Roblox A Bizarre Day Script AFK TROWEL FARM

Roblox A Bizarre Day Script AFK TROWEL FARM

Script By yakman

minmoney = 3499 --this is the least you can have to still buy trowels
--change minmoney to the lowest money you want the script to go to
--for example, if you didn't want to go under 5000, make it 5000

--hold P to pause

--this has a antiafk built in but feel free to use your own as well
--yakman on v3rm

--[[
IronBrew:tm: obfuscation; Version 2.7.2
]]
return(function(nani_lIllIllIIlIlIlIlIlIlllIll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_IlllllIIlllIlIIll)local nani_lIIlIlllIIlIlIlIIl=string.char;local nani_lIIIIlII=string.sub;local nani_llIllIIIIlIIlIlIIIIIlIlll=table.concat;local nani_lIlIIlIIII=math.ldexp;local nani_lIlIIllIIIlllllIlI=getfenv or function()return _ENV end;local nani_IIllllIllIlllII=select;local nani_lIlIlllIIIlllIIIIIl=unpack or table.unpack;local nani_IllllllIlIIlll=tonumber;local function nani_IIlIlIlIIlIII(nani_lIlIlllIIIlllIIIIIl)local nani_IlllllIlIllIlIllIllIlIll,nani_lIIIlIIlIIllIIlIllIlll,nani_lIllIlllllllIlIlllllIIl="","",{}local nani_lIllIllIIlIlIlIlIlIlllIll=256;local nani_IIIlIlIIlllIll={}for nani_lIIlIlIlIIIIIllllllIIIlIl=0,nani_lIllIllIIlIlIlIlIlIlllIll-1 do nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIlIlllIIlIlIlIIl(nani_lIIlIlIlIIIIIllllllIIIlIl)end;local nani_lIIlIlIlIIIIIllllllIIIlIl=1;local function nani_IIlIlIllIlIlIl()local nani_IlllllIlIllIlIllIllIlIll=nani_IllllllIlIIlll(nani_lIIIIlII(nani_lIlIlllIIIlllIIIIIl,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl),36)nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+1;local nani_lIIIlIIlIIllIIlIllIlll=nani_IllllllIlIIlll(nani_lIIIIlII(nani_lIlIlllIIIlllIIIIIl,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl+nani_IlllllIlIllIlIllIllIlIll-1),36)nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+nani_IlllllIlIllIlIllIllIlIll;return nani_lIIIlIIlIIllIIlIllIlll end;nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlllIIlIlIlIIl(nani_IIlIlIllIlIlIl())nani_lIllIlllllllIlIlllllIIl[1]=nani_IlllllIlIllIlIllIllIlIll;while nani_lIIlIlIlIIIIIllllllIIIlIl<#nani_lIlIlllIIIlllIIIIIl do local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIlIlIllIlIlIl()if nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl]then nani_lIIIlIIlIIllIIlIllIlll=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl]else nani_lIIIlIIlIIllIIlIllIlll=nani_IlllllIlIllIlIllIllIlIll..nani_lIIIIlII(nani_IlllllIlIllIlIllIllIlIll,1,1)end;nani_IIIlIlIIlllIll[nani_lIllIllIIlIlIlIlIlIlllIll]=nani_IlllllIlIllIlIllIllIlIll..nani_lIIIIlII(nani_lIIIlIIlIIllIIlIllIlll,1,1)nani_lIllIlllllllIlIlllllIIl[#nani_lIllIlllllllIlIlllllIIl+1],nani_IlllllIlIllIlIllIllIlIll,nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIlIIlIIllIIlIllIlll,nani_lIllIllIIlIlIlIlIlIlllIll+1 end;return table.concat(nani_lIllIlllllllIlIlllllIIl)end;local nani_IllllllIlIIlll=nani_IIlIlIlIIlIII('22822T27522T22P2761214181022T22Q2761M101N1J1C1627D23227621F1C1N1H1G141921C27H1N27E27621H19141S27I1M22T27O2752151A1627V28228427I22T22O27621811191011280275161A1B1B10161H28I2761L1N1C1B28Y27F275142941C14131E22T2332761Y101H21I27I27K27M22T238276212141L27T1N1021228T1H1N1A1928N27Z23927627X27I2181B1L1G29J29L27L27D22U2901927Z22X2761G28V1K1G1C1L21D1A2A12872372761814111021X171S21X1S141E2AZ1B21X28T21X1J22E1N1822T23028K1M21A101S1X1A1I1B2772761W1B1G2BI29622T2BN1S29X2B122T22S2812C72BU2751I141C28Y2782751X141H1428Z27521428T2BO2CM22T21F27V1G27D2312AY293182CP1S22T2CX27521314161E1L2D729D22Z2761Z293112DF1N1M1H2121D1C1928P22R27621D2A01I10192AH28J275131A2AN28P2DZ22T2DA27R2872BK27521E1A1N1E1M2DA29N2AL2752A91H27I2D72CK1728N28829G29I2DM2DO1129V2BT2CG22T21727B27D2F021I29828P2EJ22T2DT2982EG142EY161S22V2762FJ2752EA22T2DM2FE2EO28H2DR2CN1A1J102AT2D32811A1M2CE1C28T22S2C729P27521J101L1927L2CJ28O21I1H2ED141227D2FM2131G1S2DT2BR2DW29E2DE27R1029K27J27I2FI2FK24522I22T2FS22T21H2FE1029422V2732702HD2HD2642H32F92122GC2D82GN1H2GH1B22C28Q2CS28W2GH1N22F22T2AH27528V1I2H02FJ21T21122T23H2762B72B929821X1M1629229T21X29U28V112BC13132I22F029O29Q29S29U29W29Y2A02A228H2HI2HK1E2HM2HO2HW2C021F2HT2ED2HW2HY22T2I02FK29F27623J2FK27521X2JH2C92FJ2FI2JL2JH22T2JJ2FK2FI23B2752FI2JA2JR2FI2FI2IP2JN2JP2762JO2752JL2JE2752E52E72DJ2HX2AI27Z2FM2FO1N2FQ27Z28922T29H2DL2DN2DP2EY2BJ29Q2831M1M2F227C2CA2FA2AU192H42812H82942FY2D52DB2EH29D2F02CC2CE22V1U23525N1Y23O1V2692H32FJ23A27623B2C02JL2JU2C622T2I22JR2C72C72AH2LY2LV2IP2C72I22JP2K02FJ2A52C721X27O28J27828J21V2DY22T2MA2L322P22E2762MK23B23E28Z2LX23C28Z28J2CX2A52BU27F28J2LU28J2FM2LU2DR2K827628J2K222R23427627F2M52772MN2752NE27521Y2K42FJ26O2LQ2LN2LV2JI2JH2JT2JV2KD2M72LW22T2LU2LZ2762M22NF2LU2AH2IP2K62KD2FI2O328Z2OB2DR21X23F2LV2C727F22R28J2JA2O122T2202K32262LV2AH2C72O02L72NZ2NV2FM2NM2K22OV2JL2OB29F2O52NW2FJ2M02NY2JY2LV2KL2NY2P12MR2K22JI23D2PE2GT2LU2782F92762M82NU2KD2P32752AH2O62JQ2PU2KD2N12PY22W2PP2A52OT2LQ21U2KD2DD2752MQ2KD2D42NZ2AX27822Y2FJ2JJ2AH2K22OF2O92MJ2NZ2AL28J2G72PX2MV2OX2JR28J28J2LP2762MI2FI21V2PY26S2LV2352NG2762R52OU2MR2Q52JI21W2KD2PW2JR2PV28Z2P62Q22QA2PY2Q92FJ2Q52OU2PY2NC2FK2RR2OX2KD2RM2QT2RJ2AX2RI2KD2362JQ27O2RJ2I72QB27823G27622R23I2BU2102OS2R82752SH2RB2RY2O222A2RG22T2JG2S32AH2SF2N222T2PJ2RV2MS22T2R32KD21T2LV2MU2MM2762T42C92JW2FK23B2R32AH2OG2RN2KD2RU2RQ2OH2RX2AH2MR2TH2782PT2BU2782JJ2JR2782782RF2TV2BU21Z2FJ2MF2JH2JA2ME2NH22T21K2LV2QB2CX2TJ2LV2CX2O12MC2FY27F2NL2MH2FY2U92C72T42T72752UN2S62UI22T21S2T12AH2CX2US2R32UQ2U82UA2MR2CX2RZ21X22J2FY2CX2Q72JR2CX2CX2252QT29F27F2242FJ2CX29F2JO2UF2LQ2752CX2TG2KZ22T21M2LV2NB2KD2142LV2K02U72W02SM2TF27621V2782AH162LV2272SJ22T2WB2C72V22T92NZ2RC22T2UD22N2PS2UA2RO2U42TL2RL2O22PY2AH2SS2WW22T2SV2K92SX2WS2N92T12PY1J2T52WE2X82W52NR2JQ2JU2RJ2OR2ST22T2212S02KD2OP2R02NY2RS2TI2VQ2BU2232WS2PF2SN2JI2SP2RJ2WY2SQ2X128Z2SY2TK2X52T22AH2WJ2T62U72WJ2QB2AH2V72S72KD2SS2YH2AH2PJ2SA22T2V72T62BU2Q72MY2AH2222BU2P62TJ2PM22T22D2XV2LV21X2VK2Q52PD2QK2Z32PY2C72HQ2SW2HW2NS2QU2U728Z2K52P72XQ2AH2YY2752782292Z22WH2YC2V42QC2LQ2QF22T2742WV2Z82C92NL2O8275');local nani_lIIlIlIlIIIIIllllllIIIlIl=(bit or bit32);local nani_IIIlIlIIlllIll=nani_lIIlIlIlIIIIIllllllIIIlIl and nani_lIIlIlIlIIIIIllllllIIIlIl.bxor or function(nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIIlIIlIIllIIlIllIlll)local nani_IlllllIlIllIlIllIllIlIll,nani_IIIlIlIIlllIll,nani_lIIIIlII=1,0,10 while nani_lIIlIlIlIIIIIllllllIIIlIl>0 and nani_lIIIlIIlIIllIIlIllIlll>0 do local nani_lIIIIlII,nani_lIllIlllllllIlIlllllIIl=nani_lIIlIlIlIIIIIllllllIIIlIl%2,nani_lIIIlIIlIIllIIlIllIlll%2 if nani_lIIIIlII~=nani_lIllIlllllllIlIlllllIIl then nani_IIIlIlIIlllIll=nani_IIIlIlIIlllIll+nani_IlllllIlIllIlIllIllIlIll end nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll=(nani_lIIlIlIlIIIIIllllllIIIlIl-nani_lIIIIlII)/2,(nani_lIIIlIIlIIllIIlIllIlll-nani_lIllIlllllllIlIlllllIIl)/2,nani_IlllllIlIllIlIllIllIlIll*2 end if nani_lIIlIlIlIIIIIllllllIIIlIl<nani_lIIIlIIlIIllIIlIllIlll then nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIlIIlIIllIIlIllIlll end while nani_lIIlIlIlIIIIIllllllIIIlIl>0 do local nani_lIIIlIIlIIllIIlIllIlll=nani_lIIlIlIlIIIIIllllllIIIlIl%2 if nani_lIIIlIIlIIllIIlIllIlll>0 then nani_IIIlIlIIlllIll=nani_IIIlIlIIlllIll+nani_IlllllIlIllIlIllIllIlIll end nani_lIIlIlIlIIIIIllllllIIIlIl,nani_IlllllIlIllIlIllIllIlIll=(nani_lIIlIlIlIIIIIllllllIIIlIl-nani_lIIIlIIlIIllIIlIllIlll)/2,nani_IlllllIlIllIlIllIllIlIll*2 end return nani_IIIlIlIIlllIll end local function nani_lIIIlIIlIIllIIlIllIlll(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_IlllllIlIllIlIllIllIlIll)if nani_IlllllIlIllIlIllIllIlIll then local nani_lIIlIlIlIIIIIllllllIIIlIl=(nani_lIIIlIIlIIllIIlIllIlll/2^(nani_lIIlIlIlIIIIIllllllIIIlIl-1))%2^((nani_IlllllIlIllIlIllIllIlIll-1)-(nani_lIIlIlIlIIIIIllllllIIIlIl-1)+1);return nani_lIIlIlIlIIIIIllllllIIIlIl-nani_lIIlIlIlIIIIIllllllIIIlIl%1;else local nani_lIIlIlIlIIIIIllllllIIIlIl=2^(nani_lIIlIlIlIIIIIllllllIIIlIl-1);return(nani_lIIIlIIlIIllIIlIllIlll%(nani_lIIlIlIlIIIIIllllllIIIlIl+nani_lIIlIlIlIIIIIllllllIIIlIl)>=nani_lIIlIlIlIIIIIllllllIIIlIl)and 1 or 0;end;end;local nani_lIIlIlIlIIIIIllllllIIIlIl=1;local function nani_IlllllIlIllIlIllIllIlIll()local nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll,nani_lIIIIlII,nani_lIllIlllllllIlIlllllIIl=nani_lIllIllIIlIlIlIlIlIlllIll(nani_IllllllIlIIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl+3);nani_lIIIlIIlIIllIIlIllIlll=nani_IIIlIlIIlllIll(nani_lIIIlIIlIIllIIlIllIlll,101)nani_IlllllIlIllIlIllIllIlIll=nani_IIIlIlIIlllIll(nani_IlllllIlIllIlIllIllIlIll,101)nani_lIIIIlII=nani_IIIlIlIIlllIll(nani_lIIIIlII,101)nani_lIllIlllllllIlIlllllIIl=nani_IIIlIlIIlllIll(nani_lIllIlllllllIlIlllllIIl,101)nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+4;return(nani_lIllIlllllllIlIlllllIIl*16777216)+(nani_lIIIIlII*65536)+(nani_IlllllIlIllIlIllIllIlIll*256)+nani_lIIIlIIlIIllIIlIllIlll;end;local function nani_IIlIlIllIlIlIl()local nani_IlllllIlIllIlIllIllIlIll=nani_IIIlIlIIlllIll(nani_lIllIllIIlIlIlIlIlIlllIll(nani_IllllllIlIIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl),101);nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+1;return nani_IlllllIlIllIlIllIllIlIll;end;local function nani_lIllIlllllllIlIlllllIIl()local nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll=nani_lIllIllIIlIlIlIlIlIlllIll(nani_IllllllIlIIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl+2);nani_lIIIlIIlIIllIIlIllIlll=nani_IIIlIlIIlllIll(nani_lIIIlIIlIIllIIlIllIlll,101)nani_IlllllIlIllIlIllIllIlIll=nani_IIIlIlIIlllIll(nani_IlllllIlIllIlIllIllIlIll,101)nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+2;return(nani_IlllllIlIllIlIllIllIlIll*256)+nani_lIIIlIIlIIllIIlIllIlll;end;local function nani_IIlIlIlIIlIII()local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IlllllIlIllIlIllIllIlIll();local nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll();local nani_lIIIIlII=1;local nani_IIIlIlIIlllIll=(nani_lIIIlIIlIIllIIlIllIlll(nani_IlllllIlIllIlIllIllIlIll,1,20)*(2^32))+nani_lIIlIlIlIIIIIllllllIIIlIl;local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIlIIlIIllIIlIllIlll(nani_IlllllIlIllIlIllIllIlIll,21,31);local nani_IlllllIlIllIlIllIllIlIll=((-1)^nani_lIIIlIIlIIllIIlIllIlll(nani_IlllllIlIllIlIllIllIlIll,32));if(nani_lIIlIlIlIIIIIllllllIIIlIl==0)then if(nani_IIIlIlIIlllIll==0)then return nani_IlllllIlIllIlIllIllIlIll*0;else nani_lIIlIlIlIIIIIllllllIIIlIl=1;nani_lIIIIlII=0;end;elseif(nani_lIIlIlIlIIIIIllllllIIIlIl==2047)then return(nani_IIIlIlIIlllIll==0)and(nani_IlllllIlIllIlIllIllIlIll*(1/0))or(nani_IlllllIlIllIlIllIllIlIll*(0/0));end;return nani_lIlIIlIIII(nani_IlllllIlIllIlIllIllIlIll,nani_lIIlIlIlIIIIIllllllIIIlIl-1023)*(nani_lIIIIlII+(nani_IIIlIlIIlllIll/(2^52)));end;local nani_lIlIIlIIII=nani_IlllllIlIllIlIllIllIlIll;local function nani_IIllIllIlllllIllll(nani_IlllllIlIllIlIllIllIlIll)local nani_lIIIlIIlIIllIIlIllIlll;if(not nani_IlllllIlIllIlIllIllIlIll)then nani_IlllllIlIllIlIllIllIlIll=nani_lIlIIlIIII();if(nani_IlllllIlIllIlIllIllIlIll==0)then return'';end;end;nani_lIIIlIIlIIllIIlIllIlll=nani_lIIIIlII(nani_IllllllIlIIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl+nani_IlllllIlIllIlIllIllIlIll-1);nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+nani_IlllllIlIllIlIllIllIlIll;local nani_IlllllIlIllIlIllIllIlIll={}for nani_lIIlIlIlIIIIIllllllIIIlIl=1,#nani_lIIIlIIlIIllIIlIllIlll do nani_IlllllIlIllIlIllIllIlIll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIlIlllIIlIlIlIIl(nani_IIIlIlIIlllIll(nani_lIllIllIIlIlIlIlIlIlllIll(nani_lIIIIlII(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlIlIIIIIllllllIIIlIl)),101))end return nani_llIllIIIIlIIlIlIIIIIlIlll(nani_IlllllIlIllIlIllIllIlIll);end;local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IlllllIlIllIlIllIllIlIll;local function nani_llIllIIIIlIIlIlIIIIIlIlll(...)return{...},nani_IIllllIllIlllII('#',...)end local function nani_IllllllIlIIlll()local nani_lIlIlllIIIlllIIIIIl={};local nani_lIIIIlII={};local nani_lIIlIlIlIIIIIllllllIIIlIl={};local nani_lIIlIlllIIlIlIlIIl={[#{"1 + 1 = 111";"1 + 1 = 111";}]=nani_lIIIIlII,[#{"1 + 1 = 111";{9;446;41;753};"1 + 1 = 111";}]=nil,[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=nani_lIIlIlIlIIIIIllllllIIIlIl,[#{"1 + 1 = 111";}]=nani_lIlIlllIIIlllIIIIIl,};local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IlllllIlIllIlIllIllIlIll()local nani_IIIlIlIIlllIll={}for nani_lIIIlIIlIIllIIlIllIlll=1,nani_lIIlIlIlIIIIIllllllIIIlIl do local nani_IlllllIlIllIlIllIllIlIll=nani_IIlIlIllIlIlIl();local nani_lIIlIlIlIIIIIllllllIIIlIl;if(nani_IlllllIlIllIlIllIllIlIll==1)then nani_lIIlIlIlIIIIIllllllIIIlIl=(nani_IIlIlIllIlIlIl()~=0);elseif(nani_IlllllIlIllIlIllIllIlIll==2)then nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIlIlIlIIlIII();elseif(nani_IlllllIlIllIlIllIllIlIll==0)then nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIllIllIlllllIllll();end;nani_IIIlIlIIlllIll[nani_lIIIlIIlIIllIIlIllIlll]=nani_lIIlIlIlIIIIIllllllIIIlIl;end;for nani_lIIlIlIlIIIIIllllllIIIlIl=1,nani_IlllllIlIllIlIllIllIlIll()do nani_lIIIIlII[nani_lIIlIlIlIIIIIllllllIIIlIl-1]=nani_IllllllIlIIlll();end;nani_lIIlIlllIIlIlIlIIl[3]=nani_IIlIlIllIlIlIl();for nani_IllllllIlIIlll=1,nani_IlllllIlIllIlIllIllIlIll()do local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIlIlIllIlIlIl();if(nani_lIIIlIIlIIllIIlIllIlll(nani_lIIlIlIlIIIIIllllllIIIlIl,1,1)==0)then local nani_lIIIIlII=nani_lIIIlIIlIIllIIlIllIlll(nani_lIIlIlIlIIIIIllllllIIIlIl,2,3);local nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll(nani_lIIlIlIlIIIIIllllllIIIlIl,4,6);local nani_lIIlIlIlIIIIIllllllIIIlIl={nani_lIllIlllllllIlIlllllIIl(),nani_lIllIlllllllIlIlllllIIl(),nil,nil};if(nani_lIIIIlII==0)then nani_lIIlIlIlIIIIIllllllIIIlIl[#("tCI")]=nani_lIllIlllllllIlIlllllIIl();nani_lIIlIlIlIIIIIllllllIIIlIl[#("jW6u")]=nani_lIllIlllllllIlIlllllIIl();elseif(nani_lIIIIlII==1)then nani_lIIlIlIlIIIIIllllllIIIlIl[#("gzW")]=nani_IlllllIlIllIlIllIllIlIll();elseif(nani_lIIIIlII==2)then nani_lIIlIlIlIIIIIllllllIIIlIl[#("i95")]=nani_IlllllIlIllIlIllIllIlIll()-(2^16)elseif(nani_lIIIIlII==3)then nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{989;17;383;38};{272;120;499;516};}]=nani_IlllllIlIllIlIllIllIlIll()-(2^16)nani_lIIlIlIlIIIIIllllllIIIlIl[#("gueU")]=nani_lIllIlllllllIlIlllllIIl();end;if(nani_lIIIlIIlIIllIIlIllIlll(nani_lIllIllIIlIlIlIlIlIlllIll,1,1)==1)then nani_lIIlIlIlIIIIIllllllIIIlIl[#("rM")]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("MT")]]end if(nani_lIIIlIIlIIllIIlIllIlll(nani_lIllIllIIlIlIlIlIlIlllIll,2,2)==1)then nani_lIIlIlIlIIIIIllllllIIIlIl[#("z8R")]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("LxG")]]end if(nani_lIIIlIIlIIllIIlIllIlll(nani_lIllIllIIlIlIlIlIlIlllIll,3,3)==1)then nani_lIIlIlIlIIIIIllllllIIIlIl[#("AbyP")]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("X4UW")]]end nani_lIlIlllIIIlllIIIIIl[nani_IllllllIlIIlll]=nani_lIIlIlIlIIIIIllllllIIIlIl;end end;return nani_lIIlIlllIIlIlIlIIl;end;local function nani_lIlIIlIIII(nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIIlIlllIIlIlIlIIl,nani_lIllIlllllllIlIlllllIIl)nani_lIIlIlIlIIIIIllllllIIIlIl=(nani_lIIlIlIlIIIIIllllllIIIlIl==true and nani_IllllllIlIIlll())or nani_lIIlIlIlIIIIIllllllIIIlIl;return(function(...)local nani_IIIlIlIIlllIll=nani_lIIlIlIlIIIIIllllllIIIlIl[1];local nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[3];local nani_IIlIlIlIIlIII=nani_lIIlIlIlIIIIIllllllIIIlIl[2];local nani_IllllllIlIIlll=nani_llIllIIIIlIIlIlIIIIIlIlll local nani_IlllllIlIllIlIllIllIlIll=1;local nani_lIllIllIIlIlIlIlIlIlllIll=-1;local nani_lIlIIllIIIlllllIlI={};local nani_llIllIIIIlIIlIlIIIIIlIlll={...};local nani_IIlIlIllIlIlIl=nani_IIllllIllIlllII('#',...)-1;local nani_IIllllIllIlllII={};local nani_lIIIlIIlIIllIIlIllIlll={};for nani_lIIlIlIlIIIIIllllllIIIlIl=0,nani_IIlIlIllIlIlIl do if(nani_lIIlIlIlIIIIIllllllIIIlIl>=nani_lIIIIlII)then nani_lIlIIllIIIlllllIlI[nani_lIIlIlIlIIIIIllllllIIIlIl-nani_lIIIIlII]=nani_llIllIIIIlIIlIlIIIIIlIlll[nani_lIIlIlIlIIIIIllllllIIIlIl+1];else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_llIllIIIIlIIlIlIIIIIlIlll[nani_lIIlIlIlIIIIIllllllIIIlIl+#{"1 + 1 = 111";}];end;end;local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIlIlIllIlIlIl-nani_lIIIIlII+1 local nani_lIIlIlIlIIIIIllllllIIIlIl;local nani_lIIIIlII;while true do nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("2")];if nani_lIIIIlII<=#("2mBTePJjNevxf6Vy7KgQYWRZBNEuEcP")then if nani_lIIIIlII<=#("J7TrpGy01trnDqv")then if nani_lIIIIlII<=#("mv38FL2")then if nani_lIIIIlII<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if nani_lIIIIlII<=#("k")then if nani_lIIIIlII==#("")then local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("zI")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl+1,nani_lIllIllIIlIlIlIlIlIlllIll))else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Sz")]]();end;elseif nani_lIIIIlII==#("KA")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{59;421;382;693};{854;669;652;783};}]]=(nani_lIIlIlIlIIIIIllllllIIIlIl[#("FVv")]~=0);else if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ZI")]]==nani_lIIlIlIlIIIIIllllllIIIlIl[#("xZGi")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("m7C")];end;end;elseif nani_lIIIIlII<=#("XhnEh")then if nani_lIIIIlII>#("lpYE")then local nani_lIlIlllIIIlllIIIIIl=nani_IIlIlIlIIlIII[nani_lIIlIlIlIIIIIllllllIIIlIl[#("bck")]];local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII={};nani_lIllIllIIlIlIlIlIlIlllIll=nani_IlllllIIlllIlIIll({},{__index=function(nani_IlllllIlIllIlIllIllIlIll,nani_lIIlIlIlIIIIIllllllIIIlIl)local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII[nani_lIIlIlIlIIIIIllllllIIIlIl];return nani_lIIlIlIlIIIIIllllllIIIlIl[1][nani_lIIlIlIlIIIIIllllllIIIlIl[2]];end,__newindex=function(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_IlllllIlIllIlIllIllIlIll)local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII[nani_lIIlIlIlIIIIIllllllIIIlIl]nani_lIIlIlIlIIIIIllllllIIIlIl[1][nani_lIIlIlIlIIIIIllllllIIIlIl[2]]=nani_IlllllIlIllIlIllIllIlIll;end;});for nani_lIllIlllllllIlIlllllIIl=1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("9I03")]do nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];if nani_lIIlIlIlIIIIIllllllIIIlIl[#("k")]==45 then nani_lIIIIlII[nani_lIllIlllllllIlIlllllIIl-1]={nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl[#{{948;107;709;27};{96;149;653;505};"1 + 1 = 111";}]};else nani_lIIIIlII[nani_lIllIlllllllIlIlllllIIl-1]={nani_lIIlIlllIIlIlIlIIl,nani_lIIlIlIlIIIIIllllllIIIlIl[#("6p5")]};end;nani_IIllllIllIlllII[#nani_IIllllIllIlllII+1]=nani_lIIIIlII;end;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("tt")]]=nani_lIlIIlIIII(nani_lIlIlllIIIlllIIIIIl,nani_lIllIllIIlIlIlIlIlIlllIll,nani_lIllIlllllllIlIlllllIIl);else if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("CO")]]~=nani_lIIlIlIlIIIIIllllllIIIlIl[#("dhqI")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("7XZ")];end;end;elseif nani_lIIIIlII>#("DvkqSh")then local nani_lIIIIlII;local nani_IIlIlIllIlIlIl;local nani_lIIlIlllIIlIlIlIIl,nani_IIllllIllIlllII;local nani_lIlIIlIIII;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("AU")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("EFL")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("HJ")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Uh9")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("AA")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("5fz")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{531;232;319;678};"1 + 1 = 111";{361;904;713;459};}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Rj")];nani_lIlIIlIIII=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ddr")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIlIIlIIII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIlIIlIIII[nani_lIIlIlIlIIIIIllllllIIIlIl[#("5SMo")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#{{373;155;460;35};{465;338;924;320};}]nani_lIIlIlllIIlIlIlIIl,nani_IIllllIllIlllII=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]))nani_lIllIllIIlIlIlIlIlIlllIll=nani_IIllllIllIlllII+nani_lIIIIlII-1 nani_IIlIlIllIlIlIl=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII,nani_lIllIllIIlIlIlIlIlIlllIll do nani_IIlIlIllIlIlIl=nani_IIlIlIllIlIlIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIlIlllIIlIlIlIIl[nani_IIlIlIllIlIlIl];end;nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("XM")]nani_lIIlIlllIIlIlIlIIl={nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIllIllIIlIlIlIlIlIlllIll))};nani_IIlIlIllIlIlIl=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII,nani_lIIlIlIlIIIIIllllllIIIlIl[#("4om2")]do nani_IIlIlIllIlIlIl=nani_IIlIlIllIlIlIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIlIlllIIlIlIlIIl[nani_IIlIlIllIlIlIl];end nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("IRa")];else local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("qz")]local nani_IIIlIlIIlllIll,nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]())nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIlIlIlIIIIIllllllIIIlIl+nani_IlllllIlIllIlIllIllIlIll-1 local nani_lIIlIlIlIIIIIllllllIIIlIl=0;for nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll,nani_lIllIllIIlIlIlIlIlIlllIll do nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl];end;end;elseif nani_lIIIIlII<=#("jRv7fNWOn6Q")then if nani_lIIIIlII<=#("OSY8DoJTo")then if nani_lIIIIlII>#("XpXyLbqh")then local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Dh")]nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("JaB")]))else local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("7c")]nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]=nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("0nO")]))end;elseif nani_lIIIIlII==#("DhIBTjZbKS")then local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Kd")];local nani_IIIlIlIIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("BtF")]];nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll+1]=nani_IIIlIlIIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("cby4")]];else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("3Z")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("6Ip")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("upX5")]];end;elseif nani_lIIIIlII<=#("noKlZWPxRciz3")then if nani_lIIIIlII==#("3gkRcUxfWmFf")then local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Tl")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("x5E")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("11")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("cnh")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("IFk9")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Jr")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("vXB")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("sU0K")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Yu")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("7UO")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("pd")]]==nani_lIIlIlIlIIIIIllllllIIIlIl[#("3Dbb")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Xuo")];end;else if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("gH")]]~=nani_lIIlIlIlIIIIIllllllIIIlIl[#("PnqQ")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("e7Q")];end;end;elseif nani_lIIIIlII>#("fZOm8bVoJPLJYx")then local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Ml")]nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("EOG")]))else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("LSz")];end;elseif nani_lIIIIlII<=#("BitTPUZdOtI7ghCxQTGJIdZ")then if nani_lIIIIlII<=#("xhDuBKinyEPN3WBHpV9")then if nani_lIIIIlII<=#("BdPggs4ZsXuysjvIq")then if nani_lIIIIlII==#("MeltJMDZE3s8sXd7")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("M7")]]=nani_lIlIIlIIII(nani_IIlIlIlIIlIII[nani_lIIlIlIlIIIIIllllllIIIlIl[#("XKY")]],nil,nani_lIllIlllllllIlIlllllIIl);else do return end;end;elseif nani_lIIIIlII==#("tDvoiPs5KiquTB2pWj")then local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("0K")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("mgB")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("Vv8g")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("L0")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("3Vr")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("bUvk")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("rX")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{27;361;466;892};{334;341;748;378};"1 + 1 = 111";}]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("bgGH")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("dd")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("F5")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Po4")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("7S")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("sWO")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("hO")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("cR")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("o7A")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("AHNE")]];end;elseif nani_lIIIIlII<=#("RgEcOqYaHtFIuvBbf5oEz")then if nani_lIIIIlII>#("z9DlFVDATHNhqMZAR8tO")then local nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("nE")];local nani_lIllIlllllllIlIlllllIIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("jyNp")];local nani_IIIlIlIIlllIll=nani_lIIIIlII+2 local nani_lIIIIlII={nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1],nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll])};for nani_lIIlIlIlIIIIIllllllIIIlIl=1,nani_lIllIlllllllIlIlllllIIl do nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll+nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIIIlII[nani_lIIlIlIlIIIIIllllllIIIlIl];end;local nani_lIIIIlII=nani_lIIIIlII[1]if nani_lIIIIlII then nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll]=nani_lIIIIlII nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("SFf")];else nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;end;else local nani_IIIlIlIIlllIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("nr")];local nani_lIllIlllllllIlIlllllIIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Javq")];local nani_lIIIIlII=nani_IIIlIlIIlllIll+2 local nani_IIIlIlIIlllIll={nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll](nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll+1],nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII])};for nani_lIIlIlIlIIIIIllllllIIIlIl=1,nani_lIllIlllllllIlIlllllIIl do nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl];end;local nani_IIIlIlIIlllIll=nani_IIIlIlIIlllIll[1]if nani_IIIlIlIIlllIll then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_IIIlIlIIlllIll nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("z5f")];else nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;end;end;elseif nani_lIIIIlII==#("LfL69rzXtHQGYSFJCWdIgL")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Tg")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("5be")];else local nani_lIllIlllllllIlIlllllIIl;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("xb")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("33K")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("h9gA")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("D7")];nani_lIllIlllllllIlIlllllIIl=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("QOU")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIlllllllIlIlllllIIl;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("mHdp")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("NH")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("qZ6")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("tm")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("XYm")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ZM")]]~=nani_lIIlIlIlIIIIIllllllIIIlIl[#("IyPZ")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#{{730;67;599;313};"1 + 1 = 111";"1 + 1 = 111";}];end;end;elseif nani_lIIIIlII<=#("4meYmPnqjVfX42oGDdNz97MC4u0")then if nani_lIIIIlII<=#("lqfQahQU4EmhgpGVT4LRmqKFE")then if nani_lIIIIlII==#("77LN42Y8f3PAXWlFL91FrTC0")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("8P")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("RcN")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("X7EY")]];else local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("iE")]local nani_IIIlIlIIlllIll,nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]())nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIlIlIlIIIIIllllllIIIlIl+nani_IlllllIlIllIlIllIllIlIll-1 local nani_lIIlIlIlIIIIIllllllIIIlIl=0;for nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll,nani_lIllIllIIlIlIlIlIlIlllIll do nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]=nani_IIIlIlIIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl];end;end;elseif nani_lIIIIlII>#("9Ujc4QLlXjTjrJtshkMgsgYFSP")then if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ZX")]]<nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("hLWG")]])then nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("QNN")];else nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;end;else local nani_lIlIIlIIII;local nani_IIllllIllIlllII,nani_IIlIlIlIIlIII;local nani_IIlIlIllIlIlIl;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Iy")]]=nani_lIIlIlllIIlIlIlIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("O9U")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("0e")];nani_IIlIlIllIlIlIl=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("knR")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_IIlIlIllIlIlIl;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_IIlIlIllIlIlIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("xSSn")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Pu")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Hh")]]=nani_lIIlIlllIIlIlIlIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("luT")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("DE")];nani_IIlIlIllIlIlIl=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("mQi")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_IIlIlIllIlIlIl;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_IIlIlIllIlIlIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("byfC")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("OF")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("JT0")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("nS")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("SeB")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("c9fg")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("9z")]nani_IIllllIllIlllII,nani_IIlIlIlIIlIII=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]())nani_lIllIllIIlIlIlIlIlIlllIll=nani_IIlIlIlIIlIII+nani_lIIIIlII-1 nani_lIlIIlIIII=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII,nani_lIllIllIIlIlIlIlIlIlllIll do nani_lIlIIlIIII=nani_lIlIIlIIII+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_IIllllIllIlllII[nani_lIlIIlIIII];end;nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("5o")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIllIllIIlIlIlIlIlIlllIll))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];do return end;end;elseif nani_lIIIIlII<=#("O94nFU35iP5kmdn9MDvtBHlkJZUA2")then if nani_lIIIIlII==#("Pupf7m36nAyOkOlaAcfgmbxvkgXU")then local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII;nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("kK")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("OZ9")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("3DxU")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("5H")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("qlN")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("z4")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#{{102;950;272;551};{637;456;290;444};{320;511;709;303};}]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("gW")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("esl")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("dP")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("gYZ")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("VSYP")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("cr")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("QXc")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{628;929;128;239};}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{98;753;737;451};{935;559;888;277};{445;582;473;216};}]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("RG")]];else local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("TE")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Wbj")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("HmLe")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("lL")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("Jo9")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{420;61;413;914};{669;590;527;616};{569;703;516;456};}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("oZh")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("D5")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#{{68;179;171;155};{298;1;175;138};"1 + 1 = 111";}];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("3F")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])end;elseif nani_lIIIIlII>#("Q9Ecn9L5hgagQo66WvH8JAStVTO834")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("tM")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("M2Y")]];else local nani_IIIlIlIIlllIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Qe")];local nani_IlllllIlIllIlIllIllIlIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("HrE")]];nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll+1]=nani_IlllllIlIllIlIllIllIlIll;nani_lIIIlIIlIIllIIlIllIlll[nani_IIIlIlIIlllIll]=nani_IlllllIlIllIlIllIllIlIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ksnl")]];end;elseif nani_lIIIIlII<=#("ziqHA3L7PLer5eaGWAzyUqWgqrjqEvNbnpL7zSGcly2yEiW")then if nani_lIIIIlII<=#("Vm1IFHfixkqhUtDt7deQDche3xmvzzNiG4GrEfH")then if nani_lIIIIlII<=#("jDLoBzs14IAAegWTfXOhuUU8IiM0Yl02GyG")then if nani_lIIIIlII<=#{"1 + 1 = 111";{862;881;545;548};"1 + 1 = 111";"1 + 1 = 111";{909;627;145;269};"1 + 1 = 111";"1 + 1 = 111";{650;161;950;603};{969;746;404;974};"1 + 1 = 111";{997;172;503;174};"1 + 1 = 111";"1 + 1 = 111";{655;822;425;983};"1 + 1 = 111";{422;854;538;781};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{217;329;723;732};"1 + 1 = 111";{90;127;589;545};"1 + 1 = 111";{702;958;211;469};"1 + 1 = 111";{697;220;441;420};{296;650;740;645};{462;866;246;640};"1 + 1 = 111";{97;745;772;562};{946;195;694;576};"1 + 1 = 111";}then if nani_lIIIIlII==#("rmjid9s4avdmSb9jBhbfrZluTMrSiBsy")then local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("kI")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl+1])else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Pk")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("oZZ")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("Y2xZ")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{897;853;307;943};}]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("X97")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("Poc4")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("xQp")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("yn")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("BB")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("TFR")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("OT")]]();nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ia")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("s0u")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("LN")]]();nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Nj")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("QZ4")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("hT")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("mSz")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("O4ch")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("3b")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{210;816;69;768};"1 + 1 = 111";"1 + 1 = 111";}]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("F0e1")]];end;elseif nani_lIIIIlII>#("vF9HrvvhYMvoJUbUJgWOFEDaZACSKVJcQy")then do return end;else local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("LJ")]local nani_IIIlIlIIlllIll,nani_IlllllIlIllIlIllIllIlIll=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl+1]))nani_lIllIllIIlIlIlIlIlIlllIll=nani_IlllllIlIllIlIllIllIlIll+nani_lIIlIlIlIIIIIllllllIIIlIl-1 local nani_IlllllIlIllIlIllIllIlIll=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIllIllIIlIlIlIlIlIlllIll do nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];end;end;elseif nani_lIIIIlII<=#("G9MjWQ7Em0fj1p8JuGTt2c8S13NIccsJlyFU6")then if nani_lIIIIlII>#("a8HapkTqKCMmnG6eEEa4r2cABjIG7EVnMyGV")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("qH")]]=(nani_lIIlIlIlIIIIIllllllIIIlIl[#("Hov")]~=0);else if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("bV")]]==nani_lIIlIlIlIIIIIllllllIIIlIl[#("Zybd")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("ziI")];end;end;elseif nani_lIIIIlII==#("2XY8Ltl50YWNh3bTcPi5hJfNmsfRyK0akrMRm5")then local nani_lIIIIlII;local nani_IIlIlIllIlIlIl;local nani_lIIlIlllIIlIlIlIIl,nani_IIllllIllIlllII;local nani_lIlIIlIIII;local nani_lIIIIlII;nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("1LO")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("1e")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("fC")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{709;930;787;468};}]]();nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("OH")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("k87")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("6mo")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("1c")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("5ZO")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("eNpc")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{41;578;433;756};"1 + 1 = 111";}]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{929;218;35;783};"1 + 1 = 111";}]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("DFNg")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("CF")];nani_lIlIIlIIII=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("pUB")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIlIIlIIII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIlIIlIIII[nani_lIIlIlIlIIIIIllllllIIIlIl[#("TjSQ")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("s0")]nani_lIIlIlllIIlIlIlIIl,nani_IIllllIllIlllII=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]))nani_lIllIllIIlIlIlIlIlIlllIll=nani_IIllllIllIlllII+nani_lIIIIlII-1 nani_IIlIlIllIlIlIl=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII,nani_lIllIllIIlIlIlIlIlIlllIll do nani_IIlIlIllIlIlIl=nani_IIlIlIllIlIlIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIlIlllIIlIlIlIIl[nani_IIlIlIllIlIlIl];end;nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("kx")]nani_lIIlIlllIIlIlIlIIl={nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIllIllIIlIlIlIlIlIlllIll))};nani_IIlIlIllIlIlIl=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII,nani_lIIlIlIlIIIIIllllllIIIlIl[#("rkRF")]do nani_IIlIlIllIlIlIl=nani_IIlIlIllIlIlIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIlIlllIIlIlIlIIl[nani_IIlIlIllIlIlIl];end else nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("j8B")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Fh")]];end;elseif nani_lIIIIlII<=#("I1ELuV30LUFKTx0PsRlWrnFIp8WCZqtGh8KeN8U1sDF")then if nani_lIIIIlII<=#("3agNuMt9bjAuv6ux9CbuA8CVXVct7tDZTIOp1ign6")then if nani_lIIIIlII==#("F8JoTQOy21BkH5Iv0KKacSQKMXreF1uYyeEElIcv")then local nani_lIlIlllIIIlllIIIIIl=nani_IIlIlIlIIlIII[nani_lIIlIlIlIIIIIllllllIIIlIl[#("sfA")]];local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII={};nani_lIllIllIIlIlIlIlIlIlllIll=nani_IlllllIIlllIlIIll({},{__index=function(nani_IlllllIlIllIlIllIllIlIll,nani_lIIlIlIlIIIIIllllllIIIlIl)local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII[nani_lIIlIlIlIIIIIllllllIIIlIl];return nani_lIIlIlIlIIIIIllllllIIIlIl[1][nani_lIIlIlIlIIIIIllllllIIIlIl[2]];end,__newindex=function(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl,nani_IlllllIlIllIlIllIllIlIll)local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII[nani_lIIlIlIlIIIIIllllllIIIlIl]nani_lIIlIlIlIIIIIllllllIIIlIl[1][nani_lIIlIlIlIIIIIllllllIIIlIl[2]]=nani_IlllllIlIllIlIllIllIlIll;end;});for nani_lIllIlllllllIlIlllllIIl=1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("LVTI")]do nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];if nani_lIIlIlIlIIIIIllllllIIIlIl[#("q")]==45 then nani_lIIIIlII[nani_lIllIlllllllIlIlllllIIl-1]={nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{191;574;552;439};"1 + 1 = 111";}]};else nani_lIIIIlII[nani_lIllIlllllllIlIlllllIIl-1]={nani_lIIlIlllIIlIlIlIIl,nani_lIIlIlIlIIIIIllllllIIIlIl[#("gr1")]};end;nani_IIllllIllIlllII[#nani_IIllllIllIlllII+1]=nani_lIIIIlII;end;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("UT")]]=nani_lIlIIlIIII(nani_lIlIlllIIIlllIIIIIl,nani_lIllIllIIlIlIlIlIlIlllIll,nani_lIllIlllllllIlIlllllIIl);else local nani_lIIlIlllIIlIlIlIIl;local nani_IIllllIllIlllII,nani_lIlIIlIIII;local nani_IIlIlIllIlIlIl;local nani_lIIIIlII;nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("jH")];nani_IIlIlIllIlIlIl=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("MTJ")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_IIlIlIllIlIlIl;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_IIlIlIllIlIlIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("tove")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("gE")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#{{55;208;604;874};"1 + 1 = 111";}];nani_IIlIlIllIlIlIl=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("a6Y")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_IIlIlIllIlIlIl;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_IIlIlIllIlIlIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("A0tu")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("xy")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("FDO")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("aA")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("90V")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("c8aD")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Ah")]nani_IIllllIllIlllII,nani_lIlIIlIIII=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]())nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIlIIlIIII+nani_lIIIIlII-1 nani_lIIlIlllIIlIlIlIIl=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIIIlII,nani_lIllIllIIlIlIlIlIlIlllIll do nani_lIIlIlllIIlIlIlIIl=nani_lIIlIlllIIlIlIlIIl+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_IIllllIllIlllII[nani_lIIlIlllIIlIlIlIIl];end;nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("zA")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIllIllIIlIlIlIlIlIlllIll))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("FX")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("jg7")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("kD")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("HXy")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Qj")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])end;elseif nani_lIIIIlII>#("JBLyIbTSGsHN6sWr8N5yK3bGNWCCejrInuDrfmdWJx")then local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII;nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("YE")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("Xjn")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("xR")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{776;51;502;865};{918;194;880;236};}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("sX")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("eOl")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("S5")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("lgD")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("3j")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("j2P")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{304;804;533;857};{731;715;418;281};}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Sf")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("BEf")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#{{419;116;650;129};"1 + 1 = 111";}]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("g1C")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("8O")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("viy5")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("g5")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1])else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{237;687;330;975};{397;758;234;266};}]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("uRH")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ORGN")]];end;elseif nani_lIIIIlII<=#("IYkCWRln5h7fQzfUWJrOva9AMZFmVJiZn3DSDuPU26xAp")then if nani_lIIIIlII==#("X29DrnqSNHZUZ7l9Cv8i2W6xrB3HWAOJkxcNmsr5JFp5")then nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("SVr")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{1;450;744;556};"1 + 1 = 111";}]];else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("iO")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Fu1")]];end;elseif nani_lIIIIlII>#("SFSI2EaChxa6Mk0tT6n3qKD4JXjddJxGaFJ5l935Ogc9bQ")then local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("8g")]local nani_IIIlIlIIlllIll,nani_IlllllIlIllIlIllIllIlIll=nani_IllllllIlIIlll(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl+1]))nani_lIllIllIIlIlIlIlIlIlllIll=nani_IlllllIlIllIlIllIllIlIll+nani_lIIlIlIlIIIIIllllllIIIlIl-1 local nani_IlllllIlIllIlIllIllIlIll=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl,nani_lIllIllIIlIlIlIlIlIlllIll do nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];end;else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("no")]]=nani_lIlIIlIIII(nani_IIlIlIlIIlIII[nani_lIIlIlIlIIIIIllllllIIIlIl[#("PoG")]],nil,nani_lIllIlllllllIlIlllllIIl);end;elseif nani_lIIIIlII<=#("hBLZIbcMhcX8ft6zIaE6hL4iUdspjID32mbNCUYE72B3yaYLRSF9IUC")then if nani_lIIIIlII<=#("GCfFTXDKJ4f2st6Yla8pjbVToRIBcEuiVFg9OtUjA1uE46sxWRY")then if nani_lIIIIlII<=#("VmvFRvpcpcHeJ7hYn6j1pZ0sRqYsykOvQXxIiLrseS4xtp47Y")then if nani_lIIIIlII==#("j0H6r6xdYBH6OeykzVKJPMO1XH4D9Bx1F3aYZUFAlfX1Vhd0")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("uX")]]();else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("jr")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{659;219;804;542};{607;213;56;276};}]];end;elseif nani_lIIIIlII>#("i1ixpZIlQjVc3exdQCUdJvPqjyKZWfPEeE0KnFpeDNiLUyraAY")then nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("hJA")];else if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("v7")]]<nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("s3SY")]])then nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("e37")];else nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;end;end;elseif nani_lIIIIlII<=#{{325;737;585;88};"1 + 1 = 111";{339;528;626;539};"1 + 1 = 111";{826;610;12;778};"1 + 1 = 111";{535;536;80;952};"1 + 1 = 111";{458;575;599;253};"1 + 1 = 111";{72;337;953;161};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{847;839;56;982};"1 + 1 = 111";"1 + 1 = 111";{908;304;473;370};{425;78;902;35};"1 + 1 = 111";"1 + 1 = 111";{151;836;438;67};"1 + 1 = 111";{709;289;997;32};"1 + 1 = 111";{2;48;92;561};"1 + 1 = 111";{922;163;208;259};{963;456;996;258};"1 + 1 = 111";"1 + 1 = 111";{317;431;473;459};{626;24;664;639};{360;308;230;978};"1 + 1 = 111";"1 + 1 = 111";{260;458;239;514};{891;550;925;924};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{867;369;565;681};{778;739;496;231};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{732;949;216;782};{82;695;175;160};"1 + 1 = 111";}then if nani_lIIIIlII>#("3DNlDJixBVPtAJEgPxlAF3Z00TP7cuoXXahGHgLEp80MkBX8NvVF")then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{739;661;743;504};}]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("K88")];else local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Hz")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIlIlIlIIIIIllllllIIIlIl+1,nani_lIllIllIIlIlIlIlIlIlllIll))end;elseif nani_lIIIIlII>#("mDaOXuT4ktfH1GAC7KJWSjGcmPA6QuQKTlKHh2UV1JePVes4yHPWmT")then local nani_lIllIlllllllIlIlllllIIl;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{27;47;312;721};"1 + 1 = 111";}]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("nxl")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("oiJy")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("bB")];nani_lIllIlllllllIlIlllllIIl=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("JMF")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIlllllllIlIlllllIIl;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("2ZyA")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("jN")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Kmu")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("IV")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{10;979;990;6};{852;813;112;558};}]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("oU")]]~=nani_lIIlIlIlIIIIIllllllIIIlIl[#("tkoz")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("vyx")];end;else nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("QW")]]=nani_lIIlIlllIIlIlIlIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("MVR")]];end;elseif nani_lIIIIlII<=#("c77Ch5Xn0NGYQ62ufZX4if1rixGJjP4yasHKjAM0dvnboqN8FmJ6zYU7fPt")then if nani_lIIIIlII<=#("zoelTiXxzrkPn60X1Zd1TId7g78lIKEFg0CZqcsfDqJnc3TD77fqMCc1k")then if nani_lIIIIlII>#("eWkMYYXPJxFbGZH7yD8Z4mnFnKFn2PYKOj7H50CVAxuv86CpUPdJ3um1")then local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("JN")]nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll]=nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("roX")]))else local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("16")]local nani_lIIIIlII={nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll+1,nani_lIllIllIIlIlIlIlIlIlllIll))};local nani_IIIlIlIIlllIll=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IlllllIlIllIlIllIllIlIll,nani_lIIlIlIlIIIIIllllllIIIlIl[#("tZ3T")]do nani_IIIlIlIIlllIll=nani_IIIlIlIIlllIll+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIIIlII[nani_IIIlIlIIlllIll];end end;elseif nani_lIIIIlII==#("PznsKX4J4xv19bIbnAI22HqipEnLoRs7g9qCnC0JBXdKfzUNGIP5O8Phhf")then local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Sy")]]();nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("cQ")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("X12")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("WL")]]();nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Qn")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("xBh")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Dl")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("dbE")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("l1Ap")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("ll")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{814;386;204;553};}]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{{549;457;823;773};"1 + 1 = 111";{799;85;36;390};"1 + 1 = 111";}]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("GM")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("ouQ")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("Xg")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("mfe")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];if(nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("eT")]]==nani_lIIlIlIlIIIIIllllllIIIlIl[#("iqlu")])then nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;else nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("LzY")];end;else local nani_lIIlIlIlIIIIIllllllIIIlIl=nani_lIIlIlIlIIIIIllllllIIIlIl[#{{830;126;81;834};{215;233;207;816};}]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl](nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl+1])end;elseif nani_lIIIIlII<=#{{151;451;821;264};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{777;96;478;769};"1 + 1 = 111";{842;467;915;449};{39;134;72;732};{701;117;106;528};{277;296;769;708};{753;269;619;289};{352;464;176;158};"1 + 1 = 111";{26;73;61;706};"1 + 1 = 111";{184;816;272;598};"1 + 1 = 111";{526;189;638;875};{910;599;441;536};{786;927;206;931};{621;548;883;296};"1 + 1 = 111";{277;808;603;905};{205;498;806;310};{728;983;169;670};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{758;711;820;689};{490;171;285;430};"1 + 1 = 111";"1 + 1 = 111";{103;758;907;399};"1 + 1 = 111";{549;283;852;14};"1 + 1 = 111";{490;898;888;550};{417;972;225;281};"1 + 1 = 111";{949;393;554;811};{202;119;700;618};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{977;489;824;903};"1 + 1 = 111";"1 + 1 = 111";{718;979;673;913};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{897;515;873;318};}then if nani_lIIIIlII>#{"1 + 1 = 111";{284;636;903;480};"1 + 1 = 111";{503;192;196;332};{645;843;943;19};"1 + 1 = 111";{422;584;247;209};{828;420;118;29};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{101;346;783;362};{869;296;370;39};"1 + 1 = 111";{347;119;178;377};"1 + 1 = 111";{129;623;26;179};"1 + 1 = 111";"1 + 1 = 111";{358;333;179;9};"1 + 1 = 111";{894;317;672;550};{263;146;735;386};"1 + 1 = 111";"1 + 1 = 111";{644;91;607;911};{712;522;668;16};{748;512;381;586};"1 + 1 = 111";{627;106;638;235};"1 + 1 = 111";{973;582;503;150};{192;722;397;526};"1 + 1 = 111";{300;110;695;650};{126;63;668;758};"1 + 1 = 111";"1 + 1 = 111";{195;132;496;633};"1 + 1 = 111";{444;209;869;173};{137;440;451;736};"1 + 1 = 111";{16;543;87;168};{693;442;420;896};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{455;22;145;222};"1 + 1 = 111";"1 + 1 = 111";{592;449;158;457};{482;27;166;678};"1 + 1 = 111";{506;569;256;375};"1 + 1 = 111";}then nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("k3")]]=nani_lIIlIlllIIlIlIlIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Pzm")]];else local nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("ns")]local nani_lIIIIlII={nani_lIIIlIIlIIllIIlIllIlll[nani_IlllllIlIllIlIllIllIlIll](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_IlllllIlIllIlIllIllIlIll+1,nani_lIllIllIIlIlIlIlIlIlllIll))};local nani_IIIlIlIIlllIll=0;for nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IlllllIlIllIlIllIllIlIll,nani_lIIlIlIlIIIIIllllllIIIlIl[#("aSI7")]do nani_IIIlIlIIlllIll=nani_IIIlIlIIlllIll+1;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl]=nani_lIIIIlII[nani_IIIlIlIIlllIll];end end;elseif nani_lIIIIlII==#("D8BTcuRm6E82LF8yTHOzl8UtmHln7ehYFucRVq54aXBWLXEjBPoKnlaEohHFjD")then local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{557;842;916;948};}]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ZQL")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("HU7c")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("NW")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("tXT")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("EDgx")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("oJ")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("MyY")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("Da86")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("en")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("3vu")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("tx")]]=(nani_lIIlIlIlIIIIIllllllIIIlIl[#("RWI")]~=0);nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("IDM")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Sv")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_IlllllIlIllIlIllIllIlIll=nani_lIIlIlIlIIIIIllllllIIIlIl[#("WR5")];else local nani_lIllIllIIlIlIlIlIlIlllIll;local nani_lIIIIlII;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("h4")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("MPN")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("48")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Zjl")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("ySss")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("RU")]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("cvM")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("FF")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("MES")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Po")]]=nani_lIllIlllllllIlIlllllIIl[nani_lIIlIlIlIIIIIllllllIIIlIl[#("rVs")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("TV")];nani_lIllIllIIlIlIlIlIlIlllIll=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("dZV")]];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII+1]=nani_lIllIllIIlIlIlIlIlIlllIll;nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIllIllIIlIlIlIlIlIlllIll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Ii7C")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#{"1 + 1 = 111";{824;791;316;973};}]]=nani_lIIlIlIlIIIIIllllllIIIlIl[#("1pW")];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIIlII=nani_lIIlIlIlIIIIIllllllIIIlIl[#("vI")]nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIIIlII](nani_lIlIlllIIIlllIIIIIl(nani_lIIIlIIlIIllIIlIllIlll,nani_lIIIIlII+1,nani_lIIlIlIlIIIIIllllllIIIlIl[#("d36")]))nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("Ra")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("2VK")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("d93I")]];nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;nani_lIIlIlIlIIIIIllllllIIIlIl=nani_IIIlIlIIlllIll[nani_IlllllIlIllIlIllIllIlIll];nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("CS")]]=nani_lIIIlIIlIIllIIlIllIlll[nani_lIIlIlIlIIIIIllllllIIIlIl[#("VjE")]][nani_lIIlIlIlIIIIIllllllIIIlIl[#("Lr5X")]];end;nani_IlllllIlIllIlIllIllIlIll=nani_IlllllIlIllIlIllIllIlIll+1;end;end);end;return nani_lIlIIlIIII(true,{},nani_lIlIIllIIIlllllIlI())();end)(string.byte,table.insert,setmetatable);
%d bloggers like this: