I02762JH2GY2UG326C2N52BC2AF2WU32FI2GX2A532A42AP2XX329U327N327P327R327T314628Z31R6327Y323F2UU3281279328324Y328532872D0328A328C328E2CH328G279328I257328K279328M313W328Q328S2V3328U31R128D328Y28V32GQ2SR2ST27L32942XS275329732992KB329C329E2PH329M27Z3173329K286329M2DN329P2932952QM27932FS329W2D5329I2PI29132A132A3296315P32A827932AA2JH32AC32AE24H32AG2XI2KW310Z311P2KB2KO2PM2E726P2IN31AI31A92QN310Z31CF324O31A731BX31C632EK310B29G328632E9317G31D332D732BA32IQ316K311Z32F231602ZZ31ME312X259325R29G24G32EI315Z32IG326R311E2423118325F27H32AU31MT311W31N2316931F832D532B4311U312C32IT31DE316J312G311T32DJ31IE312831AO312G31V631F431TB317332BS317731FO31GE31D92FB31HC32K131TR2CM32C731D932C3318K31MF31J431UZ316G31UZ31UU31UZ32KF32CJ31V131AI31V428Y312T31LA31AO31LG316G31VK31OX31PQ31L828Y312P321Q324O31FO31IP316L312P3124322O32CX31D22N631D432BF3174312O31TB318V27S32DH32CZ32EI316K2782UD311J311U31CK319G32B12OM317O2S7325Q27832B6316932DY32D731VW317J31E7316V32LV32D732E232D731C432B1310V32B132EH316931G3317O327H31A7323T312R311C31OE32JI316J316931UU316931GQ311X32KQ316E29W31GQ325Q31AN32B131GY32EP2V731LO2X931NZ315U32N9326Q32EY31N9319Z325S32ND31WG310H326S2V732CA31I0325S32CA327832IG25X313432NT32632V32AP32662C42RX2O62OG326K326E31X42OE2O732O52I7325529G3257326P315Q325E32AR31T832NQ325U326Y32NU325X326Y325O325Q29W325S2FB325I327932OO327C32M0327F324Q32NZ31XN25W32DP2P42Q52P62OT2OV259324Z2EP2ON32P72OR32P92P932PB3254326M32OD327B32A6325A31T832OI310R32OK32OV31CW32ON2E7327232OQ316V32OS315U32OU326X2E7327A32BL32OP327D316A32632JH2TJ2AL2OR27Z32GO2AT329F2CB329H3173328X2902K431SO2G5329O29132HF329S2RX2432B124X32QX24N29R32QO2552MC2QN2FY25624H2532MY2NU2NL2NN2NZ24N2NS327S2O3327J25X32HJ329X327Q32R832FW29K31YG23Q32AV32IP31AK32CT32MT311E311931BD32IK32J22792CM31MZ31D932BJ26T32CP31TE31JK322429G23U316L31JD316W2QY27S32S5310K315U32SL2JI32IB316W23M3113321K32RZ315U32SU25J32F032BR31M2311P298310V31CO312V326Y32QC2ZN32QE32R1328T32QI2JH2JB24N2JD2AL28W32QM27J32R332QQ2DE32QW32QY32R032R225932QP2KB2482AF2B92N632TW24M25924C2MC31VW24N25324T2CS2AG2D526N26Y26Y26C26D26C26K26F32UH26F26D32RC25X2NW32RE2562NQ32RG2O12O329K31FM25J32RT32IO31CK32RW318D32B132S0323X316C32OS319E31NO31FO32BJ25J31JK324I27932SF32CL32SI31D92GK310Z325S32VL31MK32S732KD31M232L6326Q326S2BB32VO31GJ315U32VO32SP318Y318Q32SS2X932SU318G32SW311332SY3113312I24932LO27532T4312U32P0319B3139325J29G32Q632WI313732WK32OW323Z31CW2S72XC24E24W24S2FR32AH31142KW31XX3211328N325032FR327M32HK24X32RO32RI327U2UL32FZ31RA32IJ27525D2J9310Z32AK2IO32HT2JQ2Y732RD2NY32UR2O02C4310Z23W328N24232512AW2QH24W2QJ2QL2D7310Z24D2UR29S2QP32RB32H924W24Z31XO2QW2LX2DM29G24X316131M2310Z32J632PO311F32EL32JC31SY32YT32UO32JE316C315Q32NN311332Q131L832OI319631E732ER327E311W32T132WH31M1317J321V31MT2OD31CO325S32ZG32YV31GQ32YP312L250317J312032JT32BC311U31UU31T632L732LG323U312131KP317531TK31HA31T132BK29G32LG324O32LC32LR324732B232Z5311032Z7326432ZC316932S6316931VZ31MT2PP32ZH315U330N32YV330D31WG312L311632MU319H31AK32BD316J32ZV31D22PH32LF317V31DJ31TB2K231HC31YO32LN330832J2330A27S2XJ312R2Z332J82V724032Z132YV331L32Z632RZ32YM32M732VP31692FB25V31MT26K32YS325S331Y32OI32AT331P2V732OE32S332WF331S325S331O330E331Q32Z9331S330H311E2OD25V24U3113332B32W72QZ32W9330F332629W310G310V330I318Y32LS27532YZ25X24C331M325S333132OI23P332P332D331T32ZB32ZA31F3332J31133336330O27T33372V731ZP310C31MT32YP2PH332Z23L3332315U333Q32OI23Y333I330G333B31NO333Y2HY333D2X9333V333G2753344332C2V732DP25X333L31MC32WA32Z8333931MT332G2V72EQ331W311332ZO334525X334N32YV25232OL32JF326Z311E311T32632QF32RK32RM32FU32RP32RJ2QN32832OW2FZ31YD310W2ZN2KS32R125632HD32QT329R32HH327K32X8329X2FL24428S256327Q29S2962VU32QH2DT32H632QK32TB32H928432HB335X32HM32A02NS32HQ32A5310H32IA27531IG25X31A131QW319R31I132Q03137311D3306336G318D324P31BE32PN32XH316J31TN31C93220317F332Y29G31AW2X932VY279336Y332C32CG311W24D31PP336R31W33378318Y336J32MZ31Q832IP31UA32IH32WO1A2ZZ25J24H326Y337C32M9336H2E731FU31U3319U32W232DQ31IE334U32B1318C32JV32VG331Q31IJ24B31C727S31D431JQ32Q732IE31AG331A311N32BW29K31VF32L931HN2E73173337E29K2T9337G25X31GQ32D427932KF31972TY32LM31B42CH334A29G32LZ3174319Q32K932DX339631U82752LS31UA2LS319Q316926D24Z33962CM2OD31652LS31KZ31AW32MA31BL339P32LX336A321H3174310V31VI336X25X32E631FZ325Q2UD319Q28K31CS33962LS27832OQ319Q31AW31C431MA33A0337W31N9275339W33AG316C25J31SS2LS31QQ25Z26833A032IE33AM32EJ316833AQ2LS311P33AL33A031IR311A33AW31C733AZ2LS32MM33AP33A031UC31AW2LS32N2317433AN31AD31AW31Q1316J31AW31AW339825X31C432FC339U336R3165310E31JK31B431G3337O339P31G3318C31C433BI32ZC31C431C431U832JA310V31Q533BS33BR27531G331KG31742H933BX31C42H9318C310V31LE29K33BF318C31AW33B127931C431VW3165310V33C231M2310V310V31U832YL310E31LI33BV33CB32F131LH31AD32MX2CH310V31GQ318C310E33C2313G32EJ33BM33BW31AD33CG33D933BR31JK31GY337C2GK33DF31IE32EO33DL25X31MN31BE2H931MB316531GQ31N229K33CJ31CP27533E031PU317431GQ31O531BE31GQ31GQ33BM33DQ319I31JK31I0336J25J22C316D33BX33DA318C31GY31M232UW25X31GY32B631C431AW31OE311D33C431QB33AD310E2DV31CO33AJ312T31ME31W2331Y31C4310E32M833BN339Y31AD33CW31AO33CZ318433CA33BP316533DK31B42H933BU33EB337A33FI33DD317433DT332E310E310E33C625X31G333C933E833D631GQ31OP31B433EI310D33EW33DU327829K31C433BZ33BQ33CR33DH31IG33FQ33GF332E31G331G333D133D733D433FV33EM27531GY33GW316533EL2CH31G331I0318C2H933DG33D733E127533DA33GC33D633H331A931JK311633DR33D7330V33FV31C9316531GY33DY316J31GY31GY33BM31I033E429G33EX33E733GF31GY31PV31I033ED316J31I031I033BM33HJ33EJ25X33HI319I33EO31KB33BX31I031KB318C311633EU29G32MG33I0310E310V33F133DH310E2QY33AD2H9317C2X231ME31ZP31ME31WF22D32EJ2H933FG310E26C31AO33G233FN33CC25X2DZ33FS2U933DN32Q6310E33FY33GP33J931BE33GS33JC33D733AQ31B431GQ2GE33HE26B33H433GF33H732IT33E926A316J33E926L31I12H9331Y31J2316533J631AO33K233K433D733K633E233DX31AO33EF33JQ31GY33HX27933FY31H92H931MN31GQ33KB31U233KF33HB338Q25X327433HP32IT33HT25X33K3311D33L433K627933H831IE31GQ33H933KL33EH25X32AT31B433HG3174311633LI317433ID29K31GQ31JK33KR25X26H33KZ31C12H931SS2BQ33KI339533LF317431GY336927531I032MM33KP25X33H631I131GQ2442FM33M433KJ31BE33L433HV25X2412CH33HZ32B633L42F72UD31GQ31YI31GY31C131GQ331L311633MX2TK25X2BQ33N132JA31LI33L233H933MK317431I033H1312333GY33IC33D831B433IG33MO31PA321R33KZ33LV31GY33L231J433L433L633GZ33GF337631C131GY33K933MH33NR33GF33NT33I132RL33NB33MI33I633MB33JQ3116333129K33MC31H933HQ33O933L2339533NA33H233L031AD3116311C23O33EP33L5316J33IA337627933EI318C31I033H933I733OA33LH31AD33LP317431KB33LN31652PP33IH31KF31HT2AC31GY33LV31I026D31XB31GY33LZ33O6339533P133I925X33M633NG33BI27931I033LS31I131I033MF32ER3165311633HR311D33IA33BM31JK24E29G32E0317J26T334S33IA33MS33M72PI316D31C131I033MZ33PX33N233N433QG33N633LL33GQ33OT316D33Q633NH33P633D62PP33H131JK31LE337C32SF311631LE31DY2AC31I033LV311633AD311632W627531ME32LZ31NK319I31SS311632WD318Q33DM326W33IZ27933RH319C311032MC32XM33QR31QQ316533DP31AO31JK31JK33BM31KB33FP27533PA31AD31LE33FU316531LI33BX31JK31LI318C31KB33CX33NL31KB33G42PP33G725X33R231AD31LI33IM316531M533BX31KB31M5318C2PP338529K31162PP318C31JK33GM33NL33NF2PP33SJ2PP2PP33GU31LE33ND33D833NF31M533TG31MN33BX2PP31MN318C31LE33H931LE31LE33BM33SD31AD33SV31AD33TL33IB31N233HK31LE32JH317431LI24A33TW33O7311D31M531M533BM31MN33KO336W337S33UB33EA316531MN33I5311D31MN31MN33BM33U133IB2F733EM33EO31O533BX33UL31IE31N233IM27931JK33U4311D31KB31JK33IS33SK33F42H931LE32CA33RQ338Y33AJ33FU25X331Y31KB31LE33FG31KB33RY33S733QS311D33TC33JQ31LE33S633TH33U833SB27533TZ29K33TN31IE33TQ331R33TS33FN33QQ33SO33TX31B431MN33VY25X33UR29K33U331IE31LI333629K31KB33SG31742PP33T731LE33SO31LI33SJ31LI31LI33GU33TJ33TY33D631N233TG33UT2CH31LI2F7318C31M533H933UI33UD33X033D633X333HH25X33UW32V931M531O5318C31MN33OQ31B431N233Q327531N231N233BM2F733UF33WE33QB33XR33XX31PV2F733UM2752F72F733BM33XH33XF31M233UU25X33V829G2F732MR317431O533V133VP33XK316J31LE2PP33V833W633IV2H931M532KU33VE32DO31NB27933CE33VI33SP326Q32W927531LE33VO33D833H933WV33JQ31M533VV33W0317431N233WD33XE29G33X531IE33X8331R33XA311032JA31MN33SO33WF31742F723R31AD33Y8310H33XG31IE31MN32RT33WG33KJ318C31LI33M9336W33CM317431MN33SJ33UO33FN32YL33X131AD33ZH316531O533TG33YA2CH31MN32ZA316531N233H933XS33JQ340I27533ZX3165340M33XF33YD31V031N233YG31652F7333Q31B431O533XQ33ZZ31O533BM31M233XW33YL32B631O531O531PV31M233Y325X31M231M233BM33YD32VD31QB33EM31JK31OP33R3341N25X31OP316433V7341Y338231LI33YG33B831M5318231SS31M532PP342732C425J2ZA31M531ME33SU25X32SS33WB328O2CH33SY31PR33Z22V7310C33UA33Z233YR33XX32Q332IY31TZ31MG33Z231N232S6342P23Z31MO33UI342W31N232SL342Z31GU31LW3432333Z342R25X333V32S933Z231M5343931BH2X929831NI33YX31PN343S31J833J0343U31CM33AJ33CR342I343U334A33RG33HY343F33FG31M531J433UI318C31N223T342O33XX32B633UI274342U343M31N531N231OW31LN33RT33AJ29K31ME312T31LX31M5343332WO');local IIIlIIIlllIIlIIlIlII=(bit or bit32);local lIIlIIIllIlllllIlIlIllllI=IIIlIIIlllIIlIIlIlII and IIIlIIIlllIIlIIlIlII.bxor or function(IIIlIIIlllIIlIIlIlII,IllllIIllllllII)local lIlIllIIlIIIllllIll,lIIlIIIllIlllllIlIlIllllI,IIlIlIlllI=1,0,10 while IIIlIIIlllIIlIIlIlII>0 and IllllIIllllllII>0 do local IIlIIIIIIllIlIIIlllll,IIlIlIlllI=IIIlIIIlllIIlIIlIlII%2,IllllIIllllllII%2 if IIlIIIIIIllIlIIIlllll~=IIlIlIlllI then lIIlIIIllIlllllIlIlIllllI=lIIlIIIllIlllllIlIlIllllI+lIlIllIIlIIIllllIll end IIIlIIIlllIIlIIlIlII,IllllIIllllllII,lIlIllIIlIIIllllIll=(IIIlIIIlllIIlIIlIlII-IIlIIIIIIllIlIIIlllll)/2,(IllllIIllllllII-IIlIlIlllI)/2,lIlIllIIlIIIllllIll*2 end if IIIlIIIlllIIlIIlIlII<IllllIIllllllII then IIIlIIIlllIIlIIlIlII=IllllIIllllllII end while IIIlIIIlllIIlIIlIlII>0 do local IllllIIllllllII=IIIlIIIlllIIlIIlIlII%2 if IllllIIllllllII>0 then lIIlIIIllIlllllIlIlIllllI=lIIlIIIllIlllllIlIlIllllI+lIlIllIIlIIIllllIll end IIIlIIIlllIIlIIlIlII,lIlIllIIlIIIllllIll=(IIIlIIIlllIIlIIlIlII-IllllIIllllllII)/2,lIlIllIIlIIIllllIll*2 end return lIIlIIIllIlllllIlIlIllllI end local function lIlIllIIlIIIllllIll(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII,IllllIIllllllII)if IllllIIllllllII then local IIIlIIIlllIIlIIlIlII=(lIlIllIIlIIIllllIll/2^(IIIlIIIlllIIlIIlIlII-1))%2^((IllllIIllllllII-1)-(IIIlIIIlllIIlIIlIlII-1)+1);return IIIlIIIlllIIlIIlIlII-IIIlIIIlllIIlIIlIlII%1;else local IIIlIIIlllIIlIIlIlII=2^(IIIlIIIlllIIlIIlIlII-1);return(lIlIllIIlIIIllllIll%(IIIlIIIlllIIlIIlIlII+IIIlIIIlllIIlIIlIlII)>=IIIlIIIlllIIlIIlIlII)and 1 or 0;end;end;local IIIlIIIlllIIlIIlIlII=1;local function IllllIIllllllII()local IllllIIllllllII,IIlIlIlllI,IIlIIIIIIllIlIIIlllll,lIlIllIIlIIIllllIll=IlIIIlIll(IIlllIIllllI,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII+3);IllllIIllllllII=lIIlIIIllIlllllIlIlIllllI(IllllIIllllllII,213)IIlIlIlllI=lIIlIIIllIlllllIlIlIllllI(IIlIlIlllI,213)IIlIIIIIIllIlIIIlllll=lIIlIIIllIlllllIlIlIllllI(IIlIIIIIIllIlIIIlllll,213)lIlIllIIlIIIllllIll=lIIlIIIllIlllllIlIlIllllI(lIlIllIIlIIIllllIll,213)IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+4;return(lIlIllIIlIIIllllIll*16777216)+(IIlIIIIIIllIlIIIlllll*65536)+(IIlIlIlllI*256)+IllllIIllllllII;end;local function llIllIIIll()local IllllIIllllllII=lIIlIIIllIlllllIlIlIllllI(IlIIIlIll(IIlllIIllllI,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII),213);IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+1;return IllllIIllllllII;end;local function IIlIIIIIIllIlIIIlllll()local IllllIIllllllII,lIlIllIIlIIIllllIll=IlIIIlIll(IIlllIIllllI,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII+2);IllllIIllllllII=lIIlIIIllIlllllIlIlIllllI(IllllIIllllllII,213)lIlIllIIlIIIllllIll=lIIlIIIllIlllllIlIlIllllI(lIlIllIIlIIIllllIll,213)IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+2;return(lIlIllIIlIIIllllIll*256)+IllllIIllllllII;end;local function IIIIlllIllll()local lIIlIIIllIlllllIlIlIllllI=IllllIIllllllII();local IIIlIIIlllIIlIIlIlII=IllllIIllllllII();local IIlIlIlllI=1;local lIIlIIIllIlllllIlIlIllllI=(lIlIllIIlIIIllllIll(IIIlIIIlllIIlIIlIlII,1,20)*(2^32))+lIIlIIIllIlllllIlIlIllllI;local IllllIIllllllII=lIlIllIIlIIIllllIll(IIIlIIIlllIIlIIlIlII,21,31);local IIIlIIIlllIIlIIlIlII=((-1)^lIlIllIIlIIIllllIll(IIIlIIIlllIIlIIlIlII,32));if(IllllIIllllllII==0)then if(lIIlIIIllIlllllIlIlIllllI==0)then return IIIlIIIlllIIlIIlIlII*0;else IllllIIllllllII=1;IIlIlIlllI=0;end;elseif(IllllIIllllllII==2047)then return(lIIlIIIllIlllllIlIlIllllI==0)and(IIIlIIIlllIIlIIlIlII*(1/0))or(IIIlIIIlllIIlIIlIlII*(0/0));end;return llIllIlIlIlIlIIlIIl(IIIlIIIlllIIlIIlIlII,IllllIIllllllII-1023)*(IIlIlIlllI+(lIIlIIIllIlllllIlIlIllllI/(2^52)));end;local llIlIllIllllIlIIlIllll=IllllIIllllllII;local function llIllIlIlIlIlIIlIIl(IllllIIllllllII)local lIlIllIIlIIIllllIll;if(not IllllIIllllllII)then IllllIIllllllII=llIlIllIllllIlIIlIllll();if(IllllIIllllllII==0)then return'';end;end;lIlIllIIlIIIllllIll=IIlIlIlllI(IIlllIIllllI,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII+IllllIIllllllII-1);IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+IllllIIllllllII;local IllllIIllllllII={}for IIIlIIIlllIIlIIlIlII=1,#lIlIllIIlIIIllllIll do IllllIIllllllII[IIIlIIIlllIIlIIlIlII]=IllIIIlIIlIlIllIlIll(lIIlIIIllIlllllIlIlIllllI(IlIIIlIll(IIlIlIlllI(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII,IIIlIIIlllIIlIIlIlII)),213))end return llIlIlIIlIlllIIllIllI(IllllIIllllllII);end;local IIIlIIIlllIIlIIlIlII=IllllIIllllllII;local function llIlIllIllllIlIIlIllll(...)return{...},llllIIIIIlllllIIlIIlIl('#',...)end local function IlIIIlIll()local IIlllIIllllI={};local IIlIlIlllI={};local IIIlIIIlllIIlIIlIlII={};local IllIIIlIIlIlIllIlIll={[#{"1 + 1 = 111";{487;566;897;647};}]=IIlIlIlllI,[#{"1 + 1 = 111";{78;88;917;15};{131;680;191;360};}]=nil,[#{"1 + 1 = 111";{692;829;715;62};{319;951;549;509};{67;358;485;881};}]=IIIlIIIlllIIlIIlIlII,[#{{65;40;66;869};}]=IIlllIIllllI,};local IIIlIIIlllIIlIIlIlII=IllllIIllllllII()local lIIlIIIllIlllllIlIlIllllI={}for lIlIllIIlIIIllllIll=1,IIIlIIIlllIIlIIlIlII do local IllllIIllllllII=llIllIIIll();local IIIlIIIlllIIlIIlIlII;if(IllllIIllllllII==3)then IIIlIIIlllIIlIIlIlII=(llIllIIIll()~=0);elseif(IllllIIllllllII==0)then IIIlIIIlllIIlIIlIlII=IIIIlllIllll();elseif(IllllIIllllllII==1)then IIIlIIIlllIIlIIlIlII=llIllIlIlIlIlIIlIIl();end;lIIlIIIllIlllllIlIlIllllI[lIlIllIIlIIIllllIll]=IIIlIIIlllIIlIIlIlII;end;IllIIIlIIlIlIllIlIll[3]=llIllIIIll();for IIIlIIIlllIIlIIlIlII=1,IllllIIllllllII()do IIlIlIlllI[IIIlIIIlllIIlIIlIlII-1]=IlIIIlIll();end;for IlIIIlIll=1,IllllIIllllllII()do local IIIlIIIlllIIlIIlIlII=llIllIIIll();if(lIlIllIIlIIIllllIll(IIIlIIIlllIIlIIlIlII,1,1)==0)then local IIlIlIlllI=lIlIllIIlIIIllllIll(IIIlIIIlllIIlIIlIlII,2,3);local llIIllIlI=lIlIllIIlIIIllllIll(IIIlIIIlllIIlIIlIlII,4,6);local IIIlIIIlllIIlIIlIlII={IIlIIIIIIllIlIIIlllll(),IIlIIIIIIllIlIIIlllll(),nil,nil};if(IIlIlIlllI==0)then IIIlIIIlllIIlIIlIlII[#("jp3")]=IIlIIIIIIllIlIIIlllll();IIIlIIIlllIIlIIlIlII[#{{167;176;741;854};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=IIlIIIIIIllIlIIIlllll();elseif(IIlIlIlllI==1)then IIIlIIIlllIIlIIlIlII[#{{592;610;952;743};{681;864;538;339};"1 + 1 = 111";}]=IllllIIllllllII();elseif(IIlIlIlllI==2)then IIIlIIIlllIIlIIlIlII[#("CpT")]=IllllIIllllllII()-(2^16)elseif(IIlIlIlllI==3)then IIIlIIIlllIIlIIlIlII[#("5kO")]=IllllIIllllllII()-(2^16)IIIlIIIlllIIlIIlIlII[#("ZzW8")]=IIlIIIIIIllIlIIIlllll();end;if(lIlIllIIlIIIllllIll(llIIllIlI,1,1)==1)then IIIlIIIlllIIlIIlIlII[#("Ii")]=lIIlIIIllIlllllIlIlIllllI[IIIlIIIlllIIlIIlIlII[#("im")]]end if(lIlIllIIlIIIllllIll(llIIllIlI,2,2)==1)then IIIlIIIlllIIlIIlIlII[#("qkO")]=lIIlIIIllIlllllIlIlIllllI[IIIlIIIlllIIlIIlIlII[#("K9g")]]end if(lIlIllIIlIIIllllIll(llIIllIlI,3,3)==1)then IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=lIIlIIIllIlllllIlIlIllllI[IIIlIIIlllIIlIIlIlII[#("MlP5")]]end IIlllIIllllI[IlIIIlIll]=IIIlIIIlllIIlIIlIlII;end end;return IllIIIlIIlIlIllIlIll;end;local function IllIIIlIIlIlIllIlIll(IIIlIIIlllIIlIIlIlII,IIlllIIllllI,IIlIlIlllI)IIIlIIIlllIIlIIlIlII=(IIIlIIIlllIIlIIlIlII==true and IlIIIlIll())or IIIlIIIlllIIlIIlIlII;return(function(...)local lIIlIIIllIlllllIlIlIllllI=IIIlIIIlllIIlIIlIlII[1];local IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[3];local llIllIlIlIlIlIIlIIl=IIIlIIIlllIIlIIlIlII[2];local llIllIIIll=llIlIllIllllIlIIlIllll local IllllIIllllllII=1;local IlIIIlIll=-1;local llIlIlIIlIlllIIllIllI={};local IIIIlllIllll={...};local llIlIllIllllIlIIlIllll=llllIIIIIlllllIIlIIlIl('#',...)-1;local llllIIIIIlllllIIlIIlIl={};local lIlIllIIlIIIllllIll={};for IIIlIIIlllIIlIIlIlII=0,llIlIllIllllIlIIlIllll do if(IIIlIIIlllIIlIIlIlII>=IIlIIIIIIllIlIIIlllll)then llIlIlIIlIlllIIllIllI[IIIlIIIlllIIlIIlIlII-IIlIIIIIIllIlIIIlllll]=IIIIlllIllll[IIIlIIIlllIIlIIlIlII+1];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IIIIlllIllll[IIIlIIIlllIIlIIlIlII+#{"1 + 1 = 111";}];end;end;local IIIlIIIlllIIlIIlIlII=llIlIllIllllIlIIlIllll-IIlIIIIIIllIlIIIlllll+1 local IIIlIIIlllIIlIIlIlII;local IIlIIIIIIllIlIIIlllll;while true do IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("d")];if IIlIIIIIIllIlIIIlllll<=#{"1 + 1 = 111";{63;222;973;222};"1 + 1 = 111";"1 + 1 = 111";{108;737;112;859};"1 + 1 = 111";{905;983;834;323};"1 + 1 = 111";{222;639;345;580};{646;467;494;277};{765;385;845;529};{703;60;201;548};"1 + 1 = 111";{886;531;194;589};{726;359;964;733};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{69;750;521;624};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{674;840;788;608};"1 + 1 = 111";{583;164;794;985};{957;457;427;813};"1 + 1 = 111";{925;695;525;583};"1 + 1 = 111";{919;704;180;220};"1 + 1 = 111";{342;272;596;123};{911;159;494;404};{540;278;856;399};"1 + 1 = 111";{491;753;886;595};"1 + 1 = 111";{998;970;128;132};{989;204;272;747};"1 + 1 = 111";{917;561;818;276};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{204;760;724;142};"1 + 1 = 111";{305;753;431;54};{840;176;866;847};{874;466;437;600};{613;309;260;3};"1 + 1 = 111";{125;765;974;762};{88;323;284;308};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{497;529;388;142};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{666;22;491;522};{488;914;399;334};}then if IIlIIIIIIllIlIIIlllll<=#("VeXIntnKpv2JXtktiDexpb8GB6YWcE4H")then if IIlIIIIIIllIlIIIlllll<=#("nTWxlQAQ2FyWSDW")then if IIlIIIIIIllIlIIIlllll<=#{{487;517;754;302};"1 + 1 = 111";{681;805;465;706};{646;301;760;499};"1 + 1 = 111";{880;968;240;76};{101;110;772;9};}then if IIlIIIIIIllIlIIIlllll<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if IIlIIIIIIllIlIIIlllll<=#("C")then if IIlIIIIIIllIlIIIlllll==#("")then local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("nL")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("nFs")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6M")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("yoR")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VR")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("6NC")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jf")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1Hx")]][IIIlIIIlllIIlIIlIlII[#("tJfN")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tN")]]=IIIlIIIlllIIlIIlIlII[#("QLp")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("Gz6")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{458;18;978;29};}]]=IIIlIIIlllIIlIIlIlII[#("Uxu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ar")]]=IIIlIIIlllIIlIIlIlII[#("JqU")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("dy")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("iN1")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3m")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("BNK")]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4x")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IDS")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oMzO")]];end;elseif IIlIIIIIIllIlIIIlllll>#("Bv")then local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("Qz")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](llIIllIlI(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII+1,IlIIIlIll))else if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lA")]]~=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7SD5")]])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("TPN")];end;end;elseif IIlIIIIIIllIlIIIlllll<=#("JLz76")then if IIlIIIIIIllIlIIIlllll>#("ORyG")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mo")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("Ye5")]];else do return end;end;elseif IIlIIIIIIllIlIIIlllll==#("TTDbT9")then local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("23")];local lIIlIIIllIlllllIlIlIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("UPV")]];lIlIllIIlIIIllllIll[IllllIIllllllII+1]=lIIlIIIllIlllllIlIlIllllI;lIlIllIIlIIIllllIll[IllllIIllllllII]=lIIlIIIllIlllllIlIlIllllI[IIIlIIIlllIIlIIlIlII[#("bEZU")]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("II")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JJ4")]]*IIIlIIIlllIIlIIlIlII[#("uJTG")];end;elseif IIlIIIIIIllIlIIIlllll<=#{{383;931;555;224};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{705;126;703;729};{942;156;543;173};{288;937;32;46};{537;387;257;16};"1 + 1 = 111";{655;548;491;570};"1 + 1 = 111";}then if IIlIIIIIIllIlIIIlllll<=#("T6B24lOfF")then if IIlIIIIIIllIlIIIlllll==#("nOGnFIyY")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Uk")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{357;336;577;107};"1 + 1 = 111";{707;124;645;164};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QP")]]=IIIlIIIlllIIlIIlIlII[#("3sZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("rn")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("O2")]]=(IIIlIIIlllIIlIIlIlII[#("P2h")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{{450;444;273;323};{527;240;848;953};{203;716;884;81};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("y1")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return end;else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rp")]][IIIlIIIlllIIlIIlIlII[#{{333;279;201;512};"1 + 1 = 111";{19;215;702;925};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tjZG")]];end;elseif IIlIIIIIIllIlIIIlllll==#("SIUCRBpMT2")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{462;127;92;725};"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("H4ap")]];else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rl")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("uVz")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("E1")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1c5")]][IIIlIIIlllIIlIIlIlII[#("iBPJ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9h")]]=IIIlIIIlllIIlIIlIlII[#("SJs")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0F")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{831;184;494;49};{973;758;551;838};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Oj")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Zze")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{278;551;982;873};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("728")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m9iV")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5y")]][IIIlIIIlllIIlIIlIlII[#("VSi")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Zfre")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AH")]][IIIlIIIlllIIlIIlIlII[#("H0q")]]=IIIlIIIlllIIlIIlIlII[#("iv5E")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sn")]][IIIlIIIlllIIlIIlIlII[#("cnu")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("UZJ0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ZK")]][IIIlIIIlllIIlIIlIlII[#("3vx")]]=IIIlIIIlllIIlIIlIlII[#("eX2v")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SE")]][IIIlIIIlllIIlIIlIlII[#("7ou")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("cSml")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7D")]][IIIlIIIlllIIlIIlIlII[#("TYs")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{748;901;609;688};"1 + 1 = 111";{495;556;56;831};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jl")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("pLo")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3s")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HFH")]][IIIlIIIlllIIlIIlIlII[#("uB8x")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{97;618;377;509};{215;422;96;633};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XQS")]][IIIlIIIlllIIlIIlIlII[#("o2VH")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zU")]][IIIlIIIlllIIlIIlIlII[#("4bv")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("k9Hq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Dq")]][IIIlIIIlllIIlIIlIlII[#("r9d")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t1Yn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{462;433;377;812};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("SqH")]]=IIIlIIIlllIIlIIlIlII[#("AgWe")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("c2")]]end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return end;end;elseif IIlIIIIIIllIlIIIlllll<=#("zUDdXOs0JZe3H")then if IIlIIIIIIllIlIIIlllll==#("BTXVlHRLAGW9")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ol")]][IIIlIIIlllIIlIIlIlII[#("bB8")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("h3gb")]];else local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("kj")]local IIlIlIlllI={lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IlIIIlIll))};local lIIlIIIllIlllllIlIlIllllI=0;for IIIlIIIlllIIlIIlIlII=IllllIIllllllII,IIIlIIIlllIIlIIlIlII[#("sg0o")]do lIIlIIIllIlllllIlIlIllllI=lIIlIIIllIlllllIlIlIllllI+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IIlIlIlllI[lIIlIIIllIlllllIlIlIllllI];end end;elseif IIlIIIIIIllIlIIIlllll>#("UCOK5mOUElDB0p")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Uh")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IH9")]]+IIIlIIIlllIIlIIlIlII[#("t1m4")];else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{573;472;380;816};{526;582;113;693};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("AFO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("d2")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("L5W")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{893;443;722;627};{319;403;360;590};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("R2u")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{409;976;418;332};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NmT")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("k3")]]=IIIlIIIlllIIlIIlIlII[#("3Ci")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Ox")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("UV5")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NS")]][IIIlIIIlllIIlIIlIlII[#("dVt")]]=IIIlIIIlllIIlIIlIlII[#("lcvm")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("P4")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{599;758;946;785};{270;802;760;224};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QVU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{118;342;648;996};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("xAr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Jm")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mG0")]][IIIlIIIlllIIlIIlIlII[#("dl6l")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uD")]]=IIIlIIIlllIIlIIlIlII[#("6u1")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{273;960;554;996};"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("ScZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9f")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("j7")]]=IIIlIIIlllIIlIIlIlII[#("KP2")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("7e")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("MRb")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kH")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("7fG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DtJ")]][IIIlIIIlllIIlIIlIlII[#("TacD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rq")]]=IIIlIIIlllIIlIIlIlII[#("kWG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fT")]]=IIIlIIIlllIIlIIlIlII[#("5fc")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bV")]]=IIIlIIIlllIIlIIlIlII[#("4Ey")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5G")]]=IIIlIIIlllIIlIIlIlII[#("8Z0")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("aZ")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("IfZ")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BM")]]=IIIlIIIlllIIlIIlIlII[#("HBU")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("5N")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("E72")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mF")]][IIIlIIIlllIIlIIlIlII[#("Y8x")]]=IIIlIIIlllIIlIIlIlII[#("nP3p")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lv")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Ev4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("S8")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("V8T")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yv")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Ni6")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sH3")]][IIIlIIIlllIIlIIlIlII[#("uVTj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("q6")]]=IIIlIIIlllIIlIIlIlII[#("ogu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("B8")]]=IIIlIIIlllIIlIIlIlII[#("E06")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Yo")]]=IIIlIIIlllIIlIIlIlII[#("c9U")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g6")]]=IIIlIIIlllIIlIIlIlII[#("nl4")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("1U")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("h9a")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Yr")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("4oP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XE")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vue")]][IIIlIIIlllIIlIIlIlII[#("dirM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Z3")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FNm")]][IIIlIIIlllIIlIIlIlII[#("CO4f")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ht")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dTM")]][IIIlIIIlllIIlIIlIlII[#("yVJJ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gI")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("O93")]][IIIlIIIlllIIlIIlIlII[#{{880;841;820;54};{165;121;524;963};{611;950;542;686};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mT")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AlK")]]+IIIlIIIlllIIlIIlIlII[#("seyA")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oj")]]=IIIlIIIlllIIlIIlIlII[#("nWq")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rF")]]=IIIlIIIlllIIlIIlIlII[#("oa9")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rz")]]=IIIlIIIlllIIlIIlIlII[#("Gqo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Fe")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("BVa")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("L0")]]=IIIlIIIlllIIlIIlIlII[#("WIo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rJ")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("XX3")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Jmr")]][IIIlIIIlllIIlIIlIlII[#("P76f")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AC")]]=IIIlIIIlllIIlIIlIlII[#("fym")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("P3v")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HS")]]=IIIlIIIlllIIlIIlIlII[#("dMj")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("r4")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("N3C")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("cM")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("FMq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nH")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8U0")]][IIIlIIIlllIIlIIlIlII[#("Bslx")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ZF")]]=IIIlIIIlllIIlIIlIlII[#("7k8")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8H")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3X3")]][IIIlIIIlllIIlIIlIlII[#("44tG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JY")]]=IIIlIIIlllIIlIIlIlII[#{{538;825;579;158};{856;211;78;639};"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("eL")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("eGt")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("cZ")]][IIIlIIIlllIIlIIlIlII[#("zBf")]]=IIIlIIIlllIIlIIlIlII[#("ef6c")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("O9")]]end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return end;end;elseif IIlIIIIIIllIlIIIlllll<=#("oOOOmMpRC0IvkXt7qYjJy4p")then if IIlIIIIIIllIlIIIlllll<=#("Q3f7IuuuqivW1hW2EVm")then if IIlIIIIIIllIlIIIlllll<=#("y1D6knmNQQkuzF8tG")then if IIlIIIIIIllIlIIIlllll>#("igGmebBHgibreNRG")then local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("aU")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("yUW")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Kn")]]=IIIlIIIlllIIlIIlIlII[#("ug9")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mJ")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("6zk")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Od")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HtV")]][IIIlIIIlllIIlIIlIlII[#("Dfum")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{751;445;141;114};}]]=IIIlIIIlllIIlIIlIlII[#("55R")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("d3")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nt")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TiV")]][IIIlIIIlllIIlIIlIlII[#("y0BE")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("l8")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("PtS")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rm")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sTE")]][IIIlIIIlllIIlIIlIlII[#("9U1l")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("89")]]=IIIlIIIlllIIlIIlIlII[#("PRF")];else local IIlllIIllllI;local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("2K")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("yef")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("KZ")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("X6f")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{85;74;763;928};{140;582;547;422};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("z6")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Q3L")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{197;42;513;820};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("UZM")]][IIIlIIIlllIIlIIlIlII[#("eJmg")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("o4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("UYA")]][IIIlIIIlllIIlIIlIlII[#("bMzb")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8X")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("89o")]][IIIlIIIlllIIlIIlIlII[#("mhv8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("p9")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{892;518;295;500};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("KMUm")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LB")]]=IIIlIIIlllIIlIIlIlII[#("5NQ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AZ")]]=IIIlIIIlllIIlIIlIlII[#("ZIg")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("X2")]]=IIIlIIIlllIIlIIlIlII[#("04E")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{130;605;616;738};"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("dCg")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CW")]]=IIIlIIIlllIIlIIlIlII[#("T7o")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DR")]]=IIIlIIIlllIIlIIlIlII[#("haW")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oP")]]=IIIlIIIlllIIlIIlIlII[#("qpo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bJ")]]=(IIIlIIIlllIIlIIlIlII[#("Zey")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Y6")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("s2z")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{531;356;46;409};}];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{19;709;855;182};{874;949;432;368};}]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("K2SZ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ET")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("SUN")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{920;731;162;986};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uNl")]][IIIlIIIlllIIlIIlIlII[#("jciF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3j")]]=IIIlIIIlllIIlIIlIlII[#("2Er")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{919;783;558;237};"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("Wkf")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{6;688;174;362};{678;981;839;670};}]]=IIIlIIIlllIIlIIlIlII[#("10K")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yX")]]=IIIlIIIlllIIlIIlIlII[#("tRb")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("qF")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("GSE")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{651;60;792;751};{369;144;814;108};}]]=IIIlIIIlllIIlIIlIlII[#("cdJ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7J")]]=IIIlIIIlllIIlIIlIlII[#("bcU")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gM")]]=IIIlIIIlllIIlIIlIlII[#("y6F")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RQ")]]=(IIIlIIIlllIIlIIlIlII[#("eSG")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Lx")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("W79")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("JK")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WFl")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("xrOd")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uK")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("jv2")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6p")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{765;995;364;700};{263;631;85;252};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("32od")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{277;564;683;346};{239;936;840;296};}]]=IIIlIIIlllIIlIIlIlII[#("iaE")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("aA")]]=IIIlIIIlllIIlIIlIlII[#("4sz")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("51")]]=IIIlIIIlllIIlIIlIlII[#("ATG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uK")]]=IIIlIIIlllIIlIIlIlII[#("u7F")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Q3")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("lQ8")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qX")]]=IIIlIIIlllIIlIIlIlII[#("Sxz")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hr")]]=IIIlIIIlllIIlIIlIlII[#("1mZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3F")]]=IIIlIIIlllIIlIIlIlII[#("kUN")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dZ")]]=(IIIlIIIlllIIlIIlIlII[#("M2E")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("O5")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{200;579;992;327};"1 + 1 = 111";}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("I7")]]=(IIIlIIIlllIIlIIlIlII[#("IpR")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pd")]]end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return end;end;elseif IIlIIIIIIllIlIIIlllll==#("ZAjXthSOK8bxvjCvlM")then local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("hg")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](llIIllIlI(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII+1,IlIIIlIll))else local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("SW")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII+1])end;elseif IIlIIIIIIllIlIIIlllll<=#{"1 + 1 = 111";"1 + 1 = 111";{896;325;32;18};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{234;417;445;192};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{803;232;21;682};{514;770;104;91};"1 + 1 = 111";{462;940;310;646};"1 + 1 = 111";"1 + 1 = 111";{127;898;461;448};{248;195;977;663};}then if IIlIIIIIIllIlIIIlllll==#("IEdAkU8J63aMrKd8Ojle")then local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("5p")]lIlIllIIlIIIllllIll[IllllIIllllllII]=lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IIIlIIIlllIIlIIlIlII[#{{654;145;753;203};"1 + 1 = 111";{233;442;199;592};}]))else do return end;end;elseif IIlIIIIIIllIlIIIlllll==#("p8BzEMbI8QXgANryfCyebD")then local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("W2")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII+1])else local IIlIIIIIIllIlIIIlllll;IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("1qZ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("We")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9Y")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{722;693;881;421};{671;886;602;229};{235;883;144;91};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ia")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("L57")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DTJ")]][IIIlIIIlllIIlIIlIlII[#("WCz4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7r")]]=IIIlIIIlllIIlIIlIlII[#("f9s")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tW")]]=IIIlIIIlllIIlIIlIlII[#("DBx")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6A")]]=IIIlIIIlllIIlIIlIlII[#("oEa")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ei")]]=IIIlIIIlllIIlIIlIlII[#("PvK")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("vA")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("lNY")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g8")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("4LO")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("HbLke5TvN4RrFNaRi7b7mnF26WL")then if IIlIIIIIIllIlIIIlllll<=#("RY9fXq3y2B6MpujlTvWUfVpha")then if IIlIIIIIIllIlIIIlllll==#("FsGTosukOZ5LEoTNYRazR2ds")then if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Or")]]==lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1z3n")]])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("7SD")];end;else local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("F1")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII+1])end;elseif IIlIIIIIIllIlIIIlllll==#("L90D6J2frVK1imOreRuqh1HaC6")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gI")]]=IIIlIIIlllIIlIIlIlII[#("UTb")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xh")]]=IIIlIIIlllIIlIIlIlII[#("Qb7")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{312;436;955;703};}]]=IIIlIIIlllIIlIIlIlII[#("8IT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("MV")]]=IIIlIIIlllIIlIIlIlII[#("3vY")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("3L")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("VCg")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jZ")]]=IIIlIIIlllIIlIIlIlII[#("vxG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("0S")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("5QW")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gO")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("vDF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Db")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7eU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{604;74;469;462};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("DlW")]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OC")]]=-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zLM")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("hLYNpnKNsESSqdGmEiWQFvgMlTbbU")then if IIlIIIIIIllIlIIIlllll==#("Za9aVEEhuNIJuXx8enMOd2QqcVEl")then local IlIIIlIll=llIllIlIlIlIlIIlIIl[IIIlIIIlllIIlIIlIlII[#("4y9")]];local llIIllIlI;local IIlIIIIIIllIlIIIlllll={};llIIllIlI=lIlllIlIIIlIl({},{__index=function(IllllIIllllllII,IIIlIIIlllIIlIIlIlII)local IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII];return IIIlIIIlllIIlIIlIlII[1][IIIlIIIlllIIlIIlIlII[2]];end,__newindex=function(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII,IllllIIllllllII)local IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII]IIIlIIIlllIIlIIlIlII[1][IIIlIIIlllIIlIIlIlII[2]]=IllllIIllllllII;end;});for IIlIlIlllI=1,IIIlIIIlllIIlIIlIlII[#("27M4")]do IllllIIllllllII=IllllIIllllllII+1;local IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];if IIIlIIIlllIIlIIlIlII[#("9")]==86 then IIlIIIIIIllIlIIIlllll[IIlIlIlllI-1]={lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII[#("Wpe")]};else IIlIIIIIIllIlIIIlllll[IIlIlIlllI-1]={IIlllIIllllI,IIIlIIIlllIIlIIlIlII[#("Lo6")]};end;llllIIIIIlllllIIlIIlIl[#llllIIIIIlllllIIlIIlIl+1]=IIlIIIIIIllIlIIIlllll;end;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("em")]]=IllIIIlIIlIlIllIlIll(IlIIIlIll,llIIllIlI,IIlIlIlllI);else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ej")]]=(IIIlIIIlllIIlIIlIlII[#("nm3")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Y1")]]=(IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HT")]]=(IIIlIIIlllIIlIIlIlII[#("c8D")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("an")]]=(IIIlIIIlllIIlIIlIlII[#("Ls5")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VE")]]=(IIIlIIIlllIIlIIlIlII[#("PCZ")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EO")]]=(IIIlIIIlllIIlIIlIlII[#("U15")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4a")]]=(IIIlIIIlllIIlIIlIlII[#("QnS")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ut")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("y9j")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{972;796;201;451};{685;801;30;672};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ixq")]][IIIlIIIlllIIlIIlIlII[#("l1yN")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("E7")]]=IIIlIIIlllIIlIIlIlII[#("sWz")];end;elseif IIlIIIIIIllIlIIIlllll<=#("GlI30PRSpsbTvXih6atpmPYAfz7uT8")then local IIlllIIllllI;local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("eY")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("8gM")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oQ")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("4k7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("jc")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tG0")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("8E3p")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LJ")]]=IIIlIIIlllIIlIIlIlII[#("zkM")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("UD")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("ruu")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PB")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{938;219;471;921};"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("5ErM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("nk")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{236;227;501;926};{925;560;53;263};{827;422;41;36};}]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{{735;941;726;709};"1 + 1 = 111";{693;270;924;605};"1 + 1 = 111";}]];elseif IIlIIIIIIllIlIIIlllll>#("arQZC9PFiPqY5L5SeHifUk6o1yiYCRv")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qj")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bPq")]][IIIlIIIlllIIlIIlIlII[#("hEXF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tT")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("d2W")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mY")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("o9O")]][IIIlIIIlllIIlIIlIlII[#("Vj5d")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mc")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("poW")]][IIIlIIIlllIIlIIlIlII[#("zQUO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("v5")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("jat")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9G")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("U48")]][IIIlIIIlllIIlIIlIlII[#("bELe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Wt")]]=IIIlIIIlllIIlIIlIlII[#("Bym")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rt")]]=IIIlIIIlllIIlIIlIlII[#("8Jh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9a")]]=IIIlIIIlllIIlIIlIlII[#("FTB")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("ru")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("o6f")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6q")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("z8h")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rJiQ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FX")]][IIIlIIIlllIIlIIlIlII[#("RZV")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yhqi")]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("l5")]]=-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Up3")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("qsaCP8RirGkK603ZkR3YK3pZuC8d11cCsqHMKEcf0aYnavsaE")then if IIlIIIIIIllIlIIIlllll<=#("NUYIzydlgnaNqBDTqPtqoQPX8KebZ9i8KHnrNV1i")then if IIlIIIIIIllIlIIIlllll<=#("zyYfmTyVqeNRne7fbKZsbvhecdTmkfGYkR0s")then if IIlIIIIIIllIlIIIlllll<=#("RV1RqJ4FqvDqmMkb0HcqTdi9kKkJZHGoOp")then if IIlIIIIIIllIlIIIlllll>#("Y8MVXmJVSq68EuWukXcgON1HQyuQU0oM6")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("07")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BSE")]]+IIIlIIIlllIIlIIlIlII[#("Eqrr")];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9z")]]=IIIlIIIlllIIlIIlIlII[#("QsC")];end;elseif IIlIIIIIIllIlIIIlllll==#("vdnVpdjsBSnLRncmvBLjQlgefz13a1ctcl9")then if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iy")]]~=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Sd3b")]])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("PsP")];end;else local IlIIIlIll=llIllIlIlIlIlIIlIIl[IIIlIIIlllIIlIIlIlII[#("1Fa")]];local llIIllIlI;local IIlIIIIIIllIlIIIlllll={};llIIllIlI=lIlllIlIIIlIl({},{__index=function(IllllIIllllllII,IIIlIIIlllIIlIIlIlII)local IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII];return IIIlIIIlllIIlIIlIlII[1][IIIlIIIlllIIlIIlIlII[2]];end,__newindex=function(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII,IllllIIllllllII)local IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII]IIIlIIIlllIIlIIlIlII[1][IIIlIIIlllIIlIIlIlII[2]]=IllllIIllllllII;end;});for IIlIlIlllI=1,IIIlIIIlllIIlIIlIlII[#("YIZx")]do IllllIIllllllII=IllllIIllllllII+1;local IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];if IIIlIIIlllIIlIIlIlII[#("Z")]==86 then IIlIIIIIIllIlIIIlllll[IIlIlIlllI-1]={lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII[#("XgN")]};else IIlIIIIIIllIlIIIlllll[IIlIlIlllI-1]={IIlllIIllllI,IIIlIIIlllIIlIIlIlII[#("4WI")]};end;llllIIIIIlllllIIlIIlIl[#llllIIIIIlllllIIlIIlIl+1]=IIlIIIIIIllIlIIIlllll;end;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zQ")]]=IllIIIlIIlIlIllIlIll(IlIIIlIll,llIIllIlI,IIlIlIlllI);end;elseif IIlIIIIIIllIlIIIlllll<=#("gzH96uliteRhNIEXbWMk6jQ1lqrJQ3JFotf73L")then if IIlIIIIIIllIlIIIlllll==#("u98VaSUpDyospKZW7SQYPdNDAGl3tCH4AJqk8")then local IIlIIIIIIllIlIIIlllll;IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("WQq")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yC")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("l9")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("MST")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Vt")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("QsS")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("75")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pt8")]][IIIlIIIlllIIlIIlIlII[#("pTNB")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rp")]]=IIIlIIIlllIIlIIlIlII[#("EB1")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("81")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VX")]]=IIIlIIIlllIIlIIlIlII[#("YoR")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("05")]]=IIIlIIIlllIIlIIlIlII[#("MQ4")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("yr")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("jSu")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("41")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{227;26;262;971};{713;407;636;51};{957;504;50;736};}]];else local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("u2")]local lIIlIIIllIlllllIlIlIllllI,IIIlIIIlllIIlIIlIlII=llIllIIIll(lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IIIlIIIlllIIlIIlIlII[#("K59")])))IlIIIlIll=IIIlIIIlllIIlIIlIlII+IllllIIllllllII-1 local IIIlIIIlllIIlIIlIlII=0;for IllllIIllllllII=IllllIIllllllII,IlIIIlIll do IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+1;lIlIllIIlIIIllllIll[IllllIIllllllII]=lIIlIIIllIlllllIlIlIllllI[IIIlIIIlllIIlIIlIlII];end;end;elseif IIlIIIIIIllIlIIIlllll==#("QiCbZlBLs4AIipmXIrxFvFG06a1u3QtOYJcIxOo")then local IIlIIIIIIllIlIIIlllll;local IIlIlIlllI;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PI")]]=IIIlIIIlllIIlIIlIlII[#("Wor")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("6s")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("iSS")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("YA")]]=IIIlIIIlllIIlIIlIlII[#("5DC")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("o2")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("pdX")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{347;875;766;474};{170;761;155;102};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bgh")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{620;802;651;238};"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("Vj")];IIlIIIIIIllIlIIIlllll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zdM")]];lIlIllIIlIIIllllIll[IIlIlIlllI+1]=IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIlIlIlllI]=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII[#("Juhf")]];else local IlIIIlIll;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("882")]][IIIlIIIlllIIlIIlIlII[#("O2Xt")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sI")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("y4G")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EY")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("C1A")]][IIIlIIIlllIIlIIlIlII[#("hyCx")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("41")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("6mE")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7BT")]][IIIlIIIlllIIlIIlIlII[#("8LK0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{760;282;233;228};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("paV")]][IIIlIIIlllIIlIIlIlII[#{{434;16;666;737};{39;353;232;826};{842;763;972;958};{53;680;271;620};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("5b")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t6")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("cP5")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("aL")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Yak")]][IIIlIIIlllIIlIIlIlII[#("OE0f")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("MUF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xi")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Zeg")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{737;732;8;363};{773;995;507;110};{993;198;515;83};}]][IIIlIIIlllIIlIIlIlII[#("SO27")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Wv")]]=-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OmB")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mmb")]]/IIIlIIIlllIIlIIlIlII[#("y6XW")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g3")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("u4r")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hi")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m4L")]][IIIlIIIlllIIlIIlIlII[#("6VG7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("84")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9cJ")]][IIIlIIIlllIIlIIlIlII[#("2qp8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AZ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RR7")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{663;788;147;705};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7e")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("Rte")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Es")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uRV")]][IIIlIIIlllIIlIIlIlII[#("0Ip6")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Di")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ixu")]][IIIlIIIlllIIlIIlIlII[#("jcRY")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hh")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nf1")]][IIIlIIIlllIIlIIlIlII[#("EFFO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("W9")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8my")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{626;577;907;927};{797;293;891;805};{181;655;255;537};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xd")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DH7")]][IIIlIIIlllIIlIIlIlII[#("9mZk")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RM")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Dyc")]][IIIlIIIlllIIlIIlIlII[#("xn1b")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("em")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("FAR")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{961;276;775;960};{835;945;933;665};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ooh")]][IIIlIIIlllIIlIIlIlII[#("G2Iy")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xx")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ihO")]][IIIlIIIlllIIlIIlIlII[#("ZQ1m")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Dx")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jfZ")]][IIIlIIIlllIIlIIlIlII[#("3dSp")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Jj")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JVE")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xWL4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Jr")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("k8E")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{150;142;674;626};{856;972;510;520};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("spT")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{526;738;989;527};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("u9")]]=IIIlIIIlllIIlIIlIlII[#("xjB")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Yv")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("P1R")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Jk")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QyL")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NTfP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0S")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("8JD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("J2")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JVJ")]][IIIlIIIlllIIlIIlIlII[#("5kQ4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NO")]]=IIIlIIIlllIIlIIlIlII[#("Shv")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EP")]]=IIIlIIIlllIIlIIlIlII[#("3jT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AO")]]=IIIlIIIlllIIlIIlIlII[#("6mO")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Bm")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("G75")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xo")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RR8")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("L7hW")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mO")]][IIIlIIIlllIIlIIlIlII[#("zgj")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("u6L0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pU")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("kF4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("rb")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FN5")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("5FJ7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("to")]]=IIIlIIIlllIIlIIlIlII[#("RxC")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("2M")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("YTc")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("f9")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ikW")]][IIIlIIIlllIIlIIlIlII[#("LN78")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("b5")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("UMD")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{646;812;642;384};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("OK")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("I5")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("by")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Wq8")]][IIIlIIIlllIIlIIlIlII[#("fLm8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sV")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8kH")]][IIIlIIIlllIIlIIlIlII[#("SyXe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gO")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ohb")]][IIIlIIIlllIIlIIlIlII[#("APZO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qfr")]][IIIlIIIlllIIlIIlIlII[#("3XQ5")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Nv")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("GQk")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("hjhU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2k")]]=IIIlIIIlllIIlIIlIlII[#("OEj")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("IH")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("uPB")]))end;elseif IIlIIIIIIllIlIIIlllll<=#("bZmqEVsrSMb9XDclMLfYtgSNLVUKmOB3d5EHroxkSKMq")then if IIlIIIIIIllIlIIIlllll<=#("u1uH15WJAh4gKQTbTedlh518G3xn4gUEB8q4zdvTPu")then if IIlIIIIIIllIlIIIlllll==#("YJARJOi8FJfHz9va7JIOsxAQMzYNPSuGXsdAgmXKW")then IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("c37")];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{928;360;716;315};"1 + 1 = 111";}]]=(IIIlIIIlllIIlIIlIlII[#("EdW")]~=0);end;elseif IIlIIIIIIllIlIIIlllll>#("p5vB24cczjgRuCjTfkZFsWoJTg564UV81khFtkH3LNt")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JW")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("y1q")]][IIIlIIIlllIIlIIlIlII[#("snS1")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gI")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lOp")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{887;375;130;291};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("UTMv")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2q")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tuF")]][IIIlIIIlllIIlIIlIlII[#("HSFv")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zb")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ukm")]][IIIlIIIlllIIlIIlIlII[#("6Xsp")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rW")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gUp")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uQCh")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("U8v")]][IIIlIIIlllIIlIIlIlII[#("6ECv")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iy")]]<IIIlIIIlllIIlIIlIlII[#("FQ5a")])then IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("jbZ")];else IllllIIllllllII=IllllIIllllllII+1;end;else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("aV")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t1U")]][IIIlIIIlllIIlIIlIlII[#("0trF")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("zg8MqxhNUqYDQXRW9fhOziZjuOA4O54QDejNitQINhoKxO")then if IIlIIIIIIllIlIIIlllll==#("HDU4FFQVqqYrM6m9YxiaMNdOPzKaq4oXQZ2B3azkXs3xt")then if lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("V9")]]then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("zHW")];end;else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("s4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nie")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jkuy")]];end;elseif IIlIIIIIIllIlIIIlllll<=#{{783;344;201;873};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{789;881;23;496};"1 + 1 = 111";{984;63;628;749};"1 + 1 = 111";{1;794;352;454};{709;348;866;734};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{699;397;6;749};{887;437;860;185};"1 + 1 = 111";{321;151;875;256};{939;212;591;922};{698;742;48;780};{328;590;179;294};{888;536;988;165};{155;291;111;905};{832;454;196;714};"1 + 1 = 111";"1 + 1 = 111";{560;823;965;232};{474;495;276;144};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{290;144;472;281};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{738;446;352;633};"1 + 1 = 111";{843;979;300;451};"1 + 1 = 111";{552;260;543;483};{607;5;360;259};{547;129;68;143};{308;361;166;310};}then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{296;183;222;281};{288;136;790;499};}]]=(IIIlIIIlllIIlIIlIlII[#("CWo")]~=0);elseif IIlIIIIIIllIlIIIlllll==#("phZHurBrHOcMpqB3kSWNV6ev2aDKifUtcPRfEmxclcC6f1Wr")then local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("M9")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("z9P")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{930;920;183;707};{244;387;876;165};}]]=IIIlIIIlllIIlIIlIlII[#("0Et")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tV")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("L72")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{121;842;372;101};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("s41")]][IIIlIIIlllIIlIIlIlII[#("zOWp")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8q")]]=IIIlIIIlllIIlIIlIlII[#("O9t")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("dH")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HA")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("K0J")]][IIIlIIIlllIIlIIlIlII[#("F4CS")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ug")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("zme")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PZ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Pz1")]][IIIlIIIlllIIlIIlIlII[#("Jhmz")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BJ")]]=IIIlIIIlllIIlIIlIlII[#("UO7")];else IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("vGx")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KD")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("UYt9iIscDOtY0jC3TKLJvz7uUBSFipaok9yqAt4hycbIcnu39cxrkSov0")then if IIlIIIIIIllIlIIIlllll<=#("pRZY4nOfN0VkEzQElsyAsGfZFg3TdDVcBBemrKiY47LEiZJ7LRH58")then if IIlIIIIIIllIlIIIlllll<=#("QUL9sYt5bkfSUcuDlLkKGu5LRQH5hx5Ze9VuMrqtE85AzAfHNhG")then if IIlIIIIIIllIlIIIlllll==#("Vz5uY9sNqzXPpqOVqa13u0fHAFmqKas919ePdAGM9NdelqkiVu")then local IlIIIlIll;local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("DQ")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hge")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("prqj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2J")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("OIR")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eZ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("r7n")]][IIIlIIIlllIIlIIlIlII[#{{380;871;399;724};{487;577;445;293};"1 + 1 = 111";{583;678;974;651};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("E9")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("DVh")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qW")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("A24")]][IIIlIIIlllIIlIIlIlII[#("MFYr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Op")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Av8")]][IIIlIIIlllIIlIIlIlII[#("jvea")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uz")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g5E")]][IIIlIIIlllIIlIIlIlII[#("rSlP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("L1")]]=IIIlIIIlllIIlIIlIlII[#("7QV")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sv")]]=IIIlIIIlllIIlIIlIlII[#("NE6")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{120;770;146;400};{89;830;218;363};}]]=IIIlIIIlllIIlIIlIlII[#("Wii")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("TA")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("GUQ")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{472;273;307;418};"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("kyF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6k")]]=IIIlIIIlllIIlIIlIlII[#("GzV")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7D")]]=IIIlIIIlllIIlIIlIlII[#("MTB")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Vq")]]=(IIIlIIIlllIIlIIlIlII[#("h2t")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Fy")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("edx")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{149;828;752;390};{248;552;185;625};}]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("lfZ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("8p")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ZPW")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("Komq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{478;498;522;333};{886;467;750;899};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Tdh")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4K")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ppb")]][IIIlIIIlllIIlIIlIlII[#("Sh3q")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rj")]]=IIIlIIIlllIIlIIlIlII[#("BFh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BU")]]=IIIlIIIlllIIlIIlIlII[#("5rG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rz")]]=IIIlIIIlllIIlIIlIlII[#("dVu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hR")]]=IIIlIIIlllIIlIIlIlII[#("YAV")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("yfH")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("S0")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WY")]]=IIIlIIIlllIIlIIlIlII[#("NDU")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("a6")]]=IIIlIIIlllIIlIIlIlII[#("LVF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{276;213;386;157};{675;381;864;156};}]]=(IIIlIIIlllIIlIIlIlII[#("1Lr")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("52")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("5ZQ")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xb")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("J44")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Up")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{512;639;649;221};"1 + 1 = 111";}]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("23ku")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ou")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("rPr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hm")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("T5j")]][IIIlIIIlllIIlIIlIlII[#("LjWM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("V1")]]=IIIlIIIlllIIlIIlIlII[#("vp4")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("H8s")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iq")]]=IIIlIIIlllIIlIIlIlII[#("pDd")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("hlH")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("qR")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("zNH")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1I")]]=IIIlIIIlllIIlIIlIlII[#("MfI")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zv")]]=IIIlIIIlllIIlIIlIlII[#("9Bq")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Nu")]]=IIIlIIIlllIIlIIlIlII[#("E5i")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DQ")]]=(IIIlIIIlllIIlIIlIlII[#("Cyn")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Me")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("4ox")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eo")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("MMY")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8p")]][IIIlIIIlllIIlIIlIlII[#("Zqm")]]=IIIlIIIlllIIlIIlIlII[#{{660;52;821;172};{436;635;431;866};"1 + 1 = 111";{973;834;93;59};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{566;293;642;381};"1 + 1 = 111";}]]=(IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{33;676;607;390};"1 + 1 = 111";}]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("zFs")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NJ")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("SjC")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0E")]][IIIlIIIlllIIlIIlIlII[#("SxY")]]=IIIlIIIlllIIlIIlIlII[#("ndmQ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gW")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("uhU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hh")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("81O")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ci")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("p5c")]][IIIlIIIlllIIlIIlIlII[#("IgME")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BX")]]=IIIlIIIlllIIlIIlIlII[#("qR6")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("TG")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Gi")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nkX")]][IIIlIIIlllIIlIIlIlII[#("MKom")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jr")]][IIIlIIIlllIIlIIlIlII[#("UbG")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EMIK")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("f67")];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("i2")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Wp2")]][IIIlIIIlllIIlIIlIlII[#("pkTT")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Vg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("YEG")]][IIIlIIIlllIIlIIlIlII[#("i5KK")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("59")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HDh")]][IIIlIIIlllIIlIIlIlII[#("FfFR")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fa0")]][IIIlIIIlllIIlIIlIlII[#("O5mu")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KG")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Dta")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WrQ3")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TH")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{95;805;276;705};{521;229;265;883};}]][IIIlIIIlllIIlIIlIlII[#("b4JQ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VG")]]<IIIlIIIlllIIlIIlIlII[#("yIJL")])then IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("KdK")];else IllllIIllllllII=IllllIIllllllII+1;end;end;elseif IIlIIIIIIllIlIIIlllll>#("MqML4sz5tWbcpfXYpl9R1Fo4SXauiueGpVRTozjxPEmZ7KX9yD46")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("II")]]=IllIIIlIIlIlIllIlIll(llIllIlIlIlIlIIlIIl[IIIlIIIlllIIlIIlIlII[#("MXO")]],nil,IIlIlIlllI);else IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{{344;438;308;35};{267;118;860;455};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uJ")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("NyhbR3hrdW8SGXFzeJ1cMcxsz7h9b7QAhUNyKRIGbeLSnhCXsKs4d3j")then if IIlIIIIIIllIlIIIlllll>#("aZMUVipfgJKVjgZybvbHBPerFuQCPWxoKcxVeXU2ZFLPHQNlU53R2M")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ag")]]=IllIIIlIIlIlIllIlIll(llIllIlIlIlIlIIlIIl[IIIlIIIlllIIlIIlIlII[#{{647;955;218;297};{600;44;686;432};"1 + 1 = 111";}]],nil,IIlIlIlllI);else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8Q")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lpl")]]*IIIlIIIlllIIlIIlIlII[#("duDJ")];end;elseif IIlIIIIIIllIlIIIlllll==#("uUuoBCYBtlvkhUesnMiS6dAVZRERT3Px72baUIsBadrDkGGCQNPfT4mr")then if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("h8")]]<IIIlIIIlllIIlIIlIlII[#("NGbY")])then IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("cGP")];else IllllIIllllllII=IllllIIllllllII+1;end;else local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("0W")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("lcE")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("65H")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VP")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Pj")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3me")]][IIIlIIIlllIIlIIlIlII[#("HfIO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3X")]]=IIIlIIIlllIIlIIlIlII[#("Ygx")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xz")]]=IIIlIIIlllIIlIIlIlII[#("M0A")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tK")]]=IIIlIIIlllIIlIIlIlII[#("inZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gA")]]=IIIlIIIlllIIlIIlIlII[#("HhF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("sG")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{67;293;718;446};"1 + 1 = 111";}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uX")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("s3e")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("KAU7hSBG9moSdIPsSS2W6KslcbgoKNdPUQkhJD3v16ksqTMe9XbmuFz9gJ4fL")then if IIlIIIIIIllIlIIIlllll<=#("6xjK8yyHToYG59za5tzcoWL1uorlbaIXVPaYiRUnQCdXyYKzKfNLRJ7kVro")then if IIlIIIIIIllIlIIIlllll>#("gmGSQbVq9L1oJlvXSYEGP2L5x7glR0c0CbhE5vhvdsA9ozcFmkC7YTdnLL")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("aC")]][IIIlIIIlllIIlIIlIlII[#("vuN")]]=IIIlIIIlllIIlIIlIlII[#("JzmB")];else local IlIIIlIll;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("z2")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("iB2")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eE")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kD6")]][IIIlIIIlllIIlIIlIlII[#("8E0e")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9W")]]=IIIlIIIlllIIlIIlIlII[#("jEh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PQ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("MZN")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("qG")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("gJG")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Yl")]][IIIlIIIlllIIlIIlIlII[#("0Mv")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{862;141;481;29};{496;840;296;65};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AY")]][IIIlIIIlllIIlIIlIlII[#{{596;931;267;123};"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("6G3y")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IT")]][IIIlIIIlllIIlIIlIlII[#("byZ")]]=IIIlIIIlllIIlIIlIlII[#("tCOI")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("F8")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("nSG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("u0Y")]][IIIlIIIlllIIlIIlIlII[#("pp25")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nO")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{431;509;590;856};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CF")]]=IIIlIIIlllIIlIIlIlII[#("SX7")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0S")]]=IIIlIIIlllIIlIIlIlII[#("pv2")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Wt")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Zy2")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CC")]][IIIlIIIlllIIlIIlIlII[#("fZ4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5x5y")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hb")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("ba4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JG")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("O1h")]][IIIlIIIlllIIlIIlIlII[#{{254;679;983;395};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QL")]]=IIIlIIIlllIIlIIlIlII[#("t4y")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("j0")]]=IIIlIIIlllIIlIIlIlII[#("VCc")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zK")]]=IIIlIIIlllIIlIIlIlII[#("SBu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8U")]]=IIIlIIIlllIIlIIlIlII[#("J7P")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("aC")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("GcC")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{618;363;520;813};{219;92;628;546};}]][IIIlIIIlllIIlIIlIlII[#("09M")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JFzD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{460;698;393;952};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("6jc")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ohq")]][IIIlIIIlllIIlIIlIlII[#("qMdG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Kg")]]=IIIlIIIlllIIlIIlIlII[#("Pcj")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Lx")]]=IIIlIIIlllIIlIIlIlII[#("7Nb")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bQ")]]=IIIlIIIlllIIlIIlIlII[#("vLY")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qH")]]=IIIlIIIlllIIlIIlIlII[#("FMf")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{360;882;645;12};"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VC")]][IIIlIIIlllIIlIIlIlII[#("zsd")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{639;96;58;754};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BY")]]=(IIIlIIIlllIIlIIlIlII[#("r3s")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DC")]]=(IIIlIIIlllIIlIIlIlII[#("z1M")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TB")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("jEM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8j")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XuS")]][IIIlIIIlllIIlIIlIlII[#("gUO4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("hu")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("beE")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#{{387;126;104;212};"1 + 1 = 111";{440;264;291;564};{444;783;75;766};}]];end;elseif IIlIIIIIIllIlIIIlllll==#("T5JJiIaWId21xRhDvCMR75L9HyfcT732u9yAEUqBnNECusepQqSV94yXuKbU")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jK")]]=IIIlIIIlllIIlIIlIlII[#("k7a")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1Y")]]=IIIlIIIlllIIlIIlIlII[#("d71")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("H6")]]=IIIlIIIlllIIlIIlIlII[#("1QC")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{607;509;168;394};}]]=IIIlIIIlllIIlIIlIlII[#("9Zc")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("7N")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{596;978;404;399};}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yO")]]=IIIlIIIlllIIlIIlIlII[#("8oF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("v3")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{{984;437;967;852};"1 + 1 = 111";"1 + 1 = 111";}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3h")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("s2")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("YYj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ud")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("28J")]];else local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("vi")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("amT")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("f4")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("boG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("34")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("rNJ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("54")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("f9q")]][IIIlIIIlllIIlIIlIlII[#("1BG6")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hb")]]=IIIlIIIlllIIlIIlIlII[#("D9t")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fV")]]=IIIlIIIlllIIlIIlIlII[#("R03")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QL")]]=IIIlIIIlllIIlIIlIlII[#("fgI")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("cW")]]=IIIlIIIlllIIlIIlIlII[#("PSl")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("ip")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("1IE")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gJ")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Fb9")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("8dLk9GxsR8MlkEuBjOntZvDph3BLLf4SG8oJ3quXR78sfKYBdxl5YBMMLucgfWS")then if IIlIIIIIIllIlIIIlllll==#("d3PloVH2tBM2xkjHe9In494fxM8InnR5pxom5MlrZsMxZUoBlFbfnERe8JZNX9")then IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("esT")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pW")]];else local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Hf")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Y8o")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("S2")]]=IIIlIIIlllIIlIIlIlII[#("Hn1")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("YE")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("PfU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2A")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("toy")]][IIIlIIIlllIIlIIlIlII[#("LzNc")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7x")]]=IIIlIIIlllIIlIIlIlII[#("Rus")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{252;197;959;316};"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("je")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CnV")]][IIIlIIIlllIIlIIlIlII[#("Zcl8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bs")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("GGB")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("V6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("aJz")]][IIIlIIIlllIIlIIlIlII[#("Omv4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qX")]]=IIIlIIIlllIIlIIlIlII[#("h9P")];end;elseif IIlIIIIIIllIlIIIlllll<=#("fUQNa56MDYpzLxIpMxIvSmLSVPkovWJFZPHNigoFp3Jr7egRAsmppN52i81vURpQ")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SP")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1TP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("89")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("1sQ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hx")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XuC")]][IIIlIIIlllIIlIIlIlII[#("TmWA")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("f2")]]=IIIlIIIlllIIlIIlIlII[#("Ned")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{714;111;630;440};"1 + 1 = 111";}]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("ajB")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Bl")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("nRt")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vj")]][IIIlIIIlllIIlIIlIlII[#{{364;734;942;618};"1 + 1 = 111";{993;979;379;833};}]]=IIIlIIIlllIIlIIlIlII[#("oRml")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Zg")]][IIIlIIIlllIIlIIlIlII[#{{73;877;298;667};"1 + 1 = 111";{541;941;300;626};}]]=IIIlIIIlllIIlIIlIlII[#("7KDr")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AG")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Kpd")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("n7")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("P1S")]][IIIlIIIlllIIlIIlIlII[#("0fgn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eI")]]=IIIlIIIlllIIlIIlIlII[#("I9V")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yj")]]=IIIlIIIlllIIlIIlIlII[#("ekY")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("28")]]=IIIlIIIlllIIlIIlIlII[#("GPx")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("jY")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Je4")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nd")]][IIIlIIIlllIIlIIlIlII[#("zOO")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("MJim")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xp")]][IIIlIIIlllIIlIIlIlII[#("AKf")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dJQP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bt")]][IIIlIIIlllIIlIIlIlII[#("shQ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FpaZ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("V4")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("afe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("93")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Csc")]][IIIlIIIlllIIlIIlIlII[#("POgb")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zJ")]]=IIIlIIIlllIIlIIlIlII[#("6i6")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("i4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("M6K")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("6b")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{{42;753;241;733};{639;203;826;860};{17;62;646;263};}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zx")]][IIIlIIIlllIIlIIlIlII[#("v2J")]]=IIIlIIIlllIIlIIlIlII[#{{433;946;246;705};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{212;767;317;129};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Gl")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4t2")]][IIIlIIIlllIIlIIlIlII[#("oK3q")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("GL")]]=IIIlIIIlllIIlIIlIlII[#("FB5")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{684;966;27;620};}]]=IIIlIIIlllIIlIIlIlII[#("LnG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ql")]]=IIIlIIIlllIIlIIlIlII[#("bQo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ks")]]=IIIlIIIlllIIlIIlIlII[#("ScY")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("ez")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("aeB")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mE")]][IIIlIIIlllIIlIIlIlII[#("vjb")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IgiD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3b")]][IIIlIIIlllIIlIIlIlII[#("Hd6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jeKq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zr")]][IIIlIIIlllIIlIIlIlII[#("Ket")]]=IIIlIIIlllIIlIIlIlII[#("QbIU")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{608;152;605;422};{111;292;714;287};}]][IIIlIIIlllIIlIIlIlII[#("p9g")]]=IIIlIIIlllIIlIIlIlII[#("SJO1")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gB")]][IIIlIIIlllIIlIIlIlII[#("bkA")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{691;713;490;780};{306;244;590;43};"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Jo")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("HFE")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qE")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Nrs")]][IIIlIIIlllIIlIIlIlII[#("AhTn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("F2")]]=IIIlIIIlllIIlIIlIlII[#("Do7")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("oD")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XV")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3NK")]][IIIlIIIlllIIlIIlIlII[#("EPzq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rt")]][IIIlIIIlllIIlIIlIlII[#("AW2")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zgHs")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Uy")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("qvP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{189;159;142;99};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xNb")]][IIIlIIIlllIIlIIlIlII[#("Le0j")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Bg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6ND")]][IIIlIIIlllIIlIIlIlII[#("2ORq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9P")]][IIIlIIIlllIIlIIlIlII[#("OPS")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("P6cn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("QuF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2M")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VXR")]][IIIlIIIlllIIlIIlIlII[#("Ja96")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{490;405;459;107};{284;272;866;909};}]]=IIIlIIIlllIIlIIlIlII[#("hES")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8R")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zVV")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("5O")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("r3G")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mM")]][IIIlIIIlllIIlIIlIlII[#("0Ht")]]=IIIlIIIlllIIlIIlIlII[#{{766;119;476;267};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uk")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4x")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Wgl")]][IIIlIIIlllIIlIIlIlII[#("bMq0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{456;197;305;8};{127;606;312;435};}]]=IIIlIIIlllIIlIIlIlII[#("5UO")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("H0")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{759;126;188;893};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8G")]]=IIIlIIIlllIIlIIlIlII[#("OtZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("A1")]]=IIIlIIIlllIIlIIlIlII[#("4zt")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("74")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("1nJ")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NV")]][IIIlIIIlllIIlIIlIlII[#("iHa")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("McuK")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dV")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("bF8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("D0")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("J1K")]][IIIlIIIlllIIlIIlIlII[#("hi6U")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("No")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{751;413;498;3};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XO")]]=IIIlIIIlllIIlIIlIlII[#("gR7")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BD")]]=IIIlIIIlllIIlIIlIlII[#("hbH")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rm")]]=IIIlIIIlllIIlIIlIlII[#("SBf")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Ey")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("pd8")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("I9")]][IIIlIIIlllIIlIIlIlII[#("IBf")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WBD7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yF")]][IIIlIIIlllIIlIIlIlII[#("TFc")]]=IIIlIIIlllIIlIIlIlII[#("HMkd")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Oo")]][IIIlIIIlllIIlIIlIlII[#("PK4")]]=IIIlIIIlllIIlIIlIlII[#("ygKn")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yS")]][IIIlIIIlllIIlIIlIlII[#("TXL")]]=IIIlIIIlllIIlIIlIlII[#("pSEV")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("i0")]][IIIlIIIlllIIlIIlIlII[#("ROd")]]=IIIlIIIlllIIlIIlIlII[#("px0H")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ym")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("q5O")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("M4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("aFC")]][IIIlIIIlllIIlIIlIlII[#("NMDW")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2l")]]=IIIlIIIlllIIlIIlIlII[#("Af5")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("T9")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Sp")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3cE")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{833;111;811;796};"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tj")]][IIIlIIIlllIIlIIlIlII[#("zs6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("L2yh")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IG")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Ol8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ef")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gTW")]][IIIlIIIlllIIlIIlIlII[#("zCnG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("l9")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0Pk")]][IIIlIIIlllIIlIIlIlII[#("FCgu")]];elseif IIlIIIIIIllIlIIIlllll==#("VJ605hGicgZOtVQJEZcJspmTOEkp3VIN2clGj0FlRhnHgoZnkWq2mh6GxnmB6porI")then local IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("WA")];local IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("APkx")];local lIIlIIIllIlllllIlIlIllllI=IIlIlIlllI+2 local IIlIlIlllI={lIlIllIIlIIIllllIll[IIlIlIlllI](lIlIllIIlIIIllllIll[IIlIlIlllI+1],lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI])};for IIIlIIIlllIIlIIlIlII=1,IIlIIIIIIllIlIIIlllll do lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI+IIIlIIIlllIIlIIlIlII]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII];end;local IIlIlIlllI=IIlIlIlllI[1]if IIlIlIlllI then lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI]=IIlIlIlllI IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("aXr")];else IllllIIllllllII=IllllIIllllllII+1;end;else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fr")]]=IIIlIIIlllIIlIIlIlII[#("X8z")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Lt")]]=IIIlIIIlllIIlIIlIlII[#("dBv")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{474;909;498;277};{377;384;489;576};}]]=IIIlIIIlllIIlIIlIlII[#("Pz3")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xP")]]=IIIlIIIlllIIlIIlIlII[#("tTb")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("uO")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("SBG")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("A6")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{529;21;327;893};{706;927;880;434};{682;522;952;344};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bd")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SHV")]][IIIlIIIlllIIlIIlIlII[#("AK6s")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bK")]]=IIIlIIIlllIIlIIlIlII[#("5tF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("03")]]=IIIlIIIlllIIlIIlIlII[#("V1d")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KB")]]=IIIlIIIlllIIlIIlIlII[#("4RJ")];end;elseif IIlIIIIIIllIlIIIlllll<=#("WrJkzNt12lcPMzP7egEQAVgQi6NdoB2695DIPayOIvpUDRMXV9liX1Vbl2bC9pMBsgQQ6hseSZheGvmBu0sopUihjCvW85OsUYC")then if IIlIIIIIIllIlIIIlllll<=#("b51ORgA8URGZPKhj7xkI7IHEVGgWkZtR3ZAz8OIjujyD6HgyYFuxO3AEzx2kaNX4xY5ZkSktZanXjdIozS")then if IIlIIIIIIllIlIIIlllll<=#("QF7caA6aLVxiRxEfhLrnftbINPMtuYOWsOhAAW5AoSKIC2GBQ7BOhF3vDzzvYMPWhK0dodQuP1")then if IIlIIIIIIllIlIIIlllll<=#("xUDfVikNxyaPXVW6axJMMcXB1bDmMrf8pGGL9sOmN9rzg5crDhP8fpxu7coTP8afsbzrpk")then if IIlIIIIIIllIlIIIlllll<=#("RTx8MUyt58lUFMh29jkO7e4HP9mgfHVcrk8oTrUKJTsUEnFEkjzheH9MYZsNIrozniCt")then if IIlIIIIIIllIlIIIlllll==#("2jSALeoWjcBES55hN7VlvB39gcrF4HuWl0saRSECV0OW1j0vsqKkQirCpTsJXT2NSPs")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Lg")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Zy2")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4O")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0fK")]][IIIlIIIlllIIlIIlIlII[#("4jz9")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ug")]]=IIIlIIIlllIIlIIlIlII[#("NV3")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RB")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qmP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("3l")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("7hG")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7j")]][IIIlIIIlllIIlIIlIlII[#("QMP")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t2r5")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0W")]][IIIlIIIlllIIlIIlIlII[#("3X6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yux4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{245;56;414;944};{997;480;669;337};}]][IIIlIIIlllIIlIIlIlII[#("PLF")]]=IIIlIIIlllIIlIIlIlII[#("Xjuk")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yd")]][IIIlIIIlllIIlIIlIlII[#{{65;900;303;977};"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kGhJ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tU")]][IIIlIIIlllIIlIIlIlII[#("nsA")]]=IIIlIIIlllIIlIIlIlII[#("U424")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3s")]][IIIlIIIlllIIlIIlIlII[#("7Pg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("b6eF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JV")]][IIIlIIIlllIIlIIlIlII[#("A6Z")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pdnL")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bA")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("mxD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{973;46;539;491};"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ldH")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{652;126;856;906};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dt")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TIY")]][IIIlIIIlllIIlIIlIlII[#("erpz")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qi")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qpVi")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("D2")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{825;787;429;588};{435;656;385;178};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zbZu")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PT")]][IIIlIIIlllIIlIIlIlII[#("7fD")]]=IIIlIIIlllIIlIIlIlII[#("Aayc")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1L")]]end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return end;else local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("BH")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("S3J")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9B")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{290;633;643;268};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("GX")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("7zp")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1t")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iTZ")]][IIIlIIIlllIIlIIlIlII[#("Cp17")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("s6")]]=IIIlIIIlllIIlIIlIlII[#("WbZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Bc")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("n7")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FxF")]][IIIlIIIlllIIlIIlIlII[#("U5Ti")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Sh")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("ne3")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("t0")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("q1K")]][IIIlIIIlllIIlIIlIlII[#("buAU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Qn")]]=IIIlIIIlllIIlIIlIlII[#("4Ye")];end;elseif IIlIIIIIIllIlIIIlllll==#("N5B5EtBFWgh7l5lN7jfcI1U8A4Pb8bem07TxZPRxSWPiLvx1HoPIJptWkDFJOzHVc4gom")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WS")]]=IIIlIIIlllIIlIIlIlII[#("FFT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mL")]]=IIIlIIIlllIIlIIlIlII[#("N0f")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AY")]]=IIIlIIIlllIIlIIlIlII[#("2i3")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DI")]]=IIIlIIIlllIIlIIlIlII[#("d1l")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Gz")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("pXj")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8k")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("zUX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bo")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("MxR")]][IIIlIIIlllIIlIIlIlII[#("CODt")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HO")]]=IIIlIIIlllIIlIIlIlII[#("Yiz")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5S")]]=IIIlIIIlllIIlIIlIlII[#("OIu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OQ")]]=IIIlIIIlllIIlIIlIlII[#("sLd")];else if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FZ")]]~=IIIlIIIlllIIlIIlIlII[#("Wk5e")])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("qV6")];end;end;elseif IIlIIIIIIllIlIIIlllll<=#("XsDSuVmLxeIXETvGNLO7lxjhTsp3gQoiOSBxf14IKKfBb05XAGrGKpNAjv9cGsFQZAjVs8BW")then if IIlIIIIIIllIlIIIlllll>#("gyMrSg2xCELzTIzeanT12bqezMLRjFBeFZE2biBphPeY3qf1URrVS5XegH2gFkn6dH44eHd")then local IIlIIIIIIllIlIIIlllll;local IIlIlIlllI;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("If")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("no3B")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PO1")]][IIIlIIIlllIIlIIlIlII[#("MWie")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Za")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OT2")]][IIIlIIIlllIIlIIlIlII[#("ZBrQ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3V")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SsM")]][IIIlIIIlllIIlIIlIlII[#("uGNM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("4m")];IIlIIIIIIllIlIIIlllll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("j95")]];lIlIllIIlIIIllllIll[IIlIlIlllI+1]=IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIlIlIlllI]=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII[#("dMeU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hv")]]=IIIlIIIlllIIlIIlIlII[#("TJ3")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("5P")]lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("G5N")]))else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2o")]]=IIIlIIIlllIIlIIlIlII[#("UFe")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("XRo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EW")]]=IIIlIIIlllIIlIIlIlII[#("2qB")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("N8")]]=IIIlIIIlllIIlIIlIlII[#("qrQ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("77")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("PKJ")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mS")]]=IIIlIIIlllIIlIIlIlII[#("9XF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Zlv")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CO")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("C93")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ob")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("anx")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RH")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Oo7")]];end;elseif IIlIIIIIIllIlIIIlllll>#("WETm7DliGT7DnQvJbzVEquU7ChVvxlXnNA8nlLgOuULWmUTyku2PVJMCUWU0RZWt6UZYRiyBr")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4J")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{778;29;169;264};"1 + 1 = 111";"1 + 1 = 111";}]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KP")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("IVE")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("jGU8USzykbthCeXGEA0q6F8qZD44Qc7BxOAfSWbcBtPUaZsVakO8LblOIDiqXERie2UXPSYSyXZM0n")then if IIlIIIIIIllIlIIIlllll<=#("aki4Fy90vDVHoOVo6MGQheFgrx6KXlJXumhgPKmUfbyu3lJdNJ39tIi6PcMhBzdk38mcGOKxAWKg")then if IIlIIIIIIllIlIIIlllll>#("jngY27nsKDWekBM8fsR7nC59GH89GKI7cpGZGtJB01sFA8um7yuD3iCSsgru9oW94Yc55XDVUph")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IT")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("370")]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Du")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vOO")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VHdA")]];end;elseif IIlIIIIIIllIlIIIlllll==#("iAJIlWbipfe3XXHzbnCLftKL6Ark5JSNafJ2IUjnmOUZUihhqeUHYGqZZ8MWE1mRxB3RoO1reozCJ")then IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("aXY")];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fq")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vNY")]][IIIlIIIlllIIlIIlIlII[#("qtWA")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("R6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yRj")]][IIIlIIIlllIIlIIlIlII[#("FbsF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("y4")]]=(IIIlIIIlllIIlIIlIlII[#{{71;704;207;738};"1 + 1 = 111";"1 + 1 = 111";}]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mt")]]=IIIlIIIlllIIlIIlIlII[#("NJ5")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VB")]]=(IIIlIIIlllIIlIIlIlII[#("AMS")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lr")]]=(IIIlIIIlllIIlIIlIlII[#{{450;353;186;507};{39;323;652;891};{83;135;102;839};}]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xX")]]=IIIlIIIlllIIlIIlIlII[#("j7y")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("YS")]]=(IIIlIIIlllIIlIIlIlII[#("JAh")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hy")]]=(IIIlIIIlllIIlIIlIlII[#("AuO")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DP")]]=(IIIlIIIlllIIlIIlIlII[#("HEF")]~=0);end;elseif IIlIIIIIIllIlIIIlllll<=#("0Xsj31YlZEZTcJhxTuBdDtpA3MnDDKhZpehYDu7v2kLz2FLrjRGdaGrGI2qrOvSpx9D8Bt3yyekrS0Hy")then if IIlIIIIIIllIlIIIlllll>#{{924;624;967;696};"1 + 1 = 111";{622;285;720;580};{493;794;918;726};{216;747;154;442};{753;212;4;659};{605;395;323;961};{163;528;414;749};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{463;317;771;930};{775;257;147;264};{253;504;229;350};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{1;599;531;127};{343;77;554;488};{582;21;112;670};"1 + 1 = 111";{779;943;614;322};{318;760;789;822};{650;878;958;221};"1 + 1 = 111";{337;169;571;680};{484;245;651;340};"1 + 1 = 111";{576;669;660;954};{573;746;294;992};{310;422;865;326};"1 + 1 = 111";{835;909;634;942};"1 + 1 = 111";{318;67;642;646};{615;509;860;218};{697;104;180;325};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{318;544;648;858};"1 + 1 = 111";{498;626;18;331};{658;435;943;190};"1 + 1 = 111";"1 + 1 = 111";{31;971;545;296};"1 + 1 = 111";"1 + 1 = 111";{926;647;291;500};"1 + 1 = 111";{979;857;922;397};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{389;136;371;843};"1 + 1 = 111";{571;860;532;761};{337;261;279;132};"1 + 1 = 111";{147;380;867;872};"1 + 1 = 111";{162;916;409;609};{358;324;964;776};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{478;88;546;351};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{40;498;578;288};{219;400;717;604};"1 + 1 = 111";"1 + 1 = 111";{606;111;169;482};{847;669;369;467};"1 + 1 = 111";}then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oi")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LBH")]]/IIIlIIIlllIIlIIlIlII[#("omvy")];else IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Rzt")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9v")]];end;elseif IIlIIIIIIllIlIIIlllll>#("8JRkB2QH2NI7o3rtAcDdjrxitle6d7dRFjAsSMvQJOHx7I50A8b8tBOQmJ1oYUD4J0DfD8MXQWEFUakVq")then local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("fH")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII+1])else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SaH")]][IIIlIIIlllIIlIIlIlII[#("bvXD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Qs")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fT4")]][IIIlIIIlllIIlIIlIlII[#("pItP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("RY")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("5tU")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qv")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("sXE")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Kg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zAa")]][IIIlIIIlllIIlIIlIlII[#("MkiT")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9r")]]=IIIlIIIlllIIlIIlIlII[#("4Eh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zj")]]=IIIlIIIlllIIlIIlIlII[#("h1E")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("65")]]=IIIlIIIlllIIlIIlIlII[#("xuY")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Py")]]=IIIlIIIlllIIlIIlIlII[#("OLO")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("MW")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("3TV")]))end;elseif IIlIIIIIIllIlIIIlllll<=#("Hf6fydFUgjVg2ZkMXgfZxBvnsH6i6myf8Kmy8EDzKT2DcJ4PuhmeQB0fTSW0hxX3VPirMWOsNQpOI3kUMrYY9tzITg")then if IIlIIIIIIllIlIIIlllll<=#("qRNrn59RyAMcIE4BalmI0Icn0J93CqLIGhxLazcSIlXtaopuf2zvHJYSPzCO6gphZeHBgsAMjF9PUSnLsPXJ1o")then if IIlIIIIIIllIlIIIlllll<=#{{864;696;781;429};"1 + 1 = 111";"1 + 1 = 111";{529;415;594;152};"1 + 1 = 111";{206;250;671;491};"1 + 1 = 111";{153;491;158;890};"1 + 1 = 111";{56;704;471;372};{72;933;287;466};"1 + 1 = 111";{802;852;133;242};{48;228;25;389};{147;356;473;833};"1 + 1 = 111";{600;748;696;417};"1 + 1 = 111";{351;620;851;811};"1 + 1 = 111";{352;350;292;837};"1 + 1 = 111";"1 + 1 = 111";{911;947;63;383};{60;523;272;255};"1 + 1 = 111";{701;320;188;37};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{509;695;190;767};"1 + 1 = 111";"1 + 1 = 111";{192;851;544;774};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{165;975;798;331};"1 + 1 = 111";{116;370;266;961};{108;771;285;382};"1 + 1 = 111";{423;97;234;530};{240;692;154;42};"1 + 1 = 111";"1 + 1 = 111";{468;588;366;549};"1 + 1 = 111";"1 + 1 = 111";{57;148;971;832};"1 + 1 = 111";{173;302;221;6};{164;644;676;696};{692;706;353;70};"1 + 1 = 111";"1 + 1 = 111";{881;46;714;353};{954;544;937;56};"1 + 1 = 111";{918;115;729;521};{233;701;125;314};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{916;737;429;945};{324;738;609;606};"1 + 1 = 111";{42;731;270;1};{527;420;903;519};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{860;958;201;816};"1 + 1 = 111";{15;95;166;545};{575;88;218;626};{853;945;597;453};{418;694;206;448};{981;549;3;355};{388;207;202;331};}then if IIlIIIIIIllIlIIIlllll==#("JkJdm9VyxJTqzCOtzVYQMC7KRvRXpJilM1Rpu05R9brISbN9oAEmclQgn9v0s8iYBHPIUz8JZhQLkz1QSRJ")then local IIlIIIIIIllIlIIIlllll;local IIlllIIllllI;local IllIIIlIIlIlIllIlIll,llIllIlIlIlIlIIlIIl;local llllIIIIIlllllIIlIIlIl;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{611;342;732;25};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("BmG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kg")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("UdJ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mh")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6b8")]][IIIlIIIlllIIlIIlIlII[#("fSTo")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("i0")];llllIIIIIlllllIIlIIlIl=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yb2")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=llllIIIIIlllllIIlIIlIl;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=llllIIIIIlllllIIlIIlIl[IIIlIIIlllIIlIIlIlII[#("FO2l")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("dl")]IllIIIlIIlIlIllIlIll,llIllIlIlIlIlIIlIIl=llIllIIIll(lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]))IlIIIlIll=llIllIlIlIlIlIIlIIl+IIlIIIIIIllIlIIIlllll-1 IIlllIIllllI=0;for IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll,IlIIIlIll do IIlllIIllllI=IIlllIIllllI+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IllIIIlIIlIlIllIlIll[IIlllIIllllI];end;IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("HP")]IllIIIlIIlIlIllIlIll={lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IlIIIlIll))};IIlllIIllllI=0;for IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll,IIIlIIIlllIIlIIlIlII[#("tnhQ")]do IIlllIIllllI=IIlllIIllllI+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IllIIIlIIlIlIllIlIll[IIlllIIllllI];end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("2Lr")];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{18;74;845;684};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pOe")]]/IIIlIIIlllIIlIIlIlII[#("1qQ9")];end;elseif IIlIIIIIIllIlIIIlllll==#("e5iBkLbvEeyb3EhlvfoZB5y5Ff6YhQhLzrTFyoxjxNeUTORQrQtNDUAjIn5fPnnX6XNLVMXhSfCX0Nm1ypHBv")then if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{996;85;108;246};{589;759;189;452};}]]~=IIIlIIIlllIIlIIlIlII[#("AULh")])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("G9X")];end;else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Gt")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("j5M")]];end;elseif IIlIIIIIIllIlIIIlllll<=#("iP2J6ktrEjzrX6bg5P2m4xrMt5bdRzQXBCO7TlPNYBLsyJZp0ru2IjKVyppbjpKfDM0vrdyT9pyEV9oVfVmAdYor")then if IIlIIIIIIllIlIIIlllll>#("3KD6OEI1GZVSE8X3M2sVgaybF5zcjbPyJEzD4XuW0NpkDcMWAGC55GV3mCCTeFREkyj9Ku9YIG5EUnJCsMNNJTC")then local IlIIIlIll;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xb")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ou1")]][IIIlIIIlllIIlIIlIlII[#("Tah6")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ee")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("75l")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{900;978;238;837};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{633;70;241;519};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("u2JO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QA")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("xHx")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dx")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TzR")]][IIIlIIIlllIIlIIlIlII[#("HEgq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jp")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BHB")]][IIIlIIIlllIIlIIlIlII[#("xELh")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("93")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7h")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("i6R")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("it")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("q2O")]][IIIlIIIlllIIlIIlIlII[#("cANE")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9A")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yO")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gp")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ao6")]][IIIlIIIlllIIlIIlIlII[#("vEic")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Fe")]]=-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tTn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("H3")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mk8")]]/IIIlIIIlllIIlIIlIlII[#("uhLO")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("c1")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("oto")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("cp")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3eI")]][IIIlIIIlllIIlIIlIlII[#("FG6r")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5O")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{45;262;756;64};}]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{430;307;594;709};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dG")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("br5")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OA")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{528;592;7;937};"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("yjAU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m5")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iT2")]][IIIlIIIlllIIlIIlIlII[#("6iDj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pk")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("L1C")]][IIIlIIIlllIIlIIlIlII[#("sxNs")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0r")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TSi")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0TGl")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("n6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{879;341;715;695};{944;802;409;814};{423;312;65;646};}]][IIIlIIIlllIIlIIlIlII[#("A2D4")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dO")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("dGk")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("JC")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{466;943;898;690};}]][IIIlIIIlllIIlIIlIlII[#("1Ish")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("K4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CHI")]][IIIlIIIlllIIlIIlIlII[#("z5W0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Eg")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{433;146;275;798};"1 + 1 = 111";{869;725;615;912};}]][IIIlIIIlllIIlIIlIlII[#("lezU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{372;418;795;290};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("UBM")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mOCg")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("8u")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("CcG")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vD")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{100;214;17;909};"1 + 1 = 111";{958;494;55;81};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ms")]]=IIIlIIIlllIIlIIlIlII[#("qQG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("9r")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("FYb")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hm")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ju4")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rhrx")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EZ")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("a2U")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("G1")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("FQGa")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oF")]]=IIIlIIIlllIIlIIlIlII[#("O0x")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{734;570;416;752};}]]=IIIlIIIlllIIlIIlIlII[#("srP")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("MS")]]=IIIlIIIlllIIlIIlIlII[#{{670;482;404;42};"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Rf")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("8nT")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("01")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bBH")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zZvM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("N1")]][IIIlIIIlllIIlIIlIlII[#("gPj")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yKXe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("q0")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("GTF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("cJ")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rCR")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("WuWR")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rc")]]=IIIlIIIlllIIlIIlIlII[#("HR1")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("R9")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("tcY")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VO")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jaA")]][IIIlIIIlllIIlIIlIlII[#("VBv0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("WU")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{649;621;87;137};"1 + 1 = 111";{142;391;160;359};}]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("84I7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("d5")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uL")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("j7c")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tr")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3ME")]][IIIlIIIlllIIlIIlIlII[#("qNAM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LR")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Q77")]][IIIlIIIlllIIlIIlIlII[#("GJzr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("N1")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XfT")]][IIIlIIIlllIIlIIlIlII[#("xsZ7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Zo")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Br6")]][IIIlIIIlllIIlIIlIlII[#("IfJz")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vrD")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("xuLe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4i")]]=IIIlIIIlllIIlIIlIlII[#("Ns0")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{288;347;246;48};{392;176;45;520};}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("pjI")]))else local IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("H6")];local IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("etPy")];local lIIlIIIllIlllllIlIlIllllI=IIlIlIlllI+2 local IIlIlIlllI={lIlIllIIlIIIllllIll[IIlIlIlllI](lIlIllIIlIIIllllIll[IIlIlIlllI+1],lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI])};for IIIlIIIlllIIlIIlIlII=1,IIlIIIIIIllIlIIIlllll do lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI+IIIlIIIlllIIlIIlIlII]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII];end;local IIlIlIlllI=IIlIlIlllI[1]if IIlIlIlllI then lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI]=IIlIlIlllI IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#{{205;659;426;448};{455;252;508;380};"1 + 1 = 111";}];else IllllIIllllllII=IllllIIllllllII+1;end;end;elseif IIlIIIIIIllIlIIIlllll==#{{402;855;988;378};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{79;800;556;717};"1 + 1 = 111";{212;642;713;508};{172;615;603;324};{310;535;330;115};{260;678;572;244};{531;954;9;997};"1 + 1 = 111";"1 + 1 = 111";{276;51;739;716};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{82;903;648;490};{67;501;279;567};{251;160;511;272};"1 + 1 = 111";"1 + 1 = 111";{628;628;546;198};{161;22;168;139};{30;301;801;788};"1 + 1 = 111";{922;371;346;435};{957;326;766;764};"1 + 1 = 111";{947;742;250;426};{71;578;784;841};"1 + 1 = 111";"1 + 1 = 111";{708;652;87;834};{159;412;167;751};"1 + 1 = 111";"1 + 1 = 111";{901;830;362;944};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{534;935;11;979};"1 + 1 = 111";"1 + 1 = 111";{937;974;795;91};{140;43;728;744};"1 + 1 = 111";{687;484;479;818};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{53;335;401;330};{42;941;202;968};"1 + 1 = 111";"1 + 1 = 111";{597;649;913;921};"1 + 1 = 111";"1 + 1 = 111";{280;187;711;359};{566;475;928;737};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{275;517;495;301};{371;175;307;16};"1 + 1 = 111";{148;267;270;826};"1 + 1 = 111";"1 + 1 = 111";{571;468;230;370};{599;630;292;393};"1 + 1 = 111";{606;301;904;966};{187;781;456;164};{983;735;429;143};{313;766;466;386};"1 + 1 = 111";}then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3d")]]();else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fJ")]][IIIlIIIlllIIlIIlIlII[#("zYs")]]=IIIlIIIlllIIlIIlIlII[#("EqyW")];end;elseif IIlIIIIIIllIlIIIlllll<=#("QW7gTKgPjQtXuqGfU2CDQoHj6Dli50CqhFCodfUa3f9efMzWY1pnBlkCpXjqz8TtncP0YrcPiCJLpCdtdAteLo06ta9p5D")then if IIlIIIIIIllIlIIIlllll<=#("5vP1c7J7HZKe9MKmXU0m8OPT9mSGYrWUPZOoKLaxECXoaj0uUYmGfqNrR610odjod0Aj8uMlTDTH0AS0vyW9fpOzlxHN")then if IIlIIIIIIllIlIIIlllll>#("kiBsIljUQvzlaWMHgBrnbE0rjjXma7MX9DJusosnJgPbxYeEb2f5pzRQriizz6TTULmInrn2idP5YY4veski2QIKV2c")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("e6")]]=IIIlIIIlllIIlIIlIlII[#("n2U")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WS")]]=IIIlIIIlllIIlIIlIlII[#("foA")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7Q")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{528;296;931;446};"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vd")]]=IIIlIIIlllIIlIIlIlII[#("EMB")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("t6")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Fep")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("li")]]=IIIlIIIlllIIlIIlIlII[#("VxT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("5j")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("A2T")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yH")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{202;810;508;598};"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0X")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9bd")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VS")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Hh2")]];else do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nI")]]end end;elseif IIlIIIIIIllIlIIIlllll==#("f4ZMx6rVMHpUOnXmUW2EnXtfWL0ddMXupeWoocJ1HjTIdBFO3u08aJ5rKT0WgnR9T5EKBJ7Sna6edVcvglkSWYuRiFOFl")then local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("bV")]local lIIlIIIllIlllllIlIlIllllI,IIIlIIIlllIIlIIlIlII=llIllIIIll(lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IIIlIIIlllIIlIIlIlII[#("3X0")])))IlIIIlIll=IIIlIIIlllIIlIIlIlII+IllllIIllllllII-1 local IIIlIIIlllIIlIIlIlII=0;for IllllIIllllllII=IllllIIllllllII,IlIIIlIll do IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII+1;lIlIllIIlIIIllllIll[IllllIIllllllII]=lIIlIIIllIlllllIlIlIllllI[IIIlIIIlllIIlIIlIlII];end;else local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("W1")]lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IIIlIIIlllIIlIIlIlII[#("K8L")]))end;elseif IIlIIIIIIllIlIIIlllll<=#("VtCUYh64nuyiVaM1nZREP4d8n5LWC54DGBoNMt64Al80uOctfqrZYSg1qEG3HjDrA4MuW9o32WeE6mNK2qRkOfOYtxviYdxp")then if IIlIIIIIIllIlIIIlllll==#("QABbSIfby6bON5d05bpCsNtqYbzNgfZzYVpXmJkTMiqiNjQCsr3cgXAcfkmQjC5shMZ1PqNx0H0jxlNOu6uYmWravmRcvFK")then local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("P6")]lIlIllIIlIIIllllIll[IllllIIllllllII]=lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IIIlIIIlllIIlIIlIlII[#("qJZ")]))else if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PC")]]==IIIlIIIlllIIlIIlIlII[#("Ujku")])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("ISk")];end;end;elseif IIlIIIIIIllIlIIIlllll<=#("n8aauZWcPGlK7pQ4HJumhggutYGCJLav7Q6ykNsGjrjQLSdfHXGXjxbg2QQHsuDdG0MqtrT3pYc07BUMVA5WfnlKPZGF7WnZZ")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Km")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jn5")]][IIIlIIIlllIIlIIlIlII[#("n6FK")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{229;532;545;475};{309;109;352;159};}]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("Fux")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Kk")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("U6K")]][IIIlIIIlllIIlIIlIlII[#("CMyj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jQ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("J7t")]][IIIlIIIlllIIlIIlIlII[#{{844;491;810;655};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("K5")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("l1R")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5m")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Gv7")]][IIIlIIIlllIIlIIlIlII[#("5cvi")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Sh")]]=IIIlIIIlllIIlIIlIlII[#("qGY")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1s")]]=IIIlIIIlllIIlIIlIlII[#("LYe")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gA")]]=IIIlIIIlllIIlIIlIlII[#("1mt")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("dp")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("lP3")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tS")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("A9O")]]*lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("l3aX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{115;480;214;200};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("ziP")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("f5df")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("oBi")];elseif IIlIIIIIIllIlIIIlllll==#{"1 + 1 = 111";{819;828;889;450};{890;469;647;534};{581;449;384;777};{651;750;755;927};"1 + 1 = 111";{156;538;540;973};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{793;87;145;306};{205;174;44;647};{667;839;642;884};{555;342;487;402};"1 + 1 = 111";{205;917;831;78};{78;149;533;683};"1 + 1 = 111";"1 + 1 = 111";{423;37;833;375};"1 + 1 = 111";"1 + 1 = 111";{197;51;881;492};"1 + 1 = 111";{743;731;974;935};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{23;413;808;698};{701;987;386;126};"1 + 1 = 111";{451;804;701;334};"1 + 1 = 111";{469;330;508;424};"1 + 1 = 111";{84;636;957;460};{133;313;911;550};"1 + 1 = 111";{493;113;475;462};{513;741;837;615};"1 + 1 = 111";"1 + 1 = 111";{795;190;73;597};{738;967;998;706};"1 + 1 = 111";{838;789;212;569};{508;472;439;215};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{228;897;600;576};{372;767;112;819};{434;414;720;31};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{484;135;901;95};{446;167;836;671};{450;714;754;374};{989;63;427;603};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{135;253;897;817};"1 + 1 = 111";{502;512;195;563};"1 + 1 = 111";{338;20;503;527};{156;42;194;376};"1 + 1 = 111";"1 + 1 = 111";{8;343;148;969};{307;75;805;616};"1 + 1 = 111";{997;768;460;742};{71;786;699;939};"1 + 1 = 111";{583;403;432;304};"1 + 1 = 111";"1 + 1 = 111";{70;962;128;994};{50;740;435;146};{519;626;427;182};"1 + 1 = 111";{164;489;280;30};"1 + 1 = 111";{709;246;535;158};"1 + 1 = 111";"1 + 1 = 111";{998;479;812;583};{282;95;432;61};"1 + 1 = 111";}then local IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("uS")]lIlIllIIlIIIllllIll[IllllIIllllllII](llIIllIlI(lIlIllIIlIIIllllIll,IllllIIllllllII+1,IIIlIIIlllIIlIIlIlII[#("amu")]))else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RO")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qE6")]][IIIlIIIlllIIlIIlIlII[#("z4oK")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("21")]][IIIlIIIlllIIlIIlIlII[#("Gpp")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("B0bj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{620;878;277;777};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("2sL")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{973;787;159;799};"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("IU")]][IIIlIIIlllIIlIIlIlII[#("Nam")]]=IIIlIIIlllIIlIIlIlII[#("hhYs")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("E7")]][IIIlIIIlllIIlIIlIlII[#("8iH")]]=IIIlIIIlllIIlIIlIlII[#("SYcP")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xT")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Std")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Z6")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1F2")]][IIIlIIIlllIIlIIlIlII[#("t5R7")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OG")]]=IIIlIIIlllIIlIIlIlII[#("Pyq")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m0")]]=IIIlIIIlllIIlIIlIlII[#("2Gc")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tX")]]=IIIlIIIlllIIlIIlIlII[#("T4c")];end;elseif IIlIIIIIIllIlIIIlllll<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{304;972;310;785};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{148;240;359;326};{9;349;36;366};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{516;48;269;533};"1 + 1 = 111";{280;292;124;933};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{331;921;541;601};{90;230;252;649};{734;96;890;597};{132;32;543;838};{750;342;139;699};"1 + 1 = 111";{829;402;725;768};{694;420;466;290};{70;441;28;75};{904;862;209;137};"1 + 1 = 111";{958;616;139;905};"1 + 1 = 111";{331;948;690;521};{549;323;680;716};{79;89;88;150};"1 + 1 = 111";"1 + 1 = 111";{702;575;840;902};{455;173;435;428};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{596;169;890;720};{584;817;777;756};"1 + 1 = 111";{102;767;676;384};"1 + 1 = 111";{734;153;257;188};"1 + 1 = 111";{758;188;2;389};{897;105;998;787};{261;34;472;746};{649;345;950;428};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{384;293;972;537};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{576;596;610;130};"1 + 1 = 111";{465;232;301;377};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{54;465;222;735};"1 + 1 = 111";{866;520;950;804};{786;93;348;648};"1 + 1 = 111";"1 + 1 = 111";{596;95;81;878};{790;642;268;308};{473;633;844;430};{864;936;223;990};"1 + 1 = 111";{946;476;181;637};"1 + 1 = 111";"1 + 1 = 111";{747;284;654;371};{710;666;802;983};{413;941;433;216};"1 + 1 = 111";"1 + 1 = 111";{507;138;212;188};{866;458;113;286};"1 + 1 = 111";"1 + 1 = 111";{488;991;214;13};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if IIlIIIIIIllIlIIIlllll<=#{{909;844;595;724};"1 + 1 = 111";{519;891;947;14};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{353;996;807;571};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{699;526;186;856};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{752;106;939;72};{534;97;411;513};{409;546;51;241};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{493;295;865;208};"1 + 1 = 111";"1 + 1 = 111";{51;190;465;904};"1 + 1 = 111";"1 + 1 = 111";{927;210;836;561};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{372;499;516;321};{715;726;301;984};"1 + 1 = 111";{563;75;16;202};{201;706;991;594};"1 + 1 = 111";"1 + 1 = 111";{920;976;107;775};"1 + 1 = 111";{574;110;724;214};"1 + 1 = 111";{134;264;373;397};{178;15;901;453};"1 + 1 = 111";"1 + 1 = 111";{926;780;364;27};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{833;240;589;629};"1 + 1 = 111";"1 + 1 = 111";{394;709;654;687};"1 + 1 = 111";{671;98;687;688};{184;62;453;750};{668;688;157;769};"1 + 1 = 111";{405;5;481;161};"1 + 1 = 111";{645;211;919;966};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{615;297;460;477};{228;171;138;984};"1 + 1 = 111";{253;716;972;334};"1 + 1 = 111";{859;427;89;716};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{449;698;838;121};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{468;598;661;147};"1 + 1 = 111";"1 + 1 = 111";{985;538;787;750};{787;564;587;192};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{43;480;691;272};{258;839;86;255};{587;593;497;169};"1 + 1 = 111";"1 + 1 = 111";}then if IIlIIIIIIllIlIIIlllll<=#("yjuuAmDp1IcAWmcRg43srgZ0kqsQCFAli8VtfHf6yDL6AVSjKz15EkyqtEji3XXvh0qXBTLKY74ZG3AAIjfdNES7LF9Lx7cLPoYJE5S")then if IIlIIIIIIllIlIIIlllll<=#("XrhGqJVBdUKTRUTNhtm6T9m14sjqe16NCnpuxmRcTJHNxs44GlBjTViXfpL7zFvmX7rDFyp5MjnkCKFMzpV2AW4RfDphLUOomuZzb")then if IIlIIIIIIllIlIIIlllll>#("zi6FHJI7uFV9IiTEXbdLychiu2G97hVfK80N64ouihhUxLlFFTHXvAcxaYkPcIanUQzKrgI2XSCp4xVTRbEoK7Tj5EMiUKsKh4aQ")then if lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vK")]]then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("TSU")];end;else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9a")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{471;48;933;26};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("h8")]]=IIIlIIIlllIIlIIlIlII[#("oMS")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gm")]]=IIIlIIIlllIIlIIlIlII[#("PXf")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xG")]]=IIIlIIIlllIIlIIlIlII[#("BXi")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("CZ")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{895;866;397;457};"1 + 1 = 111";}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("VB")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("b6E")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PG")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("7FW")]][IIIlIIIlllIIlIIlIlII[#("HJsn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Qd")]]=IIIlIIIlllIIlIIlIlII[#{{374;52;18;364};"1 + 1 = 111";{134;654;24;832};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DP")]]=IIIlIIIlllIIlIIlIlII[#("J7M")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{89;290;402;571};"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("XO5")];end;elseif IIlIIIIIIllIlIIIlllll==#("MmylOaO8XCNcB7beVNW6oOYEzimz1havfHeYgd57elib8fsMrGvqoU77y3WGXogPBq733m7SRY1dGXGt0LhuWThuKgAmrAk0eDKSiz")then local IIlllIIllllI;local llllIIIIIlllllIIlIIlIl,IllIIIlIIlIlIllIlIll;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pm")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{310;501;507;640};}]]=IIIlIIIlllIIlIIlIlII[#("8hJz")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qF")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{611;418;108;358};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0o")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("WbX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ES")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Cpe")]][IIIlIIIlllIIlIIlIlII[#{{677;120;498;56};{767;458;790;50};"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eq")]]=IIIlIIIlllIIlIIlIlII[#("ZKr")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zU")]]=IIIlIIIlllIIlIIlIlII[#("ZOX")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]llllIIIIIlllllIIlIIlIl,IllIIIlIIlIlIllIlIll=llIllIIIll(lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("9fx")])))IlIIIlIll=IllIIIlIIlIlIllIlIll+IIlIIIIIIllIlIIIlllll-1 IIlllIIllllI=0;for IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll,IlIIIlIll do IIlllIIllllI=IIlllIIllllI+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=llllIIIIIlllllIIlIIlIl[IIlllIIllllI];end;IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("iQ")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IlIIIlIll))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{641;622;278;856};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("kKn")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pyPm")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uP")]][IIIlIIIlllIIlIIlIlII[#("knZ")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8gUj")]];else if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("A9")]]<IIIlIIIlllIIlIIlIlII[#("K2J5")])then IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("6zQ")];else IllllIIllllllII=IllllIIllllllII+1;end;end;elseif IIlIIIIIIllIlIIIlllll<=#("eJNKA23CLyCPlgV3SjMsWWUBqOb8cmYkB2cWijRDQPZZZU8TtK2IGg6sYmsW05zyKrotd8UJCiMh75MGPsPDupOu5U8504NVpBoIGPPuZ")then if IIlIIIIIIllIlIIIlllll==#("fxEZu2LXhHq6cuN4ztaYSHG11GQeaaOtNbjq0fAgucXfEtz44MqvuaLJ1N8ZlHWh36sbkvds44EPUBxHhWjzTs9MBLAnhK4YqQlIbyUJ")then local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("0g")]local lIIlIIIllIlllllIlIlIllllI,IllllIIllllllII=llIllIIIll(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII+1]))IlIIIlIll=IllllIIllllllII+IIIlIIIlllIIlIIlIlII-1 local IllllIIllllllII=0;for IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII,IlIIIlIll do IllllIIllllllII=IllllIIllllllII+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];end;else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vk")]]=IIIlIIIlllIIlIIlIlII[#("n0r")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Z4")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Wl")]]=IIIlIIIlllIIlIIlIlII[#("2cT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dM")]]=IIIlIIIlllIIlIIlIlII[#("vln")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("ie")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{971;403;210;796};{551;150;263;342};}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("94")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("TXW")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ag")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("XdD")]][IIIlIIIlllIIlIIlIlII[#("Fjdu")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gK")]]=IIIlIIIlllIIlIIlIlII[#("BBN")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9G")]]=IIIlIIIlllIIlIIlIlII[#("3BG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Bd")]]=IIIlIIIlllIIlIIlIlII[#("xTS")];end;elseif IIlIIIIIIllIlIIIlllll==#("7CBH5YApBSAxyyL7QKJ50lt9PzepZGUcK0W1JfFWa7Q2FB2rLKuXkNSWhB1GUkB48yWHMUzLeW42FCFoHWPol616iaThn9c0HW3hOuQ0lT")then local IlIIIlIll;local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("fo")];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HdL")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("4NrQ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Qc")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("09y")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ry")]]=IIIlIIIlllIIlIIlIlII[#("aYc")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kv")]]=IIIlIIIlllIIlIIlIlII[#("tvh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qO")]]=IIIlIIIlllIIlIIlIlII[#("efq")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kl")]]=(IIIlIIIlllIIlIIlIlII[#("Su3")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("yB")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("zst")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{121;179;303;71};}]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("QnO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{736;723;172;955};"1 + 1 = 111";}];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("apX")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("9IAq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hZ")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("mOv")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Nu")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QEn")]][IIIlIIIlllIIlIIlIlII[#("RM5C")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("e7")]]=IIIlIIIlllIIlIIlIlII[#("zzg")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NC")]]=IIIlIIIlllIIlIIlIlII[#("tf5")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("Clh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("u0")]]=IIIlIIIlllIIlIIlIlII[#("kiT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("cZ")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("QCs")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FZ")]]=IIIlIIIlllIIlIIlIlII[#("kjo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9d")]]=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("NC")]]=IIIlIIIlllIIlIIlIlII[#("TD0")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("j4")]]=(IIIlIIIlllIIlIIlIlII[#("gqc")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("8K")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{90;563;359;382};"1 + 1 = 111";}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qI")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("syA")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}];IlIIIlIll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iKF")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IlIIIlIll;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IlIIIlIll[IIIlIIIlllIIlIIlIlII[#("5qFC")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tH")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{568;26;570;868};{813;160;8;938};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ic")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kBC")]][IIIlIIIlllIIlIIlIlII[#("AYia")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Js")]]=IIIlIIIlllIIlIIlIlII[#("kd9")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pT")]]=IIIlIIIlllIIlIIlIlII[#("2FH")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PM")]]=IIIlIIIlllIIlIIlIlII[#("v3f")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{282;289;974;472};"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("fSu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("HC")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("0SE")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8D")]]=IIIlIIIlllIIlIIlIlII[#("UA5")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ox")]]=IIIlIIIlllIIlIIlIlII[#("6iF")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9e")]]=IIIlIIIlllIIlIIlIlII[#("uMd")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TS")]]=(IIIlIIIlllIIlIIlIlII[#("ZY0")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("pl")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("XUS")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KB")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("0BC")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{743;516;983;426};}]][IIIlIIIlllIIlIIlIlII[#("FM8")]]=IIIlIIIlllIIlIIlIlII[#{{198;772;131;228};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("A4")]]=(IIIlIIIlllIIlIIlIlII[#("Foy")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("7PE")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xt")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Hl")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("ib5")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TY")]][IIIlIIIlllIIlIIlIlII[#("9NO")]]=IIIlIIIlllIIlIIlIlII[#("562M")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kv")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("ZAe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("2lf")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CK")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{543;735;495;402};{635;603;942;680};{881;724;405;421};}]][IIIlIIIlllIIlIIlIlII[#("Mg8J")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QG")]]=IIIlIIIlllIIlIIlIlII[#("8QD")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{139;25;206;317};"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TF")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ksA")]][IIIlIIIlllIIlIIlIlII[#("AQEs")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rd")]][IIIlIIIlllIIlIIlIlII[#("nMT")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("86gI")]];else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xI")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("tga")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("y2")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Z8Y")]][IIIlIIIlllIIlIIlIlII[#("nPME")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{82;466;996;600};"1 + 1 = 111";}]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("XSA")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ya")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{781;702;764;190};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#{{378;67;413;224};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3e")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("isB")]][IIIlIIIlllIIlIIlIlII[#("C42S")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mz")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SkW")]][IIIlIIIlllIIlIIlIlII[#("UUsj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ta")]]=-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ILJ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4T")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nHG")]]/IIIlIIIlllIIlIIlIlII[#("Zr56")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iK")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("R47")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("HY")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ltq")]][IIIlIIIlllIIlIIlIlII[#("Uu0E")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SB")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{{251;802;783;567};{935;660;890;297};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vY")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pyX")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{971;31;632;753};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("GX")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8g8")]][IIIlIIIlllIIlIIlIlII[#("quyI")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("OR")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lDC")]][IIIlIIIlllIIlIIlIlII[#("hYxb")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vs")]]=-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uHn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("h3")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ah9")]]*IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{82;135;786;424};{203;686;876;739};"1 + 1 = 111";}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LG")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("lmy")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("d7")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("TIh")]][IIIlIIIlllIIlIIlIlII[#("oO7W")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{2;536;983;659};"1 + 1 = 111";}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("bzy")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ko")]][IIIlIIIlllIIlIIlIlII[#("OGm")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{209;639;917;957};{840;9;734;221};{578;472;923;217};{430;2;139;789};}]];end;elseif IIlIIIIIIllIlIIIlllll<=#("yTZqQ6N98GlSbGZyMbqyfUevTIyKlgYdCoDntTdlK9duud2LZ6dZ5vMNOEIhIcX2RiqXcLe28eXfQUaPQWVoc8igMZKZl5NHllNmXfIn2l10IH7")then if IIlIIIIIIllIlIIIlllll<=#("E2CWrJZT9jkmbpRcCp3FgX2LoIx1hrIf2PvtD1pNv4mN4ulMEYzsNCXQ91IUm8LRLfuv3yKKaqimKoQ3vUxs3pDA2PtLtFBysGbYaZTgoYsvt")then if IIlIIIIIIllIlIIIlllll>#("gUkOyCMsYvN4Eod9pF0V3em12Gbqee6ggqJJAPh8VaRQlgvEcpIYGJRbHsW2BvnTAGXmQFJLy193xHQVkHnZHiKIJHbg2pIAW8pQtiYHQ7BP")then local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("hn")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](llIIllIlI(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII+1,IlIIIlIll))else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mP")]][IIIlIIIlllIIlIIlIlII[#("YeS")]]=IIIlIIIlllIIlIIlIlII[#("UPXG")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jH")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("JLb")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bR")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("CYC")]][IIIlIIIlllIIlIIlIlII[#("aYoz")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RQ")]]=IIIlIIIlllIIlIIlIlII[#("fcM")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xI")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Uqe")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("3b")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{{721;225;520;722};"1 + 1 = 111";{160;889;470;152};}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("K5")]][IIIlIIIlllIIlIIlIlII[#("9j3")]]=IIIlIIIlllIIlIIlIlII[#("AvV7")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("KO")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("eCF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RD")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ueB")]][IIIlIIIlllIIlIIlIlII[#("b533")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9v")]]=IIIlIIIlllIIlIIlIlII[#("z2Q")];end;elseif IIlIIIIIIllIlIIIlllll==#("YPaNbR3hzmq5pNiECShtKhyr9CcTQiJS59V1bD1IOsxW9UdFPdoosu9RqTOKPkBpNJaq2rC81KQrUMrpyHdN4tAL9eLsZr3E1hjAUXNyMpySPR")then local IIlIIIIIIllIlIIIlllll;local IIlIlIlllI;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iG")]]=IIIlIIIlllIIlIIlIlII[#("ljl")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("Di")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("gDS")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("68")]]=IIIlIIIlllIIlIIlIlII[#("XMp")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("eJ")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("Cjj")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Gx")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("trh")]][IIIlIIIlllIIlIIlIlII[#("5KDS")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("TG")];IIlIIIIIIllIlIIIlllll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Soj")]];lIlIllIIlIIIllllIll[IIlIlIlllI+1]=IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIlIlIlllI]=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII[#("FFtI")]];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xq")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif IIlIIIIIIllIlIIIlllll<=#("PBzlhgYvsjAqYQjiJRlANC2FK4QaO5R5sh52BfVxdV0quHYRChZbDrumJ3LnBXRyCE8RVrSD5Zx1MLkdf8IHgPDaWStIFI6pdDY0Jh6kAvgN4DL7S")then if IIlIIIIIIllIlIIIlllll==#("hCokqXb74c7j8y3gXiWtF7cyhVJZgshvZ7AEb3lbZLn3npxSUXQCkycjz1dGnm1L4Mtb8zf37VF3Uij2y1esNQkC4pej0QXMUM8L5vTuSXFz2jAp")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LI")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LE2")]][IIIlIIIlllIIlIIlIlII[#("HPum")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{776;931;761;198};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("8Zt")]]=IIIlIIIlllIIlIIlIlII[#("Da0O")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{94;164;368;945};{752;710;970;756};}]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("B39")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bI")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mhv")]][IIIlIIIlllIIlIIlIlII[#{{164;959;106;700};"1 + 1 = 111";"1 + 1 = 111";{168;683;959;726};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("03")]][IIIlIIIlllIIlIIlIlII[#("5Wb")]]=IIIlIIIlllIIlIIlIlII[#("239h")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("X7")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("Vp1")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("akM")]][IIIlIIIlllIIlIIlIlII[#{{150;463;5;916};{617;423;817;98};{877;78;956;759};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("iRy")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Dd")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m7")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("pzX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BN")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rtQ")]][IIIlIIIlllIIlIIlIlII[#("klfO")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("8L9")]]=IIIlIIIlllIIlIIlIlII[#("GFRa")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kg")]]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("pRX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("N0")]]==IIIlIIIlllIIlIIlIlII[#("UaIF")])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("qjg")];end;else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qj")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("oof")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EE")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("M6Z")]][IIIlIIIlllIIlIIlIlII[#("aepZ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g3")]]=IIIlIIIlllIIlIIlIlII[#("m0y")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FK")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FDl")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("ko")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("ty3")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{864;219;698;973};{623;333;97;750};}]][IIIlIIIlllIIlIIlIlII[#("fGi")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vnWv")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("T2")]][IIIlIIIlllIIlIIlIlII[#("qcQ")]]=IIIlIIIlllIIlIIlIlII[#("MFlE")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iE")]][IIIlIIIlllIIlIIlIlII[#("yAm")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("R3mX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pR")]][IIIlIIIlllIIlIIlIlII[#("LIq")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("q5mV")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lP")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3k")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("E3s")]][IIIlIIIlllIIlIIlIlII[#("m2vI")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("He")]]=IIIlIIIlllIIlIIlIlII[#("mpt")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Y8")]]=IIIlIIIlllIIlIIlIlII[#("F92")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Df")]]=IIIlIIIlllIIlIIlIlII[#("pFU")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{83;473;492;358};}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("f5d")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{990;237;432;125};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("pGz")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2vF6")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6o")]]end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];do return end;end;elseif IIlIIIIIIllIlIIIlllll<=#("lixhI8oB2hTt5dq83ihjJ6bhTL0kVJU0YDPHAEmOUkcoaaWTnB9argiogpz7iePtx3FDzUJz6EAy4XgSZg7uJUIStABjfoGPFT2hFsuE1LeYQUutjQ")then local llIIllIlI;local IIlIIIIIIllIlIIIlllll;IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Oyi")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("73")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bi")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("mkG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("in")]]=IIIlIIIlllIIlIIlIlII[#("cHh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Z4")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ZM")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("na7")]][IIIlIIIlllIIlIIlIlII[#{{933;554;944;552};"1 + 1 = 111";{957;204;503;772};{938;725;373;552};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("nN")];llIIllIlI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{224;517;158;646};{971;583;940;150};{854;951;841;320};}]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=llIIllIlI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=llIIllIlI[IIIlIIIlllIIlIIlIlII[#{{699;423;69;159};"1 + 1 = 111";{811;88;529;660};"1 + 1 = 111";}]];elseif IIlIIIIIIllIlIIIlllll==#("bgtVMuWj8tzsR7U3k48mGWED8PUcKfgaAgEJk8pXTjvkCrx051jzkDMpN1W7KUJ3mz3LDlSmPlExAtaQs4hT5RZ7Fo5tlsm8KD7dyVxTi6U88o0t0fO")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ph")]]=(IIIlIIIlllIIlIIlIlII[#("ItT")]~=0);IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8q")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{{864;51;563;794};"1 + 1 = 111";{370;385;354;746};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AY")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("zWg")]][IIIlIIIlllIIlIIlIlII[#("asnN")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("vF")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("FGF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Qp")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hvK")]][IIIlIIIlllIIlIIlIlII[#("1YUn")]];else local IIlllIIllllI;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("J5")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Da0")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("iG")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yJG")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("f2Fq")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QQ")]]=IIIlIIIlllIIlIIlIlII[#{{274;473;411;968};{221;954;487;543};{162;168;966;215};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("WN")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("San")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0E")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ock")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{785;122;316;733};"1 + 1 = 111";{963;420;366;894};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("OH")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oiD")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("q9oA")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("jq")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("s8")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("BjR")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("lL")];IIlllIIllllI=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Gi3")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=IIlllIIllllI;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=IIlllIIllllI[IIIlIIIlllIIlIIlIlII[#("g5sU")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("iW")]]=IIIlIIIlllIIlIIlIlII[#("uD5")];end;elseif IIlIIIIIIllIlIIIlllll<=#("N07FK6goqybx9GX6v7sHIyK9708pzLEfOHvTGCDCPiDV5y9DC382Xhhoq8IT71ZQ36SCjdA4E11A5YeK1GYFNMrGzgDI4UEYsX19PHszEdy6pStC372BducrOmdc")then if IIlIIIIIIllIlIIIlllll<=#("29Uxdhi6f5tnzbJnvpQXaO61cV7UJuDEpYLdNJmLlGYcJnOsEer6xpKnd2urjyyUDZ7LAFKWdeMF04sYhOpFdGganyaVo4CXheKTqc39EG2rNfyjKGkFi2R6")then if IIlIIIIIIllIlIIIlllll<=#("6ycEZHiNYxVtJIfVqaHNZxi91kTU6OpyObtP0FP8UOZSMZa7fU12js3KpcNPYyRjhyQIoA4WvJ3kIAxbjVPmXxnvhUzX1ajv7PLojDTPZfGKzTb0QMFdTE")then if IIlIIIIIIllIlIIIlllll>#("UjuAFbg5uAHm3Yi2Rb9xR0O6zSJhoFgNEr1fZcoOSklk2GibIUYbTgP3GybWC9Q0s4TL7dcOXvPHPDe2KIKFRf3xM7JBbCmTEu17XHdFRjnyChnctim3A")then local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qj")]]=IIIlIIIlllIIlIIlIlII[#("EaS")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Yq")]]=IIIlIIIlllIIlIIlIlII[#("c0A")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hf")]]=IIIlIIIlllIIlIIlIlII[#("6Vo")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("n8")]]=IIIlIIIlllIIlIIlIlII[#("skk")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("jl")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{632;766;308;959};{188;442;806;767};}]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("LK")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("HKr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lS")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("2YI")]][IIIlIIIlllIIlIIlIlII[#("1kID")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8H")]]=IIIlIIIlllIIlIIlIlII[#("jDa")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tp")]]=IIIlIIIlllIIlIIlIlII[#("eQ0")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("O6")]]=IIIlIIIlllIIlIIlIlII[#("u5M")];else local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("MI")]lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](llIIllIlI(lIlIllIIlIIIllllIll,IIIlIIIlllIIlIIlIlII+1,IlIIIlIll))end;elseif IIlIIIIIIllIlIIIlllll>#("inbv9aEMNvj6dtMgfdEfYI1G5ETHg3osstmO6CIdbeH2nGe3BncjAuxKxGBFq6GTg1NTh8jNFAdTb9rzAZg20f386NqBacWeJXVx3uWDdzO9qNJxnbeC0N2")then do return lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("bG")]]end else local lIIlIIIllIlllllIlIlIllllI=IIIlIIIlllIIlIIlIlII[#("Gb")]local IIlIlIlllI={lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI](llIIllIlI(lIlIllIIlIIIllllIll,lIIlIIIllIlllllIlIlIllllI+1,IlIIIlIll))};local IllllIIllllllII=0;for IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI,IIIlIIIlllIIlIIlIlII[#("3PSg")]do IllllIIllllllII=IllllIIllllllII+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IIlIlIlllI[IllllIIllllllII];end end;elseif IIlIIIIIIllIlIIIlllll<=#{{146;226;464;7};"1 + 1 = 111";{160;986;232;945};"1 + 1 = 111";{786;303;875;747};{931;439;93;49};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{627;512;869;25};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{867;124;97;611};"1 + 1 = 111";{172;979;207;137};{22;504;109;402};"1 + 1 = 111";{462;941;728;858};"1 + 1 = 111";"1 + 1 = 111";{813;587;832;245};{902;895;96;963};"1 + 1 = 111";{442;359;59;520};{793;634;945;539};"1 + 1 = 111";{191;846;697;658};{442;529;944;516};"1 + 1 = 111";"1 + 1 = 111";{995;787;195;475};{420;73;271;554};{191;728;686;953};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{563;419;586;437};"1 + 1 = 111";{666;247;274;976};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{553;151;272;126};"1 + 1 = 111";"1 + 1 = 111";{783;894;294;728};"1 + 1 = 111";"1 + 1 = 111";{710;927;240;772};{606;47;413;196};"1 + 1 = 111";"1 + 1 = 111";{163;524;46;366};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{121;4;975;319};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{831;187;987;217};{141;756;482;91};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{317;989;677;884};{808;647;323;173};{776;925;438;19};{440;883;212;106};"1 + 1 = 111";{440;59;444;627};{553;888;806;670};{509;690;448;572};{768;692;551;600};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{531;602;656;701};{870;319;796;133};{70;555;942;791};{814;772;557;946};"1 + 1 = 111";{376;389;62;352};{897;254;926;731};"1 + 1 = 111";"1 + 1 = 111";{391;637;50;102};"1 + 1 = 111";{416;362;505;246};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{117;256;554;663};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{449;956;979;493};{24;693;299;669};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{500;12;39;832};"1 + 1 = 111";{653;690;555;823};}then if IIlIIIIIIllIlIIIlllll==#("j8C32SGJG6MPheoDqPXRZ0YBi7h8jPUfnsPpcVDMqV9Jbd4L5dffviGtkaU4KHz0lGCYA8BGmkAd0pAedHdfJPUeXufbaIbTvixFMfk6NK3kSCD5LQ1cEtqHW")then local IIlIIIIIIllIlIIIlllll;local IIlIlIlllI;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PH")]]=IIIlIIIlllIIlIIlIlII[#("Sht")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("B5")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("4mz")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Pj")]]=IIIlIIIlllIIlIIlIlII[#("7Yl")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("9L")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("xKb")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{201;960;602;268};{908;292;711;695};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SDx")]][IIIlIIIlllIIlIIlIlII[#("dLrc")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#{{910;581;206;229};"1 + 1 = 111";}];IIlIIIIIIllIlIIIlllll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rLm")]];lIlIllIIlIIIllllIll[IIlIlIlllI+1]=IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIlIlIlllI]=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII[#("deQ2")]];else local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QE")]]=IIIlIIIlllIIlIIlIlII[#("U9A")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{569;195;84;135};"1 + 1 = 111";}]]=IIIlIIIlllIIlIIlIlII[#("tHT")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lM")]]=IIIlIIIlllIIlIIlIlII[#("tRN")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ii")]]=IIIlIIIlllIIlIIlIlII[#("qMt")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("je")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Am1")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gH")]]=IIIlIIIlllIIlIIlIlII[#("qM2")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("GH")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("O65")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("QP")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Jyg")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("kO")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5Z5")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4M")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("WWb")]];end;elseif IIlIIIIIIllIlIIIlllll>#("ae3zFOjRRS24C8vgD9WKxv2kBuR9oc1ZTpfgdnfobbVVcQn3Qy1rVl9PmT7j7jCP0dkm2pco3HIuLhhUhYs1lKdHqA4up6r1Jf49GbaBuMzoOOeeLnci0LDp9O6")then local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("0q")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("f5f")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("10")]]=IIIlIIIlllIIlIIlIlII[#("7LN")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m6")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("jRY")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{760;318;224;840};{879;756;137;81};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("flbH")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1h")]]=IIIlIIIlllIIlIIlIlII[#("g58")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{{529;56;925;95};{243;177;200;103};}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("D3")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("M2Q")]][IIIlIIIlllIIlIIlIlII[#{{98;154;708;718};{943;219;613;871};{435;19;446;897};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3o")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("LGF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("a9")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Rz2")]][IIIlIIIlllIIlIIlIlII[#("5F93")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4I")]]=IIIlIIIlllIIlIIlIlII[#("lAp")];else if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Xr")]]==lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{914;789;552;193};"1 + 1 = 111";{9;617;368;745};{943;185;53;345};}]])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("GmH")];end;end;elseif IIlIIIIIIllIlIIIlllll<=#("uS86pRVFmiofY2GJlZ3MvZUc4ia8NPa1fIfNNC862K2D86u8e4ejUtgF86cgQX2IixaqW35T06TW7rd7Yc4SK0hVBKPRA2qfSutM6ell8vsXLuIQ2erO3j7rpoZlnot8")then if IIlIIIIIIllIlIIIlllll<=#("NeM7CbU0SUnItkgc8YuKMmIxcvRo97Tbth7p6TBdIYkzTU5eSjpB8ydBGp4ftF0Vamnlm1goyrbYcjNsBNH0Ssd6dHTQYuTd7zzHGT11dacRxoyxMMPR8adRjriQhA")then if IIlIIIIIIllIlIIIlllll==#("cJ71NUfWRVPWRpvJZixelPcf7vRyoLlUOKaizyVMH085sovBXSsHUvoxH24rdRHfK4hgpnkByUHvRgWT9pLGrO9svNMHEEJZs3uzgolKI2j9Y2QAflrXgaX54ZVNL")then local IIlIIIIIIllIlIIIlllll;local IIlllIIllllI;local IllIIIlIIlIlIllIlIll,llIllIlIlIlIlIIlIIl;local llllIIIIIlllllIIlIIlIl;local IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0R")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{949;430;194;414};{468;463;667;949};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Er")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Jbx")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("a3")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{636;504;837;52};{926;315;690;936};}]][IIIlIIIlllIIlIIlIlII[#("Zjg8")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("hm")];llllIIIIIlllllIIlIIlIl=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("YOZ")]];lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]=llllIIIIIlllllIIlIIlIl;lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=llllIIIIIlllllIIlIIlIl[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{107;807;755;549};"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("sZ")]IllIIIlIIlIlIllIlIll,llIllIlIlIlIlIIlIIl=llIllIIIll(lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1]))IlIIIlIll=llIllIlIlIlIlIIlIIl+IIlIIIIIIllIlIIIlllll-1 IIlllIIllllI=0;for IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll,IlIIIlIll do IIlllIIllllI=IIlllIIllllI+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IllIIIlIIlIlIllIlIll[IIlllIIllllI];end;IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("ff")]IllIIIlIIlIlIllIlIll={lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IlIIIlIll))};IIlllIIllllI=0;for IIIlIIIlllIIlIIlIlII=IIlIIIIIIllIlIIIlllll,IIIlIIIlllIIlIIlIlII[#("bpAk")]do IIlllIIllllI=IIlllIIllllI+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=IllIIIlIIlIlIllIlIll[IIlllIIllllI];end IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("pjf")];else lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ZB")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("glz")]]-lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("PjaC")]];end;elseif IIlIIIIIIllIlIIIlllll>#("74lScYVyMUea8AFaFD7mBslVTrfAErEJ834pXfZ2OSJITfcxA4trQzmPSB9VSv3uqFbeFpmzOfITTObNpS9J7l3KRpHxgejsYorod71kS5OL0E5eAvF9vuxeMCypS0r")then local IIlIIIIIIllIlIIIlllll;IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("k7")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Yk4")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{315;545;577;703};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("L2M")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ss")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("z5d")]][IIIlIIIlllIIlIIlIlII[#("Z1HW")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nF")]]=IIIlIIIlllIIlIIlIlII[#("jYv")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ta")]]=IIIlIIIlllIIlIIlIlII[#("iBZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jM")]]=IIIlIIIlllIIlIIlIlII[#("KbZ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("rC")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("Lcf")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{420;884;108;592};{228;239;829;144};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("he6")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{744;702;456;601};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("z7d")]][IIIlIIIlllIIlIIlIlII[#("ILy9")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rY")]]=IIIlIIIlllIIlIIlIlII[#("gcC")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("b8")]]=IIIlIIIlllIIlIIlIlII[#("j4C")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qQ")]]=IIIlIIIlllIIlIIlIlII[#("Kbd")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("0c")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("YFs")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xs")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("xFk")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("m4")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uxT")]][IIIlIIIlllIIlIIlIlII[#{{110;491;463;697};{263;866;965;845};{939;646;422;271};{654;627;72;240};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("u9")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WqX")]][IIIlIIIlllIIlIIlIlII[#("5fcE")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("i6")]][IIIlIIIlllIIlIIlIlII[#("95y")]]=IIIlIIIlllIIlIIlIlII[#("s1vX")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pH")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("U7D")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Sv")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9fU")]][IIIlIIIlllIIlIIlIlII[#("QfZP")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("98")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("J77")]][IIIlIIIlllIIlIIlIlII[#("WtJn")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("RB")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("9OI")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5l")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("WqV")]][IIIlIIIlllIIlIIlIlII[#("7Nuj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("hc")]]=IIIlIIIlllIIlIIlIlII[#("Xqd")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("Ps")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("g4")]][IIIlIIIlllIIlIIlIlII[#("s37")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("dunz")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AM")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("hh3")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uh")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("O1R")]][IIIlIIIlllIIlIIlIlII[#("8tQA")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uj")]]=IIIlIIIlllIIlIIlIlII[#("clQ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("9W")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("VEm")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0J")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("AjK")]][IIIlIIIlllIIlIIlIlII[#("KgHg")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("J1")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("SkI")]][IIIlIIIlllIIlIIlIlII[#("8GTD")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{85;858;473;175};}]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("kEz")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("fr")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("3SX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jn")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{213;747;255;423};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("DWSM")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("FD")]]=IIIlIIIlllIIlIIlIlII[#("ds5")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4i")]]=IIIlIIIlllIIlIIlIlII[#("7SJ")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0r")]]=IIIlIIIlllIIlIIlIlII[#("KEj")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("uO")]]=IIIlIIIlllIIlIIlIlII[#("dQu")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("zx")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("tYl")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("N6")]][IIIlIIIlllIIlIIlIlII[#("KlE")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("BESB")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("gq")]][IIIlIIIlllIIlIIlIlII[#("Dn7")]]=IIIlIIIlllIIlIIlIlII[#("sU38")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ag")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("zLj")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("EX")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5Vt")]][IIIlIIIlllIIlIIlIlII[#("8N7j")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ru")]]=IIIlIIIlllIIlIIlIlII[#("nCl")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ik")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{560;875;598;831};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("WZ")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("tfz")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("oe")]][IIIlIIIlllIIlIIlIlII[#("yOW")]]=IIIlIIIlllIIlIIlIlII[#("vAzx")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ya")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("OM1")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Kn")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ZVP")]][IIIlIIIlllIIlIIlIlII[#("PXDb")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("o4")]]=IIIlIIIlllIIlIIlIlII[#("Uol")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("LC")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("sd")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("toy")]][IIIlIIIlllIIlIIlIlII[#("C429")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DF")]][IIIlIIIlllIIlIIlIlII[#("vn5")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{406;314;674;380};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("lA")]][IIIlIIIlllIIlIIlIlII[#("Nlu")]]=IIIlIIIlllIIlIIlIlII[#("EMoN")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("yI")]][IIIlIIIlllIIlIIlIlII[#("dWZ")]]=IIIlIIIlllIIlIIlIlII[#{{938;4;686;39};"1 + 1 = 111";"1 + 1 = 111";{374;347;104;799};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Am")]][IIIlIIIlllIIlIIlIlII[#("ZT6")]]=IIIlIIIlllIIlIIlIlII[#("uJJh")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5N")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("Y0p")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Lz")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("4Cr")]][IIIlIIIlllIIlIIlIlII[#("cxvY")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Vs")]]=IIIlIIIlllIIlIIlIlII[#("XDp")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mA")]]=IIIlIIIlllIIlIIlIlII[#("Vix")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("pp")]]=IIIlIIIlllIIlIIlIlII[#{{375;286;580;634};"1 + 1 = 111";{124;779;870;404};}];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("5R")]]=IIIlIIIlllIIlIIlIlII[#("S4Q")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("9Z")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](llIIllIlI(lIlIllIIlIIIllllIll,IIlIIIIIIllIlIIIlllll+1,IIIlIIIlllIIlIIlIlII[#("rnZ")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6s")]][IIIlIIIlllIIlIIlIlII[#{{657;679;900;436};"1 + 1 = 111";{459;972;444;170};}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("ObQf")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tc")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("rA")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8ex")]][IIIlIIIlllIIlIIlIlII[#("y136")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("tk")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("6De")]][IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{268;837;176;621};{218;149;885;822};{724;557;730;394};}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{62;776;675;929};"1 + 1 = 111";}]][IIIlIIIlllIIlIIlIlII[#("682")]]=IIIlIIIlllIIlIIlIlII[#("UkWv")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("W9")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("AUQ")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("1Vc")]][IIIlIIIlllIIlIIlIlII[#("DoOX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Sq")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("jXb")]][IIIlIIIlllIIlIIlIlII[#{{350;750;492;765};"1 + 1 = 111";{298;383;660;8};"1 + 1 = 111";}]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{403;697;508;211};}]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("NoG")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("DD")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Jod")]][IIIlIIIlllIIlIIlIlII[#("5qXF")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("eA")]]=IIIlIIIlllIIlIIlIlII[#("83g")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIIIIIIllIlIIIlllll=IIIlIIIlllIIlIIlIlII[#("x9")]lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll]=lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll](lIlIllIIlIIIllllIll[IIlIIIIIIllIlIIIlllll+1])IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("mr")]][IIIlIIIlllIIlIIlIlII[#("T8n")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("D5jr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("nD")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("ZGH")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("W3")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("u4N")]][IIIlIIIlllIIlIIlIlII[#("8sLX")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("3H")]]=IIIlIIIlllIIlIIlIlII[#("Mlj")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Ki")]]=IIlIlIlllI[IIIlIIIlllIIlIIlIlII[#("zpt")]];else local IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII[#("YG")]local lIIlIIIllIlllllIlIlIllllI,IllllIIllllllII=llIllIIIll(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII](lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII+1]))IlIIIlIll=IllllIIllllllII+IIIlIIIlllIIlIIlIlII-1 local IllllIIllllllII=0;for IIIlIIIlllIIlIIlIlII=IIIlIIIlllIIlIIlIlII,IlIIIlIll do IllllIIllllllII=IllllIIllllllII+1;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII]=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];end;end;elseif IIlIIIIIIllIlIIIlllll<=#("5p5FvXKs1Z1bHsTmuD6VKj6E1mMMJMC1NfPLJASNWmiHDuHtTk5p3H9WsBOjk8Tox9zCNhO4Us9xazaGQs3zRl7gf2shWJDXE4kD6eQLHaGLIMW3BhD2fuIkbrxVZHhl0l")then if IIlIIIIIIllIlIIIlllll>#("goIKLMr2QQxJDgzRPfLSiv9BOS5V93tUvTPO2I1pXC1FPT3OA0CfpEUUpg53RG2WvMmUBUYhnu4RFFW4YqvjBnF285zVM8JqKeicGjnQbu24JdoVuafAkTvihuVFvcFpW")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("xo")]]=IIIlIIIlllIIlIIlIlII[#("cQq")];else local IIlIIIIIIllIlIIIlllll;local IIlIlIlllI;lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{"1 + 1 = 111";{897;589;463;243};}]]=IIIlIIIlllIIlIIlIlII[#("7KL")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("EZ")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("4I6")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mo")]]=IIIlIIIlllIIlIIlIlII[#("Nc8")];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("Mv")]lIlIllIIlIIIllllIll[IIlIlIlllI]=lIlIllIIlIIIllllIll[IIlIlIlllI](llIIllIlI(lIlIllIIlIIIllllIll,IIlIlIlllI+1,IIIlIIIlllIIlIIlIlII[#("IWe")]))IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("8J")]]=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("qTv")]][IIIlIIIlllIIlIIlIlII[#("sSNr")]];IllllIIllllllII=IllllIIllllllII+1;IIIlIIIlllIIlIIlIlII=lIIlIIIllIlllllIlIlIllllI[IllllIIllllllII];IIlIlIlllI=IIIlIIIlllIIlIIlIlII[#("Rp")];IIlIIIIIIllIlIIIlllll=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("Mt3")]];lIlIllIIlIIIllllIll[IIlIlIlllI+1]=IIlIIIIIIllIlIIIlllll;lIlIllIIlIIIllllIll[IIlIlIlllI]=IIlIIIIIIllIlIIIlllll[IIIlIIIlllIIlIIlIlII[#{{933;314;848;85};"1 + 1 = 111";{586;730;519;861};{773;394;728;158};}]];end;elseif IIlIIIIIIllIlIIIlllll<=#("gAvTzPdPhgvKs5QNBM3ig1Ta5lySt80Mi56ZzLMAxFLpWHb0ZTM2xNHpRvYnqvvjpTCy81nZ9DWLqEnyjH3Lx7pFyRidXzjajB9cfO27FX33169mhAdTDVXsD69rTkbLtVC")then if(lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#{{281;237;730;513};{94;976;912;706};}]]==IIIlIIIlllIIlIIlIlII[#("zx2f")])then IllllIIllllllII=IllllIIllllllII+1;else IllllIIllllllII=IIIlIIIlllIIlIIlIlII[#("fG4")];end;elseif IIlIIIIIIllIlIIIlllll==#("EksGP5fJevNCS55yuAIzORKiOLouVrKgFjT6gIeHPnngsIJXoOp3mclXLk1eQVXWWH7Im8rWvaTADDZfbCfhbQ4C85v6Q913BCuWLbLqvEIlsVuiuVdoPPUfNGKqNugvj09b")then lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("0L")]]();else local lIIlIIIllIlllllIlIlIllllI=IIIlIIIlllIIlIIlIlII[#("m2")];local IllllIIllllllII=lIlIllIIlIIIllllIll[IIIlIIIlllIIlIIlIlII[#("K5K")]];lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI+1]=IllllIIllllllII;lIlIllIIlIIIllllIll[lIIlIIIllIlllllIlIlIllllI]=IllllIIllllllII[IIIlIIIlllIIlIIlIlII[#("chR7")]];end;IllllIIllllllII=IllllIIllllllII+1;end;end);end;return IllIIIlIIlIlIllIlIll(true,{},lIIlIIIIIIIllI())();end)(string.byte,table.insert,setmetatable);

%d bloggers like this: