Roblox Mineshaft Tycoon Script AutoSell AutoMine

Roblox Mineshaft Tycoon Script AutoSell AutoMine

Script by Beam V1

--[[
Mining Gui
]]
return(function(Mining_lllllIllIlIIllIlIIlIlIlI,Mining_lIIllIIIllIlII,Mining_IIIlllIIlIllIllIlllIIl)local Mining_IIlIlIIlllII=string.char;local Mining_IllIlIIIlIIII=string.sub;local Mining_IllIIIlIIIIIllIIlllIII=table.concat;local Mining_IlIlllII=math.ldexp;local Mining_IIlIlIIIll=getfenv or function()return _ENV end;local Mining_IllIlIIlllllI=select;local Mining_lIIlIIIIIlIIIIIlI=unpack or table.unpack;local Mining_IIIIIlllIIlIlI=tonumber;local function Mining_IIllIIIIIlIlIlllIllIlI(Mining_lllllIllIlIIllIlIIlIlIlI)local Mining_lIllIIlIIlIIIl,Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIIIIIlIIIIIlI="","",{}local Mining_llIIlllIIIIIIllllIlI=256;local Mining_lIIlIlIIIIlIIIlIIIIlIl={}for Mining_llIllIllIIlIlIIIIlIl=0,Mining_llIIlllIIIIIIllllIlI-1 do Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl]=Mining_IIlIlIIlllII(Mining_llIllIllIIlIlIIIIlIl)end;local Mining_llIllIllIIlIlIIIIlIl=1;local function Mining_lIllIIllIIIlllIIIIllIIlII()local Mining_lIllIIlIIlIIIl=Mining_IIIIIlllIIlIlI(Mining_IllIlIIIlIIII(Mining_lllllIllIlIIllIlIIlIlIlI,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl),36)Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+1;local Mining_lIlIlIIIIIlllllIlllII=Mining_IIIIIlllIIlIlI(Mining_IllIlIIIlIIII(Mining_lllllIllIlIIllIlIIlIlIlI,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl+Mining_lIllIIlIIlIIIl-1),36)Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+Mining_lIllIIlIIlIIIl;return Mining_lIlIlIIIIIlllllIlllII end;Mining_lIllIIlIIlIIIl=Mining_IIlIlIIlllII(Mining_lIllIIllIIIlllIIIIllIIlII())Mining_lIIlIIIIIlIIIIIlI[1]=Mining_lIllIIlIIlIIIl;while Mining_llIllIllIIlIlIIIIlIl<#Mining_lllllIllIlIIllIlIIlIlIlI do local Mining_llIllIllIIlIlIIIIlIl=Mining_lIllIIllIIIlllIIIIllIIlII()if Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl]then Mining_lIlIlIIIIIlllllIlllII=Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl]else Mining_lIlIlIIIIIlllllIlllII=Mining_lIllIIlIIlIIIl..Mining_IllIlIIIlIIII(Mining_lIllIIlIIlIIIl,1,1)end;Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIIlllIIIIIIllllIlI]=Mining_lIllIIlIIlIIIl..Mining_IllIlIIIlIIII(Mining_lIlIlIIIIIlllllIlllII,1,1)Mining_lIIlIIIIIlIIIIIlI[#Mining_lIIlIIIIIlIIIIIlI+1],Mining_lIllIIlIIlIIIl,Mining_llIIlllIIIIIIllllIlI=Mining_lIlIlIIIIIlllllIlllII,Mining_lIlIlIIIIIlllllIlllII,Mining_llIIlllIIIIIIllllIlI+1 end;return table.concat(Mining_lIIlIIIIIlIIIIIlI)end;local Mining_lIllIIllIIIlllIIIIllIIlII=Mining_IIllIIIIIlIlIlllIllIlI('21621U27521V22227521U1B21821D21I1Z2181X21321V21T27921821321H21V2232791H1X21C2132132181521J21721V21Z2791421C1Z21B27I27Q2751M21321M21I1E1Z1W21321A21V21W28321921A21221321C21V2202791N1B1528521221727W21I28S27928B28D1021J21I21I21921821V21Y2791C28627I28T2751121928N27Y2171E28N28K2791I1Z27U21829229E27521129H21V21X29T21A1Z21N28Q21D21V22127929Q1X1Z21A1I2A62A828R2262791L1Z21721I1421921C1121621728O27P2A52A728Q29O21V2AM29K27U28Z21I21D27S27W27I22A279101Z1X21521121C21921J21821229L21A2AT23529S29K28N2BS2A32792102BL21B1G151027K27921U24I219122B42BF2AT28P2AU2BW21C2352C62C723D122CK279172CN2C721U25E182CB2252CD21C2CF1H21721K2131I21721M28I2CO2C727729T21921D2AQ21729B28128U1621721B2342D9122102CR2CS22I2CB29Z21U2D12D32D925E1T2DR27921E21E2CB2272942AQ21A21323C112B72AQ21D2DO1R2E227525E2172CB22C2BF2BH2BJ2BL2BN2121M28527C21E29V27W1X21N21T2352F42F524123H21T25Z2552321225022V21923H29D28M29X2FI2751721821J21B21V2242791521921I2162861H21321B2171W28N2122FL21U2952922A42B62132B82AA29J2G728C21I2BQ2BS2D91Y21A2CB27828A2GH2DX2132D921U2372GO2792371H1M1E131R171G2GU1I2EJ2CT1S2H926A2GN2DZ1B2H925E1G2H91Y2EM21T26K22C24Z21U23L2362722F824123M21V23M23M24023R2F82CS25E1Q2GX2GB1Z29A21C23C2DO21B2H923M2152H921U2FC2AB27R21B2AG21A22Q1E21727M2AA21V2GY2DO1J2II2HG2DZ2142II24I2F821025A1P2592391326X2I32CS24Y2FH21S2791D1921T23Z21B21O26A23B26L2462JD27925E1C2CB2GF1H2BM21C27H1H27F2AA22I29421621322Q2ED2132I92AT22Q1B21D22Q102KC21B22P23E23A23923B2932GQ28D27S2AG2GC21S27J2CS21U23A2CB2AC2KS21I1L2852E42GC2DI2BV2BR28R2E72LB2AT2FZ21F21J2F027I22F2792GJ21C2LH2LJ27G2131921321N21E2192IS21I2D923M2HJ2M11K2II1Z2JX2791F131B1C1M1H11171C1721T24G22C25427121022O25W2F81Q24B24H26525225W25D2F826W21D26G26522U1B25C27021T1N21Y2J425025J2132712GU23J2CB2GA2DW27T21721E2B92DB275132982191F2IS2GT24726Z234122MF26G2F824B26P2221322K21A23L2JT2791U2II132I721U2NS29A2FZ21A21A21T21A24A22724I23X21O2452FH28921U1X2AT2BM21I2NW2G621H2L721V22B2M92BM21D21329729929B2371121A2172BI2BY2752OZ21827M1X21I2242JH21U22823A2792IV27522Q2KZ2JH22827621U2GU2752JH2Q22Q42PY21U2Q021U2IV2IV2Q921U2JH2DV2PX2QI2QM2Q32QM2QB2QD2Q82QN27527K2822CS2QS2QH27K2QQ2QU2Q52QT21U29E2QW2C727K2QS2QO29E2R12R52RE2QH28228L2CS29E2RA2752822RD2822822QH28L2QK2RM2QM2RR2QE2792QD28L28L2QH2A42R72792S12R42A42RD2A42A42QH2782NK2792SB2R42782RD2782782QH27Q2RT21U2SL2R427Q2RD27Q27Q2QH28T2SE2752SV2R428T2RD28T28T2QH2AC2RI2C72T52R42AC2RD2AC2AC2QH2AM2SO2TF2R42AM2RD2AM2AM2QH2E72S42752TO2R42E72RD2E72E72QH2FS2GP2C72TY2R42FS2RD2FS2FS2QH2CX2U12792U82QM2362C727Q28T2QO2CX2B52QC2752CX2CX2E72QD2UO21U2FS2UR21U2US2QO2P82BE2CS2CX2P82JH2V02752AC2CX2UF2RX27Q2UZ2Q42L32PU2UN21U2292RY2VG2CX22E2VF21U2BE2LM2752UY21U2VQ2VN2Q32VU2792CX2Q32V42Q42Q32VZ2VG2VI2PZ2VK21U2VM2QO2BE22D2792281621U2P82K62VR22W2VF22J2KZ2W42W12RX2EO2V82Q422G21U22H2VN2CX22N2VJ2UW2X22QH2BE2WX2VR2752P822K2WE2X72X62VN2VI22L2WO2VH2QM2V02IV22M2X22UJ21U2X02W72X22CX2X42WW2XB2WH21U22R2XW2Q32XD2QO2VI22O2XH2VI2WQ2IV2Q02WT2QM27Q22P2VO2Q721U2TC2WY2XI2XR2US2WA2752BE2WN2X72XX22U2Y021U22V2XH2W02YF2QT2YB2JH22S21U22T21U2V92JH2WV2WX2XO2XQ2UM2XS2R42X52XW2P82Y22X722Y2XW2VI2XD2VY2XI2WQ2JH2XM2W42X22ZC2UV2XT2VN2ZG2YR2P82XZ2YR2Y12ZM21U2WD2V12ZQ2YZ2JH2YA2YJ2WL2YL2X222Z2ZD2US22X310B21U310I2Z12IJ21U2332YJ2W6310J2X22YN2YF2312ZH21U310Z310431112YX2XJ2YG2302X22Z72Z62GV311B2R327Q2342YZ27K2YI2XO310U2ZX2W92ZZ21U23531102PW311323B31152WQ27K2W3311D27K2Z32Z5311K2X12YM311O23831102392YU23E311V311H21U2WS2YJ2ZW2W82XU23F2WE2WG2ZI2WE2YT2Q323C31062ZO2W531162R32ZT312G31242X3311O2ZJ2XX23D2YU31322VI31082C72CX2Y7312D310D2XO310F310V2CX310I311M310L2V027K310O311Z310Q23I310T312Z2VL311O23J3110313V311323G312C313L21U31182YB27K2UF23H311D29E27Q122YZ29E2YI2V928227Q132YZ2822AC29E3123310G313T2WB21U103110112YU2WG31092YY2V0282311Y314F21U2Z317311D2822Z9312Y314O2ZF2XV3101315C2VV21U14312S2Y6312V282312X2ZB313S315B313231023135310615315J2WQ282310D2V928L27Q1A2YZ28L311J312U315A310X2VP31102VU2QO2VW314027528L3151316F315321U315U315N315A312J311031322Q31B315I3109313B2V028L315M2VG312H2ZE2XU315Q21U31343113313621U18315V31632UM2VZ2782CX313F311M313I2W819317B313N315Z310Q1E313R3167313U313W2YU313Z279311G2WP2VO2EO28L3143311D28L1F21U1C3183311B1D31881I31862YJ1G315O2PT2YO2RX315D1H2X12P82V3315F2Y2318L2VI311L3147318S311N2QO2VM2YQ2VN2LM1M2XW2EO313X2C72VI2EO2CS2P82YG316C2DW2X12Q32YY2Y3316K2XW2VM311L31922VM319N2PU316D1N319321U1K2XW2WD311U2CS2VM31382XW2KZ2V52PY2P82ZY2V423221U2A41J2X22V02A4314E27527827Q1L2YZ2782VE314N313G318W318I316B2X82VT2YU2VX2VG314Y2K6278311Y228314U313A315O3168310731102WJ315F318Z2ZP314Y31AG312E311931BD3158316M31AO2Q22WG2BE1Q2WE28T312N31131R316T3139310A2V0278316Y2ZV318G313131103103318P312L2XI2Y52791O2X2316V31BD313D2VG318F316N2C72BE2QB2VS318L2XR318N2R431052YR318V2XR318V2WA2WG318Y2WE316S3191319S319527931972KZ319A31CO319D2XR319F2R42VI315U2YR319K2X1319O310X2LM319R2VR2WG2EO319U31DK31B6319X2753187319Z2C72UF2QO2C7311U31A331AS31A62VO2Y527Q31AB2CX2V027Q2AC2782V928T314A2YZ28T31E9311D2AC314H2YZ2TE21U2UI316631AO31B5314S315D314U3113314W31BU31BC2YH2VF2YB2AC315431EH21U31BH316Z31C0314Q31C9315D316Q315G31BT2ZP31CB31EY31BY2WZ31F7318I317331C3319C317731DC31BU31FF2AC315Y2TS21U2YD2YZ2AM31EG31AN311M31B5318Z2VS2YT31132YW314X312V2AM316H21U2AM3121311D2AM31F531BZ31CG314Q317331FB1P31FD312U2WQ2AM31FH2XP31FJ2YF31FL315S31CQ21U1U317A2V02AM31CD2X2317G2W8317I2ZE313K31FU317M31FU31A81V317Q31EP311O31122VN2P831HJ319C31HJ31BB31G9314231BF31GC311B237311D2E727Q1S2YZ2E731FZ31EO31G1311O31ER31HK2L02YU31DQ31HP2WQ2E731B0318L31B32PZ31853125314Q3127315D31293113312B31G831IC31BE2ZU31FI31GJ318I1T316P2YU1Y31GO31CA312V2E731GS31702US317231101Z31GX2XE21U1W31H12752UQ2XN2VG31H62ZE31H8310K31I0310N31HS2E731A831HZ31G02W831B531952VS31JX2X7317V31EW31J331HR2YB2E73146311D2FS27Q1X2YZ2FS31I231J2317R314Q31I62VS311S315F31IA31AW312V2FS31B031I331JV31263128312A316E2UT31IS315931BJ311O31IX31FA2YU21231J131B32WQ2FS31J531GU310031I731JA3176310631JE316U31KO317C310E315O31JM2X231HA31KX31HC31KX31A831KB31JU2ZE31JW317T313Y31KW2FS31822V92FS31K721W2VM2CX2QA275312R2Q42VR31292BE2132X12BE2BE2102C731A531A22RV31CH2RX2IV31M62YF2QF318J31MB2SP2WE31292P831MG31CM2XX31MK2XB2V5279318O318H2XX31MU22Q31922P82E72112QC2Q031CN27421S31GN313B279313Q2P82VI2Y931ND31KX31NG22Q31NI2XX31NK31NM2R331NO2XX31NR27531952QB2RE2752GF2NQ27A27C27E2LS2KY27527M27O2VE2AE2AG27S21C2NN29Y2792A12872KR316K21321I2FZ21C21G2PJ2BD28U2PB21C27B21E29831OY31P027H2BU21U29U29W2922GF31P62982KJ2A129C2NK29L2PO2132PQ2CC27531PI2GI2FX2182112GC31G52PU31FP2RD2C72QH2IV2GU31N92Q12R42IV2DV2QD31MU31502R22T82QL2R92ZD318H2SE27K2T831MS2NK31Q631MA2792S431MW31N931MW2T831NC31MX2JH27831NW31MX31AH21U31MS2T22RX29Z31MW2CO31MW31QU2S52C731QV2C7313Q27831R831QZ2SQ28T31R32SK31FV31R62VM2TA31MU21U31MW2QK31RJ31EM2RX31RM2RX31RO2Q031RQ27Q31R72R331QR31RW2792QK31RB31RG2SF31RI31MX31R821U31O62C72DV31QQ2U11I2DD2DF2DH2R71N2DK2DM31OG21U31OI21V2QB1Q2LA2NL2KV31PC1D2102102PB2922QB1R318Z22Q31BS2QB31O731Q82QL2QG31Q4318J2VN31QJ2XR27K31TS31SM2QM2XR29E31TX2ZD31TY2S42RQ2X12RP2RE2QD31U428L2RZ31R92C731U72C72S62XR2S031A92ZD31UG2S42SG2XR2SA31UH2QD31UN31U831BD2IV2SE31UN2UB27K2SG2V02JH31SA2DA2QL31SG2762LE21U1N31P431PU1M2LW27I2DV2FN2FP31PS21U1F2PA2PC29829A21823731T41M2BM1X21631OB31SQ2DE2P22DH31PN31PW31PY2G531PN29B2PP21I2WV2PZ310I31TI2VN2QS2XR2QS2Y92YG2JH31QN2Q42TL2QM21Y318H31WL31QZ31WB228318L31WD2QC319231WF31WV31MO29E21W314I2IV2WN31TM31WN27931X42FM31MQ2C7318A31O72ZD2QB2S431RV31V22CK31QD2RX31XG31TV31XE31RF31XK31UT31RS31O12RX2PT31MW2CS31V62CS313Q31QR2PY31SL2762QB2CK2FR31P328Q31PU1H27E21I31VD2CP2FO2FQ2CK2FN2122VE21U2XG2KZ2QD31V22QO31TM2XR31MU31WG31XA31WJ2792SI31R9318H31YZ31X631O9318J31552KZ317431V331O531Z92RJ2PX31V631V831Y921831P721I31VB21E31YE2FM31YG21V31V631VJ21J2PB31VJ21G2G029131VQ31VS2162FS31W931TO2IV2QO31WU2QR2QP31QK2QM31YX2IV31WL2QJ31WO31S1319231WR31WT31XN31QZ31WX320L31WM31R631X221U2TV31WM318H320S31Z831Z731Y331TO2CS31YL312K31XD31X127931R831QB318H31SJ321231TO21W2SS31UH31MU31Z3321E2R53218318J321A31N931YS2C7317P31TM31Y231Z931O731OA2U127B27D27F31PB2CK31T031OK2192AF21A31ON31OP2G631OS29I2FT31OW31P931P121V2V531ZF31P531ZH31P828Q31PA27I2T831PE31ZX31PH322J21I31PK27F2PL21U31PO31W631VH31PU2AV27F31W231Q022831Q22X131TN31YR31XT27931TK31TN31Q531O831XO2IV31QF2R331QH2Q431QJ320727531QM31R62S52VM31QQ31O131RD31SF2YG27931QX2RY31922SQ31R231S531MX31S731RT31XA31RA27931RC31QT323X323R323Z323C31SH31RK320G31R031S031RP324631XS31RU31MV31SC324I31S031NS31MX2IV31S431R431RR31S82R0323V324S324G2R2325531UH31O2324J321R31MC27531SN2PX31SP31SR31VY29C31SU31SW23431SY31T031T231T42KU2EA31T731T931TB31T127931TE2RY31TH31ZB323D31XA31N931V02XW31TQ2ZD31TT2CO2RK2X131TY29E2QD31U031UB320K2RU282326E326J323R31U931QB326H2RH31UD326I323R28L2A431U928L31UK326T31UN326W323P31UH31UR324W325832732A431UW31UH2ZR2RX2GU31WB31V42QE31ZE31V9322S31ZK31ZM21U31VF2FQ2UL31ZR2PB2PD31VN31VP2R731VR21J31VT31VV325H2DG31PM2LN31W12L931W431PP2PQ2XM2PZ317K31WR31WH2X1320M328E320B321H320E31SG32172UC324K320I31MO2PZ31WW3208320N2QJ31R62WX2IV2U5320T328N328M275328X31X931XH21U31XC2CS31XK2RU31TL2KZ31V131XQ21U31XM318H329A326N31M92A431MS31Y631TV31XW2U231Z721U31Y031S931ZA325C325W32562QE320131V7327J31ZI31YB2I9327M327O31SY31YJ2GF314R31Z731YP2QL323A329I31M931YV31MU31YX2SZ3249318H321D327N329S3175320Z320Y31ZC31V531Y8322I31ZI327L2G632A831ZQ31VK31ZU31ZW2FK327W31ZZ2V522Q328C32AF328E31WE328T328H324F31XR31X531QL31Z0329131WY328P3206328S3265328U2RE21W3294328Z328K275328Z321G2CX2PY32AS2CS320Y31XD32152C7321A31UD314I32AM321F32AO321K31XA316F310Z2IV32AP321I27932AP321L31V231TK321P320831SK321S31TU2762GF2BR1Z21227D31OO31PX32282A22NK1A29921E1531OW21V31C321632D921D23C2312312EY27D2131W2IS2302OZ21B23128521H23127W21B21521N1Q23B1M2OX2282VU31CJ2Q432AH31YW31TP323G324S32C7326P329S31XN329C2CS32C7325D2PX32CY21932D032D22IS21132D531OT32D732D932DB29232DE32DG32DI32DK1Z32DM32DO21832DQ21932DS32DU2311Z2151M2101O1Z1I1532E432E62XW321N329F311X2R22SO2RC329D32EC31Q932EJ320Z325C2CS');local Mining_llIllIllIIlIlIIIIlIl=(bit or bit32);local Mining_llIIlllIIIIIIllllIlI=Mining_llIllIllIIlIlIIIIlIl and Mining_llIllIllIIlIlIIIIlIl.bxor or function(Mining_llIllIllIIlIlIIIIlIl,Mining_lIllIIlIIlIIIl)local Mining_lIlIlIIIIIlllllIlllII,Mining_llIIlllIIIIIIllllIlI,Mining_IllIlIIIlIIII=1,0,10 while Mining_llIllIllIIlIlIIIIlIl>0 and Mining_lIllIIlIIlIIIl>0 do local Mining_IllIlIIIlIIII,Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl%2,Mining_lIllIIlIIlIIIl%2 if Mining_IllIlIIIlIIII~=Mining_lIIlIlIIIIlIIIlIIIIlIl then Mining_llIIlllIIIIIIllllIlI=Mining_llIIlllIIIIIIllllIlI+Mining_lIlIlIIIIIlllllIlllII end Mining_llIllIllIIlIlIIIIlIl,Mining_lIllIIlIIlIIIl,Mining_lIlIlIIIIIlllllIlllII=(Mining_llIllIllIIlIlIIIIlIl-Mining_IllIlIIIlIIII)/2,(Mining_lIllIIlIIlIIIl-Mining_lIIlIlIIIIlIIIlIIIIlIl)/2,Mining_lIlIlIIIIIlllllIlllII*2 end if Mining_llIllIllIIlIlIIIIlIl<Mining_lIllIIlIIlIIIl then Mining_llIllIllIIlIlIIIIlIl=Mining_lIllIIlIIlIIIl end while Mining_llIllIllIIlIlIIIIlIl>0 do local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl%2 if Mining_lIllIIlIIlIIIl>0 then Mining_llIIlllIIIIIIllllIlI=Mining_llIIlllIIIIIIllllIlI+Mining_lIlIlIIIIIlllllIlllII end Mining_llIllIllIIlIlIIIIlIl,Mining_lIlIlIIIIIlllllIlllII=(Mining_llIllIllIIlIlIIIIlIl-Mining_lIllIIlIIlIIIl)/2,Mining_lIlIlIIIIIlllllIlllII*2 end return Mining_llIIlllIIIIIIllllIlI end local function Mining_lIlIlIIIIIlllllIlllII(Mining_lIllIIlIIlIIIl,Mining_llIllIllIIlIlIIIIlIl,Mining_lIlIlIIIIIlllllIlllII)if Mining_lIlIlIIIIIlllllIlllII then local Mining_llIllIllIIlIlIIIIlIl=(Mining_lIllIIlIIlIIIl/2^(Mining_llIllIllIIlIlIIIIlIl-1))%2^((Mining_lIlIlIIIIIlllllIlllII-1)-(Mining_llIllIllIIlIlIIIIlIl-1)+1);return Mining_llIllIllIIlIlIIIIlIl-Mining_llIllIllIIlIlIIIIlIl%1;else local Mining_llIllIllIIlIlIIIIlIl=2^(Mining_llIllIllIIlIlIIIIlIl-1);return(Mining_lIllIIlIIlIIIl%(Mining_llIllIllIIlIlIIIIlIl+Mining_llIllIllIIlIlIIIIlIl)>=Mining_llIllIllIIlIlIIIIlIl)and 1 or 0;end;end;local Mining_llIllIllIIlIlIIIIlIl=1;local function Mining_lIllIIlIIlIIIl()local Mining_IllIlIIIlIIII,Mining_lIIlIlIIIIlIIIlIIIIlIl,Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl=Mining_lllllIllIlIIllIlIIlIlIlI(Mining_lIllIIllIIIlllIIIIllIIlII,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl+3);Mining_IllIlIIIlIIII=Mining_llIIlllIIIIIIllllIlI(Mining_IllIlIIIlIIII,66)Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI(Mining_lIIlIlIIIIlIIIlIIIIlIl,66)Mining_lIlIlIIIIIlllllIlllII=Mining_llIIlllIIIIIIllllIlI(Mining_lIlIlIIIIIlllllIlllII,66)Mining_lIllIIlIIlIIIl=Mining_llIIlllIIIIIIllllIlI(Mining_lIllIIlIIlIIIl,66)Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+4;return(Mining_lIllIIlIIlIIIl*16777216)+(Mining_lIlIlIIIIIlllllIlllII*65536)+(Mining_lIIlIlIIIIlIIIlIIIIlIl*256)+Mining_IllIlIIIlIIII;end;local function Mining_IIIIIlllIIlIlI()local Mining_lIllIIlIIlIIIl=Mining_llIIlllIIIIIIllllIlI(Mining_lllllIllIlIIllIlIIlIlIlI(Mining_lIllIIllIIIlllIIIIllIIlII,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl),66);Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+1;return Mining_lIllIIlIIlIIIl;end;local function Mining_lIIlIlIIIIlIIIlIIIIlIl()local Mining_lIllIIlIIlIIIl,Mining_lIlIlIIIIIlllllIlllII=Mining_lllllIllIlIIllIlIIlIlIlI(Mining_lIllIIllIIIlllIIIIllIIlII,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl+2);Mining_lIllIIlIIlIIIl=Mining_llIIlllIIIIIIllllIlI(Mining_lIllIIlIIlIIIl,66)Mining_lIlIlIIIIIlllllIlllII=Mining_llIIlllIIIIIIllllIlI(Mining_lIlIlIIIIIlllllIlllII,66)Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+2;return(Mining_lIlIlIIIIIlllllIlllII*256)+Mining_lIllIIlIIlIIIl;end;local function Mining_IIllIIIIIlIlIlllIllIlI()local Mining_llIIlllIIIIIIllllIlI=Mining_lIllIIlIIlIIIl();local Mining_llIllIllIIlIlIIIIlIl=Mining_lIllIIlIIlIIIl();local Mining_IllIlIIIlIIII=1;local Mining_llIIlllIIIIIIllllIlI=(Mining_lIlIlIIIIIlllllIlllII(Mining_llIllIllIIlIlIIIIlIl,1,20)*(2^32))+Mining_llIIlllIIIIIIllllIlI;local Mining_lIllIIlIIlIIIl=Mining_lIlIlIIIIIlllllIlllII(Mining_llIllIllIIlIlIIIIlIl,21,31);local Mining_llIllIllIIlIlIIIIlIl=((-1)^Mining_lIlIlIIIIIlllllIlllII(Mining_llIllIllIIlIlIIIIlIl,32));if(Mining_lIllIIlIIlIIIl==0)then if(Mining_llIIlllIIIIIIllllIlI==0)then return Mining_llIllIllIIlIlIIIIlIl*0;else Mining_lIllIIlIIlIIIl=1;Mining_IllIlIIIlIIII=0;end;elseif(Mining_lIllIIlIIlIIIl==2047)then return(Mining_llIIlllIIIIIIllllIlI==0)and(Mining_llIllIllIIlIlIIIIlIl*(1/0))or(Mining_llIllIllIIlIlIIIIlIl*(0/0));end;return Mining_IlIlllII(Mining_llIllIllIIlIlIIIIlIl,Mining_lIllIIlIIlIIIl-1023)*(Mining_IllIlIIIlIIII+(Mining_llIIlllIIIIIIllllIlI/(2^52)));end;local Mining_IlIlllII=Mining_lIllIIlIIlIIIl;local function Mining_lIIlIIllIl(Mining_lIllIIlIIlIIIl)local Mining_lIlIlIIIIIlllllIlllII;if(not Mining_lIllIIlIIlIIIl)then Mining_lIllIIlIIlIIIl=Mining_IlIlllII();if(Mining_lIllIIlIIlIIIl==0)then return'';end;end;Mining_lIlIlIIIIIlllllIlllII=Mining_IllIlIIIlIIII(Mining_lIllIIllIIIlllIIIIllIIlII,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl+Mining_lIllIIlIIlIIIl-1);Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+Mining_lIllIIlIIlIIIl;local Mining_lIllIIlIIlIIIl={}for Mining_llIllIllIIlIlIIIIlIl=1,#Mining_lIlIlIIIIIlllllIlllII do Mining_lIllIIlIIlIIIl[Mining_llIllIllIIlIlIIIIlIl]=Mining_IIlIlIIlllII(Mining_llIIlllIIIIIIllllIlI(Mining_lllllIllIlIIllIlIIlIlIlI(Mining_IllIlIIIlIIII(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl,Mining_llIllIllIIlIlIIIIlIl)),66))end return Mining_IllIIIlIIIIIllIIlllIII(Mining_lIllIIlIIlIIIl);end;local Mining_llIllIllIIlIlIIIIlIl=Mining_lIllIIlIIlIIIl;local function Mining_IlIlllII(...)return{...},Mining_IllIlIIlllllI('#',...)end local function Mining_lllllIllIlIIllIlIIlIlIlI()local Mining_IllIIIlIIIIIllIIlllIII={};local Mining_IIlIlIIlllII={};local Mining_llIllIllIIlIlIIIIlIl={};local Mining_lIllIIllIIIlllIIIIllIIlII={[#{"1 + 1 = 111";{335;841;245;362};}]=Mining_IIlIlIIlllII,[#{{826;213;621;122};{265;227;148;351};{69;218;724;641};}]=nil,[#{"1 + 1 = 111";{430;896;404;765};{472;462;294;608};{504;182;404;273};}]=Mining_llIllIllIIlIlIIIIlIl,[#{{814;426;274;252};}]=Mining_IllIIIlIIIIIllIIlllIII,};local Mining_llIllIllIIlIlIIIIlIl=Mining_lIllIIlIIlIIIl()local Mining_IllIlIIIlIIII={}for Mining_lIlIlIIIIIlllllIlllII=1,Mining_llIllIllIIlIlIIIIlIl do local Mining_lIllIIlIIlIIIl=Mining_IIIIIlllIIlIlI();local Mining_llIllIllIIlIlIIIIlIl;if(Mining_lIllIIlIIlIIIl==2)then Mining_llIllIllIIlIlIIIIlIl=(Mining_IIIIIlllIIlIlI()~=0);elseif(Mining_lIllIIlIIlIIIl==3)then Mining_llIllIllIIlIlIIIIlIl=Mining_IIllIIIIIlIlIlllIllIlI();elseif(Mining_lIllIIlIIlIIIl==1)then Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIIllIl();end;Mining_IllIlIIIlIIII[Mining_lIlIlIIIIIlllllIlllII]=Mining_llIllIllIIlIlIIIIlIl;end;for Mining_lllllIllIlIIllIlIIlIlIlI=1,Mining_lIllIIlIIlIIIl()do local Mining_llIllIllIIlIlIIIIlIl=Mining_IIIIIlllIIlIlI();if(Mining_lIlIlIIIIIlllllIlllII(Mining_llIllIllIIlIlIIIIlIl,1,1)==0)then local Mining_llIIlllIIIIIIllllIlI=Mining_lIlIlIIIIIlllllIlllII(Mining_llIllIllIIlIlIIIIlIl,2,3);local Mining_lIIlIIIIIlIIIIIlI=Mining_lIlIlIIIIIlllllIlllII(Mining_llIllIllIIlIlIIIIlIl,4,6);local Mining_llIllIllIIlIlIIIIlIl={Mining_lIIlIlIIIIlIIIlIIIIlIl(),Mining_lIIlIlIIIIlIIIlIIIIlIl(),nil,nil};if(Mining_llIIlllIIIIIIllllIlI==0)then Mining_llIllIllIIlIlIIIIlIl[#("UH4")]=Mining_lIIlIlIIIIlIIIlIIIIlIl();Mining_llIllIllIIlIlIIIIlIl[#("pWff")]=Mining_lIIlIlIIIIlIIIlIIIIlIl();elseif(Mining_llIIlllIIIIIIllllIlI==1)then Mining_llIllIllIIlIlIIIIlIl[#("Gi7")]=Mining_lIllIIlIIlIIIl();elseif(Mining_llIIlllIIIIIIllllIlI==2)then Mining_llIllIllIIlIlIIIIlIl[#("4d5")]=Mining_lIllIIlIIlIIIl()-(2^16)elseif(Mining_llIIlllIIIIIIllllIlI==3)then Mining_llIllIllIIlIlIIIIlIl[#("zqQ")]=Mining_lIllIIlIIlIIIl()-(2^16)Mining_llIllIllIIlIlIIIIlIl[#("kfSf")]=Mining_lIIlIlIIIIlIIIlIIIIlIl();end;if(Mining_lIlIlIIIIIlllllIlllII(Mining_lIIlIIIIIlIIIIIlI,1,1)==1)then Mining_llIllIllIIlIlIIIIlIl[#("fL")]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("Zd")]]end if(Mining_lIlIlIIIIIlllllIlllII(Mining_lIIlIIIIIlIIIIIlI,2,2)==1)then Mining_llIllIllIIlIlIIIIlIl[#("oyE")]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("iCa")]]end if(Mining_lIlIlIIIIIlllllIlllII(Mining_lIIlIIIIIlIIIIIlI,3,3)==1)then Mining_llIllIllIIlIlIIIIlIl[#("dHhn")]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("IZv4")]]end Mining_IllIIIlIIIIIllIIlllIII[Mining_lllllIllIlIIllIlIIlIlIlI]=Mining_llIllIllIIlIlIIIIlIl;end end;Mining_lIllIIllIIIlllIIIIllIIlII[3]=Mining_IIIIIlllIIlIlI();for Mining_llIllIllIIlIlIIIIlIl=1,Mining_lIllIIlIIlIIIl()do Mining_IIlIlIIlllII[Mining_llIllIllIIlIlIIIIlIl-1]=Mining_lllllIllIlIIllIlIIlIlIlI();end;return Mining_lIllIIllIIIlllIIIIllIIlII;end;local function Mining_IIlIlIIlllII(Mining_llIllIllIIlIlIIIIlIl,Mining_lIllIIllIIIlllIIIIllIIlII,Mining_IllIlIIIlIIII)Mining_llIllIllIIlIlIIIIlIl=(Mining_llIllIllIIlIlIIIIlIl==true and Mining_lllllIllIlIIllIlIIlIlIlI())or Mining_llIllIllIIlIlIIIIlIl;return(function(...)local Mining_llIIlllIIIIIIllllIlI=Mining_llIllIllIIlIlIIIIlIl[1];local Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[3];local Mining_IllIIIlIIIIIllIIlllIII=Mining_llIllIllIIlIlIIIIlIl[2];local Mining_IIIIIlllIIlIlI=Mining_IlIlllII local Mining_lIllIIlIIlIIIl=1;local Mining_lllllIllIlIIllIlIIlIlIlI=-1;local Mining_lIIlIIllIl={};local Mining_IIllIIIIIlIlIlllIllIlI={...};local Mining_IlIlllII=Mining_IllIlIIlllllI('#',...)-1;local Mining_IllIlIIlllllI={};local Mining_lIlIlIIIIIlllllIlllII={};for Mining_llIllIllIIlIlIIIIlIl=0,Mining_IlIlllII do if(Mining_llIllIllIIlIlIIIIlIl>=Mining_lIIlIlIIIIlIIIlIIIIlIl)then Mining_lIIlIIllIl[Mining_llIllIllIIlIlIIIIlIl-Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_IIllIIIIIlIlIlllIllIlI[Mining_llIllIllIIlIlIIIIlIl+1];else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_IIllIIIIIlIlIlllIllIlI[Mining_llIllIllIIlIlIIIIlIl+#{"1 + 1 = 111";}];end;end;local Mining_llIllIllIIlIlIIIIlIl=Mining_IlIlllII-Mining_lIIlIlIIIIlIIIlIIIIlIl+1 local Mining_llIllIllIIlIlIIIIlIl;local Mining_lIIlIlIIIIlIIIlIIIIlIl;while true do Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("L")];if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("esPZJgZXaDULoplvb2nKnfa0CgcEkTV1rIpJkpNkH5SNF")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("4r2boMepA9rZyDdvNqS3tR")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#{"1 + 1 = 111";"1 + 1 = 111";{382;969;151;847};"1 + 1 = 111";{517;297;939;550};{767;87;782;985};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("lVMj")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("i")then if Mining_lIIlIlIIIIlIIIlIIIIlIl>#("")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("LD")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DKy")]];else if not Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("e7")]]then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("DkR")];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#{"1 + 1 = 111";"1 + 1 = 111";}then Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("zSD")];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("v2k")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oE")]]();else local Mining_IllIlIIIlIIII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("u3a")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ZK")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("r5")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yUn")]][Mining_llIllIllIIlIlIIIIlIl[#("ypY3")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("94P")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UZ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("E6")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{688;34;819;303};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nf")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7Nh")]][Mining_llIllIllIIlIlIIIIlIl[#("DlJE")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("H5h")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("s8")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qL")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VjY")]][Mining_llIllIllIIlIlIIIIlIl[#("fjJL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("ps")];Mining_IllIlIIIlIIII=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vLr")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_IllIlIIIlIIII;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("gDEg")]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("lsC4MKn")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("p0Dxc")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tg")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Y78")]]+Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ObAt")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("hN3EYq")then local Mining_lIllIIllIIIlllIIIIllIIlII;local Mining_IllIIIlIIIIIllIIlllIII,Mining_IllIlIIlllllI;local Mining_IIlIlIIlllII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Bu")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("yhp")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4E")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("ol9")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("rV")];Mining_IIlIlIIlllII=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5vk")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_IIlIlIIlllII;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_IIlIlIIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Kbsh")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FG")]]=Mining_llIllIllIIlIlIIIIlIl[#("qYx")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7u")]]=(Mining_llIllIllIIlIlIIIIlIl[#("Kkl")]~=0);Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Cv")]Mining_IllIIIlIIIIIllIIlllIII,Mining_IllIlIIlllllI=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("WdL")])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IllIlIIlllllI+Mining_lIIlIlIIIIlIIIlIIIIlIl-1 Mining_lIllIIllIIIlllIIIIllIIlII=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIllIIllIIIlllIIIIllIIlII=Mining_lIllIIllIIIlllIIIIllIIlII+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_IllIIIlIIIIIllIIlllIII[Mining_lIllIIllIIIlllIIIIllIIlII];end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("yy")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FW")]]();Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];do return end;else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("i7")]]={};end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("TDXJgrJU")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("RK")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("6DD")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("j8")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("N7n")]][Mining_llIllIllIIlIlIIIIlIl[#("KH8P")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Bs")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yIF")]][Mining_llIllIllIIlIlIIIIlIl[#("a7mG")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("SJ")]][Mining_llIllIllIIlIlIIIIlIl[#("yTd")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8Hoz")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Z5")]][Mining_llIllIllIIlIlIIIIlIl[#("5Jb")]]=Mining_llIllIllIIlIlIIIIlIl[#("38GA")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QX")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("8SD")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zt")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oGg")]][Mining_llIllIllIIlIlIIIIlIl[#("fvpI")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dY")]]=Mining_llIllIllIIlIlIIIIlIl[#("VJJ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("I5")]]=Mining_llIllIllIIlIlIIIIlIl[#("HbC")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("z6")]]=Mining_llIllIllIIlIlIIIIlIl[#("TM5")];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("04f5195DS")then if not Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("mW")]]then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("iFT")];end;else local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DK")]]=Mining_llIllIllIIlIlIIIIlIl[#("sHy")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Fv")]]=Mining_llIllIllIIlIlIIIIlIl[#("h0E")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vG")]]=Mining_llIllIllIIlIlIIIIlIl[#("clp")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{69;218;495;286};}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("a4i")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("PI")]][Mining_llIllIllIIlIlIIIIlIl[#("0K5")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xZFl")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cY")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("9ks")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IT")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qrM")]][Mining_llIllIllIIlIlIIIIlIl[#("B2Be")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NO")]]=Mining_llIllIllIIlIlIIIIlIl[#("Odr")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uL")]]=Mining_llIllIllIIlIlIIIIlIl[#("9Uo")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{743;285;262;749};{300;300;351;412};}]]=Mining_llIllIllIIlIlIIIIlIl[#("hpG")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("7DxtbWUZaNy1d3ZD")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("OvGrOH49Jrhuh")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("BVZtZxjWXxC")then if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4G")]]~=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Jl4r")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("fvr")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("h780mfzkqhmR")then for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("5v")],Mining_llIllIllIIlIlIIIIlIl[#("WnV")]do Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=nil;end;else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("il")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("DYh")]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("6CtCFMF357foJa")then Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("K3U")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5c")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#{"1 + 1 = 111";{477;980;183;182};"1 + 1 = 111";"1 + 1 = 111";{160;153;185;660};{566;642;573;566};"1 + 1 = 111";{657;738;858;806};{624;324;666;886};{877;301;660;875};{745;282;645;933};{436;237;961;719};{593;904;461;425};{24;596;58;339};"1 + 1 = 111";}then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oV")]][Mining_llIllIllIIlIlIIIIlIl[#("ncK")]]=Mining_llIllIllIIlIlIIIIlIl[#("jq70")];else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("ojJ")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("Ih9340trU7Qla2MNfsG")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("Jd2oGGsUALJ6FOHgJ")then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{245;586;422;209};}]Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl+1])elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("kZJqz1zo6ifC6MBcUF")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pv")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4Vo")]]-Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hXbD")]];else local Mining_IllIIIlIIIIIllIIlllIII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;local Mining_lIllIIllIIIlllIIIIllIIlII,Mining_IIlIlIIlllII;local Mining_IllIlIIIlIIII;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("LP")]]=Mining_llIllIllIIlIlIIIIlIl[#("PB9")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{211;859;485;290};{316;564;394;752};}]]=Mining_llIllIllIIlIlIIIIlIl[#("eaT")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Aj")]]=Mining_llIllIllIIlIlIIIIlIl[#("27J")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_IllIlIIIlIIII=Mining_llIllIllIIlIlIIIIlIl[#("Ep")]Mining_lIllIIllIIIlllIIIIllIIlII,Mining_IIlIlIIlllII=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_IllIlIIIlIIII](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_IllIlIIIlIIII+1,Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{130;478;844;758};{77;195;780;767};}])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IIlIlIIlllII+Mining_IllIlIIIlIIII-1 Mining_lIIlIlIIIIlIIIlIIIIlIl=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_IllIlIIIlIIII,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_lIIlIlIIIIlIIIlIIIIlIl];end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_IllIlIIIlIIII=Mining_llIllIllIIlIlIIIIlIl[#("Py")]Mining_lIllIIllIIIlllIIIIllIIlII,Mining_IIlIlIIlllII=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_IllIlIIIlIIII](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_IllIlIIIlIIII+1,Mining_lllllIllIlIIllIlIIlIlIlI)))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IIlIlIIlllII+Mining_IllIlIIIlIIII-1 Mining_lIIlIlIIIIlIIIlIIIIlIl=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_IllIlIIIlIIII,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_lIIlIlIIIIlIIIlIIIIlIl];end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_IllIlIIIlIIII=Mining_llIllIllIIlIlIIIIlIl[#("9T")];Mining_IllIIIlIIIIIllIIlllIII=Mining_lIlIlIIIIIlllllIlllII[Mining_IllIlIIIlIIII];for Mining_llIllIllIIlIlIIIIlIl=Mining_IllIlIIIlIIII+1,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIIllIIIllIlII(Mining_IllIIIlIIIIIllIIlllIII,Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl])end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("VxzIJ2izURvuFd8hRZsO")then local Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IllIIIlIIIIIllIIlllIII[Mining_llIllIllIIlIlIIIIlIl[#("6T4")]];local Mining_lIIlIIIIIlIIIIIlI;local Mining_lIIlIlIIIIlIIIlIIIIlIl={};Mining_lIIlIIIIIlIIIIIlI=Mining_IIIlllIIlIllIllIlllIIl({},{__index=function(Mining_lIllIIlIIlIIIl,Mining_llIllIllIIlIlIIIIlIl)local Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl];return Mining_llIllIllIIlIlIIIIlIl[1][Mining_llIllIllIIlIlIIIIlIl[2]];end,__newindex=function(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl,Mining_lIllIIlIIlIIIl)local Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl]Mining_llIllIllIIlIlIIIIlIl[1][Mining_llIllIllIIlIlIIIIlIl[2]]=Mining_lIllIIlIIlIIIl;end;});for Mining_IllIlIIIlIIII=1,Mining_llIllIllIIlIlIIIIlIl[#("MG36")]do Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;local Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if Mining_llIllIllIIlIlIIIIlIl[#("t")]==58 then Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_IllIlIIIlIIII-1]={Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl[#{{226;270;298;673};{242;210;362;370};"1 + 1 = 111";}]};else Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_IllIlIIIlIIII-1]={Mining_lIllIIllIIIlllIIIIllIIlII,Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{435;96;45;383};{980;532;450;279};}]};end;Mining_IllIlIIlllllI[#Mining_IllIlIIlllllI+1]=Mining_lIIlIlIIIIlIIIlIIIIlIl;end;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("h4")]]=Mining_IIlIlIIlllII(Mining_lllllIllIlIIllIlIIlIlIlI,Mining_lIIlIIIIIlIIIIIlI,Mining_IllIlIIIlIIII);elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#{{892;526;213;13};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{731;233;485;481};"1 + 1 = 111";{465;715;397;981};"1 + 1 = 111";"1 + 1 = 111";{35;803;480;256};{76;830;913;21};{787;650;124;655};{846;934;968;846};{914;266;61;38};{271;698;819;712};"1 + 1 = 111";{172;75;244;808};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HN")]][Mining_llIllIllIIlIlIIIIlIl[#("XsB")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("orBC")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0z")]][Mining_llIllIllIIlIlIIIIlIl[#{{835;444;183;212};"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("lCaH")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Rj")]][Mining_llIllIllIIlIlIIIIlIl[#{{109;348;701;212};"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("gfjs")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("P0")]][Mining_llIllIllIIlIlIIIIlIl[#("kgq")]]=Mining_llIllIllIIlIlIIIIlIl[#("SdoM")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ps")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("DHt")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Uc")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tTc")]][Mining_llIllIllIIlIlIIIIlIl[#{{753;76;492;149};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zT")]]={};Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{751;198;622;70};"1 + 1 = 111";}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("0jq")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uJ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("746")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{979;582;220;450};{879;750;406;365};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2k")]]=Mining_llIllIllIIlIlIIIIlIl[#("uX0")];else local Mining_lIllIIllIIIlllIIIIllIIlII;local Mining_IllIlIIlllllI,Mining_IllIIIlIIIIIllIIlllIII;local Mining_IIlIlIIlllII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("li")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("HIe")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Fe")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{306;67;581;283};{732;69;76;808};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{304;316;752;15};}];Mining_IIlIlIIlllII=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ov4")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_IIlIlIIlllII;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_IIlIlIIlllII[Mining_llIllIllIIlIlIIIIlIl[#("59EU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eT")]]=Mining_llIllIllIIlIlIIIIlIl[#("0nM")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{475;756;292;732};{153;511;768;785};}]]=(Mining_llIllIllIIlIlIIIIlIl[#("voM")]~=0);Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Xz")]Mining_IllIlIIlllllI,Mining_IllIIIlIIIIIllIIlllIII=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IllIIIlIIIIIllIIlllIII+Mining_lIIlIlIIIIlIIIlIIIIlIl-1 Mining_lIllIIllIIIlllIIIIllIIlII=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIllIIllIIIlllIIIIllIIlII=Mining_lIllIIllIIIlllIIIIllIIlII+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_IllIlIIlllllI[Mining_lIllIIllIIIlllIIIIllIIlII];end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QT")]]();Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];do return end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("HKXKz7EUmC0o5fZy55ECooCsNoovAZ4yH")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("U9xdIRCVpDmN3O63eDWbAshF7jS")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("uxHCRUv0a1xW9D99favKzGVC")then if Mining_lIIlIlIIIIlIIIlIIIIlIl==#("GVB12gy8tB25U6isg2mf9b6")then local Mining_lllllIllIlIIllIlIIlIlIlI;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("K0")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("oKf")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3F")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Jfn")]][Mining_llIllIllIIlIlIIIIlIl[#("rVDt")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FY")]]=Mining_llIllIllIIlIlIIIIlIl[#("qRT")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HE")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("CsW")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("nU")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("RM5")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Zy")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("oxT")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("eu")];Mining_lllllIllIlIIllIlIIlIlIlI=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rYc")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_lllllIllIlIIllIlIIlIlIlI;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lllllIllIlIIllIlIIlIlIlI[Mining_llIllIllIIlIlIIIIlIl[#("RpBc")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bM")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{11;986;186;723};"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("yH")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("xpX")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sH")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{182;527;991;107};"1 + 1 = 111";{181;762;724;442};}]][Mining_llIllIllIIlIlIIIIlIl[#("bNTk")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("EF")],Mining_llIllIllIIlIlIIIIlIl[#("hIM")]do Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=nil;end;else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("q4")]][Mining_llIllIllIIlIlIIIIlIl[#("ERP")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{582;439;317;748};}]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("iz7YiTYMe0k848iV8XQcgdvdm")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0D")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{931;28;962;431};"1 + 1 = 111";}]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("rNJvMEYgTDjK0KMp13WkziUBgl")then if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MJ")]]~=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("02qv")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("uQK")];end;else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bH")]]=(Mining_llIllIllIIlIlIIIIlIl[#("0vM")]~=0);end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("3mfc3L1ClcSoQkXoPMz7gB0mDrc2j3")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("pAi43NBp89iBniPf9L3eZSooDv3K")then local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("SJ")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl+1,Mining_llIllIllIIlIlIIIIlIl[#("dhl")]))elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("J8rr5DYHp3MovB779NdYmcrpYrHl3")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0G")]]=Mining_llIllIllIIlIlIIIIlIl[#("yDI")];else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QM")]]();end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("IU1OAb0irP0IURr0ErqqDSZWAGQcEN5")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lJ")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("GSX")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KF")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VWx")]][Mining_llIllIllIIlIlIIIIlIl[#("yANj")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Pm")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("UKo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dd")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("i8N")]][Mining_llIllIllIIlIlIIIIlIl[#("hMAA")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("r7")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{818;162;965;783};{996;699;885;360};}]][Mining_llIllIllIIlIlIIIIlIl[#{{945;689;840;248};"1 + 1 = 111";{74;242;775;497};{435;689;527;358};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("a9")]]~=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("J7v3")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("Q5n")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("OYv1ySa6h1vz7OsK87Xp4N7Z4fn3uXOO")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("CC")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Fff")]][Mining_llIllIllIIlIlIIIIlIl[#{{251;400;319;888};{908;474;563;205};{109;111;129;281};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fa")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{348;868;617;552};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{350;633;696;675};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]-Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("OSJp")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("GD")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("tX2")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{94;359;304;882};{943;316;901;116};}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("t2g")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bf")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hcM")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{761;819;672;87};{822;882;80;312};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ap")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{947;827;12;576};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("K7")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("H1G")]][Mining_llIllIllIIlIlIIIIlIl[#("qNrj")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("M8")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("EBd")]][Mining_llIllIllIIlIlIIIIlIl[#("Amsk")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vA")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("Qvv")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("YZ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ZnA")]][Mining_llIllIllIIlIlIIIIlIl[#("6xqK")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5o")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("A2V")]][Mining_llIllIllIIlIlIIIIlIl[#("3Hyr")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Nf")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Xyx")]][Mining_llIllIllIIlIlIIIIlIl[#("sJut")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("is")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Z7o")]]+Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Acjz")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9i")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("EaG")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("r8")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("edE")]][Mining_llIllIllIIlIlIIIIlIl[#("CF7V")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fq")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("78q")]][Mining_llIllIllIIlIlIIIIlIl[#{{690;801;406;260};{183;774;719;819};"1 + 1 = 111";{633;347;854;549};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ea")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("Tl2")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("72")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HEB")]][Mining_llIllIllIIlIlIIIIlIl[#("TWQi")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zD")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("M6P")]][Mining_llIllIllIIlIlIIIIlIl[#("rB8t")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{652;167;643;761};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vC4")]][Mining_llIllIllIIlIlIIIIlIl[#("1hYF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vS")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FRU")]]+Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Sr74")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Ej")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("lLm")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ty")]][Mining_llIllIllIIlIlIIIIlIl[#("0gI")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xd3J")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];do return end;else local Mining_llIIlllIIIIIIllllIlI=Mining_llIllIllIIlIlIIIIlIl[#("X1")];local Mining_lIllIIlIIlIIIl=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UhS")]];Mining_lIlIlIIIIIlllllIlllII[Mining_llIIlllIIIIIIllllIlI+1]=Mining_lIllIIlIIlIIIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIIlllIIIIIIllllIlI]=Mining_lIllIIlIIlIIIl[Mining_llIllIllIIlIlIIIIlIl[#("CzGH")]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("n45vADWqujMxAYVmgeH0PTb0H6sEgMtmRQUUyoI")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("b9JDvCFqDRnThYdE3eYDksjTZAQUeaY1HcYQ")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("IFfCbaAyLe2Mp1tBetT00O5VUlC2vmfayu")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jL")]][Mining_llIllIllIIlIlIIIIlIl[#("M23")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ntOO")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Mu")]][Mining_llIllIllIIlIlIIIIlIl[#("Gzr")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("G2mC")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("mp")]][Mining_llIllIllIIlIlIIIIlIl[#("Hv1")]]=Mining_llIllIllIIlIlIIIIlIl[#("9dZq")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ut")]][Mining_llIllIllIIlIlIIIIlIl[#("v43")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uQCZ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("X8")]][Mining_llIllIllIIlIlIIIIlIl[#("itY")]]=Mining_llIllIllIIlIlIIIIlIl[#("OSr9")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Po")]][Mining_llIllIllIIlIlIIIIlIl[#("nUR")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Q2hC")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("GG")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("9mh")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IO")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6Pi")]][Mining_llIllIllIIlIlIIIIlIl[#("35Cu")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gX")]]=Mining_llIllIllIIlIlIIIIlIl[#("nn9")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Sv")]]=Mining_llIllIllIIlIlIIIIlIl[#("IsO")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2Q")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{32;110;519;532};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("XX")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("TPt")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QW")]][Mining_llIllIllIIlIlIIIIlIl[#("m5N")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IDkY")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cz")]][Mining_llIllIllIIlIlIIIIlIl[#("sDn")]]=Mining_llIllIllIIlIlIIIIlIl[#("0eG8")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gL")]][Mining_llIllIllIIlIlIIIIlIl[#("lVN")]]=Mining_llIllIllIIlIlIIIIlIl[#("tnNY")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("YR")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("r1z")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("le")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("mxt")]][Mining_llIllIllIIlIlIIIIlIl[#("W6Ql")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xr")]]=Mining_llIllIllIIlIlIIIIlIl[#("5Ae")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IM")]]=Mining_llIllIllIIlIlIIIIlIl[#("QTZ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yG")]]=Mining_llIllIllIIlIlIIIIlIl[#("U1z")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kF")]]=Mining_llIllIllIIlIlIIIIlIl[#("2kn")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("q2")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#{{426;472;859;328};{932;719;52;522};"1 + 1 = 111";}]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("R9")]][Mining_llIllIllIIlIlIIIIlIl[#("9gr")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("GbOy")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("e8")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("PuY")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("EE")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ahM")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{293;378;595;629};{230;852;936;432};{777;285;613;209};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TB")]]=Mining_llIllIllIIlIlIIIIlIl[#("vlb")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{47;566;20;611};"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("1XU")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("Nzh")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TG")]]=Mining_llIllIllIIlIlIIIIlIl[#("vsB")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Xo")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("Oy1")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("us")]][Mining_llIllIllIIlIlIIIIlIl[#("kIi")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{892;317;831;389};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("L1")]][Mining_llIllIllIIlIlIIIIlIl[#("hqk")]]=Mining_llIllIllIIlIlIIIIlIl[#("2GOA")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("V0")]][Mining_llIllIllIIlIlIIIIlIl[#("4qX")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Kmto")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ug")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("ob7")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9g")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jAk")]][Mining_llIllIllIIlIlIIIIlIl[#("Dptf")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{457;319;155;822};{78;377;747;665};}]]=Mining_llIllIllIIlIlIIIIlIl[#("8Mh")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nZ")]]=Mining_llIllIllIIlIlIIIIlIl[#("87B")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4u")]]=Mining_llIllIllIIlIlIIIIlIl[#("3R5")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("BH")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("qhm")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MI")]][Mining_llIllIllIIlIlIIIIlIl[#("dmP")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6opa")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("o3")]][Mining_llIllIllIIlIlIIIIlIl[#("MyP")]]=Mining_llIllIllIIlIlIIIIlIl[#("HYWX")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9U")]][Mining_llIllIllIIlIlIIIIlIl[#("MFf")]]=Mining_llIllIllIIlIlIIIIlIl[#("ftE4")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("k2")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("uU7")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("m7")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nMG")]][Mining_llIllIllIIlIlIIIIlIl[#("RTqM")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ts")]]=Mining_llIllIllIIlIlIIIIlIl[#("AIZ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zO")]]=Mining_llIllIllIIlIlIIIIlIl[#("0YD")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lb")]]=Mining_llIllIllIIlIlIIIIlIl[#("ukv")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("LJ")]]=Mining_llIllIllIIlIlIIIIlIl[#("YkO")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("aA")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("VKM")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dj")]][Mining_llIllIllIIlIlIIIIlIl[#("6V8")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("prpR")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5i")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("1gb")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vG")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("USA")]][Mining_llIllIllIIlIlIIIIlIl[#("tRAB")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6a")]]=Mining_llIllIllIIlIlIIIIlIl[#("MOx")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zH")]]=Mining_llIllIllIIlIlIIIIlIl[#("yET")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{714;963;932;538};}]]=Mining_llIllIllIIlIlIIIIlIl[#("5Cc")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KK")]]=Mining_llIllIllIIlIlIIIIlIl[#("i9G")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{{850;597;212;334};{684;695;676;265};}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("gaD")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KB")]][Mining_llIllIllIIlIlIIIIlIl[#("a4L")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yBPx")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UN")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("Kvs")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("v8")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WtE")]][Mining_llIllIllIIlIlIIIIlIl[#("ZvF8")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Tg")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VSE")]][Mining_llIllIllIIlIlIIIIlIl[#("dT1N")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rr")]][Mining_llIllIllIIlIlIIIIlIl[#("XiJ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pSzI")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("s8")]][Mining_llIllIllIIlIlIIIIlIl[#("1YQ")]]=Mining_llIllIllIIlIlIIIIlIl[#("T8RM")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8C")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("TIu")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cW")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("K1c")]][Mining_llIllIllIIlIlIIIIlIl[#("O8Jo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NA")]]=Mining_llIllIllIIlIlIIIIlIl[#("oWO")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IB")]]=Mining_llIllIllIIlIlIIIIlIl[#("cS5")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6d")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{406;284;964;164};{92;714;812;583};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Dv")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("7zQ")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VM")]][Mining_llIllIllIIlIlIIIIlIl[#("Fvy")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{391;503;880;665};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2L")]][Mining_llIllIllIIlIlIIIIlIl[#("BmV")]]=Mining_llIllIllIIlIlIIIIlIl[#("OOhX")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{965;220;874;18};{265;506;167;731};}]][Mining_llIllIllIIlIlIIIIlIl[#("og6")]]=Mining_llIllIllIIlIlIIIIlIl[#("vos7")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("r3")]][Mining_llIllIllIIlIlIIIIlIl[#{{781;535;560;805};"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HBNq")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cq")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("qUy")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nc")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eWh")]][Mining_llIllIllIIlIlIIIIlIl[#("Ms2k")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oH")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{354;613;549;391};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bg")]]=Mining_llIllIllIIlIlIIIIlIl[#("WdH")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WY")]]=Mining_llIllIllIIlIlIIIIlIl[#("24x")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("EW")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("Ees")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{778;868;782;655};}]][Mining_llIllIllIIlIlIIIIlIl[#{{444;427;645;779};"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("AUd8")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("JTairTvnuXiZjFBCSeZt3KtS0JHbz82o5GV")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hH")]]=Mining_llIllIllIIlIlIIIIlIl[#("V3a")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5f")]]=Mining_llIllIllIIlIlIIIIlIl[#("Ygu")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("La")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("aRv")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{599;1;572;459};"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("nsU")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0Wp3")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("YG")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("g3z")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nS")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("JNj")]][Mining_llIllIllIIlIlIIIIlIl[#("PyNn")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("d5B")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cT")]]=Mining_llIllIllIIlIlIIIIlIl[#("Bv7")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Og")]]=Mining_llIllIllIIlIlIIIIlIl[#("skt")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FI")]]=Mining_llIllIllIIlIlIIIIlIl[#("Hud")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("vQ")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("Tts")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{951;332;512;401};{797;311;848;633};}]][Mining_llIllIllIIlIlIIIIlIl[#("IOa")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MLMQ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ps")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("uA5")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TN")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cry")]][Mining_llIllIllIIlIlIIIIlIl[#("FPUl")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("J6")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("T3Q")]][Mining_llIllIllIIlIlIIIIlIl[#("nvrU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("R8")]][Mining_llIllIllIIlIlIIIIlIl[#("PiX")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HHkA")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xp")]][Mining_llIllIllIIlIlIIIIlIl[#("UUA")]]=Mining_llIllIllIIlIlIIIIlIl[#("4Liu")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{958;516;723;884};{479;583;931;917};}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{{409;323;892;812};"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ge")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ZTC")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{89;499;590;532};"1 + 1 = 111";{373;902;555;471};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("1q")]]=Mining_llIllIllIIlIlIIIIlIl[#("t9J")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ef")]]=Mining_llIllIllIIlIlIIIIlIl[#("5q1")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lT")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{214;502;939;571};"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Ca")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#{{990;681;644;268};"1 + 1 = 111";"1 + 1 = 111";}]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("A8")]][Mining_llIllIllIIlIlIIIIlIl[#("Pka")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("iXAG")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eY")]][Mining_llIllIllIIlIlIIIIlIl[#("GOB")]]=Mining_llIllIllIIlIlIIIIlIl[#("bQlr")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rE")]][Mining_llIllIllIIlIlIIIIlIl[#("o7m")]]=Mining_llIllIllIIlIlIIIIlIl[#("Ua1g")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("T7")]][Mining_llIllIllIIlIlIIIIlIl[#("ejs")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FEFB")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ei")]][Mining_llIllIllIIlIlIIIIlIl[#("ZiY")]]=Mining_llIllIllIIlIlIIIIlIl[#("hmnn")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Zs")]][Mining_llIllIllIIlIlIIIIlIl[#("tq7")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bCrP")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DR")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("qWo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6z")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kyq")]][Mining_llIllIllIIlIlIIIIlIl[#("GpNA")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{304;8;165;807};"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("ZRh")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ex")]]=Mining_llIllIllIIlIlIIIIlIl[#("T2T")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("go")]]=Mining_llIllIllIIlIlIIIIlIl[#("JWl")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("R7")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("d76")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("P8")]][Mining_llIllIllIIlIlIIIIlIl[#("Gql")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("A5W1")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aY")]][Mining_llIllIllIIlIlIIIIlIl[#("x0u")]]=Mining_llIllIllIIlIlIIIIlIl[#("0u3f")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ah")]][Mining_llIllIllIIlIlIIIIlIl[#("mLs")]]=Mining_llIllIllIIlIlIIIIlIl[#("4Tce")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("1L")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("zGN")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kv")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qze")]][Mining_llIllIllIIlIlIIIIlIl[#("fE8X")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("c9")]]=Mining_llIllIllIIlIlIIIIlIl[#("cPJ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VD")]]=Mining_llIllIllIIlIlIIIIlIl[#("Ajl")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yh")]]=Mining_llIllIllIIlIlIIIIlIl[#("e9u")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dn")]]=Mining_llIllIllIIlIlIIIIlIl[#("Z8z")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("KN")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("mMA")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kW")]][Mining_llIllIllIIlIlIIIIlIl[#("xSB")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6KlQ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9k")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("J8q")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xD")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("JzH7")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("o6")]]=Mining_llIllIllIIlIlIIIIlIl[#("2Ko")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Sf")]]=Mining_llIllIllIIlIlIIIIlIl[#("Roo")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{433;585;445;766};}]]=Mining_llIllIllIIlIlIIIIlIl[#("PWt")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{105;381;451;556};{82;594;408;485};}]]=Mining_llIllIllIIlIlIIIIlIl[#("p94")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("O5")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("gTN")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Sq")]][Mining_llIllIllIIlIlIIIIlIl[#{{933;248;966;449};{732;105;632;769};{89;778;854;549};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FxBy")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("g7")]][Mining_llIllIllIIlIlIIIIlIl[#("oBy")]]=Mining_llIllIllIIlIlIIIIlIl[#("JSN9")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DB")]][Mining_llIllIllIIlIlIIIIlIl[#("2iz")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Xth8")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("LR")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("SQB")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Wk")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UIm")]][Mining_llIllIllIIlIlIIIIlIl[#("rAmh")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hQ")]]=Mining_llIllIllIIlIlIIIIlIl[#("ymt")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("BH")]]=Mining_llIllIllIIlIlIIIIlIl[#("zm3")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sQ")]]=Mining_llIllIllIIlIlIIIIlIl[#("e06")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{{152;90;190;126};"1 + 1 = 111";}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("SnP")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gX")]][Mining_llIllIllIIlIlIIIIlIl[#("L4M")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cq0X")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DG")]][Mining_llIllIllIIlIlIIIIlIl[#("0Xu")]]=Mining_llIllIllIIlIlIIIIlIl[#("0Ufa")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qr")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("yLG")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Dq")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IPQ")]][Mining_llIllIllIIlIlIIIIlIl[#("BY5s")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rV")]]=Mining_llIllIllIIlIlIIIIlIl[#("HPR")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Vg")]]=Mining_llIllIllIIlIlIIIIlIl[#("Wz5")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oX")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{498;395;841;965};"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ZP")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{767;668;330;654};{316;104;937;623};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Tn")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("bOO")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7A")]][Mining_llIllIllIIlIlIIIIlIl[#("65h")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IsPo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Z9")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("1Xn")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qx")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Rtc")]][Mining_llIllIllIIlIlIIIIlIl[#("x09s")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6i")]]=Mining_llIllIllIIlIlIIIIlIl[#("jy1")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8f")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{272;837;908;22};{687;16;376;997};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rP")]]=Mining_llIllIllIIlIlIIIIlIl[#("9LT")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ai")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("aH")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("LbI")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("O1")]][Mining_llIllIllIIlIlIIIIlIl[#("a1M")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NCnU")]];else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Lq")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Hg5")]]+Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jlzT")]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("dkCgFAK8Lxry5Ux5IaC9zssSmtZv543OUTyHN")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jT")]]={};elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("ZD9ugDqigOM7Q4dVsV2T4kLndRDOOlxZrZl89d")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("BT")]]=Mining_IIlIlIIlllII(Mining_IllIIIlIIIIIllIIlllIII[Mining_llIllIllIIlIlIIIIlIl[#("kht")]],nil,Mining_IllIlIIIlIIII);else local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("sN")]Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI))end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("0BdnkU7n9K8BNP3YO1VrA9NF4rWP1TfWoKbr06BDfD")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("eQUUkyaHgnWW0YJs28sxqFmmdNM7RBrm6GIZkIMq")then do return end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("l8IDYlDrOIFXgnKEIRHWc0Q5JZuqUiuxbHeGOTpCi")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ba")]]=Mining_llIllIllIIlIlIIIIlIl[#("W73")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("2Y")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("i78")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nq")]][Mining_llIllIllIIlIlIIIIlIl[#("OC0")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oHOL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ZI")]][Mining_llIllIllIIlIlIIIIlIl[#("mgj")]]=Mining_llIllIllIIlIlIIIIlIl[#("ZNNg")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{203;470;609;711};{395;853;239;193};}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("D0m")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{705;660;906;373};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Wiz")]][Mining_llIllIllIIlIlIIIIlIl[#{{506;271;450;924};"1 + 1 = 111";{895;402;840;493};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bl")]]=Mining_llIllIllIIlIlIIIIlIl[#("VqG")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ZQ")]]=Mining_llIllIllIIlIlIIIIlIl[#("7cb")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{506;597;228;603};}]]=Mining_llIllIllIIlIlIIIIlIl[#("qGp")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2H")]]=Mining_llIllIllIIlIlIIIIlIl[#("zFo")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("b8")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("czp")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{143;613;559;842};}]][Mining_llIllIllIIlIlIIIIlIl[#("aqz")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9V7k")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vi")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("7vF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("LB")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5OB")]][Mining_llIllIllIIlIlIIIIlIl[#("lqH6")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7V")]]=Mining_llIllIllIIlIlIIIIlIl[#("ILd")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hk")]]=Mining_llIllIllIIlIlIIIIlIl[#("BJl")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{915;709;771;964};}]]=Mining_llIllIllIIlIlIIIIlIl[#("B8d")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9r")]]=Mining_llIllIllIIlIlIIIIlIl[#("0Pk")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("im")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("LJN")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ty")]][Mining_llIllIllIIlIlIIIIlIl[#("30q")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yGuB")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("2fC")]]=Mining_llIllIllIIlIlIIIIlIl[#("pzmI")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uY")]][Mining_llIllIllIIlIlIIIIlIl[#("HQ6")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aOdo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("80")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("eM5")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6r")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Cxl")]][Mining_llIllIllIIlIlIIIIlIl[#("Um3q")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jB")]]=Mining_llIllIllIIlIlIIIIlIl[#("nOh")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("H1")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{902;653;573;333};"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vx")]]=Mining_llIllIllIIlIlIIIIlIl[#("lHT")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("yO")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("adU")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Lc")]][Mining_llIllIllIIlIlIIIIlIl[#("tI9")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oN9x")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ka")]][Mining_llIllIllIIlIlIIIIlIl[#("hKd")]]=Mining_llIllIllIIlIlIIIIlIl[#("zno0")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Xc")]][Mining_llIllIllIIlIlIIIIlIl[#("cBM")]]=Mining_llIllIllIIlIlIIIIlIl[#("79RC")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qb")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("UxF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{902;301;781;683};"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yii")]][Mining_llIllIllIIlIlIIIIlIl[#("srmy")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jj")]]=Mining_llIllIllIIlIlIIIIlIl[#("Spr")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rr")]]=Mining_llIllIllIIlIlIIIIlIl[#("FjA")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("70")]]=Mining_llIllIllIIlIlIIIIlIl[#{{555;709;703;233};"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("RL")]]=Mining_llIllIllIIlIlIIIIlIl[#{{344;817;133;850};"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("B7")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("y0x")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("Ky9")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KkrS")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aU")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("fxI")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2z")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bG8")]][Mining_llIllIllIIlIlIIIIlIl[#("uRTc")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6i")]]=Mining_llIllIllIIlIlIIIIlIl[#("4G9")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dD")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{841;423;507;344};{359;122;340;514};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("PQ")]]=Mining_llIllIllIIlIlIIIIlIl[#("jdW")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6l")]]=Mining_llIllIllIIlIlIIIIlIl[#("YLv")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("rg")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("2M0")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nO")]][Mining_llIllIllIIlIlIIIIlIl[#("WFO")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9ypf")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("03")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("pFf")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Cx")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ML8")]][Mining_llIllIllIIlIlIIIIlIl[#("VH8Z")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{118;73;400;908};"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MVf")]][Mining_llIllIllIIlIlIIIIlIl[#("bkv8")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("z0")]][Mining_llIllIllIIlIlIIIIlIl[#("nzN")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("b6MN")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lr")]][Mining_llIllIllIIlIlIIIIlIl[#("8zF")]]=Mining_llIllIllIIlIlIIIIlIl[#("C9FE")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Eu")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("LG8")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("p4")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ba6")]][Mining_llIllIllIIlIlIIIIlIl[#("dvr9")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Bb")]]=Mining_llIllIllIIlIlIIIIlIl[#("PBf")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gE")]]=Mining_llIllIllIIlIlIIIIlIl[#("1PY")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Xi")]]=Mining_llIllIllIIlIlIIIIlIl[#("TTv")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{788;38;579;394};}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("fu0")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{121;505;261;606};}]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{373;841;358;947};"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("SFmS")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("CE")]][Mining_llIllIllIIlIlIIIIlIl[#("8rI")]]=Mining_llIllIllIIlIlIIIIlIl[#("KTMH")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("js")]][Mining_llIllIllIIlIlIIIIlIl[#("ahT")]]=Mining_llIllIllIIlIlIIIIlIl[#("Vsxe")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Kq")]][Mining_llIllIllIIlIlIIIIlIl[#("HLg")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("AZsi")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vV")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("OIW")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DX")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("PQE")]][Mining_llIllIllIIlIlIIIIlIl[#("yffm")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("n8")]]=Mining_llIllIllIIlIlIIIIlIl[#("L1Z")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Zz")]]=Mining_llIllIllIIlIlIIIIlIl[#("d5B")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Dv")]]=Mining_llIllIllIIlIlIIIIlIl[#("Q58")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("t7")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#{{587;181;723;212};"1 + 1 = 111";"1 + 1 = 111";}]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ve")]][Mining_llIllIllIIlIlIIIIlIl[#("2TA")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("93WY")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{31;230;979;613};"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("6eo")]]=Mining_llIllIllIIlIlIIIIlIl[#("Ap9K")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oc")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("MU4")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xg")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("JPy")]][Mining_llIllIllIIlIlIIIIlIl[#("G8Oz")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("k1")]]=Mining_llIllIllIIlIlIIIIlIl[#("FV2")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fU")]]=Mining_llIllIllIIlIlIIIIlIl[#("Cst")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("1t")]]=Mining_llIllIllIIlIlIIIIlIl[#{{929;215;643;846};"1 + 1 = 111";{389;132;801;439};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("sh")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("Nf4")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xV")]][Mining_llIllIllIIlIlIIIIlIl[#("gzr")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rueW")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("O8")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("pUM")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3Z")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NRN")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{920;93;55;831};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eY")]]=Mining_llIllIllIIlIlIIIIlIl[#("a3R")];else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VJ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("ociN")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Oo")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("Lt5")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("41")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Avc")]][Mining_llIllIllIIlIlIIIIlIl[#("MA9c")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("iO")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aNF")]][Mining_llIllIllIIlIlIIIIlIl[#("R7XR")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gx")]]~=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("GsXD")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("0UB")];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("d3XAZr8uM1fFXvsM381mHFmhVKidZZCeNxWXij9crzH")then for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("kD")],Mining_llIllIllIIlIlIIIIlIl[#("xBK")]do Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=nil;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("rGTTncZqL6iIQPOpi5GXAa1AJFET8Y4i8T0o0AZX9kER")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WC")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ivE")]][Mining_llIllIllIIlIlIIIIlIl[#("Cl3j")]];else local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pA")]][Mining_llIllIllIIlIlIIIIlIl[#("Pad")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{586;203;761;418};{19;871;510;647};"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NK")]][Mining_llIllIllIIlIlIIIIlIl[#("Vdd")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("xDc7")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{9;555;234;342};"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("J8J")]]=Mining_llIllIllIIlIlIIIIlIl[#("xhvR")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("of")]][Mining_llIllIllIIlIlIIIIlIl[#("ESH")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("g8LZ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("RhF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Jm")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{648;883;977;610};"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("tHxu")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("CIN")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6n")]]=Mining_llIllIllIIlIlIIIIlIl[#("KVX")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fH")]]=Mining_llIllIllIIlIlIIIIlIl[#("0k4")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("IT")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("soT")]))end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("nhDGU3x2UdqPtjSIgsWb9K6ZzATfTXpHjmuybnn4IpnPJKHqgo31RQnNkNgukrj6YUFh")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("uH2e1DUxqpZ2C8F4yZE8Smyh3Uqgq1ZeACWRaWZnEq4xrCSsObB4bigh")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("VlhmNfABUDalX4L9pEBsaZBb7CoA4dquPIpLSb1kF6H9Sg1hZ4")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("PPYh5Vgok09GQmPHoParoMpYesCs1LhLarLP1At0LWRuGA0")then if Mining_lIIlIlIIIIlIIIlIIIIlIl==#("cKMDZMGdAadNsXxJTyGyL9PYukRC55sPCPqq9OVyWIp1xR")then if Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ts")]]then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("Kb8")];end;else if Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pG")]]then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("kOQ")];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("XzhLh4Clc4XiP5dhERzkOHgKfNhMdUYCON3cXtlU9DnvlFfD")then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("rb")]local Mining_llIIlllIIIIIIllllIlI,Mining_lIllIIlIIlIIIl=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI)))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_lIllIIlIIlIIIl+Mining_llIllIllIIlIlIIIIlIl-1 local Mining_lIllIIlIIlIIIl=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("AWj8G2qsIGEX0hsfvFbbaujGOlktUyKHP4N7PDhVNUoYR7jv4")then local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("Rl")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl+1,Mining_llIllIllIIlIlIIIIlIl[#("4Pd")]))else local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("L4")]local Mining_llIIlllIIIIIIllllIlI,Mining_lIllIIlIIlIIIl=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI)))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_lIllIIlIIlIIIl+Mining_llIllIllIIlIlIIIIlIl-1 local Mining_lIllIIlIIlIIIl=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("0aeBReMNutR6Ij57i5FuB2xqzqfuZRcZAFIJDnmJvciYdQmf3TZn0")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("Z7OXbA9qXOr1HdLvF4T59yUJmSeaCf1Z80PL4PmWJepFGljiEHo")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FJ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{242;569;19;83};"1 + 1 = 111";"1 + 1 = 111";}]]-Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0Z6E")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("F5JBmfLtv9ZRWD3QyaBZS6x5ipcaI5G516tdqnzZe2BKoIScsDVE")then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}];local Mining_lIllIIlIIlIIIl=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl];for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIIllIIIllIlII(Mining_lIllIIlIIlIIIl,Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl])end;else local Mining_lllllIllIlIIllIlIIlIlIlI;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Il")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("HWv")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{456;919;693;474};"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("A63")]][Mining_llIllIllIIlIlIIIIlIl[#("dj8J")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UI")]]=Mining_llIllIllIIlIlIIIIlIl[#("lt6")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4F")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("XhL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qs")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zIB")]][Mining_llIllIllIIlIlIIIIlIl[#("Lf0H")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cr")]]=Mining_llIllIllIIlIlIIIIlIl[#("gMg")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("B3")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2u")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("17m")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HK")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("SWz")]][Mining_llIllIllIIlIlIIIIlIl[#("n40f")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ii")]]=Mining_llIllIllIIlIlIIIIlIl[#("Lu2")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("fk")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sJ")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("3GI")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6H")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hlQ")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{840;71;62;595};{481;110;93;663};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ln")]]=Mining_llIllIllIIlIlIIIIlIl[#("Rx2")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{919;216;561;102};}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WZ")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("eKM")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ov")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dzD")]][Mining_llIllIllIIlIlIIIIlIl[#("DKd2")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eh")]]=Mining_llIllIllIIlIlIIIIlIl[#("QHv")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("1Y")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3m")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("T9e")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("e5")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4LR")]][Mining_llIllIllIIlIlIIIIlIl[#("FO8M")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{496;863;638;303};}]]=Mining_llIllIllIIlIlIIIIlIl[#("pfJ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Px")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Kg")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("aXb")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("SZ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5ph")]][Mining_llIllIllIIlIlIIIIlIl[#("HHII")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kn")]]=Mining_llIllIllIIlIlIIIIlIl[#("fBZ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("4V")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ss")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("jgr")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Zb")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("160")]][Mining_llIllIllIIlIlIIIIlIl[#("miX1")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{79;593;102;263};"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("kf4")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("pc")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("GG")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("gq6")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9c")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{273;666;333;730};"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("aieL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eh")]]=Mining_llIllIllIIlIlIIIIlIl[#("aUs")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("HP")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Jx")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("yH9")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("LQ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("A1x")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{417;923;195;824};"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("s8")]]=Mining_llIllIllIIlIlIIIIlIl[#("j7o")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("lx")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pW")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("sFL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qZ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pnR")]][Mining_llIllIllIIlIlIIIIlIl[#("3TCx")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8t")]]=Mining_llIllIllIIlIlIIIIlIl[#("23Z")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yl")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("sbY")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("V0")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("31g")]][Mining_llIllIllIIlIlIIIIlIl[#("EfgZ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tl")]]=Mining_llIllIllIIlIlIIIIlIl[#("XbY")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Hp")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Wo")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("7z6")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("l7")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TM8")]][Mining_llIllIllIIlIlIIIIlIl[#("6ho1")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{501;549;69;682};"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("bhX")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("RU")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fY")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("XnT")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HJ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cyy")]][Mining_llIllIllIIlIlIIIIlIl[#("QvrJ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kj")]]=Mining_llIllIllIIlIlIIIIlIl[#("Suh")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("8n")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zI")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("cPz")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Y2")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0Za")]][Mining_llIllIllIIlIlIIIIlIl[#("pkoe")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7S")]]=Mining_llIllIllIIlIlIIIIlIl[#("Rqv")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("iF")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("jW")]][Mining_llIllIllIIlIlIIIIlIl[#("qyl")]]=Mining_llIllIllIIlIlIIIIlIl[#("tGDX")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aI")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("5QN")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kQ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nO3")]][Mining_llIllIllIIlIlIIIIlIl[#("YxSD")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4Q")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hsx")]][Mining_llIllIllIIlIlIIIIlIl[#("YelL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{209;649;183;230};}];Mining_lllllIllIlIIllIlIIlIlIlI=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("OuM")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_lllllIllIlIIllIlIIlIlIlI;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lllllIllIlIIllIlIIlIlIlI[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{640;246;48;418};{888;287;227;185};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tx")]]=Mining_llIllIllIIlIlIIIIlIl[#("rIq")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("DX")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{495;933;416;434};}]][Mining_llIllIllIIlIlIIIIlIl[#("hGD")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("34m4")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5d")]][Mining_llIllIllIIlIlIIIIlIl[#("23H")]]=Mining_llIllIllIIlIlIIIIlIl[#("czSz")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7T")]][Mining_llIllIllIIlIlIIIIlIl[#("mgI")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TExp")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{788;155;991;297};{199;175;962;728};}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{{584;177;66;554};{198;529;444;179};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ry")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WSl")]][Mining_llIllIllIIlIlIIIIlIl[#("7NsE")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7k")]]=Mining_llIllIllIIlIlIIIIlIl[#("CLN")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uY")]]=Mining_llIllIllIIlIlIIIIlIl[#("PTI")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dE")]]=Mining_llIllIllIIlIlIIIIlIl[#("hie")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("gE")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("xBe")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("kxY")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("JAVe")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("AQ")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("WSn")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("L2")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("XK5")]][Mining_llIllIllIIlIlIIIIlIl[#("LkRF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7e")]]=Mining_llIllIllIIlIlIIIIlIl[#("x2q")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{87;519;187;25};{563;751;227;823};"1 + 1 = 111";{116;509;833;378};"1 + 1 = 111";"1 + 1 = 111";{769;935;307;882};{672;169;432;300};{629;503;629;271};"1 + 1 = 111";{842;472;726;800};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{631;969;671;992};{680;593;732;756};"1 + 1 = 111";{917;89;53;763};{950;141;961;253};"1 + 1 = 111";"1 + 1 = 111";{249;218;335;318};{605;607;789;944};{971;338;209;494};"1 + 1 = 111";{265;168;602;636};{937;827;409;275};"1 + 1 = 111";{348;784;871;632};{339;30;287;899};"1 + 1 = 111";"1 + 1 = 111";{14;162;183;734};"1 + 1 = 111";{780;146;481;609};"1 + 1 = 111";"1 + 1 = 111";{475;584;625;16};"1 + 1 = 111";"1 + 1 = 111";{198;659;271;283};{463;128;902;926};{824;500;629;2};"1 + 1 = 111";{484;144;633;189};"1 + 1 = 111";{345;913;148;154};}then local Mining_lIIlIIIIIlIIIIIlI;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ym")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("EWU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ak")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3h1")]][Mining_llIllIllIIlIlIIIIlIl[#("nmSM")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TN")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uXH")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("0v")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Fi")]]();Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Dn")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{237;941;479;908};"1 + 1 = 111";{775;261;576;317};}]][Mining_llIllIllIIlIlIIIIlIl[#("AsIA")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("HZ")];Mining_lIIlIIIIIlIIIIIlI=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("1Dn")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_lIIlIIIIIlIIIIIlI;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIIlIIIIIlIIIIIlI[Mining_llIllIllIIlIlIIIIlIl[#("zOtK")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("NydW8SAd1QpBezfxtWoj0rREPu3OfobJjxYvSTPmbSMCVPqsXHjrxSM")then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("yz")]Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl+1])else local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{195;321;322;702};"1 + 1 = 111";}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("46U")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Mg")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ygJ")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{124;961;193;500};{848;91;730;42};{312;147;270;62};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("W9")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{901;335;774;698};"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{993;549;516;981};}]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1])Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KN")]]();end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("QJgNZW8NPRrSKUPKhbhhPpTaeK0IeTmBUCPiNcypU9WexITc2JkuLERAZgIo5A")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("5E18hfG7eN2yPDPNH1XQFJ10pVosGEituB1KGKL7vMfRSgb7kEbyhTdxMbT")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("0mBKEIcoMfg6p0t3EkhiTricDVlLxF7E1ogjkFmjdWuexeirzk2C4KNJd")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ix")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("1KX")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("hTxC2giNfaTkS878f66eQzM4mlMFKqMIfWyDXM4o6T8iInD4F5FQM9TSgC")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QS")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("RIY")]];else Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{576;424;314;104};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("j5")]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("RFNdYylf5LEkDcSh6BEv8SSaOW55fdPxuxnTtQjUxhHsaVbO42WrNgp8WNzc")then local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("Rh")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl+1,Mining_llIllIllIIlIlIIIIlIl[#("kjF")]))elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("pa25h0fZ8YpqT90kz93UrbnqyTogo7QqhsghPy346Z5eGa4gAXyOGrkoWLHzL")then do return end;else local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("RA")]local Mining_llIIlllIIIIIIllllIlI,Mining_llIllIllIIlIlIIIIlIl=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl+1,Mining_llIllIllIIlIlIIIIlIl[#("4PE")])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_llIllIllIIlIlIIIIlIl+Mining_lIllIIlIIlIIIl-1 local Mining_llIllIllIIlIlIIIIlIl=0;for Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+1;Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl]=Mining_llIIlllIIIIIIllllIlI[Mining_llIllIllIIlIlIIIIlIl];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("Kbh9jB2TGbf8YDgjUyYhRBJcVZh2ue0Fs7o36H0EoQrvIIERiN0jKEqiCenusayBl")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("P0ommnHu3ajnFmuATRoQ5ZQfB2sGkns1k62OD6BNMoLq9oJba2rQlFQ0jiVt4bk")then local Mining_lIllIIllIIIlllIIIIllIIlII;local Mining_IllIIIlIIIIIllIIlllIII,Mining_IIlIlIIlllII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5a")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("P1K")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{818;268;636;762};"1 + 1 = 111";{279;609;192;32};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3U")]]=Mining_llIllIllIIlIlIIIIlIl[#("cai")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Dg")]]=Mining_llIllIllIIlIlIIIIlIl[#("JWu")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4e")]]=Mining_llIllIllIIlIlIIIIlIl[#("Bsm")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("gy")]Mining_IllIIIlIIIIIllIIlllIII,Mining_IIlIlIIlllII=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("EfJ")])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IIlIlIIlllII+Mining_lIIlIlIIIIlIIIlIIIIlIl-1 Mining_lIllIIllIIIlllIIIIllIIlII=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIllIIllIIIlllIIIIllIIlII=Mining_lIllIIllIIIlllIIIIllIIlII+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_IllIIIlIIIIIllIIlllIII[Mining_lIllIIllIIIlllIIIIllIIlII];end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("z3")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8z")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("Pk3")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TS")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cVI")]][Mining_llIllIllIIlIlIIIIlIl[#("Eiib")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WG")]]=Mining_llIllIllIIlIlIIIIlIl[#("Lck")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("T5")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("SCK")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("SsdJuR6XqMeQoAgmsrFs6MPPpcEukhSKe5IRlaRt5EAKB9MUcIaMH1TfOysrmMMi")then if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ze")]]==Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2SmO")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("aqH")];end;else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0l")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zbE")]][Mining_llIllIllIIlIlIIIIlIl[#("HWVc")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("XR")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("tWI")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DQ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6cb")]][Mining_llIllIllIIlIlIIIIlIl[#("Oe2k")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tV")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fjo")]][Mining_llIllIllIIlIlIIIIlIl[#("5glb")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6d")]]==Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3oTz")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("8tE")];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("FMs2AbrLlxCmeoqBUrNggdmlCcXSzgs1qQ6ys2NHSauFq3Jjb1Du9cXBAhAxnKmfdL")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vs")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("D4l")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eS")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Mmz")]][Mining_llIllIllIIlIlIIIIlIl[#("DSRT")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{986;214;970;906};"1 + 1 = 111";}]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("SmC")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("hg")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("I35")]][Mining_llIllIllIIlIlIIIIlIl[#("qkHN")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("CT")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qj5")]][Mining_llIllIllIIlIlIIIIlIl[#("QBP4")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Hf")]]==Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("I73V")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("mQr")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("ys2h1OfyfSS4JENQIN82o3F8lCqsiYpBQ8k1jTLQ3ORSRm12K3OCfSQFX46zyXoqDqn")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Wq")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("avc")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("oL")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("neb")]][Mining_llIllIllIIlIlIIIIlIl[#("A1t3")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("RG")]]=Mining_llIllIllIIlIlIIIIlIl[#("Wpn")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lz")]]=Mining_llIllIllIIlIlIIIIlIl[#("07h")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("c0")]]=Mining_llIllIllIIlIlIIIIlIl[#("yJj")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("0x")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("KYq")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UU")]][Mining_llIllIllIIlIlIIIIlIl[#("oMY")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("x7gE")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ib")]][Mining_llIllIllIIlIlIIIIlIl[#("zoe")]]=Mining_llIllIllIIlIlIIIIlIl[#("N9Yy")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("OQ")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("NMF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qa")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("k0W")]][Mining_llIllIllIIlIlIIIIlIl[#("Yebs")]];else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eX")]]=Mining_llIllIllIIlIlIIIIlIl[#("lWB")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("sWHYbr8KlWq8LySpjXu8rQdpWlsgABpB9qJYv0AYUfsbN8Y9f9gP6prNTrcZ82kVG08tZ43tyHnlybM")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("ytbAtKFT86eeYKZ15HFX9EjkgXrzbgoRPoCO1VC6vou2ZYGXRxq1HZX3j0tHsfS2RxzJilake")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("CVjrurqESPZyk0BIFbB5NqHDkCz6PGxgW7xcU2FbpZxdctmJiKQ8Tj6lnQg32uYmsTLnDy")then if Mining_lIIlIlIIIIlIIIlIIIIlIl>#("MGzPY3EA0p0XfZyyMblZdVMj5akUtT8fVVeDtFhrTqpNcHTy4v8mrIU14pTXTTfhrVctV")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ok")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QBW")]][Mining_llIllIllIIlIlIIIIlIl[#("EIpU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vg")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("cY2")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cy")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("GI8")]][Mining_llIllIllIIlIlIIIIlIl[#("EBrF")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sN")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("e0t")]][Mining_llIllIllIIlIlIIIIlIl[#("6v77")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ve")]]~=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MzYV")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("qmq")];end;else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UM")]]=(Mining_llIllIllIIlIlIIIIlIl[#("kB0")]~=0);end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("dh34fWF9hzrW08UWYmbnIdVtI9liuqFzM9r1txC7v5iuG63gyG7ZsIx9vJvfLxO032j0R3D")then local Mining_lllllIllIlIIllIlIIlIlIlI;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("JX")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("C16")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Nn")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("XGI")]][Mining_llIllIllIIlIlIIIIlIl[#("sdcU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("mK")]]=Mining_llIllIllIIlIlIIIIlIl[#("x8H")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Mb")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("ZfW")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Vg")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("vBq")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qy")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("QE")];Mining_lllllIllIlIIllIlIIlIlIlI=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Hkx")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_lllllIllIlIIllIlIIlIlIlI;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lllllIllIlIIllIlIIlIlIlI[Mining_llIllIllIIlIlIIIIlIl[#("RNqR")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5R")]]=Mining_llIllIllIIlIlIIIIlIl[#("F3h")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("jo")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("LJq")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ls")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("1v1")]][Mining_llIllIllIIlIlIIIIlIl[#("E5KY")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("t5")],Mining_llIllIllIIlIlIIIIlIl[#("ajZ")]do Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=nil;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("Ud1N5AYLgeUZsPfeNrFUaxx8qrBNWcAFcHfpQTd5VV9HNYHoXfnzySAyR3vO9kZdPpWWK0z3")then local Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IllIIIlIIIIIllIIlllIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{454;272;228;677};}]];local Mining_lIIlIIIIIlIIIIIlI;local Mining_lIIlIlIIIIlIIIlIIIIlIl={};Mining_lIIlIIIIIlIIIIIlI=Mining_IIIlllIIlIllIllIlllIIl({},{__index=function(Mining_lIllIIlIIlIIIl,Mining_llIllIllIIlIlIIIIlIl)local Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl];return Mining_llIllIllIIlIlIIIIlIl[1][Mining_llIllIllIIlIlIIIIlIl[2]];end,__newindex=function(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl,Mining_lIllIIlIIlIIIl)local Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_llIllIllIIlIlIIIIlIl]Mining_llIllIllIIlIlIIIIlIl[1][Mining_llIllIllIIlIlIIIIlIl[2]]=Mining_lIllIIlIIlIIIl;end;});for Mining_IllIlIIIlIIII=1,Mining_llIllIllIIlIlIIIIlIl[#("2LJC")]do Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;local Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if Mining_llIllIllIIlIlIIIIlIl[#("g")]==58 then Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_IllIlIIIlIIII-1]={Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl[#("AQl")]};else Mining_lIIlIlIIIIlIIIlIIIIlIl[Mining_IllIlIIIlIIII-1]={Mining_lIllIIllIIIlllIIIIllIIlII,Mining_llIllIllIIlIlIIIIlIl[#("kVK")]};end;Mining_IllIlIIlllllI[#Mining_IllIlIIlllllI+1]=Mining_lIIlIlIIIIlIIIlIIIIlIl;end;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KF")]]=Mining_IIlIlIIlllII(Mining_lllllIllIlIIllIlIIlIlIlI,Mining_lIIlIIIIIlIIIIIlI,Mining_IllIlIIIlIIII);else local Mining_lIllIIllIIIlllIIIIllIIlII;local Mining_IllIIIlIIIIIllIIlllIII,Mining_IIlIlIIlllII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ub")]]=Mining_llIllIllIIlIlIIIIlIl[#("PMa")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ij")]]=Mining_llIllIllIIlIlIIIIlIl[#("iJt")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("VB")]Mining_IllIIIlIIIIIllIIlllIII,Mining_IIlIlIIlllII=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("1rm")])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_IIlIlIIlllII+Mining_lIIlIlIIIIlIIIlIIIIlIl-1 Mining_lIllIIllIIIlllIIIIllIIlII=0;for Mining_llIllIllIIlIlIIIIlIl=Mining_lIIlIlIIIIlIIIlIIIIlIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIllIIllIIIlllIIIIllIIlII=Mining_lIllIIllIIIlllIIIIllIIlII+1;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_IllIIIlIIIIIllIIlllIII[Mining_lIllIIllIIIlllIIIIllIIlII];end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("SI")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("le")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("ZLU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Le")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{247;197;342;419};}]][Mining_llIllIllIIlIlIIIIlIl[#("5PME")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gO")]]=Mining_llIllIllIIlIlIIIIlIl[#("Efb")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8D")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0a")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Rxe")]][Mining_llIllIllIIlIlIIIIlIl[#("qb0I")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ur")]]=Mining_llIllIllIIlIlIIIIlIl[#("8gG")];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("J9px0vDUm0RZagugRIWxA6K551xbVP6QtkZSja1I33XthnOjCQ2rNGXMztB88B9H4bGZrM6QRoEH")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("qYRmnKfXPcXxmt0J2JD4pAfSY2ZTlKzcqDiGTVV04To8TDesggYPaM30S9yvUvMeOUgUkuZhYM")then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#{{581;564;225;958};"1 + 1 = 111";}];local Mining_lIllIIlIIlIIIl=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl];for Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_lIIllIIIllIlII(Mining_lIllIIlIIlIIIl,Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl])end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{222;443;687;710};"1 + 1 = 111";{548;398;905;70};"1 + 1 = 111";"1 + 1 = 111";{9;42;850;606};{778;808;547;852};{469;202;254;983};{202;8;918;724};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{408;505;203;79};{841;23;32;890};"1 + 1 = 111";"1 + 1 = 111";{657;746;460;74};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{180;619;462;873};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{171;768;581;942};"1 + 1 = 111";{780;328;341;263};{895;303;442;499};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{244;319;611;791};"1 + 1 = 111";{684;485;11;715};{566;699;926;260};"1 + 1 = 111";"1 + 1 = 111";{701;507;348;580};"1 + 1 = 111";"1 + 1 = 111";{423;939;362;617};{333;545;814;754};"1 + 1 = 111";"1 + 1 = 111";{298;958;864;432};"1 + 1 = 111";{537;239;769;396};{563;663;664;834};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{575;931;925;495};{509;214;270;883};{523;817;578;229};{648;231;312;909};"1 + 1 = 111";"1 + 1 = 111";{424;264;66;361};{828;289;627;611};{651;706;895;594};{32;912;741;74};"1 + 1 = 111";{940;281;966;608};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{601;713;150;282};"1 + 1 = 111";{430;372;309;948};{868;200;931;52};}then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("M5")]Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl+1])else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Th")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uo0")]][Mining_llIllIllIIlIlIIIIlIl[#("Aqp6")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Tj")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("0vo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9C")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("AFG6")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("29")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6lj")]][Mining_llIllIllIIlIlIIIIlIl[#("0jKW")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4S")]]==Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aWj9")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("QgQ")];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("L1zp4jool6D2j8PYaceZ2Undfz9qvxAHONXiyUftjMMizV3m7xSsWd61OvkGj82YH6nGlGAq7VPph")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rE")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("L9n")]][Mining_llIllIllIIlIlIIIIlIl[#("aZvq")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3x")]]=Mining_llIllIllIIlIlIIIIlIl[#("9FW")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7S")]]=Mining_llIllIllIIlIlIIIIlIl[#("mxr")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pB")]]=Mining_llIllIllIIlIlIIIIlIl[#("fFP")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("qM")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("ANN")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4K")]][Mining_llIllIllIIlIlIIIIlIl[#("1aR")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("OCJX")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("u2")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("2U1")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Xx")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nli")]][Mining_llIllIllIIlIlIIIIlIl[#("QXTg")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("18")]]=Mining_llIllIllIIlIlIIIIlIl[#("B6O")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{648;136;817;218};}]]=Mining_llIllIllIIlIlIIIIlIl[#("a4C")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{838;432;844;265};"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("JUY")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pX")]]=Mining_llIllIllIIlIlIIIIlIl[#("nMS")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("UT")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("HYD")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("YW")]][Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{483;460;886;179};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nPOk")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kE")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("sve")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fT")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Nqq")]][Mining_llIllIllIIlIlIIIIlIl[#("yfMS")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("u7")]]=Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eJ")]]=Mining_llIllIllIIlIlIIIIlIl[#("1tv")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2F")]]=Mining_llIllIllIIlIlIIIIlIl[#("ksJ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yb")]]=Mining_llIllIllIIlIlIIIIlIl[#("lUP")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("HP")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("bA8")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("im")]][Mining_llIllIllIIlIlIIIIlIl[#("Sfz")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("WeZ8")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ka")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("ncc")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Pk")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("0mR")]][Mining_llIllIllIIlIlIIIIlIl[#("F11K")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("KG")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("EXS")]][Mining_llIllIllIIlIlIIIIlIl[#("K49F")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("uIK")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("85SB")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UV")]][Mining_llIllIllIIlIlIIIIlIl[#("D72")]]=Mining_llIllIllIIlIlIIIIlIl[#{{81;686;229;387};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("l7")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("8Mz")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{987;983;257;449};}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("QYm")]][Mining_llIllIllIIlIlIIIIlIl[#("uh9B")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Sy")]]=Mining_llIllIllIIlIlIIIIlIl[#("s1s")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Kv")]]=Mining_llIllIllIIlIlIIIIlIl[#("cy6")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kq")]]=Mining_llIllIllIIlIlIIIIlIl[#("qRP")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Oc")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("MqM")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TG")]][Mining_llIllIllIIlIlIIIIlIl[#("b15")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("4mNM")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("aP")]][Mining_llIllIllIIlIlIIIIlIl[#("0U6")]]=Mining_llIllIllIIlIlIIIIlIl[#("JML1")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IF")]][Mining_llIllIllIIlIlIIIIlIl[#("nn5")]]=Mining_llIllIllIIlIlIIIIlIl[#{{488;899;299;492};{288;395;757;639};"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{956;58;628;132};"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("ND8")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sQik")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nO")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{{983;659;295;505};"1 + 1 = 111";{981;441;898;990};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("iu")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("EKV")]][Mining_llIllIllIIlIlIIIIlIl[#("CxlP")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("UH")]]=Mining_llIllIllIIlIlIIIIlIl[#("MV6")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("i2")]]=Mining_llIllIllIIlIlIIIIlIl[#("r4J")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Gf")]]=Mining_llIllIllIIlIlIIIIlIl[#("9aH")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("jz")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("3Tx")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("84")]][Mining_llIllIllIIlIlIIIIlIl[#("4I5")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vLuP")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ma")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("Cul")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Hl")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TO8")]][Mining_llIllIllIIlIlIIIIlIl[#("x2A9")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("nd")]]=Mining_llIllIllIIlIlIIIIlIl[#("q95")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Y7")]]=Mining_llIllIllIIlIlIIIIlIl[#("g72")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#{{480;712;521;204};"1 + 1 = 111";"1 + 1 = 111";}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Bc")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("PnM")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("z4")]][Mining_llIllIllIIlIlIIIIlIl[#("6ji")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yrx0")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cL")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("gCS")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fF")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("O7F")]][Mining_llIllIllIIlIlIIIIlIl[#("vu0A")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7z")]]=Mining_llIllIllIIlIlIIIIlIl[#("Kic")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{789;92;703;500};{632;256;913;715};}]]=Mining_llIllIllIIlIlIIIIlIl[#("5BB")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sM")]]=Mining_llIllIllIIlIlIIIIlIl[#{{134;24;442;372};{577;782;437;694};{256;215;838;822};}];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("bM")]]=Mining_llIllIllIIlIlIIIIlIl[#("1rT")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("AG")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("eMi")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Vu")]][Mining_llIllIllIIlIlIIIIlIl[#("TJ1")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gq7W")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Je")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("FRb")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("gT")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("r9X")]][Mining_llIllIllIIlIlIIIIlIl[#("P9Y0")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tJ")]]=Mining_llIllIllIIlIlIIIIlIl[#("CLF")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("dJ")]]=Mining_llIllIllIIlIlIIIIlIl[#("hZy")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MB")]]=Mining_llIllIllIIlIlIIIIlIl[#("XMH")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Sq")]]=Mining_llIllIllIIlIlIIIIlIl[#("Bmz")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("ya")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("S81")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Oh")]][Mining_llIllIllIIlIlIIIIlIl[#{{906;720;399;637};"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ia89")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("eA")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("W9")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zLS")]][Mining_llIllIllIIlIlIIIIlIl[#("7r5r")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("cr")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qJD")]][Mining_llIllIllIIlIlIIIIlIl[#("6Gk0")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TG")]][Mining_llIllIllIIlIlIIIIlIl[#("XeM")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("assU")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("01")]][Mining_llIllIllIIlIlIIIIlIl[#("n3C")]]=Mining_llIllIllIIlIlIIIIlIl[#("gGWA")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("TE")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("bai")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ap")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("smg")]][Mining_llIllIllIIlIlIIIIlIl[#("eNIQ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_llIllIllIIlIlIIIIlIl[#("hVu")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("DR")]]=Mining_llIllIllIIlIlIIIIlIl[#("dEy")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Zy")]]=Mining_llIllIllIIlIlIIIIlIl[#("RiZ")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("U4")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("3BK")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9b")]][Mining_llIllIllIIlIlIIIIlIl[#("Tib")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ydK0")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5I")]][Mining_llIllIllIIlIlIIIIlIl[#("vMY")]]=Mining_llIllIllIIlIlIIIIlIl[#("xtyG")];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{721;171;926;658};"1 + 1 = 111";{347;319;135;775};"1 + 1 = 111";"1 + 1 = 111";{996;557;243;36};"1 + 1 = 111";{822;647;167;385};{167;926;578;989};"1 + 1 = 111";{846;839;302;275};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{587;172;583;578};{15;51;580;288};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{13;446;638;977};"1 + 1 = 111";{507;560;839;17};"1 + 1 = 111";"1 + 1 = 111";{445;961;385;554};"1 + 1 = 111";{813;243;104;338};{290;988;406;26};"1 + 1 = 111";{712;702;712;763};{74;784;150;234};{128;486;903;720};"1 + 1 = 111";{479;616;948;439};{229;97;658;94};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{925;596;664;925};"1 + 1 = 111";{771;335;910;556};"1 + 1 = 111";{901;668;229;671};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{432;864;955;257};"1 + 1 = 111";{419;622;541;816};{697;743;706;343};{227;463;666;354};"1 + 1 = 111";{397;223;409;835};{813;948;793;38};"1 + 1 = 111";{236;490;8;373};"1 + 1 = 111";{505;532;119;214};"1 + 1 = 111";{52;732;298;672};"1 + 1 = 111";{779;917;336;577};"1 + 1 = 111";{196;156;700;697};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{194;680;430;425};}then local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("Ka")]local Mining_llIIlllIIIIIIllllIlI,Mining_llIllIllIIlIlIIIIlIl=Mining_IIIIIlllIIlIlI(Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl+1,Mining_llIllIllIIlIlIIIIlIl[#("ZA9")])))Mining_lllllIllIlIIllIlIIlIlIlI=Mining_llIllIllIIlIlIIIIlIl+Mining_lIllIIlIIlIIIl-1 local Mining_llIllIllIIlIlIIIIlIl=0;for Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl,Mining_lllllIllIlIIllIlIIlIlIlI do Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl+1;Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl]=Mining_llIIlllIIIIIIllllIlI[Mining_llIllIllIIlIlIIIIlIl];end;else local Mining_IllIlIIIlIIII;local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("u05")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("i3")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("p2")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Ez8")]][Mining_llIllIllIIlIlIIIIlIl[#("ezJW")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("nrm")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8P")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("7o")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("Q7I")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("R1")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{869;906;153;670};"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("LghD")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("AqI")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kn")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lD7")]][Mining_llIllIllIIlIlIIIIlIl[#("vQeL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("69")];Mining_IllIlIIIlIIII=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6Ax")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl+1]=Mining_IllIlIIIlIIII;Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{{867;385;938;426};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("XBKU8A3kygGd0MZ37OEzZafb8YZaRSq41M8ABCXstZZZZOTkO6PIWGSWvJVjL3EQZLmoOACG1kf9kqmteOvUc")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("iv3ld2QNSAvj9nCFHnEjQLATLfvBf6ITNgD0uCxKZnDPNbq92Jghp3cH6kL8GoIW2MG2UMkf14tCiUfJYx")then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("GZAEUd54j1zeLQRWaGzopzbpvKLylfbjiPb6DiWZZSaoD0SVC8edAisgXjikDISeZo55OUt2UKAIzXXF")then local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("E0")]Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl+1])elseif Mining_lIIlIlIIIIlIIIlIIIIlIl>#("Z5ma7Uax5is9Lvq96zo4XhSOmtZTUSaxNtOMFe2E4JTMb2iniJDzJLdSnJXN5rMmi5xrSPE1HUanyfNtl")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vX")]][Mining_llIllIllIIlIlIIIIlIl[#("Eht")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("uTpx")]];else if(Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NZ")]]==Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("25uS")]])then Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;else Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("nNR")];end;end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("KlpLXcp5y6qoJN7GEfG0GDeL2YKZti5ECsRA7HitcWrHLrlyq1MIYufhgPT8CAMoaXXp5HJ77lYTkI9KNmJ")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Uf")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("CeO")]];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("GyPgnKsrXj2MkcGYF5CTrPKNHx6JQjvp1iTNhQcvoqjXsmJibkeSVZk1XbK0NUMOYNVbt3QY3fFaFXttYYIF")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pn")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6S8")]][Mining_llIllIllIIlIlIIIIlIl[#("R5Wq")]];else local Mining_llIllIllIIlIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("Z0")]Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_llIllIllIIlIlIIIIlIl+1,Mining_lllllIllIlIIllIlIIlIlIlI))end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#{"1 + 1 = 111";"1 + 1 = 111";{157;690;337;113};{382;432;561;855};{261;754;590;963};{602;663;375;227};{263;964;70;30};{600;617;426;645};"1 + 1 = 111";{295;514;236;799};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{50;90;740;931};{889;750;745;512};"1 + 1 = 111";"1 + 1 = 111";{994;887;977;667};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{960;775;324;818};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{5;612;595;560};{663;875;593;186};"1 + 1 = 111";{140;478;885;88};{347;337;531;43};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{344;708;327;194};{76;302;430;875};"1 + 1 = 111";{204;902;116;901};"1 + 1 = 111";{310;16;182;93};{992;199;860;509};"1 + 1 = 111";{727;577;254;576};"1 + 1 = 111";{359;794;516;750};{250;473;437;493};"1 + 1 = 111";{659;755;17;936};"1 + 1 = 111";{322;628;386;720};"1 + 1 = 111";{247;149;337;514};{884;207;512;470};{793;511;847;379};{537;234;356;886};{610;855;128;798};{653;155;88;510};"1 + 1 = 111";{951;393;213;183};"1 + 1 = 111";{809;539;794;818};"1 + 1 = 111";{263;415;834;324};"1 + 1 = 111";"1 + 1 = 111";{425;825;776;501};{155;592;523;443};"1 + 1 = 111";{125;775;334;645};"1 + 1 = 111";"1 + 1 = 111";{425;66;908;192};{689;856;382;199};"1 + 1 = 111";{46;418;673;647};"1 + 1 = 111";"1 + 1 = 111";{129;41;591;892};"1 + 1 = 111";"1 + 1 = 111";{21;238;966;119};"1 + 1 = 111";{84;436;953;228};{5;218;907;186};{961;446;413;373};{922;268;136;339};}then if Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("usbp8ok1JFTYb8fjYNugpSIzagLuExcFBkEoRmyZTRIXK9vp7m7nCaGNVNp2OZxlCnx1E1CLoGxIkVYaUvxqAZ")then Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("XW")]][Mining_llIllIllIIlIlIIIIlIl[#("eT1")]]=Mining_llIllIllIIlIlIIIIlIl[#("R7ag")];elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#{"1 + 1 = 111";"1 + 1 = 111";{401;828;721;668};"1 + 1 = 111";{901;427;784;981};{875;698;783;378};"1 + 1 = 111";"1 + 1 = 111";{431;674;597;794};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{25;45;486;292};{405;343;791;571};{260;632;452;388};"1 + 1 = 111";{127;773;830;638};{534;840;942;103};"1 + 1 = 111";{211;709;690;503};"1 + 1 = 111";{757;406;339;349};{264;839;689;902};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{836;654;715;759};{810;285;177;385};"1 + 1 = 111";"1 + 1 = 111";{195;135;661;48};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{419;34;456;457};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{152;628;209;918};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{95;888;48;16};{407;982;514;251};"1 + 1 = 111";{446;165;334;136};{356;380;618;288};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{475;332;42;99};"1 + 1 = 111";{649;522;900;634};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{799;914;52;916};"1 + 1 = 111";{606;957;701;464};"1 + 1 = 111";"1 + 1 = 111";{931;296;871;298};"1 + 1 = 111";{362;5;63;748};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{636;728;377;155};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{926;948;487;749};{500;992;994;152};{347;536;422;200};"1 + 1 = 111";"1 + 1 = 111";{889;121;806;533};}then local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("er")];local Mining_llIIlllIIIIIIllllIlI=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("lz1")]];Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl+1]=Mining_llIIlllIIIIIIllllIlI;Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl]=Mining_llIIlllIIIIIIllllIlI[Mining_llIllIllIIlIlIIIIlIl[#("8FfR")]];else local Mining_lIllIIlIIlIIIl=Mining_llIllIllIIlIlIIIIlIl[#("sP")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIllIIlIIlIIIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIllIIlIIlIIIl+1,Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{563;170;643;690};{898;497;321;829};}]))end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl<=#("bhFn5h6vDcapSpR5CJjvMIP7W23ZEkpO16kJY5WpU2hgTx1hl8qNAvjDDHBdoh2rXvzWehgHW4MUBIozaVOG3MnFW")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("rA")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("S98Y")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zl")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("5IZ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("sW")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("NS1")]]-Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("iV3q")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("JUi")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Lu")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("Mgn")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("N6")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("FJB")]][Mining_llIllIllIIlIlIIIIlIl[#("ujmH")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Fa")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("JYD")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("PWAG")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kj")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("MQd")]][Mining_llIllIllIIlIlIIIIlIl[#("A3XB")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("6z")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("E1H")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Pd")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("3AV")]][Mining_llIllIllIIlIlIIIIlIl[#("enBK")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Qu")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("2B9")]][Mining_llIllIllIIlIlIIIIlIl[#("ZOJX")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Cv")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("pGC")]][Mining_llIllIllIIlIlIIIIlIl[#("37GL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("L7")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("IIH")]]+Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("5cFh")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Wo")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("dyo")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("1l")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("fTs")]][Mining_llIllIllIIlIlIIIIlIl[#("IUEQ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("qB")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kAY")]][Mining_llIllIllIIlIlIIIIlIl[#("mfKz")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("zY")]]=Mining_lIllIIllIIIlllIIIIllIIlII[Mining_llIllIllIIlIlIIIIlIl[#("Qk1")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("kZ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("JZK")]][Mining_llIllIllIIlIlIIIIlIl[#("YlIE")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{385;793;718;891};{901;537;750;946};"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#{{976;156;601;340};"1 + 1 = 111";"1 + 1 = 111";{399;492;760;481};}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{70;655;835;43};"1 + 1 = 111";}]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Yb0")]][Mining_llIllIllIIlIlIIIIlIl[#("RLA9")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("E5")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Xv3")]]+Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("SpZR")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("T4")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{947;630;423;152};}]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("9k")]][Mining_llIllIllIIlIlIIIIlIl[#("NAs")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("yyPL")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];do return end;elseif Mining_lIIlIlIIIIlIIIlIIIIlIl==#("frETbNaZtx8fcd1U0GUzc5sccDDxykh49ybYcc38ULo1B5TLOjWSUxPk9CRJkOBipefPbcRYNWPBQCMhT2SozAjMS0")then local Mining_lIIlIlIIIIlIIIlIIIIlIl;Mining_lIIlIlIIIIlIIIlIIIIlIl=Mining_llIllIllIIlIlIIIIlIl[#("23")]Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl]=Mining_lIlIlIIIIIlllllIlllII[Mining_lIIlIlIIIIlIIIlIIIIlIl](Mining_lIIlIIIIIlIIIIIlI(Mining_lIlIlIIIIIlllllIlllII,Mining_lIIlIlIIIIlIIIlIIIIlIl+1,Mining_llIllIllIIlIlIIIIlIl[#("gzl")]))Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{367;467;811;182};}]][Mining_llIllIllIIlIlIIIIlIl[#("MgV")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("tUVu")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("is")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#{"1 + 1 = 111";{846;164;263;32};"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("VQ")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("8Cf")]][Mining_llIllIllIIlIlIIIIlIl[#{{727;618;122;284};{315;487;295;847};"1 + 1 = 111";"1 + 1 = 111";}]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("mp")]]={};Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("EG")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("cfs")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("vc")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#{{205;366;136;462};"1 + 1 = 111";"1 + 1 = 111";}]][Mining_llIllIllIIlIlIIIIlIl[#("RAcJ")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("24")]]=Mining_llIllIllIIlIlIIIIlIl[#("HUT")];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("ds")]]=Mining_IllIlIIIlIIII[Mining_llIllIllIIlIlIIIIlIl[#("pVh")]];Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;Mining_llIllIllIIlIlIIIIlIl=Mining_llIIlllIIIIIIllllIlI[Mining_lIllIIlIIlIIIl];Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Pi")]]=Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("HA7")]][Mining_llIllIllIIlIlIIIIlIl[#("MTFY")]];else Mining_lIlIlIIIIIlllllIlllII[Mining_llIllIllIIlIlIIIIlIl[#("Cq")]]=Mining_IIlIlIIlllII(Mining_IllIIIlIIIIIllIIlllIII[Mining_llIllIllIIlIlIIIIlIl[#("33H")]],nil,Mining_IllIlIIIlIIII);end;Mining_lIllIIlIIlIIIl=Mining_lIllIIlIIlIIIl+1;end;end);end;return Mining_IIlIlIIlllII(true,{},Mining_IIlIlIIIll())();end)(string.byte,table.insert,setmetatable);
%d bloggers like this: