Roblox CITY-17 Gui Script

Roblox CITY-17 Gui Script

Script by leonthomas855

--[[
IronBrew:tm: obfuscation; Version 2.7.2
]]
return(function(llIlIllll,lIIIIIlII,lllllllllIIlIll)local IlllIIIIlllIlIllI=string.char;local lIIIIllIII=string.sub;local IlIIIlIIIIIllIIIl=table.concat;local llIIllIIIIIIIIllllI=math.ldexp;local IIllllIIIlllIlIlIIllIIIl=getfenv or function()return _ENV end;local IIIlIIlllIIlIlllIIIlIIII=select;local IlllIIllllIllI=unpack or table.unpack;local lIllIIIlIIIIIIIlIIII=tonumber;local function lllllIllllIllllllI(llIlIllll)local lIIllIllllIIllIIlIlIllI,llIlllIIIIIllllIll,lIlIIIlIIlllllII="","",{}local IlllIIllllIllI=256;local llllllIlIIlllllIIIl={}for lIIIIIlII=0,IlllIIllllIllI-1 do llllllIlIIlllllIIIl[lIIIIIlII]=IlllIIIIlllIlIllI(lIIIIIlII)end;local lIIIIIlII=1;local function lIlIIIIIIIIlIlIllllII()local lIIllIllllIIllIIlIlIllI=lIllIIIlIIIIIIIlIIII(lIIIIllIII(llIlIllll,lIIIIIlII,lIIIIIlII),36)lIIIIIlII=lIIIIIlII+1;local llIlllIIIIIllllIll=lIllIIIlIIIIIIIlIIII(lIIIIllIII(llIlIllll,lIIIIIlII,lIIIIIlII+lIIllIllllIIllIIlIlIllI-1),36)lIIIIIlII=lIIIIIlII+lIIllIllllIIllIIlIlIllI;return llIlllIIIIIllllIll end;lIIllIllllIIllIIlIlIllI=IlllIIIIlllIlIllI(lIlIIIIIIIIlIlIllllII())lIlIIIlIIlllllII[1]=lIIllIllllIIllIIlIlIllI;while lIIIIIlII<#llIlIllll do local lIIIIIlII=lIlIIIIIIIIlIlIllllII()if llllllIlIIlllllIIIl[lIIIIIlII]then llIlllIIIIIllllIll=llllllIlIIlllllIIIl[lIIIIIlII]else llIlllIIIIIllllIll=lIIllIllllIIllIIlIlIllI..lIIIIllIII(lIIllIllllIIllIIlIlIllI,1,1)end;llllllIlIIlllllIIIl[IlllIIllllIllI]=lIIllIllllIIllIIlIlIllI..lIIIIllIII(llIlllIIIIIllllIll,1,1)lIlIIIlIIlllllII[#lIlIIIlIIlllllII+1],lIIllIllllIIllIIlIlIllI,IlllIIllllIllI=llIlllIIIIIllllIll,llIlllIIIIIllllIll,IlllIIllllIllI+1 end;return table.concat(lIlIIIlIIlllllII)end;local lIlIIIIIIIIlIlIllllII=lllllIllllIllllllI('23R24927524924327626T26U26W27126I26L26J26O26V27224924D27627226W26S27024924E27625T26L26L26H26627026L24925427626P27V26H26I24J25225226H26W27E27026Z27H25326Y26U26S25226J26W26M25226B25K25Q27224R27027025X27K27625S26V26O28027827527Y26L25M27026J26N26O26Y27Q27S27526226U26J27026626K26O24924F27626027127125P26W26Z29O27626229226824O24U27729Q29S29826Y26L26O26U26V24924527629L26V25529827V27H27226I2492402A527126326K27V2AB24924A27625O25M25L24924229Y26U26T26L25525L26826L26P2AV29F24925M28B26I25024O24R2AW27625M25W2662A427526327G27I2AI2BC26H2AO27625Q26W26825L26U27H26L2AN2AP27525P28M27H25C26W26J2712AD27625L26T26W26B26W24X27G26I26Q26824W2B227625U26T27027H29925525X29V2CV27525N28E27026T2AI28B26M2AC29424925W26W26V2BC2CY25527W27R27626726W2A829I26824923T2762BT26U26Y26Q2702AH25L27G29D26V2A82BZ2752602AT26U2552DQ26J26S28Y2EA2EC24924128Z2712E22A926L2DU2C924925T26O2EO25525Z27O27Q2ET26226P26W2B725X26U2AM25C27623V23S2762482FB2752FF24B2762552FH2492FF2AX23V2752AX27L2762FM2AX2FU2FX2FJ2FX2FI2492FL2FN27624C2492FQ2BM2FZ2G22FR2BM29P23V25S2492G62BE24923X2BM2G62G02762FJ2G32FJ2FF2EM2G827L2ET2GP28Y2GQ2GC2FJ2782G82G62B32FX2AX2G62H028Y2AX2AE2G829P2442GP2FF2GJ2752BY27L27S2GQ25H2GH2BM2HD2GG27S2472HH2EL2G42762BY2G62EM2HO29X2HC2G72GG2EM2462HW2AP2GA2492BY29P2IB2G22HP27S2I52GF2BZ2DW27524B2FF2782FW2HK2DO2782I32EM2IK2GG2782FD2IO2FF2B32FT27529N2EM2B32HA2IG2H32752B32G82FU2AP2J92GB2A42AP2HD2752AE23U2HW2HG2GN2IT2782HG2I32B32JL2I62492HG2GL2J22492HV29P2HZ2CV2HV2I32AE2JY2IL2HV23W2HW2I92GJ2BY2AE2I92I32HG2KC2GG2I923Z2HW2DW2EM2K72HG2DW2I32HV2KO2DV24923Y2HW2FD2GX2BY2HV2FD2I32I92L02FD23L2HW2FQ2DF2ID2492I92FQ2I32DW2L02FQ23K2HW2JP2H62J62L12JP2HA2L92A42G82JP23N2FX2492FD2LW2JJ2FQ2FD2JM2GK24923M2HW2KF2AE27629N2FQ2KF2HA2M62JC2492KF23P2M32JP2MK2JJ2GL2JP2MA2KR23O2HW2L32HG2K72GL2L32I32KF2MW2JZ2L32742K32LE2HV2K72KF2LE2FZ2AC2FM2762I92752KF2762J527N27P2BR24929629829A29C29E2CJ2CL2682992AN2LT2F726Y26W26T2CK2C22992HX2BS2DR26Q28B2E02E92492AZ25L2552DH26L26Y26P2LJ2DX2CL28D26J2AJ2A927I2AN2JS25M26L2F52AN2K62BF26H29J27C2HQ27525R2O826K2702FF2M32752KU24926726O29J25N2F52PG2FU1P1U22I2612OS2752E426U26R2702A826O2CY2BG28V2CH2PK2OX2AL2AN2J525W26U2EO2EI2492EB26L26U2NT26029126S2F52AA26V2P52762D727A2PA2BE26527027E26J26U2DU2JS26426G29M26H2652FB24Q2G42PH2JJ2FF2G12G82AX2IS2FE2G92RF2G427L2G32RG2HQ2RQ2G429P2RT2HI2RN2GT2RY2BZ24P2FM2782JE2FM2RE2RW2492FJ2RI2BM2GO2AX2HA2RR2RP2S62RS2SI2RV2SI27S2S82EM2S82AE2S22G42JU2G72SI2752S82SA2GC2RK2FV2S92S02SH2RD2SJ2T62SL2T62SN2SI2SP2SI2HV2SS2IQ2K02SV2T62SX2SI2SZ2BM2T12G42SE2T42S02G62S82T92RR2TB2T62I92S82DW2TG2A42FD2G82RR2TL2T62TN2RJ2M32FO2T32S82T52RR2TU2SK2S02TY2RR2FQ2S82JP2S82K22FM2GS2TJ2U72S02UA2SC2FU2UD2SF2RO2TT2S02TW2G42UN2SI2KF2UQ2UZ2T32RE2RL2NK2NN2FU2NQ2F02NT2NV29929B29D2DO2PY2O12O32D52492O62O82OA2O226J2OD2492632OF2OH26Q2VT29H2B62B82BA2BC2AC2NM2W12OU26L2992QA2OZ2PB2BF2P32C729X2752BG2P92CH2JS2PD26T2PF2VD2FX2PK2PM2PO2PQ2VD2PT2PV2PX2492PZ2Q12Q32Q526H2Q72W02WI2AM2QH2QE2QG2J52QJ2QL2DF2QN26O2QP2A92AB2QT2D62D927B2CH2QY2R027F2R32WK2R62R82RA27523V2RC2UV2SY2TJ2UB2SD2UE2SI2UG2G42UI2T82UK2S02TD2T62AP2U32S42UU2HY2UW2YB2UY2RL2TR2UF2V32TV2YK2SO2S02SR2S32TI2U62YS2YA2SB2TP2V02TS2S82YI2RR2V52RX2Z22S82TF2Z52HG2Z72S72TM2YU2ZB2RM2YY2ZE2V42Z12SI2U02SI2U22Z52U52SW2YT2ZA2UC2ZT2YF2YZ2UJ2S82UL2V62S02UP2SI2UR2G42UT2ZO2FK2ZQ31062YD2V12FF2YG2FF2ZF2RU2S02V72T62V9310H2VB2UT2GO2VF2MO2VH27M2VJ2DF2VL2NX2VO2BE2VX2VS2O52DZ2VW2VR2VZ2PK2W22E02W42VP2BF25L26025M2BJ2BL2WD2632WF2WH27Z2OY2XG2P12WM2XT2P72WR2WK2WU2WW2PI2PJ2DP2PN2702PP2WG2X32PU2PW2WD2X82Q22A92XB2XD2Q931202QB2XH2QF27Q2XK2EK2XN2QO2QQ2XS2WO2492QV2XW311P2QZ2R12Y12R52R726O2R92RB2TK31052T031072YX31092ZV2Z0310C2YL2S02YO2Z52S5313G2Z9313I310P2ZD2SI310U2FF2ZH2DO2ZJ2SI2Z42ST2Z63104313V2TO313J2YE2T6310S2T72ZG2ZX2T62YM2RR2ZL31472ZN3149310N313W2VB313K314E310A2YJ313O2S82ZZ2T6310131473103313U314Q314B313X2ZU313Z2ZW314X2SI310X2RR310G2T6310I2G12FF310L2U82RR2UX2ZS314T2SG314V314H2S8315D2G4310Z315G31112YS2VE315Z2NO2752VI2NS311927Z2NW2VN2NZ2VQ2OB26J2O42762VV2O9311J2W0311M2OG2OF2UY2BO2BQ311W311Y2OW312S2WJ31232P431332WQ2702PA2WT2PE2PR312B2WZ312E312G31732752X4312K2CJ2R22X9312O2702Q62702Q82BN316T2XG2QD312V2QH2XL2QM31302XR2QS313331352QX27631382Y02R42762Y3313D2Y52G72Y82Z831552YC314S314D315Q313M310B2SM313P2S8313R3147313T2Y931892YV2T2310Q28Y318E314W318G31442T631462TH314O31542U92ZR314C318Q314F314029X315B314J2S0314M318Y2YR2ZP3191310O318B3194315R310V31982RR314Z2RR31512TH3153318M319F314R2YW318C2V2318S315S318U315C310F2S0315H2VC319D310M319T3156319H313Y2T631963142315U2FF315W2RR31A431122VB31142N22752JS28B2PN2QC311731652AF31672VM2NY2OJ25Q29I26Q26I2OH2F12BN2BX2602P92AN2NE2NU27Z31382E62712DI2WN2J52EZ31AU2752QZ2O829931B8316Z313326226728M2NS311D311J316E275316G311E2VZ2F22F428M2A82OC2IN2EU26K2QP26V2C527125N26U26U26L25L2CF26L2LE2Y626W313G2G82FJ2GA2GR2T32FP31632QH2GY27L2HA31CS2T731D22P631CV31072GC2J531152FF2552FQ29P2GI24925B26229X2HV2RZ24D24Y27631DK27K31DN2VG315J26429X31CT2BQ29P29P2782G331DY2CV31E129X2AE31E42HF2JJ31E22AP2IN2G62AP31DY2G62TH2G131DM2762782PH2NJ2YS2VD2LT2QH2OQ2CF2QH2NR316A2X731BY2VT31C1316I31C42CF2DR2WG2VZ31C925T31CB2DI31CE31CG31CI31CK26J2802P631BT31BV31B527531B026J31B231B4313325S27231CD29J31AZ2C226H2C526V2WN2ET2CB26W27H2682CF27131BB23V2RA2G1315L2TQ31AB2UH31A62Y6314P2YJ31CR2W031CU2FJ2AP31GM2A431GP2B331GP27S2IN2RX2IC2VF31EP311627531ES2VZ316431EW31C231BZ2VU311H316H316C2OJ2F331F331C731F627T31F931CD2EW31FC31CJ31CL31BS31BU2VJ2ET31FM31FO2DR27Q2P631FR31FT31FK2492C126831FX2C62P02O02CM26W31G831GA2T331GC2UD315831AC31GG31IG2Z031GK2PK31GP31GO2IO2T331E031IN2FJ31GS31IQ2DO31GV2DO31GX31EO2FU31EQ2J531H231EU2VJ31BX316C31H731F031HB31F231C631F52L127531F831CC31FB31CH31HM31FF31HO31FJ31AZ31B131B331HU31FQ31FS29I31HZ31I131I331FZ2AN2DF2CX2CZ26V2992D326Z31I9310J31A72RR2AX31IE31GF315K31IH2UJ31IJ31A731D231IM2T32H22JJ31D231IS31KK31IU2FM2HN31D7315Z31J027631J231H4311P31H631EZ31H931C231HC31C531F431C831HH31JG31HK31JI31FE31FG29Y31HP2NS31HR31JO31FP31HW31JS31FU31HR31FW31FY2WN2DF2D726Z2D92BG28N26V31K631GB2S031KA313L315931KD31KD31II31IN31IK31IT31KJ31D231IP31KP31KO31D231GU31KR31IB31AL31KU31H024931KX31AT31H531EY311G2O731HA2VY31L431HE31JC31F731HI31JH31FD31HN31FH31LF31JU31LI31JQ31LK31HY31FV31I231LP2AN2BE2DH2DJ2B527031LY31MI2S831M1314U2ZV31M431GI314H31KG2U831KI31KM31IO31NV31IR31NX31KQ2G431KS311331MK2NP31KW31C531J331BW31I62VY31J731L231F129Y31L531HF31JD31CA31L931CF31LB31N231LE31JM31LH31FN31JP2VO31N831JT31NA31JW2WN2BE2DQ2DS26J26831NJ31CT2SI31NM318D31M3310431M531KF31M731KH2T331MA31NW31GR31NZ31MG31O131MI316031GZ31O531H131O731KY31J531OB31L131MS31L331JA31L631HG31JE31MZ31LA31N131JK31N331OP2C031N631OT28Z31LL31JU31LO31I42K42DX2R22E126V2E42Q227H2A831P431K831GD31KB2YH31IG31PB31GJ31PD31NT31PF31NZ31MC31KN31PJ31JD31GW31KT2VD2LQ31PP24931EV31KZ31MQ316F31OD31J931Q831OR31FP2JS31G226I2OR2LT2962F32Q427129J2DE31AV29731AX2VO2JP2PC2PN26L26K2O829026H2AT31NF26W2722OC31AP31G3316D31OI29031F531F426726K2E7317T2CI27531SG29931F425P2XP27Q31712WV2PG131031SZ31SZ1W24M31MV31JB2OC31BB2PM26V2712X027E31RQ26T2CH31MY31OK31HL31LC2UY25S26I2602W025W2R026P31TJ2J526M31G326L2WX24922X31T32RE31DU31Q62VJ2IS31K226M31TX31142PJ26131TN2Y62AX319S315M31M02TJ31AK31GP2T531D22YI31D42FU31D22UX319E2UB27S2H42W02762H82T32GV2OJ2G531PM31CX2FJ29P31D92JP31DB2FQ2AP2EM31E031VA2BZ2B324P27J2JY2HG24F2G627L2DW31EI31DR2L131DT28Y2ET23V28231EG31A72G631VM2JJ31VZ2T731W231D52G631D531CX27531V62FU24N2RU311K24931WC2RE31EJ27531WG2G231VE2FF2HV2552HP2AP2AP2LK2GG2B331C92LI2JH2T324F31C331WF2YS31WI31X231DB31WQ2HX2U531WU2TJ2IT31WY31V526K2BZ31DN2SG31VQ31XH31DQ27631WK23V31DU2AP31RZ2JZ278310I2CU2IG314125J2OJ2U72SS2YV25N2JK2FG2CV316231EK31A52G331EL31QG31YA2A42DW2G32B32EM2KR2G82AE2KR2U82AE2AE2L32G82HG31CN2TJ2HV31R82TJ2I931YT2762KK31PM2B32B32AE2IN2782KR2B331VL28Y2MZ31VP27631ZC27531EN2RE2482RE2RK2MG2BF2E227125U27026826426N2EP31O8312W27631TU2922J12752A32WX2S82VD31UE2M331D92FU2JS31GH31DV310729P315J2T22GO2UV315Z2S03206312B320931V22FU2HE31V3310V31TX31ZI2FU2LH31TT31TV2WK31AQ31SE31PS31OA311F31RE31PW31OE29G31OG31JC31BB29631BE31ZO31BH2C829Y2OU26I31BK27Q31ZM2632Q426T26Z27B2CG29L29N2XY313926831YM2G731DU320J26Y319131X0315V31X331VQ2KF31VS31LZ23V31WC2FJ2IS31UK31NZ31UN31WZ31R32GY2ZS31D8320Q2G431DC29X2I131DG29W2GE2G42AP31X42FQ31X6322R2BR2CU29P2UT31ZA2FF2HG31ZD275323831XL31AL31ZH31602492PW31R931RB2BE26I31RX27Q31LR31SK316831AY2PK31TL2P226K2712AA32102BU2802PK25425M25P25O26525S25Y2822BE29H29J321U31QG27527327H31TA31AR26L31TD2CH2ET2F727225T2B52EO31WE31SO2QS2P32E727Q31U527026M2OJ25M26Y29J2E2324D2JS31N4324E2BF32542B526T2AL325931G127026926L31K42D92QH321L313331FE31ZV31PT321531C031RF31MU2ET31C2324D2J5324O31H72QN2OQ29I2C42C6311P25R312N29I24R31TX23D31T331C9316K2722R231SK2712W729I2RC31FH2B5326N31TX31TZ2W02C426I2922QR2WK32452XP326C23S21Z24321L31SZ22824M31U831W82BF26O26B31782762682612WX26126U2PW31232682CY2QH26426V31CB2NT31N42P2327O323N317Y2R226H25M2F427126U32512P632532R226T26T249321Z326H326J31T931G22QS28B31RT26Y2DU311W29I324S25M327D27025L26O269325M2DF2622DI26N28C328Q327E31XB3288325D2W226J25P26P29C26Q31K226I26I31TX23L2PW2PK25P27026S26H2CL312H2M324G22H31TX24T2PW2J52672AB2802ET31B826O2O8263324R2QH329K325J2M32DF32A7324K326Q26J2RC329J325I297328R31TX2532PW31BB32AB25D260325E31FS27P31FZ2QH25X270273324027632AB25Q28M26H2IP31332602Q331ZU2OJ26528M27227N26Z327P31SC31AR2VT31RP329A31TE31RT2VT31C229R2EO2XX31KW2AB31K22A822E2FB25F319031UG319G319V319I2RL31UO322W314E31VQ2AP310R31VQ323B31XO31QT2Y62GG31V52FU2CU315I323C2492LE322A2Z82AN32C12GC2HJ31GD318Q2GU2GC2GX318P2WO2FF32CO2NP31VQ32D324924Z313G24924K31K72Y632212NT25525V2T6313T2FJ31ZM32C531UZ31IN2DF31PI2SB31AN2GY31D22SB32DP313I313T27L31BB31UX31KP31V032DW28Y27L313T2G62WD31O531D22U32LN2TJ31VX2U831W22TN2IJ2M331DF2HA31W231D92H9322J2HQ320332D427632ES32CE32EF2G22B131W2310X31W2315F31W22GL31IV2FD31W027624J2V631DU32EX322Q31W231GU2B32FF32F724931VH2T32DW2KF23T25E2T32FD320G2HQ2L332EG2HQ313T29P31YT2G827S31YZ31AO31IW31JD2FJ2KR2G631UV2M232FW2H52TJ29P2MD320C27S32GG2TJ2EM32GJ31V22I232G62492LQ32G932G42MZ32GC2CV320R2NB2TJ27S23Q31Y52EM32GY2G82AP32H12FX31ED32FM31IN2MQ32GS2HQ32GU31W132FX32GE24932H732GZ28132H232HJ31Y52AP25732EK2BZ2FJ2IN2H032HD2G625931VY2HQ25832HG2G625B32GP2562HQ2SS2AX2DW25A31JD2AX2LY32GA32I032GD320R32GJ32G12MC32HN32GM32G432GO2IN2AX32GR32FK2GC24X32IM32I92492CU32H131UV32HF2G331W232FY32IM32GH32HO320C32GL32HP32J9320A32HT32ID2GB32HX24932J332G432II31W932JD32IL32HK2G82EM32JQ27532H632HS2IG32IR32D732I82GC31DN25132IU28Y2DW25031JD27L32IF32G432GB32I332GW32JN32IK27532GI32IN32HS32IQ31CX32IT2SS27L32IW2MD32J232IH32KE29X32JT2DO32KW32JS32JC25332JW32HA28Y32HC322032HE2FK2QL32J532HI32KG32KX32HN32KW2AP25232L232HU31CX2FL32JI32HZ32GV2S232J42HQ24O32K832IU2G632KO2492BL2RC32IG32GV32J632LC32KI32JA32J732JE32KL28Y24T32K028Y24S24924V32EE24932LN32KD2A332LQ2G624H32LT2A332LV31CX24G24932FA2SS2FJ24I32MT32K42FJ24L32MY320P27624F31XY2P631Y032N323V25I2DO32JK2DO27S313T32KZ320C32JV320C27832KW2B332HK27632NF32DN2HX32HK32N52BZ314H32K431CY31Y12RK31Y12GJ31Y12PK32NX320B31Y12P632NU2IV2TK31Y131VU32N12B332DB320C2AE319E31YO2SV2G332OK31WC31Z02TI2FX2LT2HG31D922K2HY26N2L12LH32OX2FD32E92CU2KX2RU32GD22J31K731X432P731VS32FH2FK2FQ31Z332OL32PE2CV31T331WP2CV2B32PW32NU2HG32072PH31Y12LH2LS2TI31EM31PN2J52GJ2JS327026S2BL324Z31U7312B2QH31K232A82J5329227Q2RE2FA2P625Y273273323L26L31YW23V28X2VF2G331UP2YR2IS31GK32QS314R31V02TP31V42YR320O31IX314R31D9322932L6320F2FK26R29X323432HL32QU2HX32RC2AP322F27527831W231YD2782T92782782GJ31DZ320S32JN32362CV323932RU27532OG31PM323E2PI32GY31BS32AD2RC2BE2732R226S25N266263327A2WK26227A31K2325P2CF31ZV31BJ2VJ2P6324O31SA2CH2J532AB2W02QK2R12AL326826O326W32BF27032B52PK326V326X2AV32Q026532712UY31U62NT32AB326M32AE31TX26O327I2M3326T32AG325J2PM31BI2BN328R2YS25D2WK325331BO313332QG32QI27Z2YS25C31TX259327M2762P332T0313327H323L31JK328X328Z329132AJ2M325C32AM29Y32UD26I32T431SM2BE326931P124R1P2FB32HR31UJ31IT315N31Y527L32RC2G62TP2FJ32EP32E12FU2G32UB31D92TR2IC27L2RE32JY32F8327B320C31DF2FX27L27L2G632JY31WA31V032CZ2WK32VJ31KP32JY2EM27L32IY2YQ32EA31Y52G631AN32ML31QG320R32RC32EJ32M532RE318O2HQ2IG31O532VL32JG2AE27L2K62FF28231XI27632WK32CM32HZ2PH32OX31AK23T2B32AX2I932CB27632K7314131XF2FF32WZ2RO31VQ32X332CE32VC2FK32K332VK32NR32VM31Y529P31C932IL31WW31CX31KS32JY2I92FT32LS32UZ2FK32MD32XB2J12HV32XP2SX2FQ32XP31DD31H324932MA31WH31VQ32Y232CM32DH31VS27L32W225P32E531YC32G42AX32F32HQ2GL32W3315W29P32YF31E929X32YI32RS328C2JJ32EJ315F27S27S2L32G332YV31152G32IX249315F2EM2EM32YX312C31YI2JJ32Z532CN311632M832YM31VN2GC31M82HB2SV2K627L32Y732X427632ZN31X432Y524932XO31MI23V25Q2HQ32W232JL32W432JN32W62UY32JR2UY2G332RF32Z32JJ31WR2L2330A2BZ321Z32WB31PM32XB320B31D032UY32GQ31A732XB32KC2HQ320O32YL320829X2VD32WE32VS2G132LQ27L32Z72HQ2G6330F32R62U831E22MD31E7330C33192KR2K629P26F31QT31X4331F2PH32LS32EX23V27431E8331631DJ32YS28Y32YP32NE32Z0312C27L331T32ZB2KR330728Y3311330B315W27833102JJ32RN32YR32RK2492MQ32N42A432LJ2HQ2MD31W5320K330U31A731E22MZ32IL32GY32YY2DO2HV330532RG2BZ332733212AP330F27S32WC32YQ31PK2G62MZ2K632DB2TR27632S031PM2IC324A2F427V317I311P28I26V32BV26L2BE322Q320V32PK31UG32NU2IS31GB2FA2PI31Y12FX31V82BM32PW31GY32VD2FU2P632SV27I2UY2CY26V327J1M2PW2IS26I26K26Z326S31T32JS2XQ2OQ31MI25826H31U82PW2GA25826W31TX23X329V276325O2GA24J2FL326P27A32AE32TA32502WX23D327L327A2632FB26B32C032DC31IN2PI2G12FJ2NE2AX2EM32WL312C2PH32D8320J32DB322B32DE2S731VO2V22GY322O2GM330L320B2FM330K31M62BM32CU2ZC32WI2MB335O336B32CM32Y532CE2Y9335X310R32QQ3360335M330L32O43364319W31412YU32VQ33692FM2FL336C336W336E32FB313U322Z32DC32WR2M325Z31K7335K327Y32Y532WX27532ZS32LS31TX31KS319E31R22SB32DL32VG32QQ2FJ27L32DR31A72UB332T31CX2WD31UV32XG32JN32XI2GD31R631CY31TN331J332K2M232UV31MD2YU337K31CY337M28Y337P2U8337R2TJ27L337U32G4338I29X32E92GC31W731IY249333B327A31D9337E2M333742FX32CK31A5338Q31PN2FU');local lIIIIIlII=(bit or bit32);local lIlIIIlIIlllllII=lIIIIIlII and lIIIIIlII.bxor or function(lIIIIIlII,llIlllIIIIIllllIll)local lIIllIllllIIllIIlIlIllI,lIlIIIlIIlllllII,lIIIIllIII=1,0,10 while lIIIIIlII>0 and llIlllIIIIIllllIll>0 do local llllllIlIIlllllIIIl,lIIIIllIII=lIIIIIlII%2,llIlllIIIIIllllIll%2 if llllllIlIIlllllIIIl~=lIIIIllIII then lIlIIIlIIlllllII=lIlIIIlIIlllllII+lIIllIllllIIllIIlIlIllI end lIIIIIlII,llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI=(lIIIIIlII-llllllIlIIlllllIIIl)/2,(llIlllIIIIIllllIll-lIIIIllIII)/2,lIIllIllllIIllIIlIlIllI*2 end if lIIIIIlII<llIlllIIIIIllllIll then lIIIIIlII=llIlllIIIIIllllIll end while lIIIIIlII>0 do local llIlllIIIIIllllIll=lIIIIIlII%2 if llIlllIIIIIllllIll>0 then lIlIIIlIIlllllII=lIlIIIlIIlllllII+lIIllIllllIIllIIlIlIllI end lIIIIIlII,lIIllIllllIIllIIlIlIllI=(lIIIIIlII-llIlllIIIIIllllIll)/2,lIIllIllllIIllIIlIlIllI*2 end return lIlIIIlIIlllllII end local function llIlllIIIIIllllIll(lIIllIllllIIllIIlIlIllI,lIIIIIlII,llIlllIIIIIllllIll)if llIlllIIIIIllllIll then local lIIIIIlII=(lIIllIllllIIllIIlIlIllI/2^(lIIIIIlII-1))%2^((llIlllIIIIIllllIll-1)-(lIIIIIlII-1)+1);return lIIIIIlII-lIIIIIlII%1;else local lIIIIIlII=2^(lIIIIIlII-1);return(lIIllIllllIIllIIlIlIllI%(lIIIIIlII+lIIIIIlII)>=lIIIIIlII)and 1 or 0;end;end;local lIIIIIlII=1;local function lIIllIllllIIllIIlIlIllI()local lIIIIllIII,llllllIlIIlllllIIIl,lIIllIllllIIllIIlIlIllI,llIlllIIIIIllllIll=llIlIllll(lIlIIIIIIIIlIlIllllII,lIIIIIlII,lIIIIIlII+3);lIIIIllIII=lIlIIIlIIlllllII(lIIIIllIII,153)llllllIlIIlllllIIIl=lIlIIIlIIlllllII(llllllIlIIlllllIIIl,153)lIIllIllllIIllIIlIlIllI=lIlIIIlIIlllllII(lIIllIllllIIllIIlIlIllI,153)llIlllIIIIIllllIll=lIlIIIlIIlllllII(llIlllIIIIIllllIll,153)lIIIIIlII=lIIIIIlII+4;return(llIlllIIIIIllllIll*16777216)+(lIIllIllllIIllIIlIlIllI*65536)+(llllllIlIIlllllIIIl*256)+lIIIIllIII;end;local function lIllIIIlIIIIIIIlIIII()local lIIllIllllIIllIIlIlIllI=lIlIIIlIIlllllII(llIlIllll(lIlIIIIIIIIlIlIllllII,lIIIIIlII,lIIIIIlII),153);lIIIIIlII=lIIIIIlII+1;return lIIllIllllIIllIIlIlIllI;end;local function llllllIlIIlllllIIIl()local lIIllIllllIIllIIlIlIllI,llIlllIIIIIllllIll=llIlIllll(lIlIIIIIIIIlIlIllllII,lIIIIIlII,lIIIIIlII+2);lIIllIllllIIllIIlIlIllI=lIlIIIlIIlllllII(lIIllIllllIIllIIlIlIllI,153)llIlllIIIIIllllIll=lIlIIIlIIlllllII(llIlllIIIIIllllIll,153)lIIIIIlII=lIIIIIlII+2;return(llIlllIIIIIllllIll*256)+lIIllIllllIIllIIlIlIllI;end;local function lIIllIllI()local lIIIIIlII=lIIllIllllIIllIIlIlIllI();local lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI();local lIIIIllIII=1;local lIlIIIlIIlllllII=(llIlllIIIIIllllIll(lIIllIllllIIllIIlIlIllI,1,20)*(2^32))+lIIIIIlII;local lIIIIIlII=llIlllIIIIIllllIll(lIIllIllllIIllIIlIlIllI,21,31);local lIIllIllllIIllIIlIlIllI=((-1)^llIlllIIIIIllllIll(lIIllIllllIIllIIlIlIllI,32));if(lIIIIIlII==0)then if(lIlIIIlIIlllllII==0)then return lIIllIllllIIllIIlIlIllI*0;else lIIIIIlII=1;lIIIIllIII=0;end;elseif(lIIIIIlII==2047)then return(lIlIIIlIIlllllII==0)and(lIIllIllllIIllIIlIlIllI*(1/0))or(lIIllIllllIIllIIlIlIllI*(0/0));end;return llIIllIIIIIIIIllllI(lIIllIllllIIllIIlIlIllI,lIIIIIlII-1023)*(lIIIIllIII+(lIlIIIlIIlllllII/(2^52)));end;local lllllIllllIllllllI=lIIllIllllIIllIIlIlIllI;local function llIIllIIIIIIIIllllI(lIIllIllllIIllIIlIlIllI)local llIlllIIIIIllllIll;if(not lIIllIllllIIllIIlIlIllI)then lIIllIllllIIllIIlIlIllI=lllllIllllIllllllI();if(lIIllIllllIIllIIlIlIllI==0)then return'';end;end;llIlllIIIIIllllIll=lIIIIllIII(lIlIIIIIIIIlIlIllllII,lIIIIIlII,lIIIIIlII+lIIllIllllIIllIIlIlIllI-1);lIIIIIlII=lIIIIIlII+lIIllIllllIIllIIlIlIllI;local lIIllIllllIIllIIlIlIllI={}for lIIIIIlII=1,#llIlllIIIIIllllIll do lIIllIllllIIllIIlIlIllI[lIIIIIlII]=IlllIIIIlllIlIllI(lIlIIIlIIlllllII(llIlIllll(lIIIIllIII(llIlllIIIIIllllIll,lIIIIIlII,lIIIIIlII)),153))end return IlIIIlIIIIIllIIIl(lIIllIllllIIllIIlIlIllI);end;local lIIIIIlII=lIIllIllllIIllIIlIlIllI;local function IlIIIlIIIIIllIIIl(...)return{...},IIIlIIlllIIlIlllIIIlIIII('#',...)end local function llIlIllll()local lIlIIIIIIIIlIlIllllII={};local lllllIllllIllllllI={};local lIIIIIlII={};local IlllIIIIlllIlIllI={[#{{673;417;82;74};{672;100;533;798};}]=lllllIllllIllllllI,[#{"1 + 1 = 111";"1 + 1 = 111";{637;679;654;707};}]=nil,[#{"1 + 1 = 111";"1 + 1 = 111";{523;245;873;574};{608;31;184;141};}]=lIIIIIlII,[#{"1 + 1 = 111";}]=lIlIIIIIIIIlIlIllllII,};local lIIIIIlII=lIIllIllllIIllIIlIlIllI()local lIlIIIlIIlllllII={}for llIlllIIIIIllllIll=1,lIIIIIlII do local lIIllIllllIIllIIlIlIllI=lIllIIIlIIIIIIIlIIII();local lIIIIIlII;if(lIIllIllllIIllIIlIlIllI==2)then lIIIIIlII=(lIllIIIlIIIIIIIlIIII()~=0);elseif(lIIllIllllIIllIIlIlIllI==1)then lIIIIIlII=lIIllIllI();elseif(lIIllIllllIIllIIlIlIllI==0)then lIIIIIlII=llIIllIIIIIIIIllllI();end;lIlIIIlIIlllllII[llIlllIIIIIllllIll]=lIIIIIlII;end;for llIlIllll=1,lIIllIllllIIllIIlIlIllI()do local lIIIIIlII=lIllIIIlIIIIIIIlIIII();if(llIlllIIIIIllllIll(lIIIIIlII,1,1)==0)then local lIIIIllIII=llIlllIIIIIllllIll(lIIIIIlII,2,3);local IlllIIllllIllI=llIlllIIIIIllllIll(lIIIIIlII,4,6);local lIIIIIlII={llllllIlIIlllllIIIl(),llllllIlIIlllllIIIl(),nil,nil};if(lIIIIllIII==0)then lIIIIIlII[#("moq")]=llllllIlIIlllllIIIl();lIIIIIlII[#("rTCu")]=llllllIlIIlllllIIIl();elseif(lIIIIllIII==1)then lIIIIIlII[#("Ttk")]=lIIllIllllIIllIIlIlIllI();elseif(lIIIIllIII==2)then lIIIIIlII[#("PjF")]=lIIllIllllIIllIIlIlIllI()-(2^16)elseif(lIIIIllIII==3)then lIIIIIlII[#("eRK")]=lIIllIllllIIllIIlIlIllI()-(2^16)lIIIIIlII[#("i6Zr")]=llllllIlIIlllllIIIl();end;if(llIlllIIIIIllllIll(IlllIIllllIllI,1,1)==1)then lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]=lIlIIIlIIlllllII[lIIIIIlII[#("HI")]]end if(llIlllIIIIIllllIll(IlllIIllllIllI,2,2)==1)then lIIIIIlII[#("cZ4")]=lIlIIIlIIlllllII[lIIIIIlII[#("joc")]]end if(llIlllIIIIIllllIll(IlllIIllllIllI,3,3)==1)then lIIIIIlII[#("uAU6")]=lIlIIIlIIlllllII[lIIIIIlII[#("hy7A")]]end lIlIIIIIIIIlIlIllllII[llIlIllll]=lIIIIIlII;end end;IlllIIIIlllIlIllI[3]=lIllIIIlIIIIIIIlIIII();for lIIIIIlII=1,lIIllIllllIIllIIlIlIllI()do lllllIllllIllllllI[lIIIIIlII-1]=llIlIllll();end;return IlllIIIIlllIlIllI;end;local function lllllIllllIllllllI(lIIIIIlII,lIllIIIlIIIIIIIlIIII,llllllIlIIlllllIIIl)lIIIIIlII=(lIIIIIlII==true and llIlIllll())or lIIIIIlII;return(function(...)local lIlIIIlIIlllllII=lIIIIIlII[1];local lIIIIllIII=lIIIIIlII[3];local llIIllIIIIIIIIllllI=lIIIIIlII[2];local lIlIIIIIIIIlIlIllllII=IlIIIlIIIIIllIIIl local lIIllIllllIIllIIlIlIllI=1;local llIlIllll=-1;local IIllllIIIlllIlIlIIllIIIl={};local IlllIIIIlllIlIllI={...};local IlIIIlIIIIIllIIIl=IIIlIIlllIIlIlllIIIlIIII('#',...)-1;local IIIlIIlllIIlIlllIIIlIIII={};local llIlllIIIIIllllIll={};for lIIIIIlII=0,IlIIIlIIIIIllIIIl do if(lIIIIIlII>=lIIIIllIII)then IIllllIIIlllIlIlIIllIIIl[lIIIIIlII-lIIIIllIII]=IlllIIIIlllIlIllI[lIIIIIlII+1];else llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIIIIIlII+#{{278;463;534;808};}];end;end;local lIIIIIlII=IlIIIlIIIIIllIIIl-lIIIIllIII+1 local lIIIIIlII;local lIIIIllIII;while true do lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("p")];if lIIIIllIII<=#("06UJcOFPfAQQWJ79SjGrnPVDp36BbWpB0dm5FeKZrKatmDFTlZh6unLlkqsjR")then if lIIIIllIII<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{20;792;106;996};{968;200;998;684};"1 + 1 = 111";{498;505;640;873};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{246;619;775;648};{897;788;387;509};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{668;581;179;475};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{146;18;679;915};"1 + 1 = 111";"1 + 1 = 111";{542;160;98;444};{805;543;391;501};"1 + 1 = 111";}then if lIIIIllIII<=#("Ahn6Rj6MVvjvDx")then if lIIIIllIII<=#("n7GTaG")then if lIIIIllIII<=#("FY")then if lIIIIllIII<=#("")then lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Cjc")];elseif lIIIIllIII>#("1")then llIlllIIIIIllllIll[lIIIIIlII[#("b8")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("N9f")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vW")]]=llIlllIIIIIllllIll[lIIIIIlII[#("1AJ")]][lIIIIIlII[#("qqyE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Gu")]]=llIlllIIIIIllllIll[lIIIIIlII[#("QQn")]][lIIIIIlII[#("7C5z")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("uu")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Dck")]][lIIIIIlII[#("FzEP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#("43D")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{545;597;51;346};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rg")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("O1H")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("WE")]]=llIlllIIIIIllllIll[lIIIIIlII[#("EXO")]][lIIIIIlII[#("cFcP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nL")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("lvk")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("M0")]]=llIlllIIIIIllllIll[lIIIIIlII[#("rAV")]][lIIIIIlII[#("PiZo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("o1")]]=llIlllIIIIIllllIll[lIIIIIlII[#("dfv")]][lIIIIIlII[#("QQWG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{686;982;385;564};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("hbb")]][lIIIIIlII[#("YWM1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8G")]]=llIlllIIIIIllllIll[lIIIIIlII[#("LP3")]][lIIIIIlII[#("bv7J")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rM")]][lIIIIIlII[#("dAa")]]=llIlllIIIIIllllIll[lIIIIIlII[#("RaBE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else llIlllIIIIIllllIll[lIIIIIlII[#("SJ")]]=lllllIllllIllllllI(llIIllIIIIIIIIllllI[lIIIIIlII[#("QCg")]],nil,llllllIlIIlllllIIIl);end;elseif lIIIIllIII<=#("nqxq")then if lIIIIllIII>#("2jK")then llIlllIIIIIllllIll[lIIIIIlII[#("q5")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Cl5")]]*llIlllIIIIIllllIll[lIIIIIlII[#("66eE")]];else local lIllIIIlIIIIIIIlIIII;local lIlIIIIIIIIlIlIllllII;local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("4t")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{{124;137;435;433};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Vs")]]=llIlllIIIIIllllIll[lIIIIIlII[#("GP8")]][lIIIIIlII[#("NvsC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("CU")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("hCiE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{561;871;231;940};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("IZC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qT")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Zkr")]][lIIIIIlII[#{"1 + 1 = 111";{11;871;971;889};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Gr")]]=llIlllIIIIIllllIll[lIIIIIlII[#("3H3")]][lIIIIIlII[#("SXMD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("EO")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("uM2")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("RHD6")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("GQ")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ia")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("s9n")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("7d")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("jq2")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("ORu3")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("N6")]]=lIIIIIlII[#("ORZ")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("XS")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("R00")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aD")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("0ma")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Mn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9E6")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("FV")]lIlIIIIIIIIlIlIllllII={llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])};lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,lIIIIIlII[#{{845;191;704;692};"1 + 1 = 111";"1 + 1 = 111";{106;128;123;764};}]do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=lIlIIIIIIIIlIlIllllII[lIllIIIlIIIIIIIlIIII];end lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("4gk")];end;elseif lIIIIllIII==#("R8rtk")then local lIIIIllIII=lIIIIIlII[#("ya")];local llllllIlIIlllllIIIl=lIIIIIlII[#("DDj8")];local lIlIIIlIIlllllII=lIIIIllIII+2 local lIIIIllIII={llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1],llIlllIIIIIllllIll[lIlIIIlIIlllllII])};for lIIIIIlII=1,llllllIlIIlllllIIIl do llIlllIIIIIllllIll[lIlIIIlIIlllllII+lIIIIIlII]=lIIIIllIII[lIIIIIlII];end;local lIIIIllIII=lIIIIllIII[1]if lIIIIllIII then llIlllIIIIIllllIll[lIlIIIlIIlllllII]=lIIIIllIII lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("RLa")];else lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;end;else llIlllIIIIIllllIll[lIIIIIlII[#("9m")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WiU")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif lIIIIllIII<=#("0f0l6CzFFb")then if lIIIIllIII<=#("pQNzEdrX")then if lIIIIllIII>#("E93gLmd")then local lIIIIIlII=lIIIIIlII[#("NX")]llIlllIIIIIllllIll[lIIIIIlII]=llIlllIIIIIllllIll[lIIIIIlII](llIlllIIIIIllllIll[lIIIIIlII+1])else local lllllIllllIllllllI;local llIIllIIIIIIIIllllI,IlIIIlIIIIIllIIIl;local lIIIIllIII;local IlllIIIIlllIlIllI;local IIIlIIlllIIlIlllIIIlIIII;llIlllIIIIIllllIll[lIIIIIlII[#("nz")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("rRO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ln")]]=llIlllIIIIIllllIll[lIIIIIlII[#("659")]][lIIIIIlII[#("bL3F")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6E")]]=lIIIIIlII[#("vvh")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("iK")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{565;844;836;172};"1 + 1 = 111";{163;853;229;127};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];IIIlIIlllIIlIlllIIIlIIII=lIIIIIlII[#("LaZ")];IlllIIIIlllIlIllI=llIlllIIIIIllllIll[IIIlIIlllIIlIlllIIIlIIII]for lIIIIIlII=IIIlIIlllIIlIlllIIIlIIII+1,lIIIIIlII[#("itMc")]do IlllIIIIlllIlIllI=IlllIIIIlllIlIllI..llIlllIIIIIllllIll[lIIIIIlII];end;llIlllIIIIIllllIll[lIIIIIlII[#("RE")]]=IlllIIIIlllIlIllI;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("d67")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("51")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{981;394;590;238};"1 + 1 = 111";{594;928;54;12};}]][lIIIIIlII[#{{822;796;530;97};{140;862;843;496};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qa")]]=lIIIIIlII[#{{864;274;361;629};{750;873;803;482};"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Tk")]]=lIIIIIlII[#("fJq")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("L8")]]=lIIIIIlII[#("IT4")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Oa")]llIIllIIIIIIIIllllI,IlIIIlIIIIIllIIIl=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#{"1 + 1 = 111";{310;832;679;885};{560;226;643;152};}])))llIlIllll=IlIIIlIIIIIllIIIl+lIIIIllIII-1 lllllIllllIllllllI=0;for lIIIIIlII=lIIIIllIII,llIlIllll do lllllIllllIllllllI=lllllIllllIllllllI+1;llIlllIIIIIllllIll[lIIIIIlII]=llIIllIIIIIIIIllllI[lllllIllllIllllllI];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("zK")]llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("9hK")];end;elseif lIIIIllIII>#("qICQugOTM")then local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("3Y")]llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI]=llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,lIIIIIlII[#("Q2t")]))else llllllIlIIlllllIIIl[lIIIIIlII[#("s5o")]]=llIlllIIIIIllllIll[lIIIIIlII[#("pP")]];end;elseif lIIIIllIII<=#("5RYW2pbNE7xm")then if lIIIIllIII==#("aHWj1mTLTz6")then llIlllIIIIIllllIll[lIIIIIlII[#("7v")]][lIIIIIlII[#("TLk")]]=llIlllIIIIIllllIll[lIIIIIlII[#("BhoA")]];else local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("ZQ")]local lIIIIllIII={llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,llIlIllll))};local lIlIIIlIIlllllII=0;for lIIIIIlII=lIIllIllllIIllIIlIlIllI,lIIIIIlII[#("QyPt")]do lIlIIIlIIlllllII=lIlIIIlIIlllllII+1;llIlllIIIIIllllIll[lIIIIIlII]=lIIIIllIII[lIlIIIlIIlllllII];end end;elseif lIIIIllIII==#("6JI5J8Q2LvfKR")then if(llIlllIIIIIllllIll[lIIIIIlII[#("1K")]]<=llIlllIIIIIllllIll[lIIIIIlII[#("oNOy")]])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("g6B")];end;else lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("lK8")]]=llIlllIIIIIllllIll[lIIIIIlII[#("DR")]];end;elseif lIIIIllIII<=#("Nf8SgfdNCjI7XG21ms2I5Q")then if lIIIIllIII<=#("R58QusOBmCTKONar0j")then if lIIIIllIII<=#("hyxLlj9UjXRjm6Mq")then if lIIIIllIII==#("izTuXTvGd6nolab")then local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("06")]local lIlIIIlIIlllllII,lIIIIIlII=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,lIIIIIlII[#("eWJ")])))llIlIllll=lIIIIIlII+lIIllIllllIIllIIlIlIllI-1 local lIIIIIlII=0;for lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI,llIlIllll do lIIIIIlII=lIIIIIlII+1;llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI]=lIlIIIlIIlllllII[lIIIIIlII];end;else local llllllIlIIlllllIIIl;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("SD")]]=llIlllIIIIIllllIll[lIIIIIlII[#("fWu")]][lIIIIIlII[#("Ed8H")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("aAe")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0F")]]=lIIIIIlII[#("cCx")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ts")]]=lIIIIIlII[#("Lyo")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("SG")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("u4A")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("JQ")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("IK6")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("cYZq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Rt")]]=lIIIIIlII[#("xFv")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("V3")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("iDr")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if not llIlllIIIIIllllIll[lIIIIIlII[#("EU")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("sCQ")];end;end;elseif lIIIIllIII>#("MJfuuWHuIFOFsGNcv")then llIlllIIIIIllllIll[lIIIIIlII[#("kl")]]=llIlllIIIIIllllIll[lIIIIIlII[#("L9v")]][lIIIIIlII[#("B8oP")]];else local IlllIIIIlllIlIllI;local IIIlIIlllIIlIlllIIIlIIII,lllllIllllIllllllI;local lIllIIIlIIIIIIIlIIII;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("mJ")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Hmr")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5k")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("KMZ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("m7")];lIllIIIlIIIIIIIlIIII=llIlllIIIIIllllIll[lIIIIIlII[#("uYW")]];llIlllIIIIIllllIll[lIIIIllIII+1]=lIllIIIlIIIIIIIlIIII;llIlllIIIIIllllIll[lIIIIllIII]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("Kh8T")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nh")]]=lIIIIIlII[#("xMt")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Kg")]IIIlIIlllIIlIlllIIIlIIII,lllllIllllIllllllI=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("ZW2")])))llIlIllll=lllllIllllIllllllI+lIIIIllIII-1 IlllIIIIlllIlIllI=0;for lIIIIIlII=lIIIIllIII,llIlIllll do IlllIIIIlllIlIllI=IlllIIIIlllIlIllI+1;llIlllIIIIIllllIll[lIIIIIlII]=IIIlIIlllIIlIlllIIIlIIII[IlllIIIIlllIlIllI];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Mi")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{{720;123;18;986};{950;461;729;661};}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII]()lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{{359;128;354;295};"1 + 1 = 111";}];lIllIIIlIIIIIIIlIIII=llIlllIIIIIllllIll[lIIIIIlII[#("dP0")]];llIlllIIIIIllllIll[lIIIIllIII+1]=lIllIIIlIIIIIIIlIIII;llIlllIIIIIllllIll[lIIIIllIII]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("C7cj")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("T7")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("kDG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("IZ")];lIllIIIlIIIIIIIlIIII=llIlllIIIIIllllIll[lIIIIIlII[#("RRJ")]];llIlllIIIIIllllIll[lIIIIllIII+1]=lIllIIIlIIIIIIIlIIII;llIlllIIIIIllllIll[lIIIIllIII]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("O6J9")]];end;elseif lIIIIllIII<=#("jBB8uPafhnVG8WQVKyG5")then if lIIIIllIII>#("v2zWre1nItl270K7OnA")then local llllllIlIIlllllIIIl;local lIllIIIlIIIIIIIlIIII;local IlllIIIIlllIlIllI,lllllIllllIllllllI;local lIIIIllIII;lIIIIllIII=lIIIIIlII[#("iP")]IlllIIIIlllIlIllI,lllllIllllIllllllI=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("JfB")])))llIlIllll=lllllIllllIllllllI+lIIIIllIII-1 lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,llIlIllll do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("qH")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("qX")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("sr8")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("GQnk")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("uv")]]=lIIIIIlII[#("QIe")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("2D")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("QiH")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Xk")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("ikS")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("b4Z6")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("h1")]]=lIIIIIlII[#("g0q")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("tk")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("vRF")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("rC")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("fPg")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("Mr7F")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bl")]]=lIIIIIlII[#("pBK")];else local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("WP")]llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,lIIIIIlII[#("k7m")]))end;elseif lIIIIllIII>#("oPsJcG1YI6oGAVYJbmcKi")then local lIIIIllIII=lIIIIIlII[#("Se")];local llllllIlIIlllllIIIl=lIIIIIlII[#("Si9m")];local lIlIIIlIIlllllII=lIIIIllIII+2 local lIIIIllIII={llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1],llIlllIIIIIllllIll[lIlIIIlIIlllllII])};for lIIIIIlII=1,llllllIlIIlllllIIIl do llIlllIIIIIllllIll[lIlIIIlIIlllllII+lIIIIIlII]=lIIIIllIII[lIIIIIlII];end;local lIIIIllIII=lIIIIllIII[1]if lIIIIllIII then llIlllIIIIIllllIll[lIlIIIlIIlllllII]=lIIIIllIII lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("YiY")];else lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;end;else llIlllIIIIIllllIll[lIIIIIlII[#("Jt")]]=llIlllIIIIIllllIll[lIIIIIlII[#("LG4")]]+lIIIIIlII[#("hO4U")];end;elseif lIIIIllIII<=#("K3KOb5fX6jgMnRJZTWmcQLePCl")then if lIIIIllIII<=#{{61;636;710;114};{652;139;645;985};"1 + 1 = 111";"1 + 1 = 111";{481;802;217;88};"1 + 1 = 111";"1 + 1 = 111";{279;549;319;527};"1 + 1 = 111";{796;939;262;650};"1 + 1 = 111";"1 + 1 = 111";{166;469;464;432};{670;96;903;501};{110;861;866;162};{875;41;210;213};{130;36;229;402};"1 + 1 = 111";{718;58;647;538};"1 + 1 = 111";"1 + 1 = 111";{275;460;337;492};"1 + 1 = 111";"1 + 1 = 111";}then if lIIIIllIII==#("ygl8Z5mZ2d1F8qB0Mj0vqqt")then llIlllIIIIIllllIll[lIIIIIlII[#("Ou")]]();else do return end;end;elseif lIIIIllIII==#("L9oNO5cT84CelfKdlQdQ3Fgjy")then local lIlIIIlIIlllllII=lIIIIIlII[#("SP")]local lIIIIllIII={llIlllIIIIIllllIll[lIlIIIlIIlllllII](llIlllIIIIIllllIll[lIlIIIlIIlllllII+1])};local lIIllIllllIIllIIlIlIllI=0;for lIIIIIlII=lIlIIIlIIlllllII,lIIIIIlII[#("HaZX")]do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;llIlllIIIIIllllIll[lIIIIIlII]=lIIIIllIII[lIIllIllllIIllIIlIlIllI];end else local IlllIIIIlllIlIllI;local llIIllIIIIIIIIllllI,IlIIIlIIIIIllIIIl;local lIIIIllIII;local lllllIllllIllllllI;local IIIlIIlllIIlIlllIIIlIIII;llIlllIIIIIllllIll[lIIIIIlII[#("t1")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#{{214;123;144;979};{485;220;31;803};{915;254;137;725};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("A6")]]=llIlllIIIIIllllIll[lIIIIIlII[#("8Vo")]][lIIIIIlII[#("gp03")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("XB")]]=lIIIIIlII[#("YKa")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aY")]]=llIlllIIIIIllllIll[lIIIIIlII[#("X1O")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];IIIlIIlllIIlIlllIIIlIIII=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{39;725;185;193};}];lllllIllllIllllllI=llIlllIIIIIllllIll[IIIlIIlllIIlIlllIIIlIIII]for lIIIIIlII=IIIlIIlllIIlIlllIIIlIIII+1,lIIIIIlII[#("UUee")]do lllllIllllIllllllI=lllllIllllIllllllI..llIlllIIIIIllllIll[lIIIIIlII];end;llIlllIIIIIllllIll[lIIIIIlII[#("a9")]]=lllllIllllIllllllI;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("IqG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hJ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("8l9")]][lIIIIIlII[#{{518;896;858;957};"1 + 1 = 111";{903;207;837;884};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Kk")]]=lIIIIIlII[#("bVq")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Uo")]]=lIIIIIlII[#("XDl")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nD")]]=lIIIIIlII[#("OKO")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("pL")]llIIllIIIIIIIIllllI,IlIIIlIIIIIllIIIl=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("l1C")])))llIlIllll=IlIIIlIIIIIllIIIl+lIIIIllIII-1 IlllIIIIlllIlIllI=0;for lIIIIIlII=lIIIIllIII,llIlIllll do IlllIIIIlllIlIllI=IlllIIIIlllIlIllI+1;llIlllIIIIIllllIll[lIIIIIlII]=llIIllIIIIIIIIllllI[IlllIIIIlllIlIllI];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("T7")]llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))end;elseif lIIIIllIII<=#("GZvh9gXqy0QJk7ahGeYvOGKWjLmN")then if lIIIIllIII>#{{112;382;867;863};{426;563;886;901};{749;972;822;21};"1 + 1 = 111";{207;168;664;927};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{145;573;822;617};{640;253;885;963};"1 + 1 = 111";"1 + 1 = 111";{561;329;992;494};{939;368;425;197};{439;74;365;705};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{944;503;648;294};"1 + 1 = 111";{625;707;267;730};{903;547;36;39};{337;900;940;608};"1 + 1 = 111";{259;677;409;540};{167;38;804;557};{981;596;374;800};}then llIlllIIIIIllllIll[lIIIIIlII[#("TM")]]=lllllIllllIllllllI(llIIllIIIIIIIIllllI[lIIIIIlII[#("7LT")]],nil,llllllIlIIlllllIIIl);else llIlllIIIIIllllIll[lIIIIIlII[#("C8")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("EXd")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kR")]]=llIlllIIIIIllllIll[lIIIIIlII[#("COE")]][lIIIIIlII[#{"1 + 1 = 111";{58;395;938;688};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7I")]]=llIlllIIIIIllllIll[lIIIIIlII[#("s0J")]][lIIIIIlII[#{"1 + 1 = 111";{47;217;495;602};"1 + 1 = 111";{592;441;656;595};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ft")]]=llIlllIIIIIllllIll[lIIIIIlII[#("VqR")]][lIIIIIlII[#("1VET")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{407;983;926;4};}]]=llIlllIIIIIllllIll[lIIIIIlII[#{{866;511;335;716};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{276;878;333;952};{275;538;188;232};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Qyy")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rP")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WKd")]][lIIIIIlII[#{{632;948;531;321};{387;350;278;332};{646;940;649;959};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5K")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Y5n")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("AV")]]=llIlllIIIIIllllIll[lIIIIIlII[#("DdE")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{272;732;912;982};{691;457;622;733};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8q")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Rhy")]][lIIIIIlII[#("7e4g")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("8G7")]][lIIIIIlII[#("ZMxT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("xQ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("a1T")]][lIIIIIlII[#("HDJV")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Dz")]][lIIIIIlII[#("kzr")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{192;422;376;883};{659;770;173;336};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;end;elseif lIIIIllIII==#("J7z3jor6LtoIXVPjDdTX0zHfh8qh1")then local lIIIIIlII=lIIIIIlII[#("hX")]llIlllIIIIIllllIll[lIIIIIlII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIIlII+1,llIlIllll))else local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("HT")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Xyp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("DH")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Alx")]][lIIIIIlII[#("9qua")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{776;985;385;480};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("LX1")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{599;792;777;312};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("3B")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Mlu")]][lIIIIIlII[#("S5Cg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("HG")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WCv")]][lIIIIIlII[#{"1 + 1 = 111";{995;689;633;26};"1 + 1 = 111";{943;780;506;536};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qV")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WPv")]][lIIIIIlII[#("pzUD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("c8")]]=llIlllIIIIIllllIll[lIIIIIlII[#("AK0")]][lIIIIIlII[#("IFrp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ra")]]=llIlllIIIIIllllIll[lIIIIIlII[#("1iG")]][lIIIIIlII[#("EOCJ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Av")]]=llIlllIIIIIllllIll[lIIIIIlII[#("NBJ")]][lIIIIIlII[#("RT3a")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Fz")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{369;834;979;18};"1 + 1 = 111";{352;213;299;65};}]][lIIIIIlII[#("K54e")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nj")]]=llIlllIIIIIllllIll[lIIIIIlII[#("UGI")]]+lIIIIIlII[#("MbDR")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("by")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("PKl")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("X7")]][lIIIIIlII[#("Hbi")]]=llIlllIIIIIllllIll[lIIIIIlII[#("gNbl")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mI")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("dga")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("XK")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("bfR")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("R0")]]=llIlllIIIIIllllIll[lIIIIIlII[#("vCa")]][lIIIIIlII[#("KG2E")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ll")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("qCV")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Hf")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Np4")]][lIIIIIlII[#("f7BH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ao")]]=lIIIIIlII[#("N0B")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Bc")]]=llIlllIIIIIllllIll[lIIIIIlII[#("gkG")]][lIIIIIlII[#("eD25")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("f5")]]=llIlllIIIIIllllIll[lIIIIIlII[#("zbz")]][lIIIIIlII[#("Ripg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("3Q")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("aYu")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("eF")]]=llIlllIIIIIllllIll[lIIIIIlII[#("BAc")]]+llIlllIIIIIllllIll[lIIIIIlII[#("tEQ4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("HD")]][lIIIIIlII[#("Q9j")]]=llIlllIIIIIllllIll[lIIIIIlII[#("GcKK")]];end;elseif lIIIIllIII<=#("m2A9Y3FCiQBXWspI2at228umzkBtWk8kf1gvhY6VOb5cv")then if lIIIIllIII<=#{"1 + 1 = 111";"1 + 1 = 111";{69;283;831;223};"1 + 1 = 111";{572;579;521;64};"1 + 1 = 111";{223;677;407;549};{908;445;525;778};{921;475;504;988};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{396;843;745;697};{615;153;612;511};"1 + 1 = 111";{803;982;375;602};{503;602;977;308};"1 + 1 = 111";{491;652;824;14};"1 + 1 = 111";{718;481;697;593};{159;479;871;928};"1 + 1 = 111";"1 + 1 = 111";{835;740;763;696};{179;75;556;315};"1 + 1 = 111";{849;961;520;922};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if lIIIIllIII<=#("eRxfa2Y4nssDx7uftRb5jbmpV9lqynfpR")then if lIIIIllIII<=#("3a3M4tfF0VoVFf6Uc1lIccFhubQIHam")then local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("S0")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Gg4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("1F")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("Yal")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("1Mpq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("JT")]]=lIIIIIlII[#("gSe")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Vs")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("PUc")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("RR")]]=llIlllIIIIIllllIll[lIIIIIlII[#("K0B")]][lIIIIIlII[#("k1AE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{585;386;584;605};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("dkB")]][lIIIIIlII[#("MEy3")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ix")]]=llIlllIIIIIllllIll[lIIIIIlII[#("goU")]][lIIIIIlII[#("iiIt")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dh")]]=llIlllIIIIIllllIll[lIIIIIlII[#("mmT")]][lIIIIIlII[#("7x4u")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("53")]]=llIlllIIIIIllllIll[lIIIIIlII[#("QiU")]][lIIIIIlII[#("gZ7I")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("2M")]]=llIlllIIIIIllllIll[lIIIIIlII[#("qsb")]][lIIIIIlII[#{{385;864;976;386};"1 + 1 = 111";{681;788;93;530};{4;931;190;328};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aO")]][lIIIIIlII[#("0hT")]]=lIIIIIlII[#("CmMv")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0Y")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Uh1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("yI")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("ymh")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("0SVH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("r1")]]=lIIIIIlII[#("J0o")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ot")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("PBf")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qm")]]=llIlllIIIIIllllIll[lIIIIIlII[#("p8e")]][lIIIIIlII[#("0gXA")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mb")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9BI")]][lIIIIIlII[#("xEpM")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9z")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9cK")]][lIIIIIlII[#("ER5s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{206;284;792;5};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("ZcD")]][lIIIIIlII[#("u31C")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("X6")]]=llIlllIIIIIllllIll[lIIIIIlII[#("CiT")]][lIIIIIlII[#("oMPJ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("GQ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("xeZ")]][lIIIIIlII[#{{417;301;262;520};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{974;44;854;162};}]][lIIIIIlII[#{{222;445;746;394};{608;592;557;749};{373;729;611;439};}]]=lIIIIIlII[#("oLyf")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("E0")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("3Au")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ZP")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("nBi")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("9cIW")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{38;927;350;657};}]]=lIIIIIlII[#("cYs")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Mz")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("KuQ")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bO")]]=llIlllIIIIIllllIll[lIIIIIlII[#("M0a")]][lIIIIIlII[#("Jho0")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5Q")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ys2")]][lIIIIIlII[#("Urs2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Cb")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Sfm")]][lIIIIIlII[#("71sa")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("N7")]]=llIlllIIIIIllllIll[lIIIIIlII[#("jeZ")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("GL")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{347;360;996;409};"1 + 1 = 111";}]][lIIIIIlII[#("0siG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("iW")]]=llIlllIIIIIllllIll[lIIIIIlII[#("SUd")]][lIIIIIlII[#("2s0l")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nE")]][lIIIIIlII[#("4L3")]]=lIIIIIlII[#("sufY")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7X")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("0AA")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("gx")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("gyYT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("YL")]]=lIIIIIlII[#("2IC")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Lq")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("HYh")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5V")]]=llIlllIIIIIllllIll[lIIIIIlII[#("n6S")]][lIIIIIlII[#("Ontq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5K")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9m6")]][lIIIIIlII[#("ysye")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("FT")]]=llIlllIIIIIllllIll[lIIIIIlII[#("SgN")]][lIIIIIlII[#("IZj5")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("z0")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WNM")]][lIIIIIlII[#("q9To")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ts")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ApQ")]][lIIIIIlII[#("BBhy")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("QkX")]][lIIIIIlII[#("NVFc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("QKm")]]=lIIIIIlII[#("0MEg")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ne")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("qcd")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("uZ")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("N6j")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("N92x")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("oN")]]=lIIIIIlII[#("35N")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Sb")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("EIt")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("2L")]]=llIlllIIIIIllllIll[lIIIIIlII[#("0FC")]][lIIIIIlII[#("K5Ws")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("tn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6Pk")]][lIIIIIlII[#("Dkka")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("lS")]]=llIlllIIIIIllllIll[lIIIIIlII[#("hZB")]][lIIIIIlII[#("hOKV")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0J")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{806;939;134;62};"1 + 1 = 111";}]][lIIIIIlII[#("ng5S")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Dx")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9hK")]][lIIIIIlII[#("NXuj")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("cTp")]][lIIIIIlII[#{{37;174;470;737};"1 + 1 = 111";{655;295;736;14};{918;108;474;303};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Dr")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("DP2")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("qhxb")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("uS")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("CK")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("MdY")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Qp")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("0GZ")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("GOYC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{846;294;935;958};}]]=lIIIIIlII[#("h62")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("l0")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("1WX")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("pi")]]=llIlllIIIIIllllIll[lIIIIIlII[#("FgY")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{428;992;543;25};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("NnN")]][lIIIIIlII[#("mcTp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kx")]]=llIlllIIIIIllllIll[lIIIIIlII[#("7Oo")]][lIIIIIlII[#("Gdj0")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("31")]]=llIlllIIIIIllllIll[lIIIIIlII[#("pMX")]][lIIIIIlII[#("WKNp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("p7")]]=llIlllIIIIIllllIll[lIIIIIlII[#("XQP")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{862;552;789;93};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("gp")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{{99;137;640;615};"1 + 1 = 111";"1 + 1 = 111";}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("arIx")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ZH")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;elseif lIIIIllIII==#{{351;330;71;66};{802;769;366;493};{71;35;510;805};"1 + 1 = 111";"1 + 1 = 111";{159;483;926;800};{414;933;242;11};{872;245;866;941};{154;161;780;949};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{425;18;851;366};{322;453;514;203};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{262;483;155;491};"1 + 1 = 111";"1 + 1 = 111";{786;62;447;42};"1 + 1 = 111";{815;364;326;878};"1 + 1 = 111";{640;485;120;568};"1 + 1 = 111";"1 + 1 = 111";{522;514;696;498};{308;797;51;690};}then local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("h2")]llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,lIIIIIlII[#("lgs")]))else local lIIIIllIII;local lIllIIIlIIIIIIIlIIII;local IlllIIIIlllIlIllI,IIIlIIlllIIlIlllIIIlIIII;local lllllIllllIllllllI;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("BG")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";{120;10;941;221};{378;513;119;657};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("OI")]]=llIlllIIIIIllllIll[lIIIIIlII[#("5Cu")]][lIIIIIlII[#("JrEM")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("iq")]]=llIlllIIIIIllllIll[lIIIIIlII[#("1a1")]][lIIIIIlII[#{{400;850;9;383};"1 + 1 = 111";{892;349;907;515};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ub")];lllllIllllIllllllI=llIlllIIIIIllllIll[lIIIIIlII[#("ADk")]];llIlllIIIIIllllIll[lIIIIllIII+1]=lllllIllllIllllllI;llIlllIIIIIllllIll[lIIIIllIII]=lllllIllllIllllllI[lIIIIIlII[#("3MYT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("qK")]IlllIIIIlllIlIllI,IIIlIIlllIIlIlllIIIlIIII=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1]))llIlIllll=IIIlIIlllIIlIlllIIIlIIII+lIIIIllIII-1 lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,llIlIllll do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("lk")]IlllIIIIlllIlIllI={llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))};lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,lIIIIIlII[#("n7GB")]do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("qS6")];end;elseif lIIIIllIII<=#("laLbNIueESy1dhuHJo3089MFnYAB3dsQu4Y")then if lIIIIllIII>#("3fQf0jLBb9DP6vfsfaJmygXYh4lAzSGisu")then local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("lI")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("jLY")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("sA")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("gTX")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("5bJB")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Zl")]]=lIIIIIlII[#("3kQ")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ex")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("5Kf")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Zh")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Z8l")]][lIIIIIlII[#("uiO5")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("BC")]]=llIlllIIIIIllllIll[lIIIIIlII[#("qAA")]][lIIIIIlII[#("5Ev5")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("oG")]]=llIlllIIIIIllllIll[lIIIIIlII[#("YrO")]][lIIIIIlII[#("oKIW")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("NV")]]=llIlllIIIIIllllIll[lIIIIIlII[#("hav")]][lIIIIIlII[#("DLpz")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("54")]]=llIlllIIIIIllllIll[lIIIIIlII[#("kW3")]][lIIIIIlII[#("FsTl")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("d0")]]=llIlllIIIIIllllIll[lIIIIIlII[#("lNk")]][lIIIIIlII[#("dVhV")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("KN")]][lIIIIIlII[#("PiE")]]=lIIIIIlII[#("HTcO")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("I6")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("tuD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("4h")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("xmx")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("4QdL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{547;671;895;182};}]]=lIIIIIlII[#("Gio")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("De")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("kax")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nF")]]=llIlllIIIIIllllIll[lIIIIIlII[#("eoe")]][lIIIIIlII[#("zq3r")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6Z")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Ylv")]][lIIIIIlII[#("NzT2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("J7")]]=llIlllIIIIIllllIll[lIIIIIlII[#("RBX")]][lIIIIIlII[#("uWjt")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("GI")]]=llIlllIIIIIllllIll[lIIIIIlII[#("X9h")]][lIIIIIlII[#("czCT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ix")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6UD")]][lIIIIIlII[#("jxLH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vV")]]=llIlllIIIIIllllIll[lIIIIIlII[#("YYk")]][lIIIIIlII[#("FI3d")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("UE")]][lIIIIIlII[#("Nd8")]]=lIIIIIlII[#("XIOD")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6r")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("6H")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("qvi")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("oABW")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Fe")]]=lIIIIIlII[#("dK1")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ek")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("9ui")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("QS")]]=llIlllIIIIIllllIll[lIIIIIlII[#("AkF")]][lIIIIIlII[#("OboM")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dg")]]=llIlllIIIIIllllIll[lIIIIIlII[#("bgY")]][lIIIIIlII[#{{626;165;50;726};"1 + 1 = 111";{173;916;615;837};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{255;75;787;979};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("I3a")]][lIIIIIlII[#("Fot2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Tb")]]=llIlllIIIIIllllIll[lIIIIIlII[#("eip")]][lIIIIIlII[#("cPxz")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("HV")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ntL")]][lIIIIIlII[#("fFQo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("LX")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6M5")]][lIIIIIlII[#("XhQK")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{469;423;745;983};{806;309;290;683};}]][lIIIIIlII[#("0Se")]]=lIIIIIlII[#("N7Pj")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jq")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("2uF")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Sa")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("QoG")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{172;523;562;822};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Yd")]]=lIIIIIlII[#("ICa")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("6c")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("udN")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("gD")]]=llIlllIIIIIllllIll[lIIIIIlII[#("v2v")]][lIIIIIlII[#("5YSx")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fs")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ug4")]][lIIIIIlII[#("JnWR")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("un")]]=llIlllIIIIIllllIll[lIIIIIlII[#("TJa")]][lIIIIIlII[#("Jdc2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fm")]]=llIlllIIIIIllllIll[lIIIIIlII[#("pdQ")]][lIIIIIlII[#("iuap")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Wz")]]=llIlllIIIIIllllIll[lIIIIIlII[#("cDI")]][lIIIIIlII[#("N3i8")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("K4")]]=llIlllIIIIIllllIll[lIIIIIlII[#("zGK")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{955;119;675;507};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("OD")]][lIIIIIlII[#("MYm")]]=lIIIIIlII[#("4Q3q")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("gG")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("tjo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("lu")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("9If")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("qXtf")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ST")]]=lIIIIIlII[#("xjb")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("VW")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("AZU")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aB")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oTm")]][lIIIIIlII[#("Ku83")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fF")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WRz")]][lIIIIIlII[#("J5XP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("zP")]]=llIlllIIIIIllllIll[lIIIIIlII[#("GA9")]][lIIIIIlII[#("XgUl")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ge")]]=llIlllIIIIIllllIll[lIIIIIlII[#("rGs")]][lIIIIIlII[#("cQUs")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{40;201;760;790};{74;338;407;841};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("3jv")]][lIIIIIlII[#("9c9e")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Io")]]=llIlllIIIIIllllIll[lIIIIIlII[#("uiY")]][lIIIIIlII[#("3jV3")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ms")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("7R6")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("vb5C")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("59")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("n3")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("CWX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("JN")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("VEL")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("r4ot")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Gt")]]=lIIIIIlII[#("MT9")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("qW")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("Uxv")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("CE")]]=llIlllIIIIIllllIll[lIIIIIlII[#("JqR")]][lIIIIIlII[#("MWF1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Vo")]]=llIlllIIIIIllllIll[lIIIIIlII[#("1F2")]][lIIIIIlII[#("X6RW")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8a")]]=llIlllIIIIIllllIll[lIIIIIlII[#("EkV")]][lIIIIIlII[#("KdaD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("xo")]]=llIlllIIIIIllllIll[lIIIIIlII[#("4FG")]][lIIIIIlII[#("Hv4h")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Fj")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{274;543;404;394};"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("Aj3C")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Xj")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("NAe")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("VlrF")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Bf")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else local lIlIIIIIIIIlIlIllllII;local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("x2")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("4z4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("I0")]]=llIlllIIIIIllllIll[lIIIIIlII[#("jT0")]][lIIIIIlII[#("hBAY")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{811;916;370;371};"1 + 1 = 111";}]]=lIIIIIlII[#("Wpi")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("OR")]]=lIIIIIlII[#("9fb")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Nf")]]=lIIIIIlII[#("3Ge")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("V0")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("SF9")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{97;506;26;326};{516;431;891;491};}]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("m50")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("F0")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("6M6")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("nIin")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Hd")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aS")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("l25")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6Z")]][lIIIIIlII[#("LSh")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6C87")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Hf")]]=llIlllIIIIIllllIll[lIIIIIlII[#("tXt")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Wn")]]=lIIIIIlII[#("xYe")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlIllll=lIIIIIlII[#("EEZ")];lIlIIIIIIIIlIlIllllII=llIlllIIIIIllllIll[llIlIllll]for lIIIIIlII=llIlIllll+1,lIIIIIlII[#("rbCO")]do lIlIIIIIIIIlIlIllllII=lIlIIIIIIIIlIlIllllII..llIlllIIIIIllllIll[lIIIIIlII];end;llIlllIIIIIllllIll[lIIIIIlII[#("V8")]]=lIlIIIIIIIIlIlIllllII;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("QT")]][lIIIIIlII[#("vDg")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6ahI")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("q2")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("AX7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{362;201;2;532};{595;237;632;645};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("3Lc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("AP")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("C1")]][lIIIIIlII[#("t9G")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{529;43;134;130};{465;724;210;399};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{311;309;579;769};{134;850;678;6};}]][lIIIIIlII[#("kKv")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("K8")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("ztq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("KR")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("ktU")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Dg")]]=llIlllIIIIIllllIll[lIIIIIlII[#("0lU")]][lIIIIIlII[#("iNmE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{186;561;995;618};}]]=lIIIIIlII[#("WZX")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Oa")]]=lIIIIIlII[#("WGc")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("KY")]]=lIIIIIlII[#("V31")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("gq")]]=lIIIIIlII[#("Vkv")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("zq")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("s7F")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1H")]]=llIlllIIIIIllllIll[lIIIIIlII[#("iOR")]]+llIlllIIIIIllllIll[lIIIIIlII[#("8nQi")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ie")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("7k6Y")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if not llIlllIIIIIllllIll[lIIIIIlII[#("KZ")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#{{668;23;706;210};"1 + 1 = 111";"1 + 1 = 111";}];end;end;elseif lIIIIllIII>#("DIX9YzkDnvVEH89KuuMMXr2758kbtDtvLSMV")then llIlllIIIIIllllIll[lIIIIIlII[#("Ml")]][lIIIIIlII[#("1Kx")]]=lIIIIIlII[#("UTOu")];else local lIlIIIlIIlllllII=lIIIIIlII[#("mWu")];local lIIllIllllIIllIIlIlIllI=llIlllIIIIIllllIll[lIlIIIlIIlllllII]for lIIIIIlII=lIlIIIlIIlllllII+1,lIIIIIlII[#("ht2T")]do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI..llIlllIIIIIllllIll[lIIIIIlII];end;llIlllIIIIIllllIll[lIIIIIlII[#("Ig")]]=lIIllIllllIIllIIlIlIllI;end;elseif lIIIIllIII<=#("aUYnNKDxAPCAhlXQT0kQ0e0nijVcz2YvoruLYyjSA")then if lIIIIllIII<=#("FtTMlrGQ22CfC53KeEZB7I0fkZ0m1uQCqpJHEH7")then if lIIIIllIII==#("GT964j0zRntQ38N7DNCvBtYIl9ZmxxfIGv4oI4")then llIlllIIIIIllllIll[lIIIIIlII[#{{671;172;69;450};{56;245;35;202};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("HJB")]];else llIlllIIIIIllllIll[lIIIIIlII[#("dM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("CIj")]]+llIlllIIIIIllllIll[lIIIIIlII[#("vE1j")]];end;elseif lIIIIllIII==#("a9CGNaaJrMMe1fLcm4CU4uOcuiWjHezzICBx9YkH")then llIlllIIIIIllllIll[lIIIIIlII[#{{460;370;993;593};{403;80;832;149};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("8xf")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("j2")]]=llIlllIIIIIllllIll[lIIIIIlII[#("R0t")]][lIIIIIlII[#("spzj")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{398;743;507;223};{427;132;878;614};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("iVH")]][lIIIIIlII[#("OZ8e")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Mk")]]=llIlllIIIIIllllIll[lIIIIIlII[#("q6T")]][lIIIIIlII[#("Su8T")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#("Fk2")]]=llIlllIIIIIllllIll[lIIIIIlII[#("lS")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("R4")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Y1j")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{421;853;65;113};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("N0x")]][lIIIIIlII[#("q5p7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ac")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("mlJ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8b")]]=llIlllIIIIIllllIll[lIIIIIlII[#("aph")]][lIIIIIlII[#("2a1t")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fz")]]=llIlllIIIIIllllIll[lIIIIIlII[#("DFa")]][lIIIIIlII[#("ZUD6")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("yv")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("FvHW")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ll")]]=llIlllIIIIIllllIll[lIIIIIlII[#("pTy")]][lIIIIIlII[#("SWXt")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Fz")]][lIIIIIlII[#("Zoa")]]=llIlllIIIIIllllIll[lIIIIIlII[#("4VJj")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else local lIIIIIlII=lIIIIIlII[#("lQ")]llIlllIIIIIllllIll[lIIIIIlII](llIlllIIIIIllllIll[lIIIIIlII+1])end;elseif lIIIIllIII<=#("AHLUsoD4tStfkqQvAlFo1bmmmGzOoczT5JFXdrb3ton")then if lIIIIllIII>#("fsylUbKNQstzuyHX0YQqtKkLW2shjM5MY1h3hn4nDW")then lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Q8l")];else for lIIIIIlII=lIIIIIlII[#("Da")],lIIIIIlII[#("nJp")]do llIlllIIIIIllllIll[lIIIIIlII]=nil;end;end;elseif lIIIIllIII>#{"1 + 1 = 111";"1 + 1 = 111";{629;64;470;728};"1 + 1 = 111";"1 + 1 = 111";{53;869;627;390};"1 + 1 = 111";{125;869;802;103};"1 + 1 = 111";"1 + 1 = 111";{221;875;750;259};{774;382;13;28};"1 + 1 = 111";"1 + 1 = 111";{313;395;284;923};"1 + 1 = 111";{119;592;52;300};{690;695;534;349};"1 + 1 = 111";"1 + 1 = 111";{957;243;521;302};"1 + 1 = 111";{490;780;305;867};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{172;588;519;292};"1 + 1 = 111";{208;744;462;417};"1 + 1 = 111";{787;996;123;255};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{978;789;401;306};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{376;699;498;898};"1 + 1 = 111";"1 + 1 = 111";{605;751;623;217};}then local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]local lIlIIIlIIlllllII,lIIIIIlII=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,lIIIIIlII[#("DU5")])))llIlIllll=lIIIIIlII+lIIllIllllIIllIIlIlIllI-1 local lIIIIIlII=0;for lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI,llIlIllll do lIIIIIlII=lIIIIIlII+1;llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI]=lIlIIIlIIlllllII[lIIIIIlII];end;else local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("19")]]=llIlllIIIIIllllIll[lIIIIIlII[#("m2K")]][lIIIIIlII[#("XvjL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Vq")]]=lIIIIIlII[#{{42;96;207;989};{12;176;198;219};{811;273;781;208};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{702;14;924;429};"1 + 1 = 111";}]]=lIIIIIlII[#{"1 + 1 = 111";{120;716;85;815};{405;796;898;616};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0k")]]=lIIIIIlII[#("GSq")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("tY")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("CWU")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("pn")]][lIIIIIlII[#("kq7")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Ao4Y")]];end;elseif lIIIIllIII<=#("ZMVuYcFas9oGG9zhJBLgiE8KATCefJF8PSNO2uY27XpHs0kAopuiY")then if lIIIIllIII<=#("TvOl4eKB5TFq1XxUooMTjvnBrJJcZ0oxjS8raRATrH1Gbb8xd")then if lIIIIllIII<=#("agGeXyim3uGILeFigjZfTIY2CNERApLm9u0i0f4KiXXfnU6")then if lIIIIllIII==#("b34ZH8VCrNNk4BXOUtJpoxrbpo66VTPRQQQHuVPaKy0nDT")then local lIIIIIlII=lIIIIIlII[#("eK")]llIlllIIIIIllllIll[lIIIIIlII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIIlII+1,llIlIllll))else local lIlIIIlIIlllllII=lIIIIIlII[#{{479;235;132;708};{146;257;552;445};"1 + 1 = 111";}];local lIIllIllllIIllIIlIlIllI=llIlllIIIIIllllIll[lIlIIIlIIlllllII]for lIIIIIlII=lIlIIIlIIlllllII+1,lIIIIIlII[#("syfC")]do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI..llIlllIIIIIllllIll[lIIIIIlII];end;llIlllIIIIIllllIll[lIIIIIlII[#("ym")]]=lIIllIllllIIllIIlIlIllI;end;elseif lIIIIllIII==#("Saiu4lQIPL3JrcZRJ85FnVpt8OIQ1GeIHJn5MzUGaia5Bmx8")then llIlllIIIIIllllIll[lIIIIIlII[#("ZL")]]=llIlllIIIIIllllIll[lIIIIIlII[#("pjH")]];else llIlllIIIIIllllIll[lIIIIIlII[#("k7")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("szp")]];end;elseif lIIIIllIII<=#("QrpIoD6VZvpNaRiHvbTY4fjnzEfUt2WrJ5koY9sgqjXcF2aB2zf")then if lIIIIllIII>#("Nk0LhbjUxmB6K8eeH4SvTNHUrgSGEO24XLOzfJgX0JTeT0DHY6")then local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#{{951;515;393;722};{625;844;791;286};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("ixV")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("un")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("Gai")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("3vc0")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("LN")]]=lIIIIIlII[#("cMK")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{"1 + 1 = 111";{72;723;675;355};}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("svz")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dO")]]=llIlllIIIIIllllIll[lIIIIIlII[#("a7W")]][lIIIIIlII[#("vXlm")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("x2")]]=llIlllIIIIIllllIll[lIIIIIlII[#("4I7")]][lIIIIIlII[#("Fi5s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Hm")]]=llIlllIIIIIllllIll[lIIIIIlII[#("JYV")]][lIIIIIlII[#("hBRV")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("km")]]=llIlllIIIIIllllIll[lIIIIIlII[#("tBr")]][lIIIIIlII[#("EL1Q")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1E")]]=llIlllIIIIIllllIll[lIIIIIlII[#("C3V")]][lIIIIIlII[#("pCSs")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("x6")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{143;503;777;874};{181;379;935;211};"1 + 1 = 111";}]][lIIIIIlII[#("tQuO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nV")]][lIIIIIlII[#("ii9")]]=lIIIIIlII[#("JTTE")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Rb")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("B7L")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("k8")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("V0F")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("9j6l")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("cP")]]=lIIIIIlII[#("MtD")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("UF")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("z7n")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ku")]]=llIlllIIIIIllllIll[lIIIIIlII[#("piF")]][lIIIIIlII[#("rsLy")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rD")]]=llIlllIIIIIllllIll[lIIIIIlII[#("tDd")]][lIIIIIlII[#("1RtI")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9O")]]=llIlllIIIIIllllIll[lIIIIIlII[#("KsQ")]][lIIIIIlII[#("sEvc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("pN")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{606;575;114;333};}]][lIIIIIlII[#("4e28")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("3E")]]=llIlllIIIIIllllIll[lIIIIIlII[#("JGx")]][lIIIIIlII[#{{971;230;184;189};{118;458;976;815};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Mn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("n1o")]][lIIIIIlII[#("zSnJ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("zv")]][lIIIIIlII[#("66F")]]=lIIIIIlII[#("tOQ4")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ov")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("AlQ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ul")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{{929;536;925;784};{397;461;802;331};{851;463;862;107};}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("60u7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qE")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("lB")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("4lt")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1q")]]=llIlllIIIIIllllIll[lIIIIIlII[#("jBZ")]][lIIIIIlII[#("MvWD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("of")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{502;759;921;197};{681;900;69;981};}]][lIIIIIlII[#("fxQd")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7n")]]=llIlllIIIIIllllIll[lIIIIIlII[#("LME")]][lIIIIIlII[#("4q7g")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("IC")]]=llIlllIIIIIllllIll[lIIIIIlII[#("4bP")]][lIIIIIlII[#("EbdH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9q")]]=llIlllIIIIIllllIll[lIIIIIlII[#("759")]][lIIIIIlII[#("jEVN")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0A")]]=llIlllIIIIIllllIll[lIIIIIlII[#("NNu")]][lIIIIIlII[#("OYBG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("3v")]][lIIIIIlII[#("QWh")]]=lIIIIIlII[#("eU5M")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("95")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("yyR")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("6H")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{161;158;893;371};"1 + 1 = 111";}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("CbYf")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ZT")]]=lIIIIIlII[#("hFK")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("md")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("jWC")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Wb")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{348;730;337;541};}]][lIIIIIlII[#("cbkr")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Lx")]]=llIlllIIIIIllllIll[lIIIIIlII[#("SUb")]][lIIIIIlII[#{{936;447;131;888};{181;699;7;594};"1 + 1 = 111";{33;667;654;370};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nB")]]=llIlllIIIIIllllIll[lIIIIIlII[#("l4Z")]][lIIIIIlII[#{{550;394;910;149};{341;652;680;642};{194;158;522;86};{77;297;86;863};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Xg")]]=llIlllIIIIIllllIll[lIIIIIlII[#("gct")]][lIIIIIlII[#("iLiL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nV")]]=llIlllIIIIIllllIll[lIIIIIlII[#("J0F")]][lIIIIIlII[#("r5jK")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("yA")]]=llIlllIIIIIllllIll[lIIIIIlII[#("5D0")]][lIIIIIlII[#("kvuN")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{763;358;675;683};"1 + 1 = 111";}]][lIIIIIlII[#("Rjp")]]=lIIIIIlII[#("Cn7V")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{667;627;989;978};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("uqo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ks")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("loG")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("htDN")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mh")]]=lIIIIIlII[#("QFD")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("8u")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("xR0")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("lm")]]=llIlllIIIIIllllIll[lIIIIIlII[#("7Xz")]][lIIIIIlII[#("7oDE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("sp")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{69;474;435;965};"1 + 1 = 111";}]][lIIIIIlII[#("q64z")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{206;477;914;91};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("qok")]][lIIIIIlII[#("02nr")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bm")]]=llIlllIIIIIllllIll[lIIIIIlII[#("R75")]][lIIIIIlII[#("h2Kf")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dS")]]=llIlllIIIIIllllIll[lIIIIIlII[#("EJP")]][lIIIIIlII[#("Rv6D")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vC")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Q7v")]][lIIIIIlII[#("R0cg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("fg")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("Hke")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#{{592;492;248;610};"1 + 1 = 111";"1 + 1 = 111";{325;274;290;232};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("hn")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1B")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";{343;992;302;228};{892;383;783;881};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{"1 + 1 = 111";{446;819;457;80};}];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("Mnk")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("cCQb")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("MY")]]=lIIIIIlII[#("Ukr")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Hc")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("g5K")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Pf")]]=llIlllIIIIIllllIll[lIIIIIlII[#("dTD")]][lIIIIIlII[#("nB6s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aW")]]=llIlllIIIIIllllIll[lIIIIIlII[#("J4k")]][lIIIIIlII[#("JaPq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kH")]]=llIlllIIIIIllllIll[lIIIIIlII[#("c57")]][lIIIIIlII[#("pTyX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Hg")]]=llIlllIIIIIllllIll[lIIIIIlII[#("BII")]][lIIIIIlII[#("Lsa2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("W1")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{379;786;870;55};{902;729;465;420};{799;48;412;737};}]][lIIIIIlII[#("B3Yt")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("m3")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("y6k")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("SxCB")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Md")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("fC")]local lIIIIllIII={llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI+1])};local lIlIIIlIIlllllII=0;for lIIIIIlII=lIIllIllllIIllIIlIlIllI,lIIIIIlII[#("PlJj")]do lIlIIIlIIlllllII=lIlIIIlIIlllllII+1;llIlllIIIIIllllIll[lIIIIIlII]=lIIIIllIII[lIlIIIlIIlllllII];end end;elseif lIIIIllIII==#("8RUCaOfsasNpTuGj8tP87X5Fk4CbBOlRIU4ndjNV9pfEmsaUmREm")then llIlllIIIIIllllIll[lIIIIIlII[#("9U")]][lIIIIIlII[#("XbX")]]=llIlllIIIIIllllIll[lIIIIIlII[#("qANZ")]];else llIlllIIIIIllllIll[lIIIIIlII[#("LA")]]=llIlllIIIIIllllIll[lIIIIIlII[#("rjY")]]+lIIIIIlII[#{{46;564;523;147};"1 + 1 = 111";{338;173;804;661};"1 + 1 = 111";}];end;elseif lIIIIllIII<=#("77kWorgle2xh5S8BsfZQ49RSCr23SYUj8JLXUCY1HJ5ySvrKbt4LPGo8p")then if lIIIIllIII<=#("u6zmEpinixhkR1r7juds9far1y4iFCuMHrh2DtfPpFn4D0NctRx347D")then if lIIIIllIII==#("6gufu9SQcFOzTzF0pzcE2fZbV1ZXfBSKZ25v89tqWH27mnt4lGOF58")then llIlllIIIIIllllIll[lIIIIIlII[#("cH")]]();else local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("nQ")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("xzX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("he")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("SvG")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("gVSO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("k7")]]=(lIIIIIlII[#("Qdl")]~=0);lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ft")]]=llIlllIIIIIllllIll[lIIIIIlII[#("pkD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("DX")]]=(lIIIIIlII[#("MqU")]~=0);lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("NA")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{{323;653;516;637};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("H5")]llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("J85")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("JK")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("g0F")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("xb")]]();lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{598;745;488;213};"1 + 1 = 111";}]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("gmM")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("qE")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{{407;416;231;836};{593;208;730;118};"1 + 1 = 111";}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("UCXj")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5J")]]=(lIIIIIlII[#("JDT")]~=0);lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("te")]]=llIlllIIIIIllllIll[lIIIIIlII[#("VDn")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("3B")]]=(lIIIIIlII[#("IKR")]~=0);lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";{565;494;921;643};{50;119;862;819};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("EG")]llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("0Qo")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;end;elseif lIIIIllIII==#("0rtuDk4KLXeK1Dj2peWRvn2YHI4MKXmO0GfeOP0f16qkiOCBcNzAiqbN")then llIlllIIIIIllllIll[lIIIIIlII[#("G8")]]=(lIIIIIlII[#("B8v")]~=0);else llIlllIIIIIllllIll[lIIIIIlII[#("DG")]]={};end;elseif lIIIIllIII<=#("GY4qsaYKATvyfnKoQ0z6SP3gDJ6zWGKFCPh15ZJ5DKT4gd7AYlDBMRR04YX")then if lIIIIllIII>#("dAX4j15AgTs0rEDh689AMHKLcj2V7r6hcY1dWZVphHsf3NiinK46YyhHZm")then llIlllIIIIIllllIll[lIIIIIlII[#("QO")]]=llIlllIIIIIllllIll[lIIIIIlII[#("IsL")]]*llIlllIIIIIllllIll[lIIIIIlII[#("uNMY")]];else do return llIlllIIIIIllllIll[lIIIIIlII[#("SV")]]end end;elseif lIIIIllIII==#("a8kDZWkYDMAuhmUrenFRAaUIyy9sORunK7Vr7eEsSYQGXoWUefdsuFB9nNeC")then local lIIIIllIII;local lIllIIIlIIIIIIIlIIII;local IlllIIIIlllIlIllI,IIIlIIlllIIlIlllIIIlIIII;local lllllIllllIllllllI;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Jn")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("7uC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("VI")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Aov")]][lIIIIIlII[#("mIoZ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("8s")];lllllIllllIllllllI=llIlllIIIIIllllIll[lIIIIIlII[#{{941;997;436;15};"1 + 1 = 111";{291;511;136;345};}]];llIlllIIIIIllllIll[lIIIIllIII+1]=lllllIllllIllllllI;llIlllIIIIIllllIll[lIIIIllIII]=lllllIllllIllllllI[lIIIIIlII[#("ejnl")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("gO")]IlllIIIIlllIlIllI,IIIlIIlllIIlIlllIIIlIIII=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1]))llIlIllll=IIIlIIlllIIlIlllIIIlIIII+lIIIIllIII-1 lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,llIlIllll do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("3q")]IlllIIIIlllIlIllI={llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))};lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,lIIIIIlII[#("lPk1")]do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("jEC")];else do return llIlllIIIIIllllIll[lIIIIIlII[#("G2")]]end end;elseif lIIIIllIII<=#("2jWqmVjCCu9Tl8LtoUiLpnINb2eHVeuacGZP4oLEMrMVdKjGZQ9250HPLiptQNQy99QPj6A9iP87LXJCTIRffCem9kdV")then if lIIIIllIII<=#("rX9MoWe3Fx3q9Uq2JdYKYLi6LsI5EP82O9029vxbFInkXYfRYuBhpllROca5ojAZzaMa4y2mQXeq")then if lIIIIllIII<=#("8iWn0hjo0NCYjn6uCXvhzVXmfXACnCDg5uQ4oSybqLJyklUk61oaTi8mvKhcRSazku3Z")then if lIIIIllIII<=#("cgTzt1XmAb3coFvmCyXvEIOKvuJLjmZs5O4UFMAqk96Io9DmOlS7gDcEDic9smdm")then if lIIIIllIII<=#("LhLKLR08GlEMfvv2v67F1lDLBrvJA786TuN21McE19KrJ1xXQh7pfSvzPajtvr")then local lIIIIllIII;local lIllIIIlIIIIIIIlIIII;local IlllIIIIlllIlIllI,IIIlIIlllIIlIlllIIIlIIII;local lllllIllllIllllllI;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("fA")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Bzl")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hY")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{356;905;582;338};}]][lIIIIIlII[#("phEE")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6o")]]=llIlllIIIIIllllIll[lIIIIIlII[#("h3V")]][lIIIIIlII[#("7PXk")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("eM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("2jd")]][lIIIIIlII[#("nyzP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("VK")];lllllIllllIllllllI=llIlllIIIIIllllIll[lIIIIIlII[#("hZd")]];llIlllIIIIIllllIll[lIIIIllIII+1]=lllllIllllIllllllI;llIlllIIIIIllllIll[lIIIIllIII]=lllllIllllIllllllI[lIIIIIlII[#("OXZ3")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("RT")]IlllIIIIlllIlIllI,IIIlIIlllIIlIlllIIIlIIII=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1]))llIlIllll=IIIlIIlllIIlIlllIIIlIIII+lIIIIllIII-1 lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,llIlIllll do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("sT")]IlllIIIIlllIlIllI={llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))};lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,lIIIIIlII[#("i66m")]do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=IlllIIIIlllIlIllI[lIllIIIlIIIIIIIlIIII];end lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{776;457;428;921};}];elseif lIIIIllIII==#("JmI2UTEaT4DN2MkcJ4J2saS0b9nn0DTiKBbea9MdlgnvMeEXE8KzWzoIFR0VFqj")then llIlllIIIIIllllIll[lIIIIIlII[#("RI")]]=lIIIIIlII[#("ui7")];else local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("Ov")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("8ZQ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("iW")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{{89;658;215;202};"1 + 1 = 111";"1 + 1 = 111";}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("6IGX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hl")]]=lIIIIIlII[#("pAv")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Hn")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("x1y")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("XC")]]=llIlllIIIIIllllIll[lIIIIIlII[#("D3n")]][lIIIIIlII[#{{175;602;819;193};"1 + 1 = 111";{353;580;879;591};{226;653;262;946};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1Y")]]=llIlllIIIIIllllIll[lIIIIIlII[#("q2z")]][lIIIIIlII[#("mihA")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("t3")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Bx7")]][lIIIIIlII[#("HVdh")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bu")]]=llIlllIIIIIllllIll[lIIIIIlII[#("MLS")]][lIIIIIlII[#("QUI4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("M1M")]][lIIIIIlII[#("y0qc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ln")]]=llIlllIIIIIllllIll[lIIIIIlII[#("nSL")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{773;150;260;191};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Iy")]][lIIIIIlII[#("G31")]]=lIIIIIlII[#("Ajag")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5E")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("DQS")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("fX")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("2qh")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("6CzB")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("I7")]]=lIIIIIlII[#("5v0")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ao")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("AuN")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("z4")]]=llIlllIIIIIllllIll[lIIIIIlII[#("vDI")]][lIIIIIlII[#{"1 + 1 = 111";{161;76;133;921};"1 + 1 = 111";{687;661;716;610};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7B")]]=llIlllIIIIIllllIll[lIIIIIlII[#("R8V")]][lIIIIIlII[#("y2Ys")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Px")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ofs")]][lIIIIIlII[#{"1 + 1 = 111";{692;972;855;735};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9M")]]=llIlllIIIIIllllIll[lIIIIIlII[#("sOf")]][lIIIIIlII[#("o938")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{863;567;977;588};{16;568;590;529};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("aS1")]][lIIIIIlII[#("a1A8")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("YG")]]=llIlllIIIIIllllIll[lIIIIIlII[#("PDq")]][lIIIIIlII[#("xV7F")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("U9")]][lIIIIIlII[#("DrC")]]=lIIIIIlII[#("nvg0")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("62")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("aG1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("7V")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("ehn")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("TBvU")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{682;730;612;739};{972;709;943;446};}]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{968;832;381;703};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("pM")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("5np")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("R1")]]=llIlllIIIIIllllIll[lIIIIIlII[#("7vi")]][lIIIIIlII[#("Bx8N")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qO")]]=llIlllIIIIIllllIll[lIIIIIlII[#("qDf")]][lIIIIIlII[#("AJAB")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("o3")]]=llIlllIIIIIllllIll[lIIIIIlII[#("E2Z")]][lIIIIIlII[#("7JAG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{607;937;524;245};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("mml")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Br")]]=llIlllIIIIIllllIll[lIIIIIlII[#("HEE")]][lIIIIIlII[#("N5sv")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1T")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oAR")]][lIIIIIlII[#("13V3")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("CQ")]][lIIIIIlII[#("Acb")]]=lIIIIIlII[#("YNiu")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("HC")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("SxZ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{"1 + 1 = 111";{37;626;44;155};}];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("nFy")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("O3WU")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("3Y")]]=lIIIIIlII[#("ija")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("TT")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("Aiz")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{15;855;547;484};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("su0")]][lIIIIIlII[#("YuGg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("bK7")]][lIIIIIlII[#{"1 + 1 = 111";{600;694;287;805};"1 + 1 = 111";{347;664;681;842};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("lF")]]=llIlllIIIIIllllIll[lIIIIIlII[#("TGI")]][lIIIIIlII[#{"1 + 1 = 111";{634;563;630;81};{568;41;402;399};{585;837;974;100};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{570;790;516;778};{887;673;727;500};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("P71")]][lIIIIIlII[#{"1 + 1 = 111";{5;192;749;650};"1 + 1 = 111";{692;511;982;101};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("gH")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Bra")]][lIIIIIlII[#("HYGF")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("f8")]]=llIlllIIIIIllllIll[lIIIIIlII[#("dyP")]][lIIIIIlII[#("tBfc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{94;388;226;285};}]][lIIIIIlII[#("Yeq")]]=lIIIIIlII[#("VERn")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1k")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("E6s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("p7")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#{{715;268;928;564};"1 + 1 = 111";{799;636;969;660};}]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("rzmu")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fv")]]=lIIIIIlII[#{"1 + 1 = 111";{591;932;524;885};{948;251;153;975};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("zyS")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1H")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6ZC")]][lIIIIIlII[#("6s8Z")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("4I")]]=llIlllIIIIIllllIll[lIIIIIlII[#("sWf")]][lIIIIIlII[#("XOst")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Jq")]]=llIlllIIIIIllllIll[lIIIIIlII[#("iqi")]][lIIIIIlII[#("Kpav")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jS")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Qit")]][lIIIIIlII[#("aZbH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fm")]]=llIlllIIIIIllllIll[lIIIIIlII[#("sK7")]][lIIIIIlII[#("nZIx")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mY")]]=llIlllIIIIIllllIll[lIIIIIlII[#("mCG")]][lIIIIIlII[#("9sWT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("In")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("fWc")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("g1rK")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ec")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ld")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("G2S")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("nf")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("P8V")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("oZQa")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("az")]]=lIIIIIlII[#("Mfe")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Uo")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("1k7")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("sl")]]=llIlllIIIIIllllIll[lIIIIIlII[#("x7z")]][lIIIIIlII[#("PiVe")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("15")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{755;434;978;502};{900;189;377;925};}]][lIIIIIlII[#("FEuL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("US")]]=llIlllIIIIIllllIll[lIIIIIlII[#("B6E")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Sk")]]=llIlllIIIIIllllIll[lIIIIIlII[#("trf")]][lIIIIIlII[#("gULH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("k3")]]=llIlllIIIIIllllIll[lIIIIIlII[#("TIN")]][lIIIIIlII[#("E1JL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("p2")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("IDp")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("S7B4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("qW")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;end;elseif lIIIIllIII<=#("kudBLgbKsGQmXxo7GAU22txklDKsi1I566kracmx6agqTcVhD3peHrz173oiHSCB7V")then if lIIIIllIII>#("0l76Dnx51ngCjRC0oLDyOHtthXe0oIPs7W46G7W1kxHO0CfBe1m0ExMt2NYPjGQsI")then local lIIIIIlII=lIIIIIlII[#("ns")]llIlllIIIIIllllIll[lIIIIIlII]=llIlllIIIIIllllIll[lIIIIIlII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIIlII+1,llIlIllll))else if(llIlllIIIIIllllIll[lIIIIIlII[#("Mu")]]<=llIlllIIIIIllllIll[lIIIIIlII[#("kiaU")]])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("yvu")];end;end;elseif lIIIIllIII>#("ExWGurZMnr9PEQSNVxvZZLkLd2igROQnfc7SPJG5a2iutmji7HUt7T83mkCCiS4KLVJ")then llIlllIIIIIllllIll[lIIIIIlII[#("bi")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Gp5")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Cu")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{41;85;415;80};{231;74;987;236};}]][lIIIIIlII[#{{224;913;259;593};{207;830;23;274};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("E3")]]=llIlllIIIIIllllIll[lIIIIIlII[#("x99")]][lIIIIIlII[#("F8lO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("AQ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("d3n")]][lIIIIIlII[#("SmOL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#("EqP")]]=llIlllIIIIIllllIll[lIIIIIlII[#("zt")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("F3")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("aH7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Yd")]]=llIlllIIIIIllllIll[lIIIIIlII[#("IRl")]][lIIIIIlII[#("EojG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("MV")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("SSP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aE")]]=llIlllIIIIIllllIll[lIIIIIlII[#("DMs")]][lIIIIIlII[#("XJjm")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ff")]]=llIlllIIIIIllllIll[lIIIIIlII[#("bC9")]][lIIIIIlII[#("HdAm")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5p")]]=llIlllIIIIIllllIll[lIIIIIlII[#("F7k")]][lIIIIIlII[#("tx5N")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vT")]]=llIlllIIIIIllllIll[lIIIIIlII[#("I4m")]][lIIIIIlII[#("bpdT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ip")]][lIIIIIlII[#("pHn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("GQ4u")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else if(llIlllIIIIIllllIll[lIIIIIlII[#("XR")]]~=lIIIIIlII[#("GtZJ")])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Qam")];end;end;elseif lIIIIllIII<=#("S97m0AY6CZr1Tajk3xqxdeFEhdWr7JTINSA7JIDI4cBy3LSiJTQoFmxOFEfWNG93gTnbKlMv")then if lIIIIllIII<=#("SDbOhKHvOTo2FcBvWDeDQ4ydHrjyRIyhuuXTuax3IB9XVbLRWPYSH2nYf8g0BjOfvgHkpS")then if lIIIIllIII==#{{325;633;343;203};{334;372;284;610};"1 + 1 = 111";{415;491;267;675};"1 + 1 = 111";{437;830;10;369};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{97;462;754;524};"1 + 1 = 111";"1 + 1 = 111";{192;23;294;696};{141;492;57;808};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{304;145;209;91};{771;428;348;170};"1 + 1 = 111";"1 + 1 = 111";{351;101;601;406};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{796;929;159;462};{561;715;357;293};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{152;831;399;173};"1 + 1 = 111";{547;500;413;743};"1 + 1 = 111";"1 + 1 = 111";{231;127;908;974};{505;2;735;69};{976;954;363;895};"1 + 1 = 111";{543;857;64;571};"1 + 1 = 111";"1 + 1 = 111";{619;706;624;583};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{337;153;82;513};"1 + 1 = 111";{183;508;751;300};{382;184;133;228};"1 + 1 = 111";{788;793;989;350};{310;598;600;31};{298;911;675;24};"1 + 1 = 111";{657;669;764;961};"1 + 1 = 111";"1 + 1 = 111";{688;848;263;697};"1 + 1 = 111";"1 + 1 = 111";{956;643;241;19};"1 + 1 = 111";{805;220;22;355};"1 + 1 = 111";"1 + 1 = 111";{882;843;28;705};}then llIlllIIIIIllllIll[lIIIIIlII[#("5Z")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("rMF")]];else llllllIlIIlllllIIIl[lIIIIIlII[#("K3A")]]=llIlllIIIIIllllIll[lIIIIIlII[#("71")]];end;elseif lIIIIllIII>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{339;219;723;85};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{756;553;501;830};"1 + 1 = 111";"1 + 1 = 111";{663;388;505;721};{678;49;25;576};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{977;485;790;198};{717;929;533;122};"1 + 1 = 111";{994;923;872;989};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{731;250;623;794};"1 + 1 = 111";{286;511;191;859};"1 + 1 = 111";{700;778;635;487};{354;290;376;168};{786;119;185;760};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{24;70;252;462};"1 + 1 = 111";{261;484;227;98};{337;988;794;430};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{339;887;70;985};{201;585;991;190};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{655;204;591;946};"1 + 1 = 111";{349;357;777;417};"1 + 1 = 111";"1 + 1 = 111";{897;324;304;968};"1 + 1 = 111";{58;400;212;86};"1 + 1 = 111";"1 + 1 = 111";{100;110;890;285};{434;301;827;126};{340;715;16;261};"1 + 1 = 111";{912;32;496;399};{595;450;87;340};"1 + 1 = 111";}then llIlllIIIIIllllIll[lIIIIIlII[#("jT")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("uWo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("MX")]]=llIlllIIIIIllllIll[lIIIIIlII[#("LcR")]][lIIIIIlII[#("68FC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8A")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{967;570;662;993};}]][lIIIIIlII[#("G5rA")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("WB")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{19;943;540;135};}]][lIIIIIlII[#("CI8T")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#("EHO")]]=llIlllIIIIIllllIll[lIIIIIlII[#("F8")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("UE")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("EIH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Sd")]]=llIlllIIIIIllllIll[lIIIIIlII[#("At3")]][lIIIIIlII[#("urbT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Uv")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("7k7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("cb")]]=llIlllIIIIIllllIll[lIIIIIlII[#("IFz")]][lIIIIIlII[#("okBG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mR")]]=llIlllIIIIIllllIll[lIIIIIlII[#("QVd")]][lIIIIIlII[#("hOZc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ud")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ZkZ")]][lIIIIIlII[#("mn1s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9u")]]=llIlllIIIIIllllIll[lIIIIIlII[#("liM")]][lIIIIIlII[#("v2Dz")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Dt")]][lIIIIIlII[#{{540;759;525;975};{460;539;202;569};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("g7OC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else llIlllIIIIIllllIll[lIIIIIlII[#("sy")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("7Rly")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mx")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oWc")]][lIIIIIlII[#("osfo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9r")]]=llIlllIIIIIllllIll[lIIIIIlII[#("jse")]][lIIIIIlII[#("VI8Q")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("lk")]]=llIlllIIIIIllllIll[lIIIIIlII[#("kmG")]][lIIIIIlII[#("1fpY")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Wp")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Z86")]][lIIIIIlII[#{"1 + 1 = 111";{903;796;209;580};{15;760;533;964};{287;674;277;249};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1A")]][lIIIIIlII[#("EBv")]]=llIlllIIIIIllllIll[lIIIIIlII[#("DYMx")]];end;elseif lIIIIllIII<=#("f7N0zYrAaE8beFViPRHx7iyYVPYpJoUTD2AD2imnrXViVAEunUCgtdb6KYeTac1VUpJmfrpHEt")then if lIIIIllIII>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{312;268;684;363};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{268;849;14;238};{491;741;737;523};{146;65;737;43};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{126;959;262;845};"1 + 1 = 111";{624;770;202;30};{834;546;586;866};{952;543;851;811};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{147;120;681;993};{269;892;497;84};"1 + 1 = 111";"1 + 1 = 111";{726;982;417;955};"1 + 1 = 111";"1 + 1 = 111";{19;458;692;300};"1 + 1 = 111";{825;355;634;730};"1 + 1 = 111";{630;320;903;940};{284;569;29;380};{912;373;237;917};"1 + 1 = 111";"1 + 1 = 111";{917;288;634;784};{114;131;220;562};"1 + 1 = 111";"1 + 1 = 111";{194;938;870;9};{616;724;14;531};{542;82;644;110};"1 + 1 = 111";{597;312;459;117};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{105;604;668;29};"1 + 1 = 111";{652;371;516;941};"1 + 1 = 111";"1 + 1 = 111";{94;30;438;727};"1 + 1 = 111";"1 + 1 = 111";{536;350;987;591};"1 + 1 = 111";{394;240;409;233};"1 + 1 = 111";{772;437;532;91};{744;874;195;529};"1 + 1 = 111";"1 + 1 = 111";{11;412;99;992};{827;204;95;803};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("WJ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("S9q")]][lIIIIIlII[#("qH88")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5W")]]=lIIIIIlII[#("RZI")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("BB")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nF")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{{336;359;915;131};{98;675;581;287};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Br")]]=llIlllIIIIIllllIll[lIIIIIlII[#("uLI")]][lIIIIIlII[#("ADBo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6z")]]=lIIIIIlII[#("TWd")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("sH")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Yd")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("fSy")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Na")]]=llIlllIIIIIllllIll[lIIIIIlII[#("NUo")]][lIIIIIlII[#("4iMO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("KJ")]]=lIIIIIlII[#("4MI")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Yi")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9R")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("21f")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Rx")]]=llIlllIIIIIllllIll[lIIIIIlII[#("FVK")]][lIIIIIlII[#("Y3Ws")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("KW")]]=lIIIIIlII[#("U9r")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("BV")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("fV")]][lIIIIIlII[#("ZlH")]]=lIIIIIlII[#("aSZz")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kZ")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Ac9")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("iJ")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("yZn")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("rbAX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("z7")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("cs")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("LOk")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("m0")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("xKC")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("ARTb")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Kz")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if llIlllIIIIIllllIll[lIIIIIlII[#("SB")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("GsA")];end;else llIlllIIIIIllllIll[lIIIIIlII[#("Bp")]]=lIIIIIlII[#("lTW")];end;elseif lIIIIllIII>#("Qp3arOP4NHrDL2jPjGnmMs3TgfDUzR13heBKszI40bKKbzAGqsVcehtxxk4lk4F6PzuHBKvV7tx")then local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#{{985;109;429;599};{158;861;335;806};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Aii")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dy")]]=llIlllIIIIIllllIll[lIIIIIlII[#("n9D")]][lIIIIIlII[#("oJ91")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("6I")]]=lIIIIIlII[#("M0A")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("MA")]]=lIIIIIlII[#{"1 + 1 = 111";{747;711;45;22};"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7Q")]]=lIIIIIlII[#("iOT")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("cL")]]=lIIIIIlII[#("Yd2")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("oP")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("UcT")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{984;344;766;960};"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("NcH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("d1")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("dgL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];for lIIIIIlII=lIIIIIlII[#("Ax")],lIIIIIlII[#("jlT")]do llIlllIIIIIllllIll[lIIIIIlII]=nil;end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("krM")];else llIlllIIIIIllllIll[lIIIIIlII[#("sU")]]=llIlllIIIIIllllIll[lIIIIIlII[#("kz0")]]+llIlllIIIIIllllIll[lIIIIIlII[#("zOaC")]];end;elseif lIIIIllIII<=#("SsRRQ6Eg5YZ9UdmiEvT5GO4Ne2eR6aeVVTPdDmGoBza0JvXyxnqLKBedyeNX2Xj5UeobzjPr0FFhOddSfRtS")then if lIIIIllIII<=#("EktOLQyKSvOofgFgW8nJ8Vf67Atb4SkDCkq34xYDqRhi13I7IMtSgjVSfxQkvxQalkW40MmzkUrrN7fd")then if lIIIIllIII<=#("xDszCvsAIYHRNh3bg7QgOg6z4Ix1EfirMs83xMTZEEsXPSHNypH9A7npH3E49B5DQpeui9PFn0NjYi")then if lIIIIllIII==#("maUDnIi1PfTxEiZZdI0hAOmEyLbWJudCzjq3p7R4IyzpANkxzbJL7auJXpfNHvsubq7t15Kg06Kbo")then local llIlIllll=llIIllIIIIIIIIllllI[lIIIIIlII[#("QnY")]];local IlllIIllllIllI;local lIIIIllIII={};IlllIIllllIllI=lllllllllIIlIll({},{__index=function(lIIllIllllIIllIIlIlIllI,lIIIIIlII)local lIIIIIlII=lIIIIllIII[lIIIIIlII];return lIIIIIlII[1][lIIIIIlII[2]];end,__newindex=function(llIlllIIIIIllllIll,lIIIIIlII,lIIllIllllIIllIIlIlIllI)local lIIIIIlII=lIIIIllIII[lIIIIIlII]lIIIIIlII[1][lIIIIIlII[2]]=lIIllIllllIIllIIlIlIllI;end;});for llllllIlIIlllllIIIl=1,lIIIIIlII[#("fdcJ")]do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;local lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if lIIIIIlII[#("9")]==48 then lIIIIllIII[llllllIlIIlllllIIIl-1]={llIlllIIIIIllllIll,lIIIIIlII[#("aQr")]};else lIIIIllIII[llllllIlIIlllllIIIl-1]={lIllIIIlIIIIIIIlIIII,lIIIIIlII[#("p3R")]};end;IIIlIIlllIIlIlllIIIlIIII[#IIIlIIlllIIlIlllIIIlIIII+1]=lIIIIllIII;end;llIlllIIIIIllllIll[lIIIIIlII[#("Ye")]]=lllllIllllIllllllI(llIlIllll,IlllIIllllIllI,llllllIlIIlllllIIIl);else local lIIIIIlII=lIIIIIlII[#("hv")]llIlllIIIIIllllIll[lIIIIIlII]=llIlllIIIIIllllIll[lIIIIIlII](llIlllIIIIIllllIll[lIIIIIlII+1])end;elseif lIIIIllIII==#("eVAPyIVCFyZRf92eylfdnjP1FDBDUbBsu0ktn18UJKVKFj0KnWJz5kU5fJj4gsRD7GxpYI1GmuEOyfv")then if not llIlllIIIIIllllIll[lIIIIIlII[#("ng")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("qxp")];end;else llIlllIIIIIllllIll[lIIIIIlII[#("GL")]]=llIlllIIIIIllllIll[lIIIIIlII[#("tV9")]][lIIIIIlII[#("Jbt2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Ejc")]][lIIIIIlII[#("JSKP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("WP")]]=llIlllIIIIIllllIll[lIIIIIlII[#("5h5")]][lIIIIIlII[#("ycO3")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("1l")]][lIIIIIlII[#("Cve")]]=llIlllIIIIIllllIll[lIIIIIlII[#("mzLp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("mrB")];end;elseif lIIIIllIII<=#("N0o8DcyjfpoOReOq2sM9XKVQ5clLQgI9nZrpdTa5injJsmYiRnVeDvIcfJcA0WD9SoB2WynjrR1KBmxSnd")then if lIIIIllIII==#("DuDG1qpkFQLevUj0dW6xt9MXVE7M2lulX39PoSJLHmTDQNG0qvt6rQKESPVxsNssvzqDUFMumvZgpigi8")then if(llIlllIIIIIllllIll[lIIIIIlII[#("7n")]]==lIIIIIlII[#("o45L")])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("n8N")];end;else local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("0a")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Znn")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5G")]]=lIIIIIlII[#("FIt")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("4t")]llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ki")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ccm")]][lIIIIIlII[#{"1 + 1 = 111";{860;887;235;897};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("U5")]]=llIlllIIIIIllllIll[lIIIIIlII[#("At7")]][lIIIIIlII[#("n91a")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jb")]]=llIlllIIIIIllllIll[lIIIIIlII[#("l1N")]][lIIIIIlII[#("zx0Y")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ut")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("UV4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("E5")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Yu8")]][lIIIIIlII[#("H8uu")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("NN")]]=lIIIIIlII[#("51u")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("FC")]]=lIIIIIlII[#("hMS")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("81")]]=lIIIIIlII[#("5WC")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Eq")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("YhE")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dr")]]=llIlllIIIIIllllIll[lIIIIIlII[#("jQ6")]]*llIlllIIIIIllllIll[lIIIIIlII[#("vahG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("JM")]][lIIIIIlII[#("u4n")]]=llIlllIIIIIllllIll[lIIIIIlII[#("QDWK")]];end;elseif lIIIIllIII>#("vH2y4gtG7K7mr34AhrvdfVU8U61DnJIMzlrVB7FjjnIbxad6m0aZW5cKW3O8p0sybuXgLi9kWl41nSLT24p")then local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("W7")]]=llIlllIIIIIllllIll[lIIIIIlII[#("vVN")]][lIIIIIlII[#("PgSX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hc")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("1uuB")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("KR")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Ku2")]][lIIIIIlII[#("zlNg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("cN")]]=llIlllIIIIIllllIll[lIIIIIlII[#("S1q")]][lIIIIIlII[#("0JXB")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Kv")]]=llIlllIIIIIllllIll[lIIIIIlII[#("LRM")]][lIIIIIlII[#("pKKs")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("Ape")]][lIIIIIlII[#("vJ1s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ez")]]=llIlllIIIIIllllIll[lIIIIIlII[#("rGU")]][lIIIIIlII[#("UnqD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("gl")]]=llIlllIIIIIllllIll[lIIIIIlII[#("zeO")]][lIIIIIlII[#("rPd8")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Uq")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{264;847;99;769};{147;197;653;153};}]][lIIIIIlII[#("lN3b")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("4g")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9P6")]][lIIIIIlII[#("jxb7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7V")]]=llIlllIIIIIllllIll[lIIIIIlII[#("urX")]][lIIIIIlII[#("hQvi")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("FS")]]=llIlllIIIIIllllIll[lIIIIIlII[#("osR")]][lIIIIIlII[#("fGzc")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("UF")]]=llIlllIIIIIllllIll[lIIIIIlII[#("zir")]][lIIIIIlII[#("rDc4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("75")]]=llIlllIIIIIllllIll[lIIIIIlII[#("sZ6")]]+lIIIIIlII[#("k4k8")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("y6")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#{{514;791;160;247};{205;319;479;917};{488;244;980;721};}]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("73")]][lIIIIIlII[#("KsU")]]=llIlllIIIIIllllIll[lIIIIIlII[#("kFYD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qV")]][lIIIIIlII[#("Q1I")]]=llIlllIIIIIllllIll[lIIIIIlII[#("MQJz")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Se")]]=llIlllIIIIIllllIll[lIIIIIlII[#("24Y")]][lIIIIIlII[#("9I3m")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if not llIlllIIIIIllllIll[lIIIIIlII[#("AP")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Vad")];end;else local llllllIlIIlllllIIIl;local lIIIIllIII;lIIIIllIII=lIIIIIlII[#("ly")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("CMz")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("fQ")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("ZCT")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("e1ik")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Be")]]=lIIIIIlII[#("WbT")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("lf")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("b3R")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("hI")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("3ia")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#{{396;308;931;607};"1 + 1 = 111";{571;863;226;565};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qG")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{287;887;35;109};}];end;elseif lIIIIllIII<=#("IS0EiR9HsH4s5jacm7ue00dKakvds4fvL4ZsFt73iC1prM6eSJH5JlHSPqD8v5ozCJRatRI29B5z8XrzorvUyjWz")then if lIIIIllIII<=#("hNn19InnDYT45UbbO5iqhT18dUdKEarWsNmdtba3RlG9JFtHtTTnOipzVpYpENTCG6MrI7SN5pJ6m2AJBGpVrd")then if lIIIIllIII==#("jyXrdmVzeCeDM3b9xbgszJsl30pZ8x7kDXC4UPOAk1FEizXPzH3UlUULeMyn75ARF3aZBgoRxQhIeYcFcKABD")then llIlllIIIIIllllIll[lIIIIIlII[#("gT")]]=(lIIIIIlII[#("U7A")]~=0);else if(llIlllIIIIIllllIll[lIIIIIlII[#("dW")]]~=lIIIIIlII[#("SL9C")])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("tv1")];end;end;elseif lIIIIllIII>#("9Sd00iqADoBX9oy8orrmxFNmHpJ3kyG9or4rVLqgA7n3gqZXgevhjqZEf0tKJyofSCJRugmNblWArTfpBVWgby0")then local lIIIIIlII=lIIIIIlII[#("TO")]llIlllIIIIIllllIll[lIIIIIlII](llIlllIIIIIllllIll[lIIIIIlII+1])else local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("Vp")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("VZO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Fe")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{365;281;497;267};{928;466;421;649};}]][lIIIIIlII[#("pmcR")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIIIIlII[#("JET")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Y2")]]=lIIIIIlII[#("hUR")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("j6")]]=lIIIIIlII[#("mZd")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("yW")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9bK")]][lIIIIIlII[#("M123")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ri")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Zao")]][lIIIIIlII[#("z7aD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kB")]]=llIlllIIIIIllllIll[lIIIIIlII[#("co7")]][lIIIIIlII[#("UJ0F")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ut")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("jCd")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Hi")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oMy")]]+llIlllIIIIIllllIll[lIIIIIlII[#("sW96")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("k3C")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Av")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{299;805;488;434};}]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jR")]]=llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("5FuX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{732;363;434;511};}]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("sor")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("QD")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oEo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("n6")]llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("Ige")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("xP")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("HsF")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII]()lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hK")]]=llIlllIIIIIllllIll[lIIIIIlII[#("RFU")]][lIIIIIlII[#("bRgP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("iU")]]=llIlllIIIIIllllIll[lIIIIIlII[#("B6C")]][lIIIIIlII[#("WFmq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hO")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("JGL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Hz")]]=llIlllIIIIIllllIll[lIIIIIlII[#("VoL")]][lIIIIIlII[#("n9pG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("m4")]]=llIlllIIIIIllllIll[lIIIIIlII[#("6Dh")]][lIIIIIlII[#("YoH8")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ku7")]][lIIIIIlII[#("iUF7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if(llIlllIIIIIllllIll[lIIIIIlII[#{{234;608;573;632};{656;795;353;310};}]]<=llIlllIIIIIllllIll[lIIIIIlII[#("Emgm")]])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("xXJ")];end;end;elseif lIIIIllIII<=#("DBl5rQHbSikPRhDa2Sg7EAlxVdjYMiduLMo44rvuPVRjJAIssWntr2DdoZjnHTAKe0df3JfKvVsTSbXuF0F04TcTil")then if lIIIIllIII>#("fhhX6uheSvDAUQN7HKTumbZTRnJPvYu7R39Dn7vzL7f8cAVjqVFiz0DdrzgSWCT4bFS1QkUJnuUp60RrDzyKslI1B")then local llIlIllll;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("oE")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{{758;458;282;701};"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("4G")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("NKs")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{637;821;895;353};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ik")]]=lIIIIIlII[#("QRd")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("K0")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("Xkj")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Hh")];llIlIllll=llIlllIIIIIllllIll[lIIIIIlII[#("2IZ")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llIlIllll;llIlllIIIIIllllIll[lIIIIllIII]=llIlIllll[lIIIIIlII[#("R0vi")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{{215;626;95;121};{110;973;13;410};}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if not llIlllIIIIIllllIll[lIIIIIlII[#("pE")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("GCz")];end;else llIlllIIIIIllllIll[lIIIIIlII[#("Jj")]]=lIllIIIlIIIIIIIlIIII[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif lIIIIllIII==#("kZ1ONiok7HR3Egb54dgnhCSYoxeiLZ61BUa4SKSMbV3jKJ5rIxrEUmYThczpdfJhK0DTfhnuvFlvIIoQBWKoICgn6qX")then local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{158;727;963;625};}]][lIIIIIlII[#("H8n")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oxJR")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("xzr")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("4V")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9ue")]][lIIIIIlII[#("tHEs")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("r3")]]=lIIIIIlII[#("5Z6")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0o")]]=lIIIIIlII[#("zWh")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("x9")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("kp2")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("66")]][lIIIIIlII[#("8pH")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Q7x2")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("LQ")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("SDg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jd")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{532;442;968;919};{475;291;748;272};"1 + 1 = 111";}]][lIIIIIlII[#("rmjp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jH")]]=lIIIIIlII[#("EA8")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5P")]]=lIIIIIlII[#("3RT")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5W")]]=lIIIIIlII[#("DPy")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("xL")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("GjP")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bQ")]][lIIIIIlII[#("CGl")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Kz9q")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llllllIlIIlllllIIIl[lIIIIIlII[#("fyP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9j")]]=llIlllIIIIIllllIll[lIIIIIlII[#("15U")]][lIIIIIlII[#("R442")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("S3")]]=lIIIIIlII[#("nbf")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("XN")]]=lIIIIIlII[#("LoV")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("FG")]]=lIIIIIlII[#("XTf")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ox")]]=lIIIIIlII[#("Gtv")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("oV")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("211")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ix")]][lIIIIIlII[#("YSL")]]=llIlllIIIIIllllIll[lIIIIIlII[#("73zp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("W4")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("V6L")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ta")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{721;212;725;379};{142;77;524;428};"1 + 1 = 111";}]][lIIIIIlII[#("VkXQ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("M4")]]=lIIIIIlII[#("6mt")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("DC")]]=lIIIIIlII[#("Jzf")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Jk")]]=lIIIIIlII[#("yPL")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("AB")]]=lIIIIIlII[#("BRV")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Sh")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("bxo")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{788;604;983;253};"1 + 1 = 111";}]][lIIIIIlII[#("elS")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{904;859;895;235};{210;805;871;942};{210;775;848;141};"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kh")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("AIn")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("NW")]]=llIlllIIIIIllllIll[lIIIIIlII[#("OQp")]][lIIIIIlII[#("jjm7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0M")]]=llIlllIIIIIllllIll[lIIIIIlII[#("lhH")]][lIIIIIlII[#("FRgr")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9m")]][lIIIIIlII[#("a3T")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Zysb")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("u9")]][lIIIIIlII[#("WKj")]]=lIIIIIlII[#("zMMx")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("gl")]][lIIIIIlII[#("g2h")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WJgk")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7b")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{"1 + 1 = 111";{144;615;379;101};{480;210;657;566};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{187;470;977;749};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("NH3")]][lIIIIIlII[#("gADi")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vZ")]]=lIIIIIlII[#("EYc")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("LZ")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("lQ")]]=lIIIIIlII[#("AQH")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("lI")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("jBV")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("k9")]][lIIIIIlII[#("NVn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("2LE7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vM")]][lIIIIIlII[#("bKA")]]=lIIIIIlII[#("IS6G")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("HK")]][lIIIIIlII[#("AjD")]]=lIIIIIlII[#("qXgh")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Of")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("M2r")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("UM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("oX0")]][lIIIIIlII[#("y2Vg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ti")]]=lIIIIIlII[#("1Sr")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("mp")]]=lIIIIIlII[#("7BS")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bq")]]=lIIIIIlII[#("uZ4")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Kp")]]=lIIIIIlII[#("d5U")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("OX")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("tAS")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Vj")]][lIIIIIlII[#("zEM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("ufBW")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("b5")]]=llllllIlIIlllllIIIl[lIIIIIlII[#{{806;710;411;772};{467;564;883;994};{423;498;221;813};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("LL")]]=llIlllIIIIIllllIll[lIIIIIlII[#("y2d")]][lIIIIIlII[#("Kcct")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nx")]]=lIIIIIlII[#("LKq")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{210;574;723;995};}]]=lIIIIIlII[#("D3G")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("20")]]=lIIIIIlII[#("18n")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("s2")]]=lIIIIIlII[#("pSU")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("e9")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("hBu")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("zj")]][lIIIIIlII[#("e6X")]]=llIlllIIIIIllllIll[lIIIIIlII[#("fn7y")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jW")]][lIIIIIlII[#("gpx")]]=lIIIIIlII[#("n3vG")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("d3")]][lIIIIIlII[#("ukd")]]=lIIIIIlII[#{{693;99;386;83};{528;293;927;531};{826;29;834;992};{401;328;348;483};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("C3")]][lIIIIIlII[#("VHj")]]=llIlllIIIIIllllIll[lIIIIIlII[#("9C8s")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bT")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("PZy")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("TT")]]=llIlllIIIIIllllIll[lIIIIIlII[#("3hb")]][lIIIIIlII[#("oOvC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("a8")]]=lIIIIIlII[#("qaW")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("zX")]]=lIIIIIlII[#("dBA")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("oS")]]=lIIIIIlII[#("Hos")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ju")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("W2Z")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8Q")]][lIIIIIlII[#("Gxp")]]=llIlllIIIIIllllIll[lIIIIIlII[#("WkSA")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("hM")]][lIIIIIlII[#("5V0")]]=lIIIIIlII[#("FPNq")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("EB")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("Jqa")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("cj")]]=llIlllIIIIIllllIll[lIIIIIlII[#("c45")]][lIIIIIlII[#("c0T1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rW")]]=lIIIIIlII[#("5yg")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("X1")]]=lIIIIIlII[#{"1 + 1 = 111";{457;13;989;35};{592;821;584;667};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("GK")]]=lIIIIIlII[#("Vf4")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9e")]]=lIIIIIlII[#("nFR")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{"1 + 1 = 111";{812;367;971;594};}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("9k4")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("j5")]][lIIIIIlII[#("2uE")]]=llIlllIIIIIllllIll[lIIIIIlII[#("FGoe")]];else local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#{{94;530;958;272};"1 + 1 = 111";}];local lIlIIIlIIlllllII=llIlllIIIIIllllIll[lIIIIIlII[#("kdR")]];llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI+1]=lIlIIIlIIlllllII;llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI]=lIlIIIlIIlllllII[lIIIIIlII[#("P9Fs")]];end;elseif lIIIIllIII<=#("kCI5mVKUfmlBj6ipaDkKYTZrFuKhTpXZtIj37qjW7FKnLieLt1mEgn1CNpA2lCaZAxhLXprUszMsiMRxp8Y1dtSfQSqR0qLGEUYnbDYdJCkR")then if lIIIIllIII<=#("IsbJdMmOiWgOb4e9L4bXgZzXDuWjVrMjbEizphWPz1u8SK9ITd8Hi4GT4ngSZc31j6NHWQUDixzoEAe3vnBRteag8zFbbdZv8EYV")then if lIIIIllIII<=#("CWdtGzVFqoEimxLMlHf6GJxkSCeHdpaMt63CxxYPpLRkb2YQoUX6TZA3z2LeuoCbn1ZpEioZTAQ42mjZNystDd2EHadFVTua")then if lIIIIllIII<=#("Q6jdImfF7mtiFblTWB66iJj9uTDeUd9eQVmp9WelmYF0Ivb91V9szeagXkTYTaU4npDTY6TavVTudsB9SEn8dRPLVfDZcq")then if lIIIIllIII>#("leKNs2rk5c96OuQdETUgpXV0GK27TE37ftHpDQhgAss6eUbpfc8gsjlzsUgSatBBjc1uYAKYLNR6FZVVJM2RFXO6hi7TJ")then local llIlIllll=llIIllIIIIIIIIllllI[lIIIIIlII[#("Ag5")]];local IlllIIllllIllI;local lIIIIllIII={};IlllIIllllIllI=lllllllllIIlIll({},{__index=function(lIIllIllllIIllIIlIlIllI,lIIIIIlII)local lIIIIIlII=lIIIIllIII[lIIIIIlII];return lIIIIIlII[1][lIIIIIlII[2]];end,__newindex=function(llIlllIIIIIllllIll,lIIIIIlII,lIIllIllllIIllIIlIlIllI)local lIIIIIlII=lIIIIllIII[lIIIIIlII]lIIIIIlII[1][lIIIIIlII[2]]=lIIllIllllIIllIIlIlIllI;end;});for llllllIlIIlllllIIIl=1,lIIIIIlII[#("ieTf")]do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;local lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if lIIIIIlII[#("I")]==48 then lIIIIllIII[llllllIlIIlllllIIIl-1]={llIlllIIIIIllllIll,lIIIIIlII[#("txT")]};else lIIIIllIII[llllllIlIIlllllIIIl-1]={lIllIIIlIIIIIIIlIIII,lIIIIIlII[#("WTU")]};end;IIIlIIlllIIlIlllIIIlIIII[#IIIlIIlllIIlIlllIIIlIIII+1]=lIIIIllIII;end;llIlllIIIIIllllIll[lIIIIIlII[#("2E")]]=lllllIllllIllllllI(llIlIllll,IlllIIllllIllI,llllllIlIIlllllIIIl);else local lIIIIIlII=lIIIIIlII[#("W3")]local lIlIIIlIIlllllII,lIIllIllllIIllIIlIlIllI=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIIlII](llIlllIIIIIllllIll[lIIIIIlII+1]))llIlIllll=lIIllIllllIIllIIlIlIllI+lIIIIIlII-1 local lIIllIllllIIllIIlIlIllI=0;for lIIIIIlII=lIIIIIlII,llIlIllll do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;llIlllIIIIIllllIll[lIIIIIlII]=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];end;end;elseif lIIIIllIII==#("ff21Wc3RCQCkFQCo3D8vjzCU6vz4mPC0olIMeOcT21klots8E2oFUnoRNh5BO8EWoM5sh0kpAoEsnpFMdABuA7fb6186SMf")then local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("4o")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("qv5")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("T7")]]=llIlllIIIIIllllIll[lIIIIIlII[#("0tF")]][lIIIIIlII[#{"1 + 1 = 111";{10;96;888;103};"1 + 1 = 111";{741;75;99;978};}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("zh")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{937;726;548;579};"1 + 1 = 111";}]]=lIIIIIlII[#("ayd")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("qc")]]=lIIIIIlII[#("3L4")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("V8")]]=lIIIIIlII[#("zsE")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("jS")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("krl")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("zu")]]=lIIIIIlII[#("Wsa")];else if(lIIIIIlII[#("Ue")]<=llIlllIIIIIllllIll[lIIIIIlII[#("dk6K")]])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("BEq")];end;end;elseif lIIIIllIII<=#("yy7Nz90NS9eFU6DyNsxnIjxqG3vq2nHYjL40r2ndKYMB2KrazLtAo1uobRgFOKVFCqvjcMfVftOUH5z5Mv2q4hJrpQYLVTzach")then if lIIIIllIII>#("Loi7WFIt4nLRgrl3sRELtRd3vXEax4ORA6XRDygVvYOeO8StJZgsJHP4kpM8aI6aK3rjEFA4LSoGc9oxfkBHXvi3q3GnWhUY1")then if(llIlllIIIIIllllIll[lIIIIIlII[#("4z")]]==lIIIIIlII[#("bcZL")])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("zOP")];end;else local lIIIIllIII;local lIllIIIlIIIIIIIlIIII;local lllllIllllIllllllI,IIIlIIlllIIlIlllIIIlIIII;local IlllIIIIlllIlIllI;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("La")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("INn")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("bL")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("XdM")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("1q")];IlllIIIIlllIlIllI=llIlllIIIIIllllIll[lIIIIIlII[#("siF")]];llIlllIIIIIllllIll[lIIIIllIII+1]=IlllIIIIlllIlIllI;llIlllIIIIIllllIll[lIIIIllIII]=IlllIIIIlllIlIllI[lIIIIIlII[#("iThP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ma")]]=lIIIIIlII[#("Zta")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("vz")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("1qP")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nQ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("hOq")]][lIIIIIlII[#("SzqD")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Yh")];IlllIIIIlllIlIllI=llIlllIIIIIllllIll[lIIIIIlII[#("ndA")]];llIlllIIIIIllllIll[lIIIIllIII+1]=IlllIIIIlllIlIllI;llIlllIIIIIllllIll[lIIIIllIII]=IlllIIIIlllIlIllI[lIIIIIlII[#("XQA1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("MN")]lllllIllllIllllllI,IIIlIIlllIIlIlllIIIlIIII=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1]))llIlIllll=IIIlIIlllIIlIlllIIIlIIII+lIIIIllIII-1 lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,llIlIllll do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=lllllIllllIllllllI[lIllIIIlIIIIIIIlIIII];end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("EF")]lllllIllllIllllllI={llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,llIlIllll))};lIllIIIlIIIIIIIlIIII=0;for lIIIIIlII=lIIIIllIII,lIIIIIlII[#("B6Hq")]do lIllIIIlIIIIIIIlIIII=lIllIIIlIIIIIIIlIIII+1;llIlllIIIIIllllIll[lIIIIIlII]=lllllIllllIllllllI[lIllIIIlIIIIIIIlIIII];end lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("hIl")];end;elseif lIIIIllIII>#("EURIZezlR0ri1lao30gzmoVz3L8miE7BPzFEPHvxhMOsLicumHo4RCCp9sPnfmdn20ECQGJxEUqLKCXUJO9LocUm7pFx1iq5IBA")then local lIIIIIlII=lIIIIIlII[#("W8")]local lIlIIIlIIlllllII,lIIllIllllIIllIIlIlIllI=lIlIIIIIIIIlIlIllllII(llIlllIIIIIllllIll[lIIIIIlII](llIlllIIIIIllllIll[lIIIIIlII+1]))llIlIllll=lIIllIllllIIllIIlIlIllI+lIIIIIlII-1 local lIIllIllllIIllIIlIlIllI=0;for lIIIIIlII=lIIIIIlII,llIlIllll do lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;llIlllIIIIIllllIll[lIIIIIlII]=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];end;else local lIIIIIlII=lIIIIIlII[#("iE")]llIlllIIIIIllllIll[lIIIIIlII]=llIlllIIIIIllllIll[lIIIIIlII]()end;elseif lIIIIllIII<=#("OKOR82B6k0PHG4PCmD8ZgqFBbmFvEvciccg9asNxMXbgK706EYTfDLOyenQWxfDZYHFDYPC40Mnsoy0dvJ2PM7QCyS4WM09HumscCxhY")then if lIIIIllIII<=#("Zp1yviRxNAYmXm01dffVPr9MQ8cfXL8BdrXRYecKnA9BktH9ClzrbcSHqoRyfMJbCxiGAjc9cGIpsIBvBdNMmQzbKqBKxPFM079Xkb")then if lIIIIllIII==#("sjzpGFDnSXu6b87YV8h6iSDMxa6AuJNlzEtDXB3HgdSWbSDN2inZcfBKQW3FId2ikjHIOFbueLZfaQLOItHmvXitcUWaIy8dkKM2k")then if(lIIIIIlII[#("Ti")]<=llIlllIIIIIllllIll[lIIIIIlII[#("lv4z")]])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("5e2")];end;else llIlllIIIIIllllIll[lIIIIIlII[#("2p")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("es1")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("A3")]]=llIlllIIIIIllllIll[lIIIIIlII[#("QqI")]][lIIIIIlII[#("uKPI")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("E6")]]=llIlllIIIIIllllIll[lIIIIIlII[#("XZB")]][lIIIIIlII[#("Mk33")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ud")]]=llIlllIIIIIllllIll[lIIIIIlII[#("DsP")]][lIIIIIlII[#("A6dv")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#("9hS")]]=llIlllIIIIIllllIll[lIIIIIlII[#("cH")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ng")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("v87")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("W9")]]=llIlllIIIIIllllIll[lIIIIIlII[#("NfX")]][lIIIIIlII[#("bKb4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("WH")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("7qp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{824;895;320;465};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("Co3")]][lIIIIIlII[#("xVeX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("nd")]]=llIlllIIIIIllllIll[lIIIIIlII[#("AH2")]][lIIIIIlII[#("fGIR")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jN")]]=llIlllIIIIIllllIll[lIIIIIlII[#("gNC")]][lIIIIIlII[#("XYSf")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("cu")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Msd")]][lIIIIIlII[#("hUTF")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ay")]][lIIIIIlII[#("3do")]]=llIlllIIIIIllllIll[lIIIIIlII[#("NXHC")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;end;elseif lIIIIllIII>#("8xh3VCpuKalo7oGQXxbnF4TaXRNV4AeTDNujeCcRdSjWYsATIFXp07AeOgfdYFAk5DVu4vLutujXU7lEq3nANZ2GnpG7v82Jr90vIeZ")then if llIlllIIIIIllllIll[lIIIIIlII[#("Wh")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("v8A")];end;else llIlllIIIIIllllIll[lIIIIIlII[#("EU")]][lIIIIIlII[#("vhE")]]=lIIIIIlII[#("E3l8")];end;elseif lIIIIllIII<=#("3C5GXMtR5MX5qaHgLphO0O8uCLFVg06mdbGk3xSL6ZcUl7rrDTUr7lvoDLdmgJKePL1oEvnoHHSaMoiFsnrxgOo2QrSssGExo7eLfcXgGG")then if lIIIIllIII==#("AEuNoCI33qm8bv9JmO55bcuVOjIAqBl0K3ZyuOD0VMLfc9dpfDLDLKTxiK8f4hNDfvyhGMoIlekzCpTOfruXZSpakCpVPx6N9i9QM5TEo")then local llllllIlIIlllllIIIl;local lIIIIllIII;lIIIIllIII=lIIIIIlII[#("7U")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("DXR")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("E5")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("KRQ")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("Lt9S")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("B6")]]=lIIIIIlII[#("zgS")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("df")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("o1X")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("v8")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("GJh")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("KG2C")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Bp")]]=lIIIIIlII[#("b72")];else local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("kK")]]=llIlllIIIIIllllIll[lIIIIIlII[#("bBz")]][lIIIIIlII[#("fMlO")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("R9")]]=lIIIIIlII[#("ZXm")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("8n")]]=lIIIIIlII[#("dry")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("da")]]=lIIIIIlII[#("65Y")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Rs")]]=llIlllIIIIIllllIll[lIIIIIlII[#("NZB")]][lIIIIIlII[#("Ln86")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("OD")]]=llIlllIIIIIllllIll[lIIIIIlII[#("vWJ")]][lIIIIIlII[#("r1GL")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("0U")]]=llIlllIIIIIllllIll[lIIIIIlII[#("kRK")]][lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("iS")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("ajJ")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("f9")]]=llIlllIIIIIllllIll[lIIIIIlII[#("4XG")]]+llIlllIIIIIllllIll[lIIIIIlII[#("ltK0")]];end;elseif lIIIIllIII>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{908;600;442;847};{322;969;503;918};{636;659;448;347};"1 + 1 = 111";{849;539;318;550};"1 + 1 = 111";{255;432;129;565};{840;67;819;507};"1 + 1 = 111";"1 + 1 = 111";{491;394;593;322};"1 + 1 = 111";{563;684;934;442};{827;994;495;811};"1 + 1 = 111";"1 + 1 = 111";{122;734;610;354};{55;482;52;123};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{562;948;8;392};{446;826;762;392};"1 + 1 = 111";"1 + 1 = 111";{943;444;390;650};"1 + 1 = 111";{270;723;890;898};"1 + 1 = 111";{701;568;492;259};"1 + 1 = 111";{688;500;624;898};"1 + 1 = 111";"1 + 1 = 111";{531;995;285;708};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{327;652;20;269};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{774;222;447;180};"1 + 1 = 111";"1 + 1 = 111";{797;642;912;356};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{691;500;899;436};{443;676;638;972};"1 + 1 = 111";"1 + 1 = 111";{338;838;736;971};"1 + 1 = 111";{394;894;207;71};{351;141;899;131};{66;172;237;158};"1 + 1 = 111";{581;416;857;254};{447;628;270;333};"1 + 1 = 111";{803;16;652;768};"1 + 1 = 111";"1 + 1 = 111";{897;296;369;886};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{387;290;25;437};{183;88;500;321};"1 + 1 = 111";{313;291;936;340};"1 + 1 = 111";"1 + 1 = 111";{387;209;653;109};"1 + 1 = 111";{717;197;462;284};{713;772;176;540};{17;229;396;372};"1 + 1 = 111";{632;574;868;265};"1 + 1 = 111";{653;699;943;526};{660;312;633;934};{433;802;947;50};{410;900;677;950};"1 + 1 = 111";{825;19;338;2};"1 + 1 = 111";"1 + 1 = 111";{27;221;148;334};{468;588;916;976};{742;565;854;969};{782;749;792;691};"1 + 1 = 111";"1 + 1 = 111";{191;503;802;99};{83;578;558;82};}then local lIIIIIlII=lIIIIIlII[#("QP")]llIlllIIIIIllllIll[lIIIIIlII]=llIlllIIIIIllllIll[lIIIIIlII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIIlII+1,llIlIllll))else llIlllIIIIIllllIll[lIIIIIlII[#("Av")]]={};end;elseif lIIIIllIII<=#("nLbMkPYbuFOjlGm7ecmNsBF2FXyi6qtuXNJc6RIpgRWI4hSxDThAODYWfjhyrPeeksxJ7kbyF6GMP78yebPmi4QtZW6XKk8CMSyMUjzsSU5S6mhilTsq")then if lIIIIllIII<=#("25pMdTknnXt8e96JxO4MxFy88xMOYM01RCUWh9QAoeE6LT2mkJYfyPMxIrORgGAM7DrNpjCx7FxsbBxpFADoXVDcZxo0u9sSO19iCo7bhBh3rtvg")then if lIIIIllIII<=#("zmRckZlaoY25Mc7lPPjBnYpDChvNJUGbh56XLPDcXimBefFzkRNPmQQK6oKdDJBFs1YQfkK9lgOfLZyxM6D1h0YCov0xeAKoSSimrYt9hODgbL")then if lIIIIllIII>#("h0nBHgJxCcxCTun4WHzy3QlfXNEUEySANxSG18ciiuRj4xKO3TRJMnfBPiN3MY3eu6YxNRcXEqoI9bkBcZ0UQiXAqq0SujGuBNZ7InblQ3fv9")then do return end;else local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Yt")]local lIIIIllIII={llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,llIlIllll))};local lIlIIIlIIlllllII=0;for lIIIIIlII=lIIllIllllIIllIIlIlIllI,lIIIIIlII[#("DYa1")]do lIlIIIlIIlllllII=lIlIIIlIIlllllII+1;llIlllIIIIIllllIll[lIIIIIlII]=lIIIIllIII[lIlIIIlIIlllllII];end end;elseif lIIIIllIII>#("CO8m1W7jyljzfv0uDuV4hxlm2YYOdWdCBTZmUirTxroOYjiPuvBVKeAeCVuc8sgMhS7vHOKuccIZiHyTPitRur1vsUU8XoVdkNHflWiRWgTIHK6")then local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("bq")]llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI]=llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI](IlllIIllllIllI(llIlllIIIIIllllIll,lIIllIllllIIllIIlIlIllI+1,lIIIIIlII[#("smz")]))else local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("pG")]]=llIlllIIIIIllllIll[lIIIIIlII[#("3Bz")]][lIIIIIlII[#("L2rN")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Px")]]=lIIIIIlII[#("DEW")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rv")]]=lIIIIIlII[#("VmR")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7R")]]=lIIIIIlII[#("HfI")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("DL")]]=lIIIIIlII[#("23s")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Ub")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("mBq")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("UL")]][lIIIIIlII[#("S2z")]]=llIlllIIIIIllllIll[lIIIIIlII[#("aL20")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("7r")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("zPN")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("sO")]]=llIlllIIIIIllllIll[lIIIIIlII[#("AY3")]][lIIIIIlII[#("p5oX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("93")]]=llIlllIIIIIllllIll[lIIIIIlII[#("yLb")]][lIIIIIlII[#("UXyP")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("MN")]][lIIIIIlII[#("49b")]]=llIlllIIIIIllllIll[lIIIIIlII[#("v4DZ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("LK")]][lIIIIIlII[#("Dx8")]]=lIIIIIlII[#("Wbva")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("BE")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("pqq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("UY")]]=llIlllIIIIIllllIll[lIIIIIlII[#("4qz")]][lIIIIIlII[#("Wngh")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("CT")]]=lIIIIIlII[#("jGp")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("46")]]=lIIIIIlII[#("eMl")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ve")]]=lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";{888;328;311;126};}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("rq")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("mN1")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Vs")]][lIIIIIlII[#("2Mn")]]=llIlllIIIIIllllIll[lIIIIIlII[#("AJ3z")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jv")]][lIIIIIlII[#("zDB")]]=lIIIIIlII[#{{738;367;911;736};"1 + 1 = 111";{660;971;942;897};"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("rr")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("4K4")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Yu")]]=llIlllIIIIIllllIll[lIIIIIlII[#("znH")]][lIIIIIlII[#("qfWp")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{366;388;592;793};}]]=llIlllIIIIIllllIll[lIIIIIlII[#("AAV")]][lIIIIIlII[#("QAun")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIIIIlII[#("vAM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("RzD6")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("H9")]][lIIIIIlII[#("Y6o")]]=lIIIIIlII[#("9p1R")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("vF")]][lIIIIIlII[#("LpM")]]=lIIIIIlII[#{{243;935;677;59};{47;192;135;435};"1 + 1 = 111";"1 + 1 = 111";}];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Kz")]][lIIIIIlII[#("A9H")]]=lIIIIIlII[#("k39N")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("2O")]]={};end;elseif lIIIIllIII<=#("xLyZ9AqZ0McX3LHXrFPFasH3aM4oJtYSX0Mm15dVxRoKTvYlK5pc5B3eeEZyFcpHXu9d9t5vB3itd7jPYSOOdVXv6HixgPptBSWzvVmp94LbrKbguj")then if lIIIIllIII==#("WyMDbHNgClJpWOZ2ulUsdGyPjkVdvGbc6fD5ZpU1TOUeBOZyDRQ4K1Hqa6s1WJU6jGsRk3deB3KzVtnFuxKPZgCeIm5272fj3Y44vinKOMDRrhFQS")then local llllllIlIIlllllIIIl;local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("Qu")]]=llIlllIIIIIllllIll[lIIIIIlII[#("dme")]][lIIIIIlII[#("ah0C")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("GZ")]]=llIlllIIIIIllllIll[lIIIIIlII[#("e4R")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("9q")]]=lIIIIIlII[#("SdR")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("MD")]]=lIIIIIlII[#("TMs")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("kN")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("195")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("4L")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("95y")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("Qofh")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{549;94;644;475};{296;191;279;693};}]]=lIIIIIlII[#("nnU")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("VV")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("7rS")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if not llIlllIIIIIllllIll[lIIIIIlII[#("3z")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Rof")];end;else if llIlllIIIIIllllIll[lIIIIIlII[#("PJ")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("veX")];end;end;elseif lIIIIllIII==#("Hz9fhdeni77khJXAG7AtjmjabnNUWBSojjvQkXR00h9qNDE431LIqzOup8e4AtBSpSb8mhpTqJDbm3yITT05Zk7VGbBlTXBHQra4CGRWM2qS5MhvLGk")then local llllllIlIIlllllIIIl;local lIIIIllIII;lIIIIllIII=lIIIIIlII[#("az")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("TgK")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("v32N")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Oh")]]=lIIIIIlII[#("o3D")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{{856;10;305;873};{615;598;997;879};}]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("60U")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#{{111;939;161;13};"1 + 1 = 111";}];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("des")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("ag77")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{"1 + 1 = 111";{625;901;2;187};}]]=lIIIIIlII[#("YLD")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("ql")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("kcH")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if llIlllIIIIIllllIll[lIIIIIlII[#("kQ")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("urO")];end;else local lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("Nh")];local lIlIIIlIIlllllII=llIlllIIIIIllllIll[lIIIIIlII[#("GgA")]];llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI+1]=lIlIIIlIIlllllII;llIlllIIIIIllllIll[lIIllIllllIIllIIlIlIllI]=lIlIIIlIIlllllII[lIIIIIlII[#{{71;166;726;998};"1 + 1 = 111";{799;412;977;303};"1 + 1 = 111";}]];end;elseif lIIIIllIII<=#("DG2eVpClQe9Dh6v42Dgmbes63pZ33eKnMUejz6jldGgH3XL9qnEiz7Pzn6lFBIrLFW1x2lF6t5iF8WdfPZNQLCYOeQ6DUOUFnFch6nheSIYEYkAB2f0M5Mac")then if lIIIIllIII<=#("mrlpblPkNqDT6jCRJ7dNuZ4pFLOYiKME9jT55ZQvisk37R66z4vO7zNxy6UBH1cdP9TWAGVUrREbPbsYORznn7HLHxI9foYrqhn77jH2iMxp4MSvO5WZCY")then if lIIIIllIII==#("RCipc8WOc3mVHYu0FjHeMLrQ5OlvjC8ZCsHGZ4F3x8tvS1kIsfrP5UnfkDuyWBFK4ysoqYbLPNSOr57eDOcdks4SfBvvJgh5DTCtI6qEeRarbJYoFq4hz")then if not llIlllIIIIIllllIll[lIIIIIlII[#("d5")]]then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("mET")];end;else llIlllIIIIIllllIll[lIIIIIlII[#("eN")]]=llIlllIIIIIllllIll[lIIIIIlII[#("uNn")]];end;elseif lIIIIllIII==#("ALELi0DPbJGWkIEOGHyI9DsMQGNg0sl9Hct006XBbzQBWozqV1UyU0B7s24NnxZSxGpinNXJT7HKX1ZChvv8JXpRLxI8ckmPK7dq9qciekPWt1jBcDG1b0j")then llIlllIIIIIllllIll[lIIIIIlII[#("Ft")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("UVT")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("kM")]]=llIlllIIIIIllllIll[lIIIIIlII[#("Hru")]][lIIIIIlII[#("C7Jg")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{563;865;895;594};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("67z")]][lIIIIIlII[#("WBRJ")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("ym")]]=llIlllIIIIIllllIll[lIIIIIlII[#("L5q")]][lIIIIIlII[#("JJaG")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llllllIlIIlllllIIIl[lIIIIIlII[#("KjA")]]=llIlllIIIIIllllIll[lIIIIIlII[#("cd")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Tv")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("p8C")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("VN")]]=llIlllIIIIIllllIll[lIIIIIlII[#("A7n")]][lIIIIIlII[#("UkUo")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("5F")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("vAX")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("jy")]]=llIlllIIIIIllllIll[lIIIIIlII[#("yig")]][lIIIIIlII[#("h6Ev")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("dK")]]=llIlllIIIIIllllIll[lIIIIIlII[#("tA3")]][lIIIIIlII[#("d6bK")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("BN")]]=llIlllIIIIIllllIll[lIIIIIlII[#{{631;852;664;88};{915;826;220;563};"1 + 1 = 111";}]][lIIIIIlII[#("Gdng")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ln")]]=llIlllIIIIIllllIll[lIIIIIlII[#("RPl")]][lIIIIIlII[#("TQ9y")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("to")]][lIIIIIlII[#("mcs")]]=llIlllIIIIIllllIll[lIIIIIlII[#("5msj")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];do return end;else local lIIIIIlII=lIIIIIlII[#("Dz")]llIlllIIIIIllllIll[lIIIIIlII]=llIlllIIIIIllllIll[lIIIIIlII]()end;elseif lIIIIllIII<=#("qIH1fYHIU1a0YID0tn4yiDxUmh5KPvNTXEaBTkdpNhcC0tNFaPHY5VCXlXP7272zoqdtIbhikOVaA433FBKaYZXbcmo6GfxQoOnJqs68HzOraBxq3VDCy2KzEb")then if lIIIIllIII>#("uWkNeqfWWRtNlELDAlGbLZ7dUM5rxdZfobMlxVJa5OLKJir7Xzkm7aQFYh2DvXAS1oyk2zgONGf7oyELu8F73Niovgyo3fPho2TuVheysGJC4TqBNqixsDZof")then local lIIIIllIII;llIlllIIIIIllllIll[lIIIIIlII[#("vW")]]=llllllIlIIlllllIIIl[lIIIIIlII[#("mqe")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("aK")]]=llIlllIIIIIllllIll[lIIIIIlII[#("s3R")]][lIIIIIlII[#("CgBn")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#{{767;591;258;625};"1 + 1 = 111";}]]=llIlllIIIIIllllIll[lIIIIIlII[#("eVq")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("St")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](llIlllIIIIIllllIll[lIIIIllIII+1])lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];if(lIIIIIlII[#("mJ")]<=llIlllIIIIIllllIll[lIIIIIlII[#("IU08")]])then lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;else lIIllIllllIIllIIlIlIllI=lIIIIIlII[#("jnx")];end;else local llllllIlIIlllllIIIl;local lIIIIllIII;lIIIIllIII=lIIIIIlII[#("Yb")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("Z2x")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("WY")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("px9")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("FDn7")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("t6")]]=lIIIIIlII[#("B3i")];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("NB")]llIlllIIIIIllllIll[lIIIIllIII]=llIlllIIIIIllllIll[lIIIIllIII](IlllIIllllIllI(llIlllIIIIIllllIll,lIIIIllIII+1,lIIIIIlII[#("V6x")]))lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];lIIIIllIII=lIIIIIlII[#("Wz")];llllllIlIIlllllIIIl=llIlllIIIIIllllIll[lIIIIIlII[#("gL7")]];llIlllIIIIIllllIll[lIIIIllIII+1]=llllllIlIIlllllIIIl;llIlllIIIIIllllIll[lIIIIllIII]=llllllIlIIlllllIIIl[lIIIIIlII[#("ZzgM")]];lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;lIIIIIlII=lIlIIIlIIlllllII[lIIllIllllIIllIIlIlIllI];llIlllIIIIIllllIll[lIIIIIlII[#("Ir")]]=lIIIIIlII[#("eug")];end;elseif lIIIIllIII==#("YWb1VH18SxOj0m4hOydRtMZ6MM7rZWdEoMssvCVcL6a4WEB5DlYClzZl6fpiJJi6tj4o4MVmMagyM5jhkcZO7MsZWgvqmNDbXeLNJmb1AMZksCKb5h7HTF8R1fC")then lIllIIIlIIIIIIIlIIII[lIIIIIlII[#("St8")]]=llIlllIIIIIllllIll[lIIIIIlII[#("JK")]];else for lIIIIIlII=lIIIIIlII[#("zj")],lIIIIIlII[#("UbA")]do llIlllIIIIIllllIll[lIIIIIlII]=nil;end;end;lIIllIllllIIllIIlIlIllI=lIIllIllllIIllIIlIlIllI+1;end;end);end;return lllllIllllIllllllI(true,{},IIllllIIIlllIlIlIIllIIIl())();end)(string.byte,table.insert,setmetatable);
%d bloggers like this: