Roblox AREA 27 GUI , GET TOOLS , TELEPORTS , MORPHS

Roblox AREA 27 GUI , GET TOOLS , TELEPORTS , MORPHS

Script By AcidicExploiter

--[[
Acidic#0001
]]
return(function(IlIlllIllllIIIIlIlllI,lIIlIIIlIIlIlIIIlllII,lIlIIIlllIllIIlI)local IllIIlIlII=string.char;local IlIllIIIIll=string.sub;local lIlIIlIlIIlIlIlI=table.concat;local llIllIlIlIIlIlllllIIlI=math.ldexp;local IllIlIlIllIlIIllllIIll=getfenv or function()return _ENV end;local lIIIlIIIlIIlIII=select;local IIIIlIIlIIlIll=unpack or table.unpack;local lIIlIlIIIIlIllIl=tonumber;local function lIIIIlllIllllIllIIIllIl(IlIlllIllllIIIIlIlllI)local IllIIIlllIIIllIII,IIlIIIllIIlIIIlllI,IIIIlIIlIIlIll="","",{}local llIIllllIlIIllIIl=256;local IlIlIIllIlII={}for lIIlIIIlIIlIlIIIlllII=0,llIIllllIlIIllIIl-1 do IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII]=IllIIlIlII(lIIlIIIlIIlIlIIIlllII)end;local lIIlIIIlIIlIlIIIlllII=1;local function llIIIIlI()local IllIIIlllIIIllIII=lIIlIlIIIIlIllIl(IlIllIIIIll(IlIlllIllllIIIIlIlllI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII),36)lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+1;local IIlIIIllIIlIIIlllI=lIIlIlIIIIlIllIl(IlIllIIIIll(IlIlllIllllIIIIlIlllI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII+IllIIIlllIIIllIII-1),36)lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+IllIIIlllIIIllIII;return IIlIIIllIIlIIIlllI end;IllIIIlllIIIllIII=IllIIlIlII(llIIIIlI())IIIIlIIlIIlIll[1]=IllIIIlllIIIllIII;while lIIlIIIlIIlIlIIIlllII<#IlIlllIllllIIIIlIlllI do local lIIlIIIlIIlIlIIIlllII=llIIIIlI()if IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII]then IIlIIIllIIlIIIlllI=IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII]else IIlIIIllIIlIIIlllI=IllIIIlllIIIllIII..IlIllIIIIll(IllIIIlllIIIllIII,1,1)end;IlIlIIllIlII[llIIllllIlIIllIIl]=IllIIIlllIIIllIII..IlIllIIIIll(IIlIIIllIIlIIIlllI,1,1)IIIIlIIlIIlIll[#IIIIlIIlIIlIll+1],IllIIIlllIIIllIII,llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI,IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1 end;return table.concat(IIIIlIIlIIlIll)end;local llIIIIlI=lIIIIlllIllllIllIIIllIl('23Y25S27525U26027525S24925A24J24K24X25A24Z25125U25V27925A25124N25U26127923N24Z24I25125125A24724L25525U25X27924624I24X25927I27Q27523O25124O24K24C24X24Y25125825U26227928B28D24224L24K24K25B25A25U25Y27923K24X27U25A24K25U25W27925328627I25Z27924325B27U27Y28026627923U27B25028C24225125424X24M25529C29327924525A24L25925U29927523N25524Y25825525A25329T27524E29727P27924D24X2A62842AC25C27924224X24Z25725324I25B24L25A25029B25829C26B28V29A25B2AX24I2AZ2A025S2522AR25923M2472422792BE24A24025U2672AL29C29K24I2A224Q25123K25524O28I2BE2BV27728X25B24J25524K29R28U28227523P24425525926A25S24123E24Z1G23M23K1526N2BV25S22823226N2A925S2BO2512CL1G24M2402CL23K24O2BH28925S2442852532962A425125T25T27J2AL28Z2CL26O2542CX2CL26M2BH28W27524127U24X26A26F2CL21C25B2BH25I2DD2AO2AQ2AS2AU23O28527C24G28Z27W24Z24P2CL25S1W2CK25K25J24P25R25422921Y2CK2BV1G23W2BH29427524628T29228L27524725B24K29O2592422B22502CQ28N29226527923V23N24323K23X26O2DO25124X26O2DR28K28M28C24K2AW2AY2BX28A2FO2CS2EB2702BH2C525S2432AX24J2CT2532282701G24E21O21O2EM2BE2282412BH25T27923S25U2AK27524D2AS2G328P28R28T26924425B24N28U2B624Z28T27M24Z29227K2GM23O24625S25D25Z1623Z25L21X22P2CK1U22822124026W23B1Q2GC27924023V2DI2GD2402D12AE2H626O23N2E62GW28129A29O2BZ25S25U23A24M25S24G1E162CP2D22432722492HY2I028U2H42G024424325S23925M26D21C23926C21C2IE29A2IO26O24328I25824J2B02GM24426O2AM2EA24921E2721G25F21621G2CP2DM25S2482C124Y25B24O25S22T23L26U25S1I26P2JI25U2F92752422552D625124I26O2JM24K2JO24O2I228A25B2B22J52D224725124K26O23O2KE2J42FS2JL25529K2AB2872AD2752JM29K26O2KT27I2JK24E25B24Z2A524G2FM2AA2L42L626O23V23U23X2KV25S28B25825124G29C24K24J25S21824N2722341822H23H23325S21S21E1Q23326823222R2HO2792552HS2BE2492DL27R2K524M2K525S22G22M1824V22925I2IX29Z29A27U2502C12LO23R1O27021C26L1E21F2CK1624A1L25R24L24M2GB25U26327924124Z2KR25524Z26R2682NJ2692LG24F24G27W2AI2872CL1021H2M627523T2M92752282422BH2B623Q2552C02D82GH2CQ2NN27W2NA2792EY2F02862422582AN2572KP2OA25A26O24723P24925S2EW25S2IM2MP2752O42O62LJ2DA2GH2BV2FZ25S2782CL2682BE2O82CL2P225S2P82792GH2IM2PF2792OT2CQ2962KU2B623K2OI24P2K52J52NB27524C2L424X2582PP24X2PR24I2LG24329O2852H22K52GK27924829X27F25B2KR23M2KE24K28Y24I2922JK2432NQ27I2IM27M24N25S1O24P21B25R23B24Y24N1G25S22N21B25U24125S23S25B2R222Q1722Z26N26M2252272R22BE2K025S25E24S2PI27526O2CL25U25S2RR2BV27K2RV2BE2942RY27928225E2752GH2JK2RV2GH2GH2992S42I62P52792SC27K2D22SC2942OT2PI2942RT2GL27528W2PC2RP2OS2792PL2AC2PO2PQ2PS2OC2PV2PX2PZ2SZ2Q32IF2Q62AN24K2Q92SP2QC2592QE2QG2QI2QK2QM29A2QP2DC2752QS25S21222V25W2IX26622C2RJ2BE26O24J2R22202732731G25Y1W22P2TW2752RL2RN2ST2S12762RU2CL2RX2CL2S02CL2S32S525S2S72UM2SA2RM2UE2P62UR2OU25S2SI2752SK2PB25S2SN25S2SP2UN25S2SS2UM2752PK2ER25S2PM29828X2T52PT2792PW24Z2PY2Q02Q22Q42T82Q82Q32TC2QD25A2QF2502QH2EZ2TI2J62G02TL2QR27N25S26M22O21F2331G25Z22D2R222226U25826N2212292572R21P22M22L24024S23Y2382U825S2UA2RO2V82UF2BW2WY2BE2UH2BV2UJ2P32UU2S62792S82V625S2SB2US2SF2752SH2XE2V12SU2BV2GH2V22V42SR2V02V92SV2VB2VD2OW25S2VM2T02PU25S2VJ2VL2T52VO28Z2T92TB2QB2VT2VV2VX2QJ28Z2TJ2752QO2852KU2W32QT24L26H26T26O26U26L23T2R223Y22D21W2271427Z2R225F24U23D22725J1G2362WT2WV2UC2RS2X02792X22RZ2ZA2752UL2XA2UO2XA2UQ2SC2RT2UT2SG2UW2XH2UZ2XK2XI2SO2BE2XO2ZS27525G2XR2952AC2OT2KI24K23N2ME2NG27I2OT23N27E2QL2K529E2XU31062FP29C27I2SP31062AU2L32C22522NG24X2C228T2KC2LH2C12LJ2XU2PW24X29K25026P2F62FO25U25K28M26O26L26O29V28G2LJ26O26I26O23K311A26O2C824J311E2VE2752XW24I2VH2T22VK2T42Q12Q92UT31042GN24L2G32CQ24Y2A62F52BE310V31252AU26A25U2PC2922FZ312A2502AZ2PC2L72B624B25124P2GU2I12GY2H02512H22UV2752UT312431262Y32Q72TA2VR2Y72TE2VU2TG2VY2YC2W02YF2AC2YI25S25421K22721C24Y22021V2CX22C22726G22821A26K24X2CX21P25224626N25M22C2511G2SS29G27525E2742S927925Y24L2792F9314925W273314D2XA25S26W314J2X826J2ZJ2SD2X92PG2UU2RT2VB2RV2RT2RT2ZG27K2JK2SJ2XB2XH2822UT2SV25S2822ZU2XA2V225S25A2ST31452I6312G3126312C2RT27523Z2472KP2482FI2502FV2CL25O2BH2UT311M311O2502DA2CQ27M28D2SW2KU31032KJ310624I29Q27H2XU311R2J531672QJ2VG2CQ2L02T12XZ2T3311R310V24G311V2582DA2792BJ2762T72Y42VQ2QA2KW2Y831382YB2QL2CQ2CS2XU23Q312U28S2B42TM315D27N25U315L25S315N315P315R317726428M2E424J2E62902E92B7252317V317V21I2CP2OT24224I2NG2572FQ2Q32XY23M2FI25825824P26O2A424L27I2UT2AF31332552PY316J251310U2OT24327F2AW2A529K2V725S26Q2BE2CT2DF2V02UD2SD2SC2XL2X82UP3158314T2V52RQ2UE2RT2XC2UV2ZI27K27K319E2942ZI2942942B6315B2SD2V427K318V2TX31912Z92PE312X2ZP2EB319B2ZS31922RT31942XJ2WY31492ZG2RT2XY2PI314X2V32BE28L319T319631A2319W2BE317N2RL2EB31922GH31A32PD2BE29G316V2P92792JU31463148314M25Y25O279294314F314H2UY315B31B725S26T2XA31472XA317H26826R2XA27K29431A531BG2UM28228W31BM31AI31A8319A2GH31BC2PC314G27931BW2RM31B02B625E28W2ZM31AI31AD27Q31522SL2UE2V2314W2SD31AB31AD31BK2BE31BI31AQ2ZZ28W282317N25E319D2SE31A129929931C927527Q31CB315327Q2RT2RV31CU2WU2WY31D4317N2DM28W25Q2XA29931BY27531DB2XL31BA318X2GH31BE28W315G25Y23P3153319725S24Z2S22BE2562V52RT2P224B2XI2ZV24F2XA2ZZ2PA31DE25S31E52TN315F2SV315I2AU2AZ317H317J2UT315Q3111315T2BV315V2KP315Y2D831602DB2VB31632922XS31022OD31683107316C2SY311X311S2L825S3104316E316J2AC2XY2Y0311W2VN2FZ316Q2PY316S2PC315G31312Y53134317131362Y92TH313A2VB31772O3317A2FR313E2EB2NY2752ED25U317N28A317P317R2E824P31F531813183318525U25D2AE2512MS29X2TY28S27M26O2AQ312O2KP318I2K5318K28J31F227D2NG31F5318Q25A318S2KR2D92V725R2BE27031AO319V2WZ31A5314V319731A9319A2UU31502ZQ31DQ31AW2XM2X1314M31H831AJ2WZ319X2SE319O319031HP31282X6319Z31A72XA31HE31CZ2PA315A31CX31HN31HU31AW31AR31HR2NB31G431A031AP2ZE2SD31HR2F9315G2ST26P2SF31B02PC314B319631B631IQ31C131BF279268282314S31BL2UM31BN31I02V531A531C32XD31A131C82UU2ZR31HW31CD319C25S31CG2SD31CI27931DG2RU31CM319831CP31CR2UT31D331D02UU31CY2CL31CV314Q27531D42F931JQ29931D82SQ25S25L31DC2V131BA31K531DH27925P31BD27431DM314A31DP2B6314931DS31DU27931DW31C5314J31E02VB2SQ31E32GH2BJ31E631BA31KV31EA2WX31BI31462582Z831HA2UE2PH31HW31D22UI31992P42XF31572PE31HH29931LF2SE2D22ZB31BD31AW31A131AF31IF2NB2X927531IC31IU31A42UE315G2ZL31D531462UE2SP31LZ31AV31LZ2SC319931GF31J72XA25F2WY31AD31CM31DP2VB31KJ31DT31A02SD31B531JK2SD2GH31MC26O2AK31ME2I624D2XI318V314U2XA26O2ZZ31DY25S31MQ31MS2SD31N131MV315C31JB314J315E2WX31AN2CL31G22D224N29C257317Q2AN27I31M727B31332T92C324F24Y256317A2J52UT24324424524J2VK2NO31A02FY29A2A52AO3165310931EY310531F027I31M925S318824G31O8310S31GH310B29C24X25331OB2AA2KJ31NI24I2572A62A831MC27531NP2K52T931882592EZ2512452MF29131F524625527U31692MF2Q32JK2AT2E62AO2BV2DX2792DS31HW31BR31A131492X2314F31AE2PI31DK31J031BS31BJ31HZ3195314R2V52V431IX31HX2B631Q42782ZO31LK2UM27K31L9314P28L31Q431LR319731CP31LD31NE31E12UG31QP2ST318V31BX2SV2OT2AX311127D31822A731OA2XU24828R24G310425U31IL27525431R524J26I2U22E627D251312A2722GZ25927328524N27324A24D25123T24724126G31MJ2792SI315G2PC31PR31Q22UV2ZO31KR31B831QT31QR2Z92ZS31S927531AV2W02VU2L52552L731EW316631OC31PF310831F523M2AT31SO31F127R2TA24G2NO2F5312S25A2H12H327931OJ2Q331F22Q2311T316M311V316O2FZ31P53122318G31OC31213123312M312O312Q2C431T431R02YD316M311131GH25U31OZ2XV27U24J24J26O26Q23U26Q26O28S26O31SH2L62SD319Y2762JK31U731SJ31R231T72XX2VI316N2Y2316X3132311Y31352TF2F52XY2Q527F31OQ310B31OL2EB26U2NY2UA2742WX25Y31AY31MW31B931B431V631LT31KD31572RQ24R2RW31IF2X42BE282319228W3192319E31C62EB31N2315D2ST2D2312D27924Q31SG2LA31UE31SL311P2XV316I31FB31UJ31F331FL316Z31EI317231UQ2I331UT25131UV2TA31UX2402SS31AV26U24531LL31IR31LD31KA27529G31DK31B0317H25S26Z314P31M131IU31WY314S31PS319P31Q431VI319731VK319729931QA31HG31HY2PI319S31KZ314M31DB27925J2EB31M7314M31XL317H319227K31LZ31S7315731QG31VH31IF31C531MV31WU2NZ315731PY31VB31IF278319231CW27931J531Y831AI2BE31AB31JD31XL2OT31YF31YB279317N31VJ31MU31MO2BE2LO2UE31Y22U92XH2GH31IJ31HW31YR31M031HX31AV2WZ31SD312W2I62O32O52A32P0316T2X5279315631IV31AW31XZ314M31HR31X131LN25S21G315L25E26B31L431PQ31QE31A031AD31A52PC31Q431LW31ML2V031ZT31YQ31C72SD31ZX31JH31L8319331WO31AI319H32072XI31LC2UV320031V531A1319M320B31BP31LA320F31Q731A128231592UU28W2JK31DU320F2ZW2WY320S320B299320T31K3320F29931ZV31JX315331ZX27832113217320B27832152SE27831ZX27Q321A321G320B27Q321E27Q31D12UU28L321A321P31ZX31AG31AI28L28L31ZX2NB321A321Y320B2NB321E2NB2NB31ZX31K22BV3227320B317N321E317N317N31ZX2F9321A322G320B314E31AI2F92F931ZX29G320D322P320B31WR31AI29G29G31ZX2BJ320D322Y320B31KY31A12BJ2BJ31ZX2AK320D3237320B2AK321E2AK31N52SC31GF31XS31N531ZX31GF321E31GF31GF31ZX2S4321A323P320B2S431JP31M12S427Q2V42XC2SC2S42XY2RV2S42S431QI323X25S317N2V428L2S42PE2GH31II2V32JQ2UQ31462P82S42SP32452UR31GF2SC31MC31M72SC2ZZ324U27525H2UU2BE2S4324Z315A31KU2UR324F31N331E82UU2S431PN2WY3246320B31MC31XJ31WY2ZZ2ZZ31WY324Z311831WY2DX325K325125S2DX325425S324Z325E2UR325C324P2S431ZX31MC325Q324V25S25M2XH324Z32642752DX25N2CL325B319Q2UM31K5324E2UM31B331KC2PE2RT2F931DB2GL31CR31Y2324N31AI325E324R27532632XH2ZZ31H5325L25S3272325R325331PW2RT2BJ326J2SD326Z3242325S326V2UR32623259325I32663268327J2UU2DX3192326F315A2RT326I31AS2SD326L327V27K2F931IL2GL319I31LM2UR324O3249326X3258318X327K328A2UU324Z328C2XE3277328225S327A327Y25S31BI26S328L327D31M1325Z3249327I31BC327K326A325V327N2SC325P326E327F315A27K325W325A327F31A1325E327I328X2ZZ31V42SC32692XH327P3292325T31PW27K327U327E3244324926V325D2UR314L328I329R327B27K26X25S26Y329732862UR2S4328831MC328C326532A8329R328E3292328H31LD31WW329X25S31H7271327V2942F927231PW319N3284326U3299324Q2UU32A73270318W2SF24Q328Y328F23W2UR32AE2XI328K2PE294328N32AL3258324W328R327G326132AV25S31BA3265328X329G325O327N31S532932V332AO2943296327E328S32A4325F328Z2ZY327V328D32BZ327F327Q32BQ2GL294329N31M1324432BD2S4329R31U432BX329U31B8329W32BB329Z26932A232BF2H832BH32A832C032CR32B132AD326G2XI32AG2PD31MC29432AJ31MN2S42942CB31MR32BX31ZO31DO327N2PA31KK2752V431RY2SS23T2UR31E92PE2822F926C31PW282321432CN32AT32A532BH329C3274327M3275328G32CW28232B731MC282327D23Q325Y32CO327I26D32AX32BL25S26E329H32BO32BE315A28232BU32BE32DT319332B0326Z314624I325931PP32C2328X2DX26G329J32E131K432BX2UR329P32BX32CE324932CH319832CJ32DL25S329Z26H31IT32AS2RU25432BX32A632AY328B327M328F31M132B528232CY32FB32D2324P28232D6324931ZO25U31MV31E927932DI2S432DK31K32F926I31PW28W32DR327E32A3326W32DV32AX3275329F32DX2BV325232CW28W32E32V532E632E832EN32EA32EC327M314O32BN325Q2XE329K2GL28W32EL32GS329S32BG25E32EP328Z32ES2ZZ32EU32GJ32EW25S32EY32GL32C631K332C932F332CO32F632CG32GA25S32FA31K3329Z26K32FF31PW32FH32FJ32CQ32AX32CT32AC32HI32B528W32FS31K332FU31M128W32FX32D831YM31N12BE32G432592GH2PE2992F926L31PW31D4326T32HX326032CP324S32C3327132DY32CV315A29932GP29932GR326F32GT32BH32EB328W327M26M32EG32GZ32EI32IO328Y325X32J432H632EO32BC2SF32HB25S32HD324Y32C332EX32EZ32IZ32F132JG31JE32HN32JI32F829932HS3153329Z2CK31BE32FG2DG32HZ32IU32CT2ZZ32I232FL327632CW29932I7315332I92UR29932IC325E32FZ32G131Z325S32IH32G62SE2F92CX2GL27832GC31M132GE32AU32IU32DW32GI32JP32DZ32FP32CW27832GP27832J3329832JI32GU32J832732R732GY32JS31PW27832H432JH32IS31A432H9326432JM32JO328Y32HF32HH325R32H1319Y32HL324332JX32IS32F827832K1278329Z2CX32K532IR32FI32GF32K932I132FN32IY32LM31WV3256319Y32KJ323V25S32KM2UR32KO325931KR32KS2XA2PE27Q2F92BD2GL27Q32KZ328532CO32FK32L432IX32I432CW27Q32GP27Q32LD32BW329A32BH2IP32LH32C232LJ327O32EH32E8315A27Q32LO32LE32LQ2RM32LS32JL32ET327M32LX32LL32N232JU329732F4325E32HO325E32F827Q32K127Q329Z24432HW324O32ME32L2326Y32KD32A932MI32NA32NQ32ML327B27Q32MO2ZP32MR2S432MT2ZZ2P432MW32IJ2XQ2F931WL2GL28L32N432K6328732GG327K32L5328Y32L732B432CW28L32GP28L32NF32E932NI32GV327332EF32LK32HI32M02SU32NS32NG327H32NV32JK32ER32NY327332O032PQ32PF32O3329O32M432F731PW28L32K128L329Z2H732MC32OG32K832OJ32KA32OK32JP32FO32PE315A28L32KH28L32OS28L32OU25S32OW31HF32KR32DJ32MX2752NB2F924731PW2NB32P632IR32P832L332GH32N932KE315A2NB32GP2NB32PJ32J532IU32NJ2UU325J32GW32JB32O132R032JF329732PU32H732NW32PY32HC32NZ32EG32LY32H032CW2NB32M232JW32EN32O7329T32R432HR32MM32JW329Z24832OF2X832OH32DU32MG32FM327332QL32GM32RD32OP327V2NB32OS2NB32QT32QV319O32OZ327V31AM27A31PW317N32R632L132SI32OJ32N8327332PD32SN32T1328J325631MC317N32RH32LF32PL32NK32GJ32JA32PP32LZ32CW317N32PT32PK32H832PX2RM32LU32RY32BN32S032JD2GL317N32S432O52UR32S72S432F8317N32K1317N329Z24A32SF2RQ32SH32IT32QH32MH32SL32MJ32U032SP2PE317N32OS317N32SU32IE31CS27532G932G532QZ31D52F931E02GL2F932T332N632I032SK32C232SM328Y315A2F932B731YS32BA2PE2F9328Q32H532NU32IU24C32PM32C231MV32TM32S132VA32RR32BV32TR32T632AX24E32TW32NN31E332Q232VR32U232Q632HP32V132SA327B2F9329Z31E032GD32V432SJ32RL32QJ32CU32ON31PW2F932KH2F932D22PE29G2F923K31PW29G32V332EN32FK32QI32KC32V832B531AU32SB29G32VE31WQ32JK32VT32RI32OJ23L32VM32GJ32VO32NN32JC32NP32WS32VS32EM32TH32R9327K32VX32Q032EG32W032TN315A29G32W332S632JY32XH32K129G329Z32WR32WC32WV32V532WF32WY32UK32X532FS31MC29G32WN32UC2BJ2F923M31PW2BJ32WU32JI32WW32UI32V732Y732TC32VC32TC32X432TC32VH32LP328T32BH23N32XB32JP23O32RO32W132YH32XI32VI32YW32XL32WF329E32JP32HF32C532PR2BJ32XU32JI32U5314K32Z432K12BJ329Z31DP32Y232YK32Y432OL32UJ32WI2GL2BJ32KH2BJ32WN32DE31D532E72GL2AK31Y932P732QG32TT326532PB324Z32T932V931PW2AK32YQ2AK32YU32NT32Z732VV32TJ32JP23R32Z232XR330E32Z532YV32BX329B32AX23S32VY329032QX32Z3330332O32PE2AK23U25S23V327V31GF2F932B32GL31GF2992AK32ZP32IS32N732RA32T832YO31GF32YQ31GF330I32RT32BY32LT3259330X32XO32BN32DI331127531GF32ZG32IS32ZI23X31PW31GF32K131GF329Z27432QE32SG330732AW32V632GJ32WZ32CW31GF32KH31GF32OS31GF32UR32DA2ZZ321M31U932DG2BE31RY2V431M132G231NC314M');local lIIlIIIlIIlIlIIIlllII=(bit or bit32);local IlIlIIllIlII=lIIlIIIlIIlIlIIIlllII and lIIlIIIlIIlIlIIIlllII.bxor or function(lIIlIIIlIIlIlIIIlllII,IllIIIlllIIIllIII)local IIlIIIllIIlIIIlllI,IlIlIIllIlII,IlIllIIIIll=1,0,10 while lIIlIIIlIIlIlIIIlllII>0 and IllIIIlllIIIllIII>0 do local IlIllIIIIll,llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII%2,IllIIIlllIIIllIII%2 if IlIllIIIIll~=llIIllllIlIIllIIl then IlIlIIllIlII=IlIlIIllIlII+IIlIIIllIIlIIIlllI end lIIlIIIlIIlIlIIIlllII,IllIIIlllIIIllIII,IIlIIIllIIlIIIlllI=(lIIlIIIlIIlIlIIIlllII-IlIllIIIIll)/2,(IllIIIlllIIIllIII-llIIllllIlIIllIIl)/2,IIlIIIllIIlIIIlllI*2 end if lIIlIIIlIIlIlIIIlllII<IllIIIlllIIIllIII then lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII end while lIIlIIIlIIlIlIIIlllII>0 do local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII%2 if IllIIIlllIIIllIII>0 then IlIlIIllIlII=IlIlIIllIlII+IIlIIIllIIlIIIlllI end lIIlIIIlIIlIlIIIlllII,IIlIIIllIIlIIIlllI=(lIIlIIIlIIlIlIIIlllII-IllIIIlllIIIllIII)/2,IIlIIIllIIlIIIlllI*2 end return IlIlIIllIlII end local function IIlIIIllIIlIIIlllI(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII,IllIIIlllIIIllIII)if IllIIIlllIIIllIII then local lIIlIIIlIIlIlIIIlllII=(IIlIIIllIIlIIIlllI/2^(lIIlIIIlIIlIlIIIlllII-1))%2^((IllIIIlllIIIllIII-1)-(lIIlIIIlIIlIlIIIlllII-1)+1);return lIIlIIIlIIlIlIIIlllII-lIIlIIIlIIlIlIIIlllII%1;else local lIIlIIIlIIlIlIIIlllII=2^(lIIlIIIlIIlIlIIIlllII-1);return(IIlIIIllIIlIIIlllI%(lIIlIIIlIIlIlIIIlllII+lIIlIIIlIIlIlIIIlllII)>=lIIlIIIlIIlIlIIIlllII)and 1 or 0;end;end;local lIIlIIIlIIlIlIIIlllII=1;local function IllIIIlllIIIllIII()local llIIllllIlIIllIIl,IlIllIIIIll,IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII=IlIlllIllllIIIIlIlllI(llIIIIlI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII+3);llIIllllIlIIllIIl=IlIlIIllIlII(llIIllllIlIIllIIl,208)IlIllIIIIll=IlIlIIllIlII(IlIllIIIIll,208)IIlIIIllIIlIIIlllI=IlIlIIllIlII(IIlIIIllIIlIIIlllI,208)IllIIIlllIIIllIII=IlIlIIllIlII(IllIIIlllIIIllIII,208)lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+4;return(IllIIIlllIIIllIII*16777216)+(IIlIIIllIIlIIIlllI*65536)+(IlIllIIIIll*256)+llIIllllIlIIllIIl;end;local function lIIlIlIIIIlIllIl()local IllIIIlllIIIllIII=IlIlIIllIlII(IlIlllIllllIIIIlIlllI(llIIIIlI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII),208);lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+1;return IllIIIlllIIIllIII;end;local function llIIllllIlIIllIIl()local IllIIIlllIIIllIII,IIlIIIllIIlIIIlllI=IlIlllIllllIIIIlIlllI(llIIIIlI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII+2);IllIIIlllIIIllIII=IlIlIIllIlII(IllIIIlllIIIllIII,208)IIlIIIllIIlIIIlllI=IlIlIIllIlII(IIlIIIllIIlIIIlllI,208)lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+2;return(IIlIIIllIIlIIIlllI*256)+IllIIIlllIIIllIII;end;local function lIllllllllIlIlIIll()local IlIlIIllIlII=IllIIIlllIIIllIII();local lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII();local IlIllIIIIll=1;local IlIlIIllIlII=(IIlIIIllIIlIIIlllI(lIIlIIIlIIlIlIIIlllII,1,20)*(2^32))+IlIlIIllIlII;local IllIIIlllIIIllIII=IIlIIIllIIlIIIlllI(lIIlIIIlIIlIlIIIlllII,21,31);local lIIlIIIlIIlIlIIIlllII=((-1)^IIlIIIllIIlIIIlllI(lIIlIIIlIIlIlIIIlllII,32));if(IllIIIlllIIIllIII==0)then if(IlIlIIllIlII==0)then return lIIlIIIlIIlIlIIIlllII*0;else IllIIIlllIIIllIII=1;IlIllIIIIll=0;end;elseif(IllIIIlllIIIllIII==2047)then return(IlIlIIllIlII==0)and(lIIlIIIlIIlIlIIIlllII*(1/0))or(lIIlIIIlIIlIlIIIlllII*(0/0));end;return llIllIlIlIIlIlllllIIlI(lIIlIIIlIIlIlIIIlllII,IllIIIlllIIIllIII-1023)*(IlIllIIIIll+(IlIlIIllIlII/(2^52)));end;local lIIIIlllIllllIllIIIllIl=IllIIIlllIIIllIII;local function llIllIlIlIIlIlllllIIlI(IllIIIlllIIIllIII)local IIlIIIllIIlIIIlllI;if(not IllIIIlllIIIllIII)then IllIIIlllIIIllIII=lIIIIlllIllllIllIIIllIl();if(IllIIIlllIIIllIII==0)then return'';end;end;IIlIIIllIIlIIIlllI=IlIllIIIIll(llIIIIlI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII+IllIIIlllIIIllIII-1);lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+IllIIIlllIIIllIII;local IllIIIlllIIIllIII={}for lIIlIIIlIIlIlIIIlllII=1,#IIlIIIllIIlIIIlllI do IllIIIlllIIIllIII[lIIlIIIlIIlIlIIIlllII]=IllIIlIlII(IlIlIIllIlII(IlIlllIllllIIIIlIlllI(IlIllIIIIll(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII,lIIlIIIlIIlIlIIIlllII)),208))end return lIlIIlIlIIlIlIlI(IllIIIlllIIIllIII);end;local lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII;local function lIIIIlllIllllIllIIIllIl(...)return{...},lIIIlIIIlIIlIII('#',...)end local function llIIIIlI()local IlIlllIllllIIIIlIlllI={};local IlIlIIllIlII={};local lIIlIIIlIIlIlIIIlllII={};local IllIIlIlII={[#{{736;2;429;641};{570;536;554;320};}]=IlIlIIllIlII,[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=nil,[#{"1 + 1 = 111";{140;738;887;157};{639;681;566;788};"1 + 1 = 111";}]=lIIlIIIlIIlIlIIIlllII,[#{"1 + 1 = 111";}]=IlIlllIllllIIIIlIlllI,};local lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII()local IlIllIIIIll={}for IIlIIIllIIlIIIlllI=1,lIIlIIIlIIlIlIIIlllII do local IllIIIlllIIIllIII=lIIlIlIIIIlIllIl();local lIIlIIIlIIlIlIIIlllII;if(IllIIIlllIIIllIII==1)then lIIlIIIlIIlIlIIIlllII=(lIIlIlIIIIlIllIl()~=0);elseif(IllIIIlllIIIllIII==0)then lIIlIIIlIIlIlIIIlllII=lIllllllllIlIlIIll();elseif(IllIIIlllIIIllIII==2)then lIIlIIIlIIlIlIIIlllII=llIllIlIlIIlIlllllIIlI();end;IlIllIIIIll[IIlIIIllIIlIIIlllI]=lIIlIIIlIIlIlIIIlllII;end;IllIIlIlII[3]=lIIlIlIIIIlIllIl();for lIIlIIIlIIlIlIIIlllII=1,IllIIIlllIIIllIII()do IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII-1]=llIIIIlI();end;for llIIIIlI=1,IllIIIlllIIIllIII()do local lIIlIIIlIIlIlIIIlllII=lIIlIlIIIIlIllIl();if(IIlIIIllIIlIIIlllI(lIIlIIIlIIlIlIIIlllII,1,1)==0)then local IlIlIIllIlII=IIlIIIllIIlIIIlllI(lIIlIIIlIIlIlIIIlllII,2,3);local IIIIlIIlIIlIll=IIlIIIllIIlIIIlllI(lIIlIIIlIIlIlIIIlllII,4,6);local lIIlIIIlIIlIlIIIlllII={llIIllllIlIIllIIl(),llIIllllIlIIllIIl(),nil,nil};if(IlIlIIllIlII==0)then lIIlIIIlIIlIlIIIlllII[#("Q1Z")]=llIIllllIlIIllIIl();lIIlIIIlIIlIlIIIlllII[#("gC4R")]=llIIllllIlIIllIIl();elseif(IlIlIIllIlII==1)then lIIlIIIlIIlIlIIIlllII[#("BKL")]=IllIIIlllIIIllIII();elseif(IlIlIIllIlII==2)then lIIlIIIlIIlIlIIIlllII[#("6M7")]=IllIIIlllIIIllIII()-(2^16)elseif(IlIlIIllIlII==3)then lIIlIIIlIIlIlIIIlllII[#("Kpj")]=IllIIIlllIIIllIII()-(2^16)lIIlIIIlIIlIlIIIlllII[#("1EqR")]=llIIllllIlIIllIIl();end;if(IIlIIIllIIlIIIlllI(IIIIlIIlIIlIll,1,1)==1)then lIIlIIIlIIlIlIIIlllII[#("PC")]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("tZ")]]end if(IIlIIIllIIlIIIlllI(IIIIlIIlIIlIll,2,2)==1)then lIIlIIIlIIlIlIIIlllII[#("ggc")]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{557;129;865;230};}]]end if(IIlIIIllIIlIIIlllI(IIIIlIIlIIlIll,3,3)==1)then lIIlIIIlIIlIlIIIlllII[#("gtQB")]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("iiyJ")]]end IlIlllIllllIIIIlIlllI[llIIIIlI]=lIIlIIIlIIlIlIIIlllII;end end;return IllIIlIlII;end;local function llIllIlIlIIlIlllllIIlI(lIIlIIIlIIlIlIIIlllII,IlIlllIllllIIIIlIlllI,IlIllIIIIll)lIIlIIIlIIlIlIIIlllII=(lIIlIIIlIIlIlIIIlllII==true and llIIIIlI())or lIIlIIIlIIlIlIIIlllII;return(function(...)local IlIlIIllIlII=lIIlIIIlIIlIlIIIlllII[1];local llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[3];local lIlIIlIlIIlIlIlI=lIIlIIIlIIlIlIIIlllII[2];local IllIIlIlII=lIIIIlllIllllIllIIIllIl local IllIIIlllIIIllIII=1;local llIIIIlI=-1;local IllIlIlIllIlIIllllIIll={};local lIIIIlllIllllIllIIIllIl={...};local lIIIlIIIlIIlIII=lIIIlIIIlIIlIII('#',...)-1;local lIIlIlIIIIlIllIl={};local IIlIIIllIIlIIIlllI={};for lIIlIIIlIIlIlIIIlllII=0,lIIIlIIIlIIlIII do if(lIIlIIIlIIlIlIIIlllII>=llIIllllIlIIllIIl)then IllIlIlIllIlIIllllIIll[lIIlIIIlIIlIlIIIlllII-llIIllllIlIIllIIl]=lIIIIlllIllllIllIIIllIl[lIIlIIIlIIlIlIIIlllII+1];else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=lIIIIlllIllllIllIIIllIl[lIIlIIIlIIlIlIIIlllII+#{"1 + 1 = 111";}];end;end;local lIIlIIIlIIlIlIIIlllII=lIIIlIIIlIIlIII-llIIllllIlIIllIIl+1 local lIIlIIIlIIlIlIIIlllII;local llIIllllIlIIllIIl;while true do lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Y")];if llIIllllIlIIllIIl<=#("arp85sphOnlUVxF7mc4caA9oWxvYhDQTGSIvGRctZYq382NZXxZvga3KrblI6B9k")then if llIIllllIlIIllIIl<=#("DndZiBGaLnmjfp3UGbVOtMGZ7dFFExy")then if llIIllllIlIIllIIl<=#("fvFPJaP6tuGXQAm")then if llIIllllIlIIllIIl<=#("rYAAoHn")then if llIIllllIlIIllIIl<=#("Rn2")then if llIIllllIlIIllIIl<=#{{294;495;621;163};}then if llIIllllIlIIllIIl>#{}then local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("3B")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("s9J")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fD")]][lIIlIIIlIIlIlIIIlllII[#("GQc")]]=lIIlIIIlIIlIlIIIlllII[#("FTXa")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8m")]][lIIlIIIlIIlIlIIIlllII[#{{352;867;468;154};"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("z4kE")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3g")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{330;406;597;90};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0P")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9Mx")]][lIIlIIIlIIlIlIIIlllII[#("s7K9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4d")]]=lIIlIIIlIIlIlIIIlllII[#("8rR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("G4")]]=lIIlIIIlIIlIlIIIlllII[#("hC3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ku")]]=lIIlIIIlIIlIlIIIlllII[#("j50")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("JZ")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("g4k")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ds")]][lIIlIIIlIIlIlIIIlllII[#("bcS")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AnsY")]];else local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("9e")]IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII+1,lIIlIIIlIIlIlIIIlllII[#("J5E")]))end;elseif llIIllllIlIIllIIl==#("oZ")then local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Lm")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Rh9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Ad")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zzd")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("bYTp")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fr")]]=lIIlIIIlIIlIlIIIlllII[#("706")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("V4")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xn")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{41;697;794;381};"1 + 1 = 111";{912;28;906;6};}]][lIIlIIIlIIlIlIIIlllII[#("xRgM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RV")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ym5")]][lIIlIIIlIIlIlIIIlllII[#("RgYv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("DY")]]==IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xO4J")]])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("EqM")];end;else local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("oS")]IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII]=IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII+1,lIIlIIIlIIlIlIIIlllII[#("4hu")]))end;elseif llIIllllIlIIllIIl<=#("eUVok")then if llIIllllIlIIllIIl==#("vZu9")then local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{{159;89;165;236};"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{{683;691;21;176};{644;427;515;825};"1 + 1 = 111";}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("95")]][lIIlIIIlIIlIlIIIlllII[#("CCf")]]=lIIlIIIlIIlIlIIIlllII[#("6sXK")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("u3")]][lIIlIIIlIIlIlIIIlllII[#("1fz")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jTRY")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("8jj")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xF")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("LOD")]][lIIlIIIlIIlIlIIIlllII[#("5ZKP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yB")]]=lIIlIIIlIIlIlIIIlllII[#{{559;56;956;417};{608;494;477;522};{729;707;991;487};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vA")]]=lIIlIIIlIIlIlIIIlllII[#("ms8")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ym")]]=lIIlIIIlIIlIlIIIlllII[#("Xg1")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("uv")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("G2n")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mG")]][lIIlIIIlIIlIlIIIlllII[#("MCM")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Q9IH")]];else local llIIIIlI;local lIIlIlIIIIlIllIl;local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Px")]][lIIlIIIlIIlIlIIIlllII[#("Ch7")]]=lIIlIIIlIIlIlIIIlllII[#("SYJI")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Bx")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("YPS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Vf")]][lIIlIIIlIIlIlIIIlllII[#("gZv")]]=lIIlIIIlIIlIlIIIlllII[#("mion")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AA")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Osb")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{751;599;678;949};}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("QhW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("gt")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("E77")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("WtUN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zf")]]=lIIlIIIlIIlIlIIIlllII[#("oIU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("r2")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{{812;568;274;989};"1 + 1 = 111";"1 + 1 = 111";}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Qo")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ciK")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("SbjV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("bP")]lIIlIlIIIIlIllIl={IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])};llIIIIlI=0;for lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl,lIIlIIIlIIlIlIIIlllII[#("N9r5")]do llIIIIlI=llIIIIlI+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=lIIlIlIIIIlIllIl[llIIIIlI];end IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("SxR")];end;elseif llIIllllIlIIllIIl==#{{638;851;46;880};"1 + 1 = 111";"1 + 1 = 111";{370;923;609;396};{681;103;137;385};"1 + 1 = 111";}then local llIIIIlI;local lIIlIlIIIIlIllIl;local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vi")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("LOb")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("W2")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VLl")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#{{443;586;162;493};"1 + 1 = 111";"1 + 1 = 111";{908;176;235;41};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("76")]]=lIIlIIIlIIlIlIIIlllII[#("1fZ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("CN")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("PD1")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("p5")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jlF")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{992;455;542;815};"1 + 1 = 111";{482;128;272;792};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]lIIlIlIIIIlIllIl={IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])};llIIIIlI=0;for lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl,lIIlIIIlIIlIlIIIlllII[#("hUpj")]do llIIIIlI=llIIIIlI+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=lIIlIlIIIIlIllIl[llIIIIlI];end IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("4Nz")];else if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nn")]]~=lIIlIIIlIIlIlIIIlllII[#("bFDI")])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("Pmn")];end;end;elseif llIIllllIlIIllIIl<=#("68KJiN7uhKa")then if llIIllllIlIIllIIl<=#("Yq7svDadO")then if llIIllllIlIIllIIl==#("dAlnV8fu")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{369;55;786;618};}]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("TgA")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2x")]][lIIlIIIlIIlIlIIIlllII[#("BoI")]]=lIIlIIIlIIlIlIIIlllII[#("Le6R")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mU")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("59a")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nT")]][lIIlIIIlIIlIlIIIlllII[#("vIn")]]=lIIlIIIlIIlIlIIIlllII[#("P0Xn")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;else IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("YPE")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ye")]];end;elseif llIIllllIlIIllIIl==#("kY1r1YFLhq")then local IlIlIIllIlII=lIIlIIIlIIlIlIIIlllII[#("ND")];local IllIIIlllIIIllIII=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qeU")]];IIlIIIllIIlIIIlllI[IlIlIIllIlII+1]=IllIIIlllIIIllIII;IIlIIIllIIlIIIlllI[IlIlIIllIlII]=IllIIIlllIIIllIII[lIIlIIIlIIlIlIIIlllII[#("SGOH")]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gj")]]=lIIlIIIlIIlIlIIIlllII[#("2BN")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("j6")]]=lIIlIIIlIIlIlIIIlllII[#("oIs")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cc")]]=lIIlIIIlIIlIlIIIlllII[#("xQE")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("rq")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("QHe")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6y")]][lIIlIIIlIIlIlIIIlllII[#("5bJ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R8Di")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("He")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("l13")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("64")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AJP")]][lIIlIIIlIIlIlIIIlllII[#("Q77j")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yU")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{959;246;204;478};"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("7V9E")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8o")]][lIIlIIIlIIlIlIIIlllII[#("v3A")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hHT9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5C")]][lIIlIIIlIIlIlIIIlllII[#("MKL")]]=lIIlIIIlIIlIlIIIlllII[#("XJD3")];end;elseif llIIllllIlIIllIIl<=#("yWYclZV0kzUjb")then if llIIllllIlIIllIIl==#{{663;963;378;150};"1 + 1 = 111";"1 + 1 = 111";{435;177;170;318};{881;876;535;975};{466;651;805;691};"1 + 1 = 111";{168;215;839;145};"1 + 1 = 111";{852;700;437;227};"1 + 1 = 111";{303;646;336;657};}then IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("RCp")];else local llIIIIlI=lIlIIlIlIIlIlIlI[lIIlIIIlIIlIlIIIlllII[#("dCj")]];local IIIIlIIlIIlIll;local llIIllllIlIIllIIl={};IIIIlIIlIIlIll=lIlIIIlllIllIIlI({},{__index=function(IllIIIlllIIIllIII,lIIlIIIlIIlIlIIIlllII)local lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII];return lIIlIIIlIIlIlIIIlllII[1][lIIlIIIlIIlIlIIIlllII[2]];end,__newindex=function(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII,IllIIIlllIIIllIII)local lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII]lIIlIIIlIIlIlIIIlllII[1][lIIlIIIlIIlIlIIIlllII[2]]=IllIIIlllIIIllIII;end;});for IlIllIIIIll=1,lIIlIIIlIIlIlIIIlllII[#("HsiO")]do IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;local lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];if lIIlIIIlIIlIlIIIlllII[#("E")]==99 then llIIllllIlIIllIIl[IlIllIIIIll-1]={IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII[#("LeO")]};else llIIllllIlIIllIIl[IlIllIIIIll-1]={IlIlllIllllIIIIlIlllI,lIIlIIIlIIlIlIIIlllII[#("FKu")]};end;lIIlIlIIIIlIllIl[#lIIlIlIIIIlIllIl+1]=llIIllllIlIIllIIl;end;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TV")]]=llIllIlIlIIlIlllllIIlI(llIIIIlI,IIIIlIIlIIlIll,IlIllIIIIll);end;elseif llIIllllIlIIllIIl==#("fE113XYFrLjc6m")then local IlIlllIllllIIIIlIlllI;local llIllIlIlIIlIlllllIIlI,lIlIIlIlIIlIlIlI;local lIIlIlIIIIlIllIl;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("2r0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("8Z")];lIIlIlIIIIlIllIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CZz")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=lIIlIlIIIIlIllIl;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=lIIlIlIIIIlIllIl[lIIlIIIlIIlIlIIIlllII[#("LgTM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("H4")]]=lIIlIIIlIIlIlIIIlllII[#("geY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Dr")]]=(lIIlIIIlIIlIlIIIlllII[#("AmD")]~=0);IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("8q")]llIllIlIlIIlIlllllIIlI,lIlIIlIlIIlIlIlI=IllIIlIlII(IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Lns")])))llIIIIlI=lIlIIlIlIIlIlIlI+llIIllllIlIIllIIl-1 IlIlllIllllIIIIlIlllI=0;for lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl,llIIIIlI do IlIlllIllllIIIIlIlllI=IlIlllIllllIIIIlIlllI+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=llIllIlIlIIlIlllllIIlI[IlIlllIllllIIIIlIlllI];end;IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{{275;302;103;872};{991;11;178;267};}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,llIIIIlI))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CT")]]();IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;else if not IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mk")]]then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("AyA")];end;end;elseif llIIllllIlIIllIIl<=#("jYBPZo6OhRorKLy8HnZQvtI")then if llIIllllIlIIllIIl<=#("vnINJm16W9OKz0iVi0T")then if llIIllllIlIIllIIl<=#("OGo43NMYgH3ZpKsLR")then if llIIllllIlIIllIIl>#("f40sFK7YJRfeHGLy")then local IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("Ih")];local llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("cctP")];local IlIlIIllIlII=IlIllIIIIll+2 local IlIllIIIIll={IIlIIIllIIlIIIlllI[IlIllIIIIll](IIlIIIllIIlIIIlllI[IlIllIIIIll+1],IIlIIIllIIlIIIlllI[IlIlIIllIlII])};for lIIlIIIlIIlIlIIIlllII=1,llIIllllIlIIllIIl do IIlIIIllIIlIIIlllI[IlIlIIllIlII+lIIlIIIlIIlIlIIIlllII]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII];end;local IlIllIIIIll=IlIllIIIIll[1]if IlIllIIIIll then IIlIIIllIIlIIIlllI[IlIlIIllIlII]=IlIllIIIIll IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("a8i")];else IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;end;else local IlIlIIllIlII=lIIlIIIlIIlIlIIIlllII[#("fJ")];local IllIIIlllIIIllIII=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JzC")]];IIlIIIllIIlIIIlllI[IlIlIIllIlII+1]=IllIIIlllIIIllIII;IIlIIIllIIlIIIlllI[IlIlIIllIlII]=IllIIIlllIIIllIII[lIIlIIIlIIlIlIIIlllII[#("OhX0")]];end;elseif llIIllllIlIIllIIl>#("08NU5LcZpfYtYHHeZU")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("LG")]][lIIlIIIlIIlIlIIIlllII[#("b5E")]]=lIIlIIIlIIlIlIIIlllII[#("30s6")];else local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("x2")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("LHm")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("E7")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dxk")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{41;426;348;965};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{118;784;434;466};}]]=lIIlIIIlIIlIlIIIlllII[#("qsZ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("SG")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("hKA")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("I7")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6Lo")]][lIIlIIIlIIlIlIIIlllII[#("hGKS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0W")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2nS")]][lIIlIIIlIIlIlIIIlllII[#("yYsz")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{160;81;28;78};}]]==IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1cy4")]])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("RNn")];end;end;elseif llIIllllIlIIllIIl<=#("tvaP7ed4Tbayo2yCNdKjt")then if llIIllllIlIIllIIl==#("DpEiFUkJaRVWe10tQP2Q")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PC")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("NCt")]][lIIlIIIlIIlIlIIIlllII[#("fmdU")]];else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iA")]][lIIlIIIlIIlIlIIIlllII[#("Sdj")]]=lIIlIIIlIIlIlIIIlllII[#("QWM8")];end;elseif llIIllllIlIIllIIl==#("YoSJCBf3apLEH2VlYKtUjb")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UB")]]();else local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("71")]]=(lIIlIIIlIIlIlIIIlllII[#{{104;595;81;888};{503;750;787;776};{218;846;65;859};}]~=0);IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{855;428;756;823};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("FL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eD")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("iZO")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Dq")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9iz")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("Q9mN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JE")]]=lIIlIIIlIIlIlIIIlllII[#("R9H")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Wa")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("ZTH")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ap")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jE3")]][lIIlIIIlIIlIlIIIlllII[#("YCM2")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Bd")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8uL")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("HDLt")]];end;elseif llIIllllIlIIllIIl<=#("MDYHMsx4rODPaVKdseP9CjrH8fi")then if llIIllllIlIIllIIl<=#("fI5kX5fgN4ELNut0dnUAoGaQE")then if llIIllllIlIIllIIl>#{{966;720;302;371};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{445;713;976;818};{715;192;918;991};{760;91;382;812};"1 + 1 = 111";{607;194;934;838};{456;681;36;153};{554;771;130;634};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{731;685;90;726};"1 + 1 = 111";"1 + 1 = 111";{876;933;455;510};"1 + 1 = 111";}then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("cS")]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII+1])else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7u")]]=(not IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]);end;elseif llIIllllIlIIllIIl==#("VuSNJIpQVeN5xx7AhFLhUvPUVg")then local llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("yB")];local IlIlIIllIlII={};for lIIlIIIlIIlIlIIIlllII=1,#lIIlIlIIIIlIllIl do local lIIlIIIlIIlIlIIIlllII=lIIlIlIIIIlIllIl[lIIlIIIlIIlIlIIIlllII];for IllIIIlllIIIllIII=0,#lIIlIIIlIIlIlIIIlllII do local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[IllIIIlllIIIllIII];local IlIllIIIIll=IllIIIlllIIIllIII[1];local lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII[2];if IlIllIIIIll==IIlIIIllIIlIIIlllI and lIIlIIIlIIlIlIIIlllII>=llIIllllIlIIllIIl then IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII];IllIIIlllIIIllIII[1]=IlIlIIllIlII;end;end;end;else IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Rlr")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EU")]];end;elseif llIIllllIlIIllIIl<=#("fzPTMTWXlC2qkDMgacJdcNPoMptUA")then if llIIllllIlIIllIIl>#("82D6jrgublLJV7ooAOioOSldKCUA")then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kd")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("09u")]][lIIlIIIlIIlIlIIIlllII[#("0YzM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XW")]]=lIIlIIIlIIlIlIIIlllII[#("8oR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ve")]]=lIIlIIIlIIlIlIIIlllII[#("c4X")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6g")]]=lIIlIIIlIIlIlIIIlllII[#("HWo")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("tx")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("IE3")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Hu")]][lIIlIIIlIIlIlIIIlllII[#("9JU")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{16;42;561;442};"1 + 1 = 111";"1 + 1 = 111";{581;83;959;683};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JH")]][lIIlIIIlIIlIlIIIlllII[#("oLJ")]]=lIIlIIIlIIlIlIIIlllII[#("8T4v")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oC")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZIS")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{831;452;269;336};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("7g")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SHH")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#("zLPZ")]];else if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lf")]]~=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zBGB")]])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("zPB")];end;end;elseif llIIllllIlIIllIIl>#("xzcyFEaYosu9PaxCD1R9yZQMkbqQzv")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Df")]]=(lIIlIIIlIIlIlIIIlllII[#("WzW")]~=0);else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9L")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{514;796;277;961};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("MLU3")]];end;elseif llIIllllIlIIllIIl<=#("HQnPWIkqEoAkuXo9RYLgKcBTHTBnEnuz2LXtBvL4rLnV7Pu")then if llIIllllIlIIllIIl<=#("5cJ1YphFpFhch7Xp3brTa5IunQY8ZQV2yMrBODK")then if llIIllllIlIIllIIl<=#("Dsd6oIXuY716xLY9FnNhCiPKTpOFQvMACPq")then if llIIllllIlIIllIIl<=#("1MgP3Ek1YZFXYr6A0CluNEm84rODvBESu")then if llIIllllIlIIllIIl==#("h3h8n88YV4V1QyAlK9E5eyzhVMZSGxuW")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YN")]]={};else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ee")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("gbs")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yg")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sI9")]][lIIlIIIlIIlIlIIIlllII[#("1y95")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EN")]]=lIIlIIIlIIlIlIIIlllII[#("pHM")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("h0")]]=lIIlIIIlIIlIlIIIlllII[#("PdP")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("n4")]]=lIIlIIIlIIlIlIIIlllII[#("lsa")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("05")]]=lIIlIIIlIIlIlIIIlllII[#("pz3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("DZ")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("d77")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kk")]][lIIlIIIlIIlIlIIIlllII[#("WQq")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nLFS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3D")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("f5H")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oFl")]][lIIlIIIlIIlIlIIIlllII[#("fIpY")]];end;elseif llIIllllIlIIllIIl==#("Rjds1nmvYSrncLqcj0FozcUE9mMiqsyJ8A")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CT")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("HpK")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Se")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ddp")]][lIIlIIIlIIlIlIIIlllII[#("M1AO")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZB")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ur2")]][lIIlIIIlIIlIlIIIlllII[#("ojJl")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rE")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1Gy")]][lIIlIIIlIIlIlIIIlllII[#("B67a")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jd")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hAk")]][lIIlIIIlIIlIlIIIlllII[#("y8bB")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Sp")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("KAF")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Hi")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pps")]][lIIlIIIlIIlIlIIIlllII[#("74QH")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vv")]]=lIIlIIIlIIlIlIIIlllII[#("H0p")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yt")]]=lIIlIIIlIIlIlIIIlllII[#("h0C")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("a4")]]=lIIlIIIlIIlIlIIIlllII[#{{939;530;705;217};{32;123;361;675};{826;772;571;436};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Kp")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{{945;65;359;224};"1 + 1 = 111";{600;600;231;827};}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nP")]][lIIlIIIlIIlIlIIIlllII[#("XcF")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xg7p")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zF")]][lIIlIIIlIIlIlIIIlllII[#("HYQ")]]=lIIlIIIlIIlIlIIIlllII[#("0kRt")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ub")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("u0L")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qk")]][lIIlIIIlIIlIlIIIlllII[#("UaM")]]=lIIlIIIlIIlIlIIIlllII[#{{713;175;249;243};"1 + 1 = 111";{572;48;425;94};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lb")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("UHl")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Tl")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("blg")]][lIIlIIIlIIlIlIIIlllII[#("SYXp")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];if IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0Q")]]then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#{{689;420;829;534};"1 + 1 = 111";{716;931;680;330};}];end;end;elseif llIIllllIlIIllIIl<=#("ov2SVqKpPg4TaIPvH0IcPzJtPMefGuSpMMcRr")then if llIIllllIlIIllIIl>#("U8ZXfxeELKL71TBxtZXJdimETuyOgyG8dzfK")then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gg")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("rNFz")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("43")]]=lIIlIIIlIIlIlIIIlllII[#("K9X")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JY")]]=lIIlIIIlIIlIlIIIlllII[#("UTm")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RS")]]=lIIlIIIlIIlIlIIIlllII[#("jAv")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("k6")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("oup")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("is")]][lIIlIIIlIIlIlIIIlllII[#("Acp")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hHZN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uX")]][lIIlIIIlIIlIlIIIlllII[#("e6E")]]=lIIlIIIlIIlIlIIIlllII[#("Sl3m")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5EF")]][lIIlIIIlIIlIlIIIlllII[#("ils1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("BN")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5Ko")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#("ppO5")]];else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Wr")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("nqI")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("BT")]][lIIlIIIlIIlIlIIIlllII[#("myd")]]=lIIlIIIlIIlIlIIIlllII[#("l1KU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fg")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{14;543;434;382};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("igAr")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TE")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Z0W")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ek")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ieQ")]][lIIlIIIlIIlIlIIIlllII[#("kLJd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9K")]]=lIIlIIIlIIlIlIIIlllII[#("4Cp")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ia")]]=lIIlIIIlIIlIlIIIlllII[#("Glr")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{625;905;909;371};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("ncX")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("DG")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("llc")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("e6")]][lIIlIIIlIIlIlIIIlllII[#("WEM")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("svej")]];end;elseif llIIllllIlIIllIIl>#("2tmolaEFJD9Zosm3TeLWvdV8BxmeN3DN0kCFKt")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#{{598;341;379;655};"1 + 1 = 111";{359;998;586;307};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("DW")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("l2V")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xq")]][lIIlIIIlIIlIlIIIlllII[#{{704;657;853;494};{530;23;860;391};{11;155;470;768};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Js4W")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nf")]][lIIlIIIlIIlIlIIIlllII[#("4Qq")]]=lIIlIIIlIIlIlIIIlllII[#("GG6B")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zz")]][lIIlIIIlIIlIlIIIlllII[#("b4o")]]=lIIlIIIlIIlIlIIIlllII[#("b9J0")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jp")]][lIIlIIIlIIlIlIIIlllII[#{{101;558;199;164};{186;581;32;463};{153;86;849;821};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{966;164;850;196};{310;22;20;920};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4k")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("PkA")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Sr")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XY6")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{623;764;574;522};"1 + 1 = 111";{326;646;880;225};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("md")]]=lIIlIIIlIIlIlIIIlllII[#("DPJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("07")]]=lIIlIIIlIIlIlIIIlllII[#("LNC")];else if not IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Sa")]]then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("AmK")];end;end;elseif llIIllllIlIIllIIl<=#("iS9k1zZ1fteutFY1YJnYYXA1Pav8e0StzmCdx33JLGh")then if llIIllllIlIIllIIl<=#("IIiictO6xFdushF1d0WoLV5hcVE5POmsQPtg1m6Vm")then if llIIllllIlIIllIIl>#("64ihUpycFVT2jXMbfrZTqSrUPOYya04bcZYb85ao")then if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JH")]]==IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("INpP")]])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("b7P")];end;else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("4r6")]];end;elseif llIIllllIlIIllIIl>#("NiCKXFGEZhO5EFnMyDfC9bP0R0t8LcjqLlNK0k1ir3")then local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ql")]]=(not IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pK5")]]);IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("CJ6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EG")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("q3")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dt")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zxx")]][lIIlIIIlIIlIlIIIlllII[#("4lEI")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pk")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hLj")]][lIIlIIIlIIlIlIIIlllII[#("37Yn")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EE")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("DLL")]][lIIlIIIlIIlIlIIIlllII[#("Nk9s")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Op")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mup")]][lIIlIIIlIIlIlIIIlllII[#("kbSc")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("06")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("F5T")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("xq5j")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("V4")]]=lIIlIIIlIIlIlIIIlllII[#("2ez")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Tvn")]))else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YZ")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{{517;263;927;434};"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif llIIllllIlIIllIIl<=#("TqgJtLAKD4XILEM37lH3X8xur2OWnL7jf15KLq9ylCRvY")then if llIIllllIlIIllIIl>#("bfoq37UayV3VqC6Nv17NCUIbsQljSuqaHO0II7S9zeEk")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nn")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5RM")]][lIIlIIIlIIlIlIIIlllII[#("XR1r")]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mo")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("KAx")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hIA")]][lIIlIIIlIIlIlIIIlllII[#("3pr5")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("FW")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9ca")]][lIIlIIIlIIlIlIIIlllII[#{{308;266;247;92};"1 + 1 = 111";{360;168;105;366};{437;73;11;178};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6C")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("tnH")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ze")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yWa")]][lIIlIIIlIIlIlIIIlllII[#("sh1l")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{624;320;373;929};{156;172;225;327};}]]=lIIlIIIlIIlIlIIIlllII[#("8EG")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Q0")]]=lIIlIIIlIIlIlIIIlllII[#("xhR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("aS")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{905;399;20;41};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("1M")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("SLi")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tp")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AWr3")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Oc")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("OU3")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wr")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vhS")]][lIIlIIIlIIlIlIIIlllII[#("G4nS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A7")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2O5")]][lIIlIIIlIIlIlIIIlllII[#("NquV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Iu")]][lIIlIIIlIIlIlIIIlllII[#("R1Q")]]=lIIlIIIlIIlIlIIIlllII[#("lfHn")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OZ")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#{{966;594;32;532};"1 + 1 = 111";{226;54;57;683};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("np")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1xp")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{600;119;336;349};{926;398;959;306};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xa")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eFy")]][lIIlIIIlIIlIlIIIlllII[#("Pa15")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rH")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("fD9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Um")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yQh")]][lIIlIIIlIIlIlIIIlllII[#("oATW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kZ")]]=lIIlIIIlIIlIlIIIlllII[#("KYA")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Hl")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jr")]][lIIlIIIlIIlIlIIIlllII[#("znj")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bA77")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3M")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("xYY")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yy")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4cj")]][lIIlIIIlIIlIlIIIlllII[#("8bJX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bi")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CzD")]][lIIlIIIlIIlIlIIIlllII[#("JkpP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fv")]][lIIlIIIlIIlIlIIIlllII[#("FmN")]]=lIIlIIIlIIlIlIIIlllII[#("mLNh")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iN")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("T9y")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CH")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("P7W")]][lIIlIIIlIIlIlIIIlllII[#("HTdL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ux")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{85;981;695;785};"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("Fdsd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Jc")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{576;833;590;846};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("nHJz")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;end;elseif llIIllllIlIIllIIl>#("ZaIBIfZzklrIm8mVLscE2oNMzfzi7nxpxuDQOSjoCMvCIa")then IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("nFu")];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{303;900;182;628};"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("RGY")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ViJU")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9b")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{814;891;444;568};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ME")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("m0T")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{165;15;93;410};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cu")]]=lIIlIIIlIIlIlIIIlllII[#("kKF")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("z8")]]=lIIlIIIlIIlIlIIIlllII[#("0Uf")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Cp")]]=lIIlIIIlIIlIlIIIlllII[#("cXi")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1P")]]=lIIlIIIlIIlIlIIIlllII[#("IdT")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Nc")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Y0d")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8e")]][lIIlIIIlIIlIlIIIlllII[#("1yi")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EUm9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sZ")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("luh")]];end;elseif llIIllllIlIIllIIl<=#("8GoYWCRYKy6cCQQB6Zck1GGh2iXbp2ldyVBNTzLYQG2sSQSIVlzMG0E")then if llIIllllIlIIllIIl<=#("9g6NOPISm2PRpcRHonFuNnAlBpqeDJHHq8OND7ja7kgZbasSE2y")then if llIIllllIlIIllIIl<=#("vi0VRUmzzEoNuhArzeerdExChKkA6ILLkplii35SUVLE6DE4L")then if llIIllllIlIIllIIl==#{"1 + 1 = 111";"1 + 1 = 111";{934;747;288;53};{998;735;645;898};"1 + 1 = 111";{710;207;192;976};{847;160;281;839};"1 + 1 = 111";"1 + 1 = 111";{103;137;697;103};"1 + 1 = 111";{666;353;272;2};"1 + 1 = 111";{160;423;325;990};{347;144;711;779};"1 + 1 = 111";"1 + 1 = 111";{963;77;965;206};{45;895;132;755};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{822;421;241;388};{265;560;808;595};"1 + 1 = 111";"1 + 1 = 111";{534;554;68;314};"1 + 1 = 111";{90;222;83;173};{397;521;23;484};"1 + 1 = 111";"1 + 1 = 111";{58;512;536;615};{516;758;975;901};{168;754;154;720};"1 + 1 = 111";"1 + 1 = 111";{342;278;404;568};"1 + 1 = 111";{673;331;222;437};"1 + 1 = 111";{622;156;290;646};"1 + 1 = 111";{526;131;10;909};}then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4t")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("BXY")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Rf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Tg5")]][lIIlIIIlIIlIlIIIlllII[#("OWMW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Jc")]]=lIIlIIIlIIlIlIIIlllII[#("nkX")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xD")]]=lIIlIIIlIIlIlIIIlllII[#("z5n")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vf")]]=lIIlIIIlIIlIlIIIlllII[#("yxF")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Tc")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("tXk")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("M3")]][lIIlIIIlIIlIlIIIlllII[#("XTG")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rxxt")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gS")]][lIIlIIIlIIlIlIIIlllII[#("Bro")]]=lIIlIIIlIIlIlIIIlllII[#("5TG2")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pg")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("ME8")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6a")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9oS")]][lIIlIIIlIIlIlIIIlllII[#("bM1F")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ft")]]=lIIlIIIlIIlIlIIIlllII[#("igG")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Mh")]]=lIIlIIIlIIlIlIIIlllII[#("cKK")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{662;311;224;93};{3;520;956;73};}]]=lIIlIIIlIIlIlIIIlllII[#("joZ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("E2")]]=lIIlIIIlIIlIlIIIlllII[#("Z2q")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("rF")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("MCg")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7q")]][lIIlIIIlIIlIlIIIlllII[#("Lhl")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eb2b")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3p")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("6r0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{935;330;120;180};{974;769;353;868};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("784")]][lIIlIIIlIIlIlIIIlllII[#("mDp1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YY")]]=lIIlIIIlIIlIlIIIlllII[#("Oeg")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mC")]]=lIIlIIIlIIlIlIIIlllII[#("rHt")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5N")]]=lIIlIIIlIIlIlIIIlllII[#("iKO")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{702;975;825;716};}]]=lIIlIIIlIIlIlIIIlllII[#("CAP")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("nU")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("muN")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qQ")]][lIIlIIIlIIlIlIIIlllII[#("iTZ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("V0sL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Oh")]][lIIlIIIlIIlIlIIIlllII[#{{457;104;884;224};"1 + 1 = 111";{582;892;13;988};}]]=lIIlIIIlIIlIlIIIlllII[#("C5WJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{146;802;960;771};{520;102;85;251};}]][lIIlIIIlIIlIlIIIlllII[#("TP8")]]=lIIlIIIlIIlIlIIIlllII[#("zVpW")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lr")]][lIIlIIIlIIlIlIIIlllII[#("uQj")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("MYyK")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qc")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Vdv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3y")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{277;647;812;493};{495;262;485;942};}]][lIIlIIIlIIlIlIIIlllII[#("23SZ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SX")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{278;640;776;479};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A0")]]=lIIlIIIlIIlIlIIIlllII[#("MgS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4J")]]=lIIlIIIlIIlIlIIIlllII[#("vx9")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("kg")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("ofr")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dU")]][lIIlIIIlIIlIlIIIlllII[#("ZID")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("M3Ki")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8N")]][lIIlIIIlIIlIlIIIlllII[#("MC1")]]=lIIlIIIlIIlIlIIIlllII[#("ZgGj")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RC")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("p58")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("64")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9Hz")]][lIIlIIIlIIlIlIIIlllII[#("eB4M")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zb")]]=lIIlIIIlIIlIlIIIlllII[#("2ZH")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iP")]]=lIIlIIIlIIlIlIIIlllII[#("gki")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qq")]]=lIIlIIIlIIlIlIIIlllII[#("7u0")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("FF")]]=lIIlIIIlIIlIlIIIlllII[#("QoF")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("O1")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("WNp")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eT")]][lIIlIIIlIIlIlIIIlllII[#("Axz")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fZrM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UT")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{322;670;522;198};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("sVg0")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Jh")]][lIIlIIIlIIlIlIIIlllII[#("iJO")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{277;512;879;972};{134;162;709;475};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sr")]][lIIlIIIlIIlIlIIIlllII[#("8Uc")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2iDn")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lm")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("IxL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fW")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A0G")]][lIIlIIIlIIlIlIIIlllII[#("IvO6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ua")]]=lIIlIIIlIIlIlIIIlllII[#("M3f")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fV")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Q3")]]=lIIlIIIlIIlIlIIIlllII[#("rZZ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("jI")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("AGV")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Kt")]][lIIlIIIlIIlIlIIIlllII[#("4BF")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{792;453;191;611};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UM")]][lIIlIIIlIIlIlIIIlllII[#("Rb9")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{941;96;22;532};{38;919;228;297};{645;178;269;422};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9l")]][lIIlIIIlIIlIlIIIlllII[#("leh")]]=lIIlIIIlIIlIlIIIlllII[#("cLfe")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qZ")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("cLj")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("N0")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1iz")]][lIIlIIIlIIlIlIIIlllII[#{{236;438;681;385};{104;995;418;585};{994;557;333;954};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jf")]]=lIIlIIIlIIlIlIIIlllII[#("Mpr")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("lsG")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("et")]]=lIIlIIIlIIlIlIIIlllII[#("5Ia")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("a9")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{202;975;936;19};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Pe")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("vhJ")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1A")]][lIIlIIIlIIlIlIIIlllII[#("3jZ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UBy1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rS")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("k7s")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PB")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PoO")]][lIIlIIIlIIlIlIIIlllII[#("67R8")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mg")]]=lIIlIIIlIIlIlIIIlllII[#("hGY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Rd")]]=lIIlIIIlIIlIlIIIlllII[#("jPm")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5D")]]=lIIlIIIlIIlIlIIIlllII[#("F0a")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HG")]]=lIIlIIIlIIlIlIIIlllII[#("efY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("WM")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("1ko")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GG")]][lIIlIIIlIIlIlIIIlllII[#("JYx")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UlvJ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{296;273;631;527};{52;311;285;9};}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("A7P")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ut")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("90E")]][lIIlIIIlIIlIlIIIlllII[#("dOIV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uA")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3S4")]][lIIlIIIlIIlIlIIIlllII[#("Fu1G")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tu")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{308;634;275;959};{964;165;269;165};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qczi")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zF")]][lIIlIIIlIIlIlIIIlllII[#("5kf")]]=lIIlIIIlIIlIlIIIlllII[#("VMGR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Fu")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jx")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{233;884;20;799};}]][lIIlIIIlIIlIlIIIlllII[#("12pn")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Pf")]]=lIIlIIIlIIlIlIIIlllII[#("a4T")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ch")]]=lIIlIIIlIIlIlIIIlllII[#("ivo")];else local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("97z")]][lIIlIIIlIIlIlIIIlllII[#("nmWK")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("BW")]]=lIIlIIIlIIlIlIIIlllII[#("xtU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7U")]]=lIIlIIIlIIlIlIIIlllII[#("kTD")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6D")]]=lIIlIIIlIIlIlIIIlllII[#("uHX")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("Cx")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("Tts")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("WM")]][lIIlIIIlIIlIlIIIlllII[#("RLf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0oHM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wi")]][lIIlIIIlIIlIlIIIlllII[#("a9Q")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{440;909;601;575};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9M6")]][lIIlIIIlIIlIlIIIlllII[#("zK1M")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("0v")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{235;284;497;886};"1 + 1 = 111";{918;830;540;673};}]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#{{128;323;353;479};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif llIIllllIlIIllIIl==#("tay8t1YqCJ59228as8HMQZydL3zptmK9hqlOSsFdB5vFguF1rZ")then local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("Vo")]local IlIllIIIIll={IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII+1])};local IlIlIIllIlII=0;for lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII,lIIlIIIlIIlIlIIIlllII[#("hPPo")]do IlIlIIllIlII=IlIlIIllIlII+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IlIllIIIIll[IlIlIIllIlII];end else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gR")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("WAQ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Js")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A33")]][lIIlIIIlIIlIlIIIlllII[#("lzuL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("L3")]]=lIIlIIIlIIlIlIIIlllII[#("9di")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("6C")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6I")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("hvK")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HR")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("c9F")]][lIIlIIIlIIlIlIIIlllII[#("sJqN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{241;134;249;678};}]]=lIIlIIIlIIlIlIIIlllII[#("22P")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("zq")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("I3")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("OWx")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HL")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("WB7")]][lIIlIIIlIIlIlIIIlllII[#("cFWg")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cm")]]=lIIlIIIlIIlIlIIIlllII[#("ZZL")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("e0")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("J3")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("OFZ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RPH")]][lIIlIIIlIIlIlIIIlllII[#("GOo7")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("K0")]]=lIIlIIIlIIlIlIIIlllII[#("0m1")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("pm")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zs")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("bh9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ji")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("itf")]][lIIlIIIlIIlIlIIIlllII[#("qaNj")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jS")]]=lIIlIIIlIIlIlIIIlllII[#("Vrj")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("nb")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Fd")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("GuN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("h3")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fBO")]][lIIlIIIlIIlIlIIIlllII[#("OOJg")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("p2")]]=lIIlIIIlIIlIlIIIlllII[#("Uql")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("h7")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6q")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("jRR")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VY")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uRH")]][lIIlIIIlIIlIlIIIlllII[#("lKsa")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rr")]]=lIIlIIIlIIlIlIIIlllII[#("4TI")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("fi")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("V3")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("BhJ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{291;834;946;417};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("URI")]][lIIlIIIlIIlIlIIIlllII[#("X4yP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tu")]]=lIIlIIIlIIlIlIIIlllII[#("ulr")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("O0")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AC")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("c71")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ba")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IK3")]][lIIlIIIlIIlIlIIIlllII[#("0son")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ar")]]=lIIlIIIlIIlIlIIIlllII[#("6BQ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("1m")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nz")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("N3J")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("a6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{221;504;914;866};{336;870;223;90};{579;97;537;590};}]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{779;426;192;809};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Tz")]]=lIIlIIIlIIlIlIIIlllII[#("W7h")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("ax")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{522;876;532;436};}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("1iH")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("KX")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{657;339;462;420};{381;381;621;923};"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("DBRu")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5r")]]=lIIlIIIlIIlIlIIIlllII[#("ztk")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Mu")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("F0")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("0h4")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZXT")]][lIIlIIIlIIlIlIIIlllII[#("kVkt")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("63")]]=lIIlIIIlIIlIlIIIlllII[#("Ch2")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("lH")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ot")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("iFL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("i5")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CFK")]][lIIlIIIlIIlIlIIIlllII[#("O9j2")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lA")]]=lIIlIIIlIIlIlIIIlllII[#{{861;380;40;3};{306;159;401;376};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{{195;250;417;558};"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xA")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("c1b")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("T6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nRc")]][lIIlIIIlIIlIlIIIlllII[#("CmWq")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Aa")]]=lIIlIIIlIIlIlIIIlllII[#("Tlm")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Xz7")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("de")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oiH")]][lIIlIIIlIIlIlIIIlllII[#("LqJH")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ta")]]=lIIlIIIlIIlIlIIIlllII[#("pQ3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Cv")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nX")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("oLG")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9B")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TfI")]][lIIlIIIlIIlIlIIIlllII[#{{118;800;218;970};{342;118;189;580};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qJ")]]=lIIlIIIlIIlIlIIIlllII[#("KEr")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("v8")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xn")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("WNW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("WV")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fKh")]][lIIlIIIlIIlIlIIIlllII[#("1m6j")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("BR")]]=lIIlIIIlIIlIlIIIlllII[#("r7Z")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("tP")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ih")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{38;426;706;510};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("LM")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uXk")]][lIIlIIIlIIlIlIIIlllII[#("U37Q")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("x4")]]=lIIlIIIlIIlIlIIIlllII[#("7X1")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{{738;865;560;115};"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IA")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("khK")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jp")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ood")]][lIIlIIIlIIlIlIIIlllII[#("cTdR")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Eh")]][lIIlIIIlIIlIlIIIlllII[#("h9n")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0ix9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OR")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("vXP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HI")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("I66")]][lIIlIIIlIIlIlIIIlllII[#("kak1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cb")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("WDy")]][lIIlIIIlIIlIlIIIlllII[#("m1jq")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("P4")]][lIIlIIIlIIlIlIIIlllII[#("p0N")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zucC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("X1")]][lIIlIIIlIIlIlIIIlllII[#("t5a")]]=lIIlIIIlIIlIlIIIlllII[#("BdaK")];end;elseif llIIllllIlIIllIIl<=#("8Wi5ENuxADI6o851MQtraDDlVD27qzI8FvMm9vRby5eL28hHlD3k7")then if llIIllllIlIIllIIl>#("0Ft6jbUxfb4JC3xS2q9r4ez1sXvvWXFxa7Fg3dlQraZcQtGojDLN")then if IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JQ")]]then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("VjJ")];end;else local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("y8")]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII+1,llIIIIlI))end;elseif llIIllllIlIIllIIl>#("QNWgCNxQyLsHIIFypZZesa3ovk9qglsl1kuuTaBAY93zHGiVb03NWI")then local lIIlIlIIIIlIllIl;local lIlIIlIlIIlIlIlI,llIllIlIlIIlIlllllIIlI;local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]={};IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yn")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("9Fs")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6q")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{761;496;727;174};"1 + 1 = 111";{922;260;978;267};}]][lIIlIIIlIIlIlIIIlllII[#("JofL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1Z")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xnu")]][lIIlIIIlIIlIlIIIlllII[#("2m1T")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kE")]][lIIlIIIlIIlIlIIIlllII[#("iEY")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZzAJ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Fd")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{{512;362;621;151};"1 + 1 = 111";{447;44;468;387};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{320;457;506;818};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UBx")]][lIIlIIIlIIlIlIIIlllII[#("0beY")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zv")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Mq9")]][lIIlIIIlIIlIlIIIlllII[#{{31;960;303;528};{879;881;505;684};{795;984;98;285};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("aU")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9o0")]][lIIlIIIlIIlIlIIIlllII[#("RQML")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qK")]][lIIlIIIlIIlIlIIIlllII[#("oRQ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XiWH")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9g")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{456;216;815;354};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("tc")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("H0W")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#{{917;435;774;786};{675;732;941;272};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iT")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{512;689;47;94};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("4g")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("g9h")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nX")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("s1n")]][lIIlIIIlIIlIlIIIlllII[#("99Ad")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hFB")]][lIIlIIIlIIlIlIIIlllII[#("a4EU")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("3e")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GTI")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("z8mF")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3z")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("yit")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ll")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YUx")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{{162;900;916;202};{822;458;338;410};}]lIlIIlIlIIlIlIlI,llIllIlIlIIlIlllllIIlI=IllIIlIlII(IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]))llIIIIlI=llIllIlIlIIlIlllllIIlI+llIIllllIlIIllIIl-1 lIIlIlIIIIlIllIl=0;for lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl,llIIIIlI do lIIlIlIIIIlIllIl=lIIlIlIIIIlIllIl+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=lIlIIlIlIIlIlIlI[lIIlIlIIIIlIllIl];end;IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("WP")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,llIIIIlI))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("12")]]={};end;elseif llIIllllIlIIllIIl<=#("QTHUrOfJmrgPxmjOpzzpsgFS0cnoqsQztrPLmpjWSBRgA0VI1lOoyrKJoY4")then if llIIllllIlIIllIIl<=#("A1s4MRvfIIC9oNI2Ays9rQxeOBbbSgxyv4x1iXFSFQatTO9UUSj1G47UE")then if llIIllllIlIIllIIl>#("pkQuxBleNuqQUN3KFMPduaCqqa7G2C7Ny4HtcjsJhPaPEe8G75AveA2p")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A1")]]=(not IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lKk")]]);else local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("fv")]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII+1,llIIIIlI))end;elseif llIIllllIlIIllIIl>#("zdxEQmlxOrZfKIusg6P9WXmcBI6bMI8brKOg5eCDYs0WiAyyfc8Enp6L1u")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Te")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Pvs")]][lIIlIIIlIIlIlIIIlllII[#("ZIWv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hl")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Njf")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HB")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{705;709;783;886};{989;516;566;911};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ky")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Eh6")]][lIIlIIIlIIlIlIIIlllII[#("QN3I")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7g")]]=lIIlIIIlIIlIlIIIlllII[#("CVU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Di")]]=lIIlIIIlIIlIlIIIlllII[#("rOO")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uc")]]=lIIlIIIlIIlIlIIIlllII[#("Vmb")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("1i")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Mk8")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ex")]][lIIlIIIlIIlIlIIIlllII[#("Qt3")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5D6t")]];else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("uj")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("m3a")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6X")]][lIIlIIIlIIlIlIIIlllII[#("OHa")]]=lIIlIIIlIIlIlIIIlllII[#{{66;960;653;648};"1 + 1 = 111";"1 + 1 = 111";{113;571;846;765};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rj")]][lIIlIIIlIIlIlIIIlllII[#("o68")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wl1u")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Bd")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("YnF")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZvM")]][lIIlIIIlIIlIlIIIlllII[#("Y6q7")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uL")]]=lIIlIIIlIIlIlIIIlllII[#{{932;772;90;88};{813;965;622;122};{814;731;397;287};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("k3")]]=lIIlIIIlIIlIlIIIlllII[#("iTy")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("b6")]]=lIIlIIIlIIlIlIIIlllII[#("RkR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("KV")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("nj6")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A2")]][lIIlIIIlIIlIlIIIlllII[#("Uzk")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yinf")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wd")]][lIIlIIIlIIlIlIIIlllII[#("N6i")]]=lIIlIIIlIIlIlIIIlllII[#("zTcN")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nl")]][lIIlIIIlIIlIlIIIlllII[#("nuI")]]=lIIlIIIlIIlIlIIIlllII[#("xb68")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vo")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("PI3")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XQ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R2e")]][lIIlIIIlIIlIlIIIlllII[#("6b2A")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yc")]]=lIIlIIIlIIlIlIIIlllII[#("hKn")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{965;369;501;339};{385;409;938;397};}]]=lIIlIIIlIIlIlIIIlllII[#("jeb")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IG")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{537;545;749;378};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("j4")]]=lIIlIIIlIIlIlIIIlllII[#("r6Q")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("jt")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("l1y")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dx")]][lIIlIIIlIIlIlIIIlllII[#("X7m")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("G4af")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{66;991;854;532};}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("l8q")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yO")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rvD")]][lIIlIIIlIIlIlIIIlllII[#("9U5A")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{45;482;186;319};}]]=lIIlIIIlIIlIlIIIlllII[#("ePC")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("f9")]]=lIIlIIIlIIlIlIIIlllII[#("kpL")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ry")]]=lIIlIIIlIIlIlIIIlllII[#("5fJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YO")]]=lIIlIIIlIIlIlIIIlllII[#("03h")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("NT")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("1Ci")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("11")]][lIIlIIIlIIlIlIIIlllII[#("FuE")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Uv6v")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AN")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("xAT")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vD")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("X1V")]][lIIlIIIlIIlIlIIIlllII[#("Xo1c")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ds")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vjK")]][lIIlIIIlIIlIlIIIlllII[#("jqa5")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Hy")]][lIIlIIIlIIlIlIIIlllII[#("FFq")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Up2a")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Qa")]][lIIlIIIlIIlIlIIIlllII[#("pZZ")]]=lIIlIIIlIIlIlIIIlllII[#{{219;837;851;414};{75;580;655;927};{403;652;596;444};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eP")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("yW7")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{157;824;75;380};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1Ir")]][lIIlIIIlIIlIlIIIlllII[#("EhiZ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kC")]]=lIIlIIIlIIlIlIIIlllII[#("nM0")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ov")]]=lIIlIIIlIIlIlIIIlllII[#("kqY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sA")]]=lIIlIIIlIIlIlIIIlllII[#("HAV")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("kI")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{696;500;156;373};{157;132;145;275};}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{352;305;205;245};{537;448;507;619};}]][lIIlIIIlIIlIlIIIlllII[#("sFo")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OYNb")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{253;617;722;970};{193;658;867;130};}]][lIIlIIIlIIlIlIIIlllII[#("lnL")]]=lIIlIIIlIIlIlIIIlllII[#("bfKL")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Gc")]][lIIlIIIlIIlIlIIIlllII[#("FXW")]]=lIIlIIIlIIlIlIIIlllII[#("SkZU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ej")]][lIIlIIIlIIlIlIIIlllII[#("CBt")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("p3em")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("K6Q")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GJ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sZC")]][lIIlIIIlIIlIlIIIlllII[#("U24z")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{553;639;261;278};{845;63;321;809};}]]=lIIlIIIlIIlIlIIIlllII[#("RGz")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zo")]]=lIIlIIIlIIlIlIIIlllII[#("eVx")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ng")]]=lIIlIIIlIIlIlIIIlllII[#("Sp9")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("mU")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("s6N")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nx")]][lIIlIIIlIIlIlIIIlllII[#("bkp")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QFQQ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XV")]][lIIlIIIlIIlIlIIIlllII[#("Ems")]]=lIIlIIIlIIlIlIIIlllII[#("PfcU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#{{896;641;158;919};"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{705;725;234;604};{858;335;773;782};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UI")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("auy")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0Q")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dbO")]][lIIlIIIlIIlIlIIIlllII[#("PPqD")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GZ")]]=lIIlIIIlIIlIlIIIlllII[#("YVK")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bX")]]=lIIlIIIlIIlIlIIIlllII[#("Af2")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ky")]]=lIIlIIIlIIlIlIIIlllII[#("C76")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Mf")]]=lIIlIIIlIIlIlIIIlllII[#("sQS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("0n")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("KeT")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nt")]][lIIlIIIlIIlIlIIIlllII[#("ntT")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("MogS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yq")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("r9R")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kN")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2Fs")]][lIIlIIIlIIlIlIIIlllII[#("Ld5s")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Mi")]]=lIIlIIIlIIlIlIIIlllII[#("r7l")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pd")]]=lIIlIIIlIIlIlIIIlllII[#("LG7")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("89")]]=lIIlIIIlIIlIlIIIlllII[#("ugN")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2h")]]=lIIlIIIlIIlIlIIIlllII[#("I0f")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("3k")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Np3")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bO")]][lIIlIIIlIIlIlIIIlllII[#("sjD")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("W3nm")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dk")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("caC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sH")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yGt")]][lIIlIIIlIIlIlIIIlllII[#("Hz4R")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eG")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OPv")]][lIIlIIIlIIlIlIIIlllII[#("MhfR")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ic")]][lIIlIIIlIIlIlIIIlllII[#("ECI")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("M3pv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Fu")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("eLCg")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1A")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("QJb")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Gu")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3xU")]][lIIlIIIlIIlIlIIIlllII[#("By8o")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GO")]]=lIIlIIIlIIlIlIIIlllII[#("Mt9")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("j7")]]=lIIlIIIlIIlIlIIIlllII[#("ERn")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Dt")]]=lIIlIIIlIIlIlIIIlllII[#("eHa")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("uW")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("WRF")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yh")]][lIIlIIIlIIlIlIIIlllII[#("FUZ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("MkTl")]];end;elseif llIIllllIlIIllIIl<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{852;186;288;292};{970;933;532;263};"1 + 1 = 111";{766;132;186;703};{170;552;648;886};{199;512;202;638};{737;59;470;403};"1 + 1 = 111";"1 + 1 = 111";{277;173;816;354};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{841;639;69;766};"1 + 1 = 111";{431;436;38;80};{235;14;346;621};"1 + 1 = 111";"1 + 1 = 111";{139;36;18;187};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{834;137;576;494};{404;240;602;850};"1 + 1 = 111";{813;612;163;520};"1 + 1 = 111";"1 + 1 = 111";{88;771;903;936};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{983;982;116;673};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{97;949;108;651};"1 + 1 = 111";{683;931;599;40};{339;189;627;932};{961;287;149;274};{560;276;516;346};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{630;308;937;896};{609;276;435;149};{726;905;783;861};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{577;607;512;930};}then if llIIllllIlIIllIIl>#("Wv29Y9k9G6m7IzUff5NFX6lyXh9tGByoMxZdL107YbJGBD4NoMho3ul0jEmQ")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ss")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("SZ2")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vk")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("avZ")]][lIIlIIIlIIlIlIIIlllII[#("DAXz")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("b0")]]=lIIlIIIlIIlIlIIIlllII[#("9aH")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jy")]]=lIIlIIIlIIlIlIIIlllII[#{{403;775;100;710};{349;302;458;551};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fb")]]=lIIlIIIlIIlIlIIIlllII[#("Qn1")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sG")]]=lIIlIIIlIIlIlIIIlllII[#("n7a")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("OI")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("suu")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ii")]][lIIlIIIlIIlIlIIIlllII[#("di6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pUKL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3L")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("HJ4")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eX")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Cah")]][lIIlIIIlIIlIlIIIlllII[#("EizG")]];else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("XQ")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("2UL")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Tj")]][lIIlIIIlIIlIlIIIlllII[#{{61;983;235;967};{933;383;617;5};{460;726;221;855};}]]=lIIlIIIlIIlIlIIIlllII[#("RXJC")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bk")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lCh9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YF")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("2c6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ja")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZrQ")]][lIIlIIIlIIlIlIIIlllII[#("jBQz")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ty")]]=lIIlIIIlIIlIlIIIlllII[#("aZA")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zc")]]=lIIlIIIlIIlIlIIIlllII[#("dxE")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sk")]]=lIIlIIIlIIlIlIIIlllII[#("XI2")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("5j")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("gU5")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dC")]][lIIlIIIlIIlIlIIIlllII[#("x6K")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Cz4C")]];end;elseif llIIllllIlIIllIIl<=#("0EfJ8vlJQEofPQWyP6tnvf3tiurk93hPk77ID7DhSeIi2inOACEH2COVKWANda")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("u7")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("rqN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{859;407;606;248};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6Qr")]][lIIlIIIlIIlIlIIIlllII[#("lg1c")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Kv")]]=lIIlIIIlIIlIlIIIlllII[#("Mj7")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nq")]]=lIIlIIIlIIlIlIIIlllII[#("uDg")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("j0")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{978;572;942;506};{77;805;257;653};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{50;792;893;784};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("G0q")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("9J")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("sHk")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3P")]][lIIlIIIlIIlIlIIIlllII[#("gDy")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tb0A")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9E")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Sxx")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OY")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mH4")]][lIIlIIIlIIlIlIIIlllII[#("r8CA")]];elseif llIIllllIlIIllIIl>#("WxK5RSn4SElGrHVBagNVHzKWStm7RIZeSEVWsnH6lIWdR6voZuAGBodyWYmyGqm")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{799;353;638;730};{568;526;738;787};}]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("e8K")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("KD")]][lIIlIIIlIIlIlIIIlllII[#("LSu")]]=lIIlIIIlIIlIlIIIlllII[#("YLrS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VC")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("N3i")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1U")]][lIIlIIIlIIlIlIIIlllII[#("56W")]]=lIIlIIIlIIlIlIIIlllII[#{{188;307;321;899};"1 + 1 = 111";{221;832;475;238};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;else local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{24;12;975;460};}]local IlIlIIllIlII,lIIlIIIlIIlIlIIIlllII=IllIIlIlII(IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII+1,lIIlIIIlIIlIlIIIlllII[#("aZK")])))llIIIIlI=lIIlIIIlIIlIlIIIlllII+IllIIIlllIIIllIII-1 local lIIlIIIlIIlIlIIIlllII=0;for IllIIIlllIIIllIII=IllIIIlllIIIllIII,llIIIIlI do lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+1;IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII]=IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII];end;end;elseif llIIllllIlIIllIIl<=#("OhXXV8iXKRK8NHfW78hvhsNDBy9EaiA4uMzJiJD0mN5UPeUpTBAIi1cuEuxx9OWCqPObhGOzFriFx3YxOUVJS2WEJdeXmg1J")then if llIIllllIlIIllIIl<=#("EE9BShmXbd1SH7LH9Tp2nTy3jCdB0myAKP3zY65MIVRZ5WbfEqmyMRMVfgqqeW7ZPBi1elTdXNtCcI8x")then if llIIllllIlIIllIIl<=#("87K9aX3dhtSPPHWY1kEOkbrIiK8xkTHi30gYyZOOpY72ayifHOkyFTp7Pb1BZG3zWJVZB8Bc")then if llIIllllIlIIllIIl<=#("0zvdAHUB2ZGIjOkKjjv8mYT5IgCNtPJmi1Pu43pFg96Rx0M5LorYedtbPAGsfhhnpsAr")then if llIIllllIlIIllIIl<=#("ZPq302m1cJREGbexVieINQFx6A82TBdBu6VKb5nlgjN0YZJfd1FkvUvjk37B3uiMGq")then if llIIllllIlIIllIIl==#("JpEuZ42CEcOJh12Y252fLLMzi7XrVaauHQ9ZJGPqDs2gHu0KbHqQOlI8Ofm2gKQDc")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5j")]]=llIllIlIlIIlIlllllIIlI(lIlIIlIlIIlIlIlI[lIIlIIIlIIlIlIIIlllII[#("Fjz")]],nil,IlIllIIIIll);else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Hm")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("WeC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cd")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fxZ")]][lIIlIIIlIIlIlIIIlllII[#("Yeku")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vB")]]=lIIlIIIlIIlIlIIIlllII[#("0NJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rR")]]=lIIlIIIlIIlIlIIIlllII[#("qNm")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("m6")]]=lIIlIIIlIIlIlIIIlllII[#("lHF")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1R")]]=lIIlIIIlIIlIlIIIlllII[#("uV7")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("MJ")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("K5T")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("F6")]][lIIlIIIlIIlIlIIIlllII[#("6F2")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fo7X")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Di")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("KB1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lD")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pxH")]][lIIlIIIlIIlIlIIIlllII[#("K6H0")]];end;elseif llIIllllIlIIllIIl==#("bB1covqLMsSF2YhnqoUuRvhalEtXj2MzenszS8r4AcKppinzU3sCSRMPt11VcDCTQtB")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8e")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("dtV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kg")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yok")]][lIIlIIIlIIlIlIIIlllII[#("kLRp")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("p4")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("N9n")]][lIIlIIIlIIlIlIIIlllII[#("k9pW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zn")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OlY")]][lIIlIIIlIIlIlIIIlllII[#("0hly")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{518;582;582;292};{205;420;93;242};"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("3sC2")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XP")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("OD1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EJ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VO8")]][lIIlIIIlIIlIlIIIlllII[#("p0Fk")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("WPu")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7b")]]=lIIlIIIlIIlIlIIIlllII[#("9pi")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XJ")]]=lIIlIIIlIIlIlIIIlllII[#{{329;256;444;900};{747;519;380;663};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("dk")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("VvT")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zs")]][lIIlIIIlIIlIlIIIlllII[#("q3q")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dbOX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Hb")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("M0B")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6L")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9xL")]][lIIlIIIlIIlIlIIIlllII[#{{306;847;169;279};{76;493;280;205};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xX")]]=lIIlIIIlIIlIlIIIlllII[#("DzG")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("up")]]=lIIlIIIlIIlIlIIIlllII[#("qtM")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mQ")]]=lIIlIIIlIIlIlIIIlllII[#("Pz8")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bR")]]=lIIlIIIlIIlIlIIIlllII[#("cXa")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("YF")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("tbA")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Um")]][lIIlIIIlIIlIlIIIlllII[#("T3e")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ALIS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("yKo")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8V")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oVZ")]][lIIlIIIlIIlIlIIIlllII[#("ZZy4")]];end;elseif llIIllllIlIIllIIl<=#("FSFs6Z5OW1Ucq5cqJjQyMOf1hH26L0J6SJ3cyaG3W73CgYFhBkjGNdc1NOkz68d5sXtRba")then if llIIllllIlIIllIIl>#("JOXMOUOVscVGARctPHczUZg6X38jsEXfArL2ZCyg932xlDOnpEPj8LiTI0YUWFCYoQfhg")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{412;281;185;328};{654;490;146;873};}]]=(lIIlIIIlIIlIlIIIlllII[#("OIJ")]~=0);else if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hp")]]~=lIIlIIIlIIlIlIIIlllII[#("7cKf")])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("jNf")];end;end;elseif llIIllllIlIIllIIl==#("Enj6A07UVtpU3ZZOgZj1t9NNuFBdhGxGhe9CackrVXfEFbLM9LJq8o0FLGL5z3Mp6TNZ0yN")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8I")]]=lIIlIIIlIIlIlIIIlllII[#("UWs")];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sg")]]=lIIlIIIlIIlIlIIIlllII[#("51u")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nN")]]=lIIlIIIlIIlIlIIIlllII[#("0ap")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XL")]]=lIIlIIIlIIlIlIIIlllII[#("7s2")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Cb")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("tOx")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eL")]][lIIlIIIlIIlIlIIIlllII[#("fQT")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qEOd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2W")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("KuU")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UL")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nzp")]][lIIlIIIlIIlIlIIIlllII[#("tgHL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Bz")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("67J")]][lIIlIIIlIIlIlIIIlllII[#("juDV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("Lm6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VQOD")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("re")]][lIIlIIIlIIlIlIIIlllII[#("ozf")]]=lIIlIIIlIIlIlIIIlllII[#("sUU2")];end;elseif llIIllllIlIIllIIl<=#{"1 + 1 = 111";{833;714;462;449};{322;239;349;303};"1 + 1 = 111";{47;815;437;548};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{203;994;383;158};{726;580;659;623};{91;650;134;330};"1 + 1 = 111";{717;945;13;862};"1 + 1 = 111";"1 + 1 = 111";{75;761;982;59};"1 + 1 = 111";"1 + 1 = 111";{705;420;976;117};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{412;382;477;761};{555;568;18;554};"1 + 1 = 111";{39;920;346;480};"1 + 1 = 111";{325;79;58;298};"1 + 1 = 111";{281;172;332;101};{145;12;345;985};"1 + 1 = 111";{552;73;186;535};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{547;953;353;242};"1 + 1 = 111";{4;473;473;48};{729;489;543;222};"1 + 1 = 111";{840;957;830;935};"1 + 1 = 111";{972;433;231;895};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{633;942;627;279};"1 + 1 = 111";"1 + 1 = 111";{29;486;473;927};"1 + 1 = 111";"1 + 1 = 111";{541;657;886;663};"1 + 1 = 111";{934;834;426;987};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{153;105;516;761};{362;329;800;380};{678;165;107;428};"1 + 1 = 111";{619;448;341;973};"1 + 1 = 111";}then if llIIllllIlIIllIIl<=#("rcfHRKPlAeY2nj49I1az4IvH1vV9RFicDkQkoG3Xo5NyUJqq04sIfUsURJQvYQE46WAcDTUb7n")then if llIIllllIlIIllIIl==#("958WreEiWlK6S26EQ0H8ICSC7jnXhkrK2KtYTWyquISSv0RkHodlApMImGZi1QbL4aeiJhV4D")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0d")]]=lIIlIIIlIIlIlIIIlllII[#("F1Q")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5G")]]=lIIlIIIlIIlIlIIIlllII[#("Q9q")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pH")]]=lIIlIIIlIIlIlIIIlllII[#("qzx")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("sH")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{{140;625;35;154};"1 + 1 = 111";"1 + 1 = 111";}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CH")]][lIIlIIIlIIlIlIIIlllII[#("h0L")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ACLW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("K9")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("VKb")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xp")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("U47")]][lIIlIIIlIIlIlIIIlllII[#("aBJd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yo")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R0B")]][lIIlIIIlIIlIlIIIlllII[#("zAyO")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Z1")]][lIIlIIIlIIlIlIIIlllII[#("KFz")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("te7e")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("E5")]][lIIlIIIlIIlIlIIIlllII[#("PzY")]]=lIIlIIIlIIlIlIIIlllII[#("EvNv")];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xG")]][lIIlIIIlIIlIlIIIlllII[#("hUz")]]=lIIlIIIlIIlIlIIIlllII[#("rzgX")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("DL")]][lIIlIIIlIIlIlIIIlllII[#("LF4")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HTWe")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ti")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("3xy")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XPD")]][lIIlIIIlIIlIlIIIlllII[#("2FV4")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oB")]]=lIIlIIIlIIlIlIIIlllII[#("0QL")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{663;487;5;452};}]]=lIIlIIIlIIlIlIIIlllII[#("cjY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rT")]]=lIIlIIIlIIlIlIIIlllII[#("7QE")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("j4")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("9K4")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5c")]][lIIlIIIlIIlIlIIIlllII[#("cxt")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SVAa")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mg")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("vra3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QV")]][lIIlIIIlIIlIlIIIlllII[#("9Un")]]=lIIlIIIlIIlIlIIIlllII[#("oXQc")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("n5")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Cd3")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{403;493;368;578};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cE2")]][lIIlIIIlIIlIlIIIlllII[#("eYpi")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Vp")]]=lIIlIIIlIIlIlIIIlllII[#("Ydl")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("j7")]]=lIIlIIIlIIlIlIIIlllII[#("58K")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oK")]]=lIIlIIIlIIlIlIIIlllII[#("ayn")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2H")]]=lIIlIIIlIIlIlIIIlllII[#("CQv")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("0m")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("vCT")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fn")]][lIIlIIIlIIlIlIIIlllII[#("svV")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("LuVM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QH")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("5E8")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jh")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XJF")]][lIIlIIIlIIlIlIIIlllII[#("POsj")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{625;551;462;680};}]]=lIIlIIIlIIlIlIIIlllII[#("R54")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Oa")]]=lIIlIIIlIIlIlIIIlllII[#("luf")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("c6")]]=lIIlIIIlIIlIlIIIlllII[#("3Do")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6G")]]=lIIlIIIlIIlIlIIIlllII[#("H42")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("A9")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("RDJ")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mR")]][lIIlIIIlIIlIlIIIlllII[#("UGQ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YtcB")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bu")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("r3d")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("WZ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("aQh")]][lIIlIIIlIIlIlIIIlllII[#("T6Nl")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zi")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2RM")]][lIIlIIIlIIlIlIIIlllII[#("azmZ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("AO")]][lIIlIIIlIIlIlIIIlllII[#("Wxo")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TdTL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xM")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("epMG")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZS")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("hiU")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VK")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{924;677;833;87};{225;428;689;640};{510;794;915;256};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rZ")]]=lIIlIIIlIIlIlIIIlllII[#("94V")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("24")]]=lIIlIIIlIIlIlIIIlllII[#("pCR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SQ")]]=lIIlIIIlIIlIlIIIlllII[#("rNm")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("PE")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("uWU")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fh")]][lIIlIIIlIIlIlIIIlllII[#("sxa")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R80m")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CP")]][lIIlIIIlIIlIlIIIlllII[#("oJo")]]=lIIlIIIlIIlIlIIIlllII[#("5Vo4")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("to")]][lIIlIIIlIIlIlIIIlllII[#("d0u")]]=lIIlIIIlIIlIlIIIlllII[#("ikd1")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XN")]][lIIlIIIlIIlIlIIIlllII[#("ic1")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mh5A")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IK")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("CYD")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vK")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6Bq")]][lIIlIIIlIIlIlIIIlllII[#("L4RU")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SC")]]=lIIlIIIlIIlIlIIIlllII[#("Q6T")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4T")]]=lIIlIIIlIIlIlIIIlllII[#("tpF")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("84")]]=lIIlIIIlIIlIlIIIlllII[#("z5S")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("0R")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("l4f")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EU")]][lIIlIIIlIIlIlIIIlllII[#("PHh")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JRGz")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Mq")]][lIIlIIIlIIlIlIIIlllII[#("gJi")]]=lIIlIIIlIIlIlIIIlllII[#("Sj1R")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uy")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("WzV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tV3")]][lIIlIIIlIIlIlIIIlllII[#("bJaQ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RE")]]=lIIlIIIlIIlIlIIIlllII[#("gQO")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("su")]]=lIIlIIIlIIlIlIIIlllII[#("0G3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yx")]]=lIIlIIIlIIlIlIIIlllII[#("u9T")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{473;967;805;14};{258;490;821;847};}]]=lIIlIIIlIIlIlIIIlllII[#("tNN")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{{212;64;777;769};"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Sbs")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sD")]][lIIlIIIlIIlIlIIIlllII[#("s1m")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8YY0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8D")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("XD6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zt")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("F8b")]][lIIlIIIlIIlIlIIIlllII[#("3lVh")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("h5")]]=lIIlIIIlIIlIlIIIlllII[#("b1h")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("za")]]=lIIlIIIlIIlIlIIIlllII[#("pXK")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nz")]]=lIIlIIIlIIlIlIIIlllII[#("Oue")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wm")]]=lIIlIIIlIIlIlIIIlllII[#("Z55")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("rQ")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("WmY")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Lc")]][lIIlIIIlIIlIlIIIlllII[#("CEI")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qexr")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xH")]][lIIlIIIlIIlIlIIIlllII[#("EHE")]]=lIIlIIIlIIlIlIIIlllII[#("XqfJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("h4")]][lIIlIIIlIIlIlIIIlllII[#("J8s")]]=lIIlIIIlIIlIlIIIlllII[#("no0l")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{207;395;465;535};{786;790;737;421};}]][lIIlIIIlIIlIlIIIlllII[#("8fl")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{927;603;683;519};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("su")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Fhr")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xr")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CjV")]][lIIlIIIlIIlIlIIIlllII[#("Ogpi")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ul")]]=lIIlIIIlIIlIlIIIlllII[#("Wfr")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("az")]]=lIIlIIIlIIlIlIIIlllII[#("IXj")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4T")]]=lIIlIIIlIIlIlIIIlllII[#("kTm")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("c6")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("s2b")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ja")]][lIIlIIIlIIlIlIIIlllII[#("tnL")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xf1E")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lx")]][lIIlIIIlIIlIlIIIlllII[#("bRi")]]=lIIlIIIlIIlIlIIIlllII[#("x6zJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nc")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("TCO")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("e9")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("420")]][lIIlIIIlIIlIlIIIlllII[#("OWKY")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("TKC")];end;elseif llIIllllIlIIllIIl==#("OaTafhCcq2gfkN7WLm7oAOGgYvWJMzDjTjLMYmBRRYAjEZZBkWHJ6n0aEMmTv3B1z7xabv7zVpI")then local llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("r4")];local IlIlIIllIlII={};for lIIlIIIlIIlIlIIIlllII=1,#lIIlIlIIIIlIllIl do local lIIlIIIlIIlIlIIIlllII=lIIlIlIIIIlIllIl[lIIlIIIlIIlIlIIIlllII];for IllIIIlllIIIllIII=0,#lIIlIIIlIIlIlIIIlllII do local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[IllIIIlllIIIllIII];local IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[1];local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[2];if IlIllIIIIll==IIlIIIllIIlIIIlllI and IllIIIlllIIIllIII>=llIIllllIlIIllIIl then IlIlIIllIlII[IllIIIlllIIIllIII]=IlIllIIIIll[IllIIIlllIIIllIII];lIIlIIIlIIlIlIIIlllII[1]=IlIlIIllIlII;end;end;end;else local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#{{883;618;48;749};{963;472;606;455};}]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII+1])end;elseif llIIllllIlIIllIIl<=#("nxM8GuyZ24mGsLhlaRvXyJUHDZAZZhXRPpWh9nmbGM8FU1RBnVzd4VmOMfGR5IaVgG0dY9lWFuqWLp")then if llIIllllIlIIllIIl>#("Mh9MdTUW4ciG4RGf7MnynaOMnKMJKEBdvr4J566bxT6aQEqf8otkx1JLDxyEhkmAMejNW6jaPlbFe")then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("e7")]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII+1,llIIIIlI))else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jL")]]=llIllIlIlIIlIlllllIIlI(lIlIIlIlIIlIlIlI[lIIlIIIlIIlIlIIIlllII[#("oMY")]],nil,IlIllIIIIll);end;elseif llIIllllIlIIllIIl==#("6UsGKukqQEStfJJD4lGGzLtOscesFl0eGZBNkLL2puzQ4D0LBlrZ8JpuBOmHq1VFOOXqi5rsLOpdmOT")then local IlIlIIllIlII=lIIlIIIlIIlIlIIIlllII[#("7C")];local llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("UDCf")];local IlIllIIIIll=IlIlIIllIlII+2 local IlIlIIllIlII={IIlIIIllIIlIIIlllI[IlIlIIllIlII](IIlIIIllIIlIIIlllI[IlIlIIllIlII+1],IIlIIIllIIlIIIlllI[IlIllIIIIll])};for lIIlIIIlIIlIlIIIlllII=1,llIIllllIlIIllIIl do IIlIIIllIIlIIIlllI[IlIllIIIIll+lIIlIIIlIIlIlIIIlllII]=IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII];end;local IlIlIIllIlII=IlIlIIllIlII[1]if IlIlIIllIlII then IIlIIIllIIlIIIlllI[IlIllIIIIll]=IlIlIIllIlII IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("Ybl")];else IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;end;else local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("qf")]local IlIlIIllIlII,lIIlIIIlIIlIlIIIlllII=IllIIlIlII(IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII+1,lIIlIIIlIIlIlIIIlllII[#("2Ok")])))llIIIIlI=lIIlIIIlIIlIlIIIlllII+IllIIIlllIIIllIII-1 local lIIlIIIlIIlIlIIIlllII=0;for IllIIIlllIIIllIII=IllIIIlllIIIllIII,llIIIIlI do lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII+1;IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII]=IlIlIIllIlII[lIIlIIIlIIlIlIIIlllII];end;end;elseif llIIllllIlIIllIIl<=#("mD1s3ag7KfmGydLzK3bqPJDG49otsmiX5xuY9DLNHZRcTV4Hd1EsMDkNavz4VWPy7ALbSXzhszT02BWieRqBT0kC")then if llIIllllIlIIllIIl<=#("SYNdR1Vktetj2ZqDxamTuUJKpZeGoPhoj0a9VdLH8PJvC9l297vZ7S08odY1Xo5O7eacZrSszPVPknhqNlGq")then if llIIllllIlIIllIIl<=#("rqB9cURpTUTU4yy8jdSpdBs7kXa6HoMTPvQYJcWHadP5b5pZUrEhXap18EZoTVSFiaeISJAgqlp9Vx5oHl")then if llIIllllIlIIllIIl==#("oUE5OgYZfnIXoukXa0Shk2y0MVpgLIKSIJDUOfBC3Tu2TyaOKK4yZdbxxNt21SnHOZoQ2Ai5ApnBIGhnV")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("f6")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("fIM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("If6")]][lIIlIIIlIIlIlIIIlllII[#{{136;379;620;922};{556;607;118;72};"1 + 1 = 111";{528;734;686;131};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IJ")]]=lIIlIIIlIIlIlIIIlllII[#{{305;606;963;795};"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zp")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zW")]]=lIIlIIIlIIlIlIIIlllII[#("34Z")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("AOF")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Da")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("zZ1")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ef")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{861;101;847;629};{428;501;251;485};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JZEV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{712;139;357;689};}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{159;787;57;395};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wp")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qMU")]][lIIlIIIlIIlIlIIIlllII[#("jZnV")]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8Y")]]=lIIlIIIlIIlIlIIIlllII[#("NxA")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("di")]]=lIIlIIIlIIlIlIIIlllII[#("DSN")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5k")]]=lIIlIIIlIIlIlIIIlllII[#("O4x")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("gD")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("ZCm")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QP")]][lIIlIIIlIIlIlIIIlllII[#("d4Y")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{578;28;115;740};"1 + 1 = 111";"1 + 1 = 111";{91;753;536;346};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sV")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("o6K")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JJ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{780;403;805;175};{988;217;41;37};{209;924;883;789};}]][lIIlIIIlIIlIlIIIlllII[#("r0rS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9X")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7ab")]][lIIlIIIlIIlIlIIIlllII[#("mUIE")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{906;556;365;661};{258;754;700;124};}]][lIIlIIIlIIlIlIIIlllII[#("jlf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kPjf")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9Y")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{520;688;554;962};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("ZCcl")];end;elseif llIIllllIlIIllIIl==#("GbOl3FIgybWJLlFXo3jtWjC98J0KZ1Gfgpmm3C6UiVcgj0Pc5UqndCZvKOntP7rHGQCu8s4W7Alahu0h3XO")then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{331;703;413;519};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lIv")]][lIIlIIIlIIlIlIIIlllII[#("ICNx")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OA")]]=lIIlIIIlIIlIlIIIlllII[#("G3q")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ru")]]=lIIlIIIlIIlIlIIIlllII[#("Zfs")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SE")]]=lIIlIIIlIIlIlIIIlllII[#("Yaz")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("ax")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("Xva")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Iy")]][lIIlIIIlIIlIlIIIlllII[#("3Fv")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZJYS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("u9")]][lIIlIIIlIIlIlIIIlllII[#("3fY")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{115;904;193;76};"1 + 1 = 111";{35;690;572;641};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7m")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vjo")]][lIIlIIIlIIlIlIIIlllII[#("4Q5A")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("U9")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PhH")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#{{172;180;692;193};"1 + 1 = 111";{419;14;919;799};"1 + 1 = 111";}]];else local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{105;644;878;254};{756;894;42;796};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("K8I")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{794;121;981;331};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("H5")]]=lIIlIIIlIIlIlIIIlllII[#("X8s")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("T5")]]=lIIlIIIlIIlIlIIIlllII[#("ROD")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fb")]]=lIIlIIIlIIlIlIIIlllII[#("XAp")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("pa")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("XZX")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("l1")]][lIIlIIIlIIlIlIIIlllII[#("lSS")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pyAN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{617;791;162;247};}]][lIIlIIIlIIlIlIIIlllII[#("eNF")]]=lIIlIIIlIIlIlIIIlllII[#("Zm5y")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HB")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1dR")]][lIIlIIIlIIlIlIIIlllII[#("O5Zz")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("BO")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("DSf")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#("scst")]];end;elseif llIIllllIlIIllIIl<=#{"1 + 1 = 111";"1 + 1 = 111";{654;60;105;703};"1 + 1 = 111";"1 + 1 = 111";{951;663;229;125};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{624;763;751;513};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{958;14;602;927};"1 + 1 = 111";{143;73;778;292};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{787;673;409;818};"1 + 1 = 111";"1 + 1 = 111";{395;89;394;141};{553;111;171;491};"1 + 1 = 111";{547;500;471;499};"1 + 1 = 111";"1 + 1 = 111";{413;799;324;906};"1 + 1 = 111";"1 + 1 = 111";{677;649;773;260};{887;625;286;493};"1 + 1 = 111";{863;446;543;80};{180;118;387;32};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{132;557;820;852};"1 + 1 = 111";"1 + 1 = 111";{599;692;659;682};"1 + 1 = 111";{100;492;60;822};"1 + 1 = 111";{159;75;567;936};{342;680;875;133};"1 + 1 = 111";{926;491;951;650};{198;112;354;89};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{324;344;144;286};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{975;977;933;543};"1 + 1 = 111";"1 + 1 = 111";{943;791;142;416};{287;687;967;753};"1 + 1 = 111";{845;402;749;108};{780;649;259;165};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{477;621;477;854};}then if llIIllllIlIIllIIl>#("r71mqysGspBhghocvIhkYeejedit808VxgLuRjHnfAO4FZnidKk3pPtm2Sino9HDrPUaH3vlb4eyAkOo0apzP")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xn")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("XnM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("M3")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lF6")]][lIIlIIIlIIlIlIIIlllII[#("jGMg")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("BD")]]=lIIlIIIlIIlIlIIIlllII[#("NP0")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Hk")]]=lIIlIIIlIIlIlIIIlllII[#("3vC")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gr")]]=lIIlIIIlIIlIlIIIlllII[#("u0F")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1D")]]=lIIlIIIlIIlIlIIIlllII[#("phS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("kf")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("EN9")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1V")]][lIIlIIIlIIlIlIIIlllII[#("7WQ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qDDv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Mx")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{322;640;16;1};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("n2G")]][lIIlIIIlIIlIlIIIlllII[#("jB0C")]];else local llIIIIlI=lIlIIlIlIIlIlIlI[lIIlIIIlIIlIlIIIlllII[#("WEX")]];local IIIIlIIlIIlIll;local llIIllllIlIIllIIl={};IIIIlIIlIIlIll=lIlIIIlllIllIIlI({},{__index=function(IllIIIlllIIIllIII,lIIlIIIlIIlIlIIIlllII)local lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII];return lIIlIIIlIIlIlIIIlllII[1][lIIlIIIlIIlIlIIIlllII[2]];end,__newindex=function(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII,IllIIIlllIIIllIII)local lIIlIIIlIIlIlIIIlllII=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII]lIIlIIIlIIlIlIIIlllII[1][lIIlIIIlIIlIlIIIlllII[2]]=IllIIIlllIIIllIII;end;});for IlIllIIIIll=1,lIIlIIIlIIlIlIIIlllII[#("7B9l")]do IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;local lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];if lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";}]==99 then llIIllllIlIIllIIl[IlIllIIIIll-1]={IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII[#("WJW")]};else llIIllllIlIIllIIl[IlIllIIIIll-1]={IlIlllIllllIIIIlIlllI,lIIlIIIlIIlIlIIIlllII[#("L1v")]};end;lIIlIlIIIIlIllIl[#lIIlIlIIIIlIllIl+1]=llIIllllIlIIllIIl;end;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Df")]]=llIllIlIlIIlIlllllIIlI(llIIIIlI,IIIIlIIlIIlIll,IlIllIIIIll);end;elseif llIIllllIlIIllIIl==#{"1 + 1 = 111";{296;528;992;158};{878;567;500;465};"1 + 1 = 111";"1 + 1 = 111";{558;688;462;312};{965;52;733;465};"1 + 1 = 111";{311;153;68;286};{170;303;536;532};{10;616;279;216};"1 + 1 = 111";"1 + 1 = 111";{978;59;759;299};{740;805;929;71};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{940;394;207;452};{184;116;10;518};"1 + 1 = 111";"1 + 1 = 111";{992;989;889;235};{568;318;95;402};{487;944;343;790};{751;288;217;650};{604;706;185;629};"1 + 1 = 111";"1 + 1 = 111";{260;730;403;370};"1 + 1 = 111";{777;27;752;48};"1 + 1 = 111";"1 + 1 = 111";{780;700;918;152};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{190;2;524;139};{636;449;461;151};{865;56;773;445};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{742;988;405;296};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{540;607;287;336};"1 + 1 = 111";{42;401;860;61};"1 + 1 = 111";"1 + 1 = 111";{390;650;837;826};{752;797;719;323};"1 + 1 = 111";{802;15;269;664};{869;13;128;735};{405;9;634;670};{77;778;520;147};{997;301;168;221};"1 + 1 = 111";{852;791;615;24};"1 + 1 = 111";"1 + 1 = 111";{668;534;561;361};{687;109;472;492};{828;129;825;282};"1 + 1 = 111";{259;290;486;33};{658;958;389;91};{802;198;60;378};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{611;525;788;75};{674;958;989;134};{562;740;790;283};"1 + 1 = 111";{893;433;782;420};}then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("G5")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mnJ")]][lIIlIIIlIIlIlIIIlllII[#("RVI1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gD")]]=lIIlIIIlIIlIlIIIlllII[#("FCB")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YY")]]=lIIlIIIlIIlIlIIIlllII[#("Frq")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iP")]]=lIIlIIIlIIlIlIIIlllII[#("8VM")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("Hq")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("q2M")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9P")]][lIIlIIIlIIlIlIIIlllII[#("tYg")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2BK2")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qp")]][lIIlIIIlIIlIlIIIlllII[#("usx")]]=lIIlIIIlIIlIlIIIlllII[#("BvYf")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("06")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1Ed")]][lIIlIIIlIIlIlIIIlllII[#("TVtp")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("n9")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Bd2")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#("vTJH")]];else local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("A1")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{517;394;14;98};"1 + 1 = 111";{833;851;774;826};}]][lIIlIIIlIIlIlIIIlllII[#("nfyJ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Od")]]=lIIlIIIlIIlIlIIIlllII[#("B7l")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("m6C")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TV")]]=lIIlIIIlIIlIlIIIlllII[#{{589;251;360;913};"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("ov")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("o3s")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("BS")]][lIIlIIIlIIlIlIIIlllII[#("gXu")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2dgy")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Pf")]][lIIlIIIlIIlIlIIIlllII[#("eGR")]]=lIIlIIIlIIlIlIIIlllII[#("y8VO")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("02LN")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("Om")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3GM")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#("XNUu")]];end;elseif llIIllllIlIIllIIl<=#("997xISAdVkMW1ghiM6xp1bUDBdJQvk6RUpBRdN5aDVzoaNQeiMi1sTq7pF5EiUSLo5cMPAf9bvXfNFDYyEIUbeza8DCJ")then if llIIllllIlIIllIIl<=#("B1ScYaeKdzSGjZ66kuUbhgOm7KkHcOm8HrLFedYFzntfZn1oCeXhRHKumGeoZHIAmU91oC1hHpN3WJxUS6e70eq9Sq")then if llIIllllIlIIllIIl>#("I8KP1Q42fna9amPLC4QIOjuH3CKJiDaj8jsj7KVn1RqGR6eUkDZebSOzNcWAfuUMn0b04GO1jDR62YZ6yZzQO5hpG")then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("TQ")]local IlIlIIllIlII,IllIIIlllIIIllIII=IllIIlIlII(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII+1]))llIIIIlI=IllIIIlllIIIllIII+lIIlIIIlIIlIlIIIlllII-1 local IllIIIlllIIIllIII=0;for lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII,llIIIIlI do IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IlIlIIllIlII[IllIIIlllIIIllIII];end;else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("o2")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("X0b")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Lz")]][lIIlIIIlIIlIlIIIlllII[#("NNK")]]=lIIlIIIlIIlIlIIIlllII[#("lgTX")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yF")]][lIIlIIIlIIlIlIIIlllII[#("0v8")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7laC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Lp")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("pu1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tq")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("UE9")]][lIIlIIIlIIlIlIIIlllII[#("XdbJ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8b")]]=lIIlIIIlIIlIlIIIlllII[#{{725;327;166;825};{39;596;762;866};{209;384;72;290};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rA")]]=lIIlIIIlIIlIlIIIlllII[#("pjp")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vI")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Be")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Qy5")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("H9")]][lIIlIIIlIIlIlIIIlllII[#("26V")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xoB5")]];end;elseif llIIllllIlIIllIIl==#("G4YuhG7Os14n0PY75JbRGZnZcq6d8rSWta9UdYuk9nF7cj9U1RaJnZxQQ8s1K3Qbii3ZPe3go1RrtpX2qmmqqjIFNse")then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("pI")]local IlIlIIllIlII,IllIIIlllIIIllIII=IllIIlIlII(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII+1]))llIIIIlI=IllIIIlllIIIllIII+lIIlIIIlIIlIlIIIlllII-1 local IllIIIlllIIIllIII=0;for lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII,llIIIIlI do IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IlIlIIllIlII[IllIIIlllIIIllIII];end;else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("xF")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("m6v")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GO")]][lIIlIIIlIIlIlIIIlllII[#("HiW")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("U9PV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sc")]][lIIlIIIlIIlIlIIIlllII[#("t3l")]]=lIIlIIIlIIlIlIIIlllII[#("Ei6h")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ge")]][lIIlIIIlIIlIlIIIlllII[#("HIW")]]=lIIlIIIlIIlIlIIIlllII[#("LudC")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Aa")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("hgg")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TP")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xI1")]][lIIlIIIlIIlIlIIIlllII[#("VutX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5C")]]=lIIlIIIlIIlIlIIIlllII[#("oJ2")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("V2")]]=lIIlIIIlIIlIlIIIlllII[#("zCP")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Jk")]]=lIIlIIIlIIlIlIIIlllII[#("SF1")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R1")]]=lIIlIIIlIIlIlIIIlllII[#("H9x")];end;elseif llIIllllIlIIllIIl<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{359;975;911;197};"1 + 1 = 111";"1 + 1 = 111";{202;470;68;224};{507;554;18;700};"1 + 1 = 111";"1 + 1 = 111";{178;94;283;608};{848;711;114;920};{655;63;249;514};{842;290;418;46};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{560;450;793;3};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{914;719;456;121};"1 + 1 = 111";{864;340;513;990};{128;409;531;410};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{941;919;964;37};{647;181;194;692};"1 + 1 = 111";{298;486;165;86};"1 + 1 = 111";"1 + 1 = 111";{555;78;194;59};{801;495;413;37};"1 + 1 = 111";{390;883;572;770};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{367;980;249;143};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{79;673;891;690};"1 + 1 = 111";{823;703;180;15};{524;757;45;561};{132;526;215;901};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{128;473;259;983};{717;773;207;941};"1 + 1 = 111";{581;834;143;80};{300;68;720;751};{76;815;628;791};{550;551;447;120};{794;543;441;665};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{958;664;54;461};"1 + 1 = 111";{293;433;863;607};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{937;563;225;755};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{85;19;666;549};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{593;820;856;419};"1 + 1 = 111";{231;183;30;171};{370;331;56;957};"1 + 1 = 111";"1 + 1 = 111";}then if llIIllllIlIIllIIl==#("KKVjyMEepd0nBOLqz8imvQ3ZtuBdUQfvTzzScs1PCs3xlB7RuqEdcAV4Q60dkBuK7EFcp2nfhDUdWHO2xUTElctsNFbgD")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Uv")]]();else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("V7")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("yvS")]];end;elseif llIIllllIlIIllIIl>#("Fb8tzR65CCcy6JPShjr7QBR0y5klAV0hNs8TfDh76CrqBXfUO4x2YFheth5EGUFRM5VNK6NPcuaniBAKZAHFy8tik4z8HOB")then local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("cD")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("uS2")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("68")]][lIIlIIIlIIlIlIIIlllII[#("Mbq")]]=lIIlIIIlIIlIlIIIlllII[#("m7tB")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("a0")]][lIIlIIIlIIlIlIIIlllII[#("0rh")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("X1cX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ea")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("ebE")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{503;871;421;532};{964;819;410;508};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("q4F")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{863;280;386;443};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Qt")]]=lIIlIIIlIIlIlIIIlllII[#("nyR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#{{607;833;853;505};"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("I6")]]=lIIlIIIlIIlIlIIIlllII[#("T9f")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("NM")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{{323;717;405;73};"1 + 1 = 111";{762;640;232;974};}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SW")]][lIIlIIIlIIlIlIIIlllII[#("QTp")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lB8n")]];else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gO")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("k37")]];end;elseif llIIllllIlIIllIIl<=#("6LPGcDjRrSZDE353RuOgnasOLMCQIPiy4ZrHV4Hxp0nQi0Or8Fql9u86ra4AaEjNJCJPMzhXXr0xXNGV8kScy6yK0voV9gvWQKgQr9PJxDySELiP")then if llIIllllIlIIllIIl<=#("iC0WhoNd9ZqjxXR6eRmGZE9GiP4IQfomKp0PGaJvDNrjzAaQRWA46iQPDuNCtex4LdJh6bBei0dllZgSPo14PtpCKlllxgbzpyJu03TP")then if llIIllllIlIIllIIl<=#("vWffEDOn4XenDoqYhHV0oRbZP5YpV2VGlJtIkvfSI7Cs6kXisHTv8ZgOUqBIPyCccJc34TNVCdrrpT2EiP7oiAHvDPX35HckFzqy")then if llIIllllIlIIllIIl<=#("3oJ3745IYzbz6AaAn4McRBp6U04ahW0DFxoByulFMYOpVF9hcUrFOuBD8Njha4AcJJ4KlJc3SgA2X9ko0W8xEvYj5VCUkeFSyL")then if llIIllllIlIIllIIl>#("mKz5DSzWH5IQ9D4qn6cInUVOBhrSOMSElr7OB1FPfJrnyfCrqXqVvcECZVFvBQi4ndESFpZxCyDPDHquP9C0u6iiXFZQvjozA")then local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{659;997;73;489};}]IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII+1,lIIlIIIlIIlIlIIIlllII[#("ynd")]))else if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("X8")]]~=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zo30")]])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("Gz0")];end;end;elseif llIIllllIlIIllIIl==#("atLUWa84t8KZ9sEjQBosKq4u4aBiaridogH7U4nB1BNkJ8GGlmDXjhXUzp0WJZ4bZGK3WHAVnXBjNUW5E47YZv3htWIEeB2cGMv")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2U")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("10A")]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{286;940;187;949};"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("a0C")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pU")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Oic")]][lIIlIIIlIIlIlIIIlllII[#("C9JB")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{281;379;103;854};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mgX")]][lIIlIIIlIIlIlIIIlllII[#{{233;639;774;278};{941;41;994;821};"1 + 1 = 111";{885;725;839;287};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("c7s")]][lIIlIIIlIIlIlIIIlllII[#("XQod")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jF")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OhR")]][lIIlIIIlIIlIlIIIlllII[#("Ngje")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3t")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("BpP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ls")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("K1N")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{438;870;709;254};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{759;275;972;83};{87;669;102;814};}]]=lIIlIIIlIIlIlIIIlllII[#("jLj")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("az")]]=lIIlIIIlIIlIlIIIlllII[#{{75;23;564;894};{521;911;593;414};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("h2")]]=lIIlIIIlIIlIlIIIlllII[#("rrT")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("NW")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{{415;206;627;191};{561;94;448;426};"1 + 1 = 111";}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JR")]][lIIlIIIlIIlIlIIIlllII[#("AmD")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tvgQ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;end;elseif llIIllllIlIIllIIl<=#{"1 + 1 = 111";"1 + 1 = 111";{619;884;683;284};"1 + 1 = 111";{412;284;397;799};{934;175;83;179};"1 + 1 = 111";"1 + 1 = 111";{364;273;521;618};"1 + 1 = 111";{84;607;106;830};"1 + 1 = 111";"1 + 1 = 111";{26;813;344;947};"1 + 1 = 111";"1 + 1 = 111";{792;910;380;575};{216;499;303;435};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{641;720;802;691};{623;205;657;779};{213;802;94;793};{675;385;263;300};{912;142;357;939};{766;11;504;28};"1 + 1 = 111";"1 + 1 = 111";{363;56;722;831};"1 + 1 = 111";{52;640;858;722};"1 + 1 = 111";{734;129;192;71};"1 + 1 = 111";"1 + 1 = 111";{564;104;198;14};{158;875;197;21};{87;632;957;414};"1 + 1 = 111";"1 + 1 = 111";{979;221;244;919};{965;481;195;866};{898;756;830;305};{52;430;469;395};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{119;56;348;997};"1 + 1 = 111";{9;965;658;599};{438;218;274;18};{829;952;634;886};{713;311;528;461};{309;114;774;925};{266;469;124;718};{170;242;526;326};"1 + 1 = 111";"1 + 1 = 111";{639;437;778;60};{32;411;101;31};"1 + 1 = 111";{621;755;453;211};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{555;7;674;570};{630;447;407;501};{764;923;575;18};{684;705;399;346};{859;906;941;426};{228;336;309;739};"1 + 1 = 111";{275;766;509;980};{991;171;390;192};"1 + 1 = 111";"1 + 1 = 111";{692;469;162;206};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{383;114;225;74};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{290;222;501;179};{901;702;891;667};{296;457;222;147};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if llIIllllIlIIllIIl>#("TTLutku3iCK4DiTdYDUCVKf549R92oSCRW49M1su7SR7cqN1xf1h2WaiNQBtEvb3ThmRnUC6kAEd2i2Ox0MWyLK5WVv6A81MQYn5d")then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("tx")]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII+1])else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iH")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("gs0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RF")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ifG")]][lIIlIIIlIIlIlIIIlllII[#("8eEX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ry")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("k8y")]][lIIlIIIlIIlIlIIIlllII[#("XrMR")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Q3")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("GRR")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gQ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6Xb")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{81;43;664;813};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8f")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xo")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yPD")]][lIIlIIIlIIlIlIIIlllII[#("Gm4C")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5d")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("byd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("R9")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zeo")]][lIIlIIIlIIlIlIIIlllII[#("SfYW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("FL")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("VA1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dK")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GUP")]][lIIlIIIlIIlIlIIIlllII[#("6IDF")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Ec")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("46H")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vd")]][lIIlIIIlIIlIlIIIlllII[#("ANu")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QY7t")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zt")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("lCg")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{90;600;377;900};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cEv")]][lIIlIIIlIIlIlIIIlllII[#("SlCX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PG")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("MlT")]][lIIlIIIlIIlIlIIIlllII[#("uFCe")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("5by")]]=lIIlIIIlIIlIlIIIlllII[#("0zxG")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6H")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("D00")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("In")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5rE")]][lIIlIIIlIIlIlIIIlllII[#("hCOm")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("H9")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("W7C")]][lIIlIIIlIIlIlIIIlllII[#("2pRI")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ml")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("it4")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("zN")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dBl")]][lIIlIIIlIIlIlIIIlllII[#("pYg6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TN")]]=lIIlIIIlIIlIlIIIlllII[#("8KY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("QN")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{866;840;280;656};{320;160;766;216};}]][lIIlIIIlIIlIlIIIlllII[#("dyh")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YLWH")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("s9")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("b2y")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lc")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JfR")]][lIIlIIIlIIlIlIIIlllII[#("tUhE")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("og")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XYR")]][lIIlIIIlIIlIlIIIlllII[#("nOUx")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("7z1")]]=lIIlIIIlIIlIlIIIlllII[#("Hk7e")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{876;589;802;222};{799;219;280;613};}]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#{{164;4;115;722};{951;412;401;519};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("rY")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qvT")]][lIIlIIIlIIlIlIIIlllII[#("okUP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{245;182;926;337};"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0BC")]][lIIlIIIlIIlIlIIIlllII[#("DF4E")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oH")]][lIIlIIIlIIlIlIIIlllII[#("bJD")]]=lIIlIIIlIIlIlIIIlllII[#("HyGV")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;end;elseif llIIllllIlIIllIIl>#("NNO46Cs7qFXX6NTpGiIr5DyFGmJ2xe47KBn9iDOhMZF0jNbo3BrfyWajoiyU3AKlKZmGzTgcEAPg7Hv3kt95WZKXBdUaf3nmotptAGZ")then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("P6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kiQ")]][lIIlIIIlIIlIlIIIlllII[#("oMZP")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("CT")]]=lIIlIIIlIIlIlIIIlllII[#("KJ3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("J2")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mo")]]=lIIlIIIlIIlIlIIIlllII[#("Ur9")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("1u")]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("SUn")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("c7")]][lIIlIIIlIIlIlIIIlllII[#("cZe")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{935;981;250;498};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{779;679;410;14};"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("i3c")]]=lIIlIIIlIIlIlIIIlllII[#("oGti")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("q4")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("NYI")]][lIIlIIIlIIlIlIIIlllII[#("e1cr")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("Yy")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ujT")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{416;466;582;24};"1 + 1 = 111";{501;587;927;937};}]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9f")]]=lIIlIIIlIIlIlIIIlllII[#("T7E")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xe")]]=lIIlIIIlIIlIlIIIlllII[#("asQ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YH")]]=lIIlIIIlIIlIlIIIlllII[#("VFU")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{961;627;535;639};}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("B3k")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cN")]][lIIlIIIlIIlIlIIIlllII[#("usF")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Z0NV")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EL")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("e9V")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("LB")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HVz")]][lIIlIIIlIIlIlIIIlllII[#("Zh9W")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("f5")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yx3")]][lIIlIIIlIIlIlIIIlllII[#("5vr8")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cC")]][lIIlIIIlIIlIlIIIlllII[#("JkZ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4bQn")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sz")]][lIIlIIIlIIlIlIIIlllII[#("pVj")]]=lIIlIIIlIIlIlIIIlllII[#("7kVS")];end;elseif llIIllllIlIIllIIl<=#("upL7h4mSWFKJBOzVpzev9g6LlC1OqbDOF0LHoMQG1cnLtOWK4FebBEjns9WPdIBVc5eLc2GNTJE72vrHQqTW7CnbQynoZbDsMDIyKlIc8Br2")then if llIIllllIlIIllIIl<=#("mv6So8WZOXLRd4POrYRflvAX37FTRXHjvcEbqHKdRE7P7QHq2zRNLWX15iZrDdi1pBvbBNxUnOzSyU0mAo0sg4IKoMgiRsKNugAGuG0ob6")then if llIIllllIlIIllIIl>#("7xfDlsM2omZUv3WWYHoc5dVxrut14zLqjFLmii5ZfAvBGvdNJTbSW4E4LSl09U7ZLJL0sJNQMA7FRu16qRsky3EpbQMB7e0uDGZ6Unu9f")then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII+1])else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jJ")]]=lIIlIIIlIIlIlIIIlllII[#("ij5")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pz")]]=lIIlIIIlIIlIlIIIlllII[#("jER")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ud")]]=lIIlIIIlIIlIlIIIlllII[#("Op3")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("2D")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{269;643;816;586};}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SU")]][lIIlIIIlIIlIlIIIlllII[#("mX6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PvnQ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qX")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("31h")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8m")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Lj9")]][lIIlIIIlIIlIlIIIlllII[#("xF6q")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("u3")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dzc")]][lIIlIIIlIIlIlIIIlllII[#("IRzC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PV")]][lIIlIIIlIIlIlIIIlllII[#("jWm")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gHI8")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jF")]][lIIlIIIlIIlIlIIIlllII[#("egI")]]=lIIlIIIlIIlIlIIIlllII[#("SJdb")];end;elseif llIIllllIlIIllIIl>#("gx69mq1oJsCWCSevZM7mSHJNckG4ldvsfcWgscEuJSFI3Qeg1zySc2NKYt6cU6dG6iRA68cXhMN9bbUvgzdXQOqmzms9fCLNP9MU8Pk3xLK")then local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dx")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{{15;484;738;354};"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("b3")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("D16")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("Ml4C")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("BfI")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("H1")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Z3Z")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Pn")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cHd")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("Oe5g")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Eu")]]=lIIlIIIlIIlIlIIIlllII[#("FBR")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ub")]]={};IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Sn")]][lIIlIIIlIIlIlIIIlllII[#("ms3")]]=lIIlIIIlIIlIlIIIlllII[#("E4sZ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yY")]][lIIlIIIlIIlIlIIIlllII[#("lZP")]]=lIIlIIIlIIlIlIIIlllII[#("BzaS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("MK")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{781;482;4;368};"1 + 1 = 111";}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HL")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("QJ5")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QY")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mY0")]][lIIlIIIlIIlIlIIIlllII[#("nNnM")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cR")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("0LV")]][lIIlIIIlIIlIlIIIlllII[#("BNX1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("GZ")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("643")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("fslG")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("hB")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("KP")]]=lIIlIIIlIIlIlIIIlllII[#("dII")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("76u")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Tk")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("4A")]]=lIIlIIIlIIlIlIIIlllII[#("8ea")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("BDl")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Gv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SN")]]=lIIlIIIlIIlIlIIIlllII[#("RKM")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("LtW")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{10;569;766;568};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ia")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("LTy")]][lIIlIIIlIIlIlIIIlllII[#("lLF0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Y9")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IM5")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("DVrF")]];else if IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uC")]]then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("6gc")];end;end;elseif llIIllllIlIIllIIl<=#("pOJWKL5u3p0r1FaUPcSQbatbA9yCojBed07VOHAFGpUzjt2EOBot34zotHxKmEgTZVobIpfiMnkVp41gg3XY5gliBSBgkZrbjaKze16zufRQTN")then if llIIllllIlIIllIIl==#("APqEsRrYTJgKZY98X5jMpuDbp7zEZAGAXTbB4v8t1m1Z8qgKuh4UKbTemoovsX8sdQWgXIeB7ZUcENd81YiSFV0W96oPgNbeoIVrEaXXcDWUr")then local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("1n")]IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII]=IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IllIIIlllIIIllIII+1,lIIlIIIlIIlIlIIIlllII[#("vJr")]))else do return end;end;elseif llIIllllIlIIllIIl>#("LKkqEFPpYr0ag0tztuYQX61VE0avPc8fEsuPE0iHz9TEBE47DOiC6L3PSAWOFsKWtVGYFP4DlqqYmyta6c3b3Hi2zQ6eeFcgz7kQ7gCXTQqPufD")then local lIIlIIIlIIlIlIIIlllII=lIIlIIIlIIlIlIIIlllII[#("cL")]IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,lIIlIIIlIIlIlIIIlllII+1,llIIIIlI))else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("eX")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("nUV")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("a3")]][lIIlIIIlIIlIlIIIlllII[#("YoH")]]=lIIlIIIlIIlIlIIIlllII[#("mnSk")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nM")]][lIIlIIIlIIlIlIIIlllII[#("z0J")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tIus")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fj")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("sA6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8t")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("V1c")]][lIIlIIIlIIlIlIIIlllII[#("98ri")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{547;270;450;761};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("JTN")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5J")]]=lIIlIIIlIIlIlIIIlllII[#("jTP")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fW")]]=lIIlIIIlIIlIlIIIlllII[#("AEJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("py")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("s2o")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Wd")]][lIIlIIIlIIlIlIIIlllII[#("JO2")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("brek")]];end;elseif llIIllllIlIIllIIl<=#("fWRCAJ3WMNzZSZzRojzonOc0LfrnpEIsmN9sXKQ0eydtRNf3qJAkQnfBT01uqQHiffMf0g3PEJj0KTj79z6RdxN9HIJ7TvJz15oLb9dkQVRhdp0aR3u2TZfS")then if llIIllllIlIIllIIl<=#("NJrH65h9V9PEJ6auWarQG5rSJpZbRPbZHhyBVNUZKhsplGi6uH7ZXc7RrK8Qfgsf8Z7BIKKjqDgyNbGch3RkSmcEkRjlOdTDZmrvJRzU7YIu6Jepd6Jm")then if llIIllllIlIIllIIl<=#("iyWXDq1AzFmTNJAUkDAE6n4OSILM3hRFGdRZFIfBHtIsuLsaPG2DiSE4Dhf4QpHqYSmJ2LoMy87MPLtgpK7yonvXKWvyDkVrXrFMzTheqqfkV1p2Y8")then if llIIllllIlIIllIIl==#("fribKxz9go1imnPYxgRSGD3g8hlcSGEJFFQ9Op5p9UbZAh37fd2WhpjMzcdClxrKVrORHPjhlBTVBdR0on6ONSBpudLMmDeNDBehElAA4VLRHzluu")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("pD")]]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("m9m")]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("vN")]]=lIIlIIIlIIlIlIIIlllII[#("dJ7")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6x")]]=lIIlIIIlIIlIlIIIlllII[#("kt6")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ot")]]=lIIlIIIlIIlIlIIIlllII[#("Gdk")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("eT")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("hz8")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("7x")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{916;613;28;459};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lTXE")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Kg")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("qCd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kfj")]][lIIlIIIlIIlIlIIIlllII[#("04kf")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{492;188;737;802};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8Qb")]][lIIlIIIlIIlIlIIIlllII[#("CuSE")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{587;771;847;254};}]][lIIlIIIlIIlIlIIIlllII[#("G4s")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("n4MB")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QB")]][lIIlIIIlIIlIlIIIlllII[#("Vjj")]]=lIIlIIIlIIlIlIIIlllII[#("H72J")];end;elseif llIIllllIlIIllIIl>#("m7AN6d0zxDeH4Svfsa9JxdXGU2gUS62qr9phm0EbrfZ7vx12uBglvW0jj32e6fQALYp5Co3CG7rro0kyaoAr0R4Fjg7t7zflAzvIg5BfIOPyFJ4sTFd")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("9Z")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HeL")]][lIIlIIIlIIlIlIIIlllII[#("msx0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("SN")]][lIIlIIIlIIlIlIIIlllII[#("RUT")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("lRhO")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("nY")]][lIIlIIIlIIlIlIIIlllII[#("PYX")]]=lIIlIIIlIIlIlIIIlllII[#("DAoJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("bQ")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("crB")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("db")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("FHv")]][lIIlIIIlIIlIlIIIlllII[#("Aypd")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{156;264;671;574};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{565;47;398;331};"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("bM8")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gb")]]=lIIlIIIlIIlIlIIIlllII[#("gys")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("T9")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("d1y")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YE")]][lIIlIIIlIIlIlIIIlllII[#("0YT")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("PqYb")]];else local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("CI")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("x9C")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Yf")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("2bG")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jp")]]=lIIlIIIlIIlIlIIIlllII[#("ERf")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Ax")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tm")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Ye6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Vs")]]=lIIlIIIlIIlIlIIIlllII[#("IVn")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("8M")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;end;elseif llIIllllIlIIllIIl<=#("PyK33VVurKEg2f1ZFMqfYuUmbH9LmPKDvxGbZDOvkfY7jJFzReYgn84uNy2vVkiM9aVGK0ac844SHWcCcK4h0EpxDlyCLrLa7l8iY9Z1eWitelX1uAtkpa")then if llIIllllIlIIllIIl==#("GVycyCIBQt4VvY3OcUdceu6rrzHhk8AU6ACyA6CzHuD9kACcBWrAm7RkZgV94BqS3jZ5xGnfsOGU26h16FQzQ9I8TqItlDFfeVfaLGQ5IlhJC6s383czV")then if(IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ed")]]==IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gPNI")]])then IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;else IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#{{643;396;192;480};"1 + 1 = 111";{617;689;920;552};}];end;else do return end;end;elseif llIIllllIlIIllIIl==#("b4M1lf8340iAQg0gpAZV1F28GW7PvrAfunUlzUtK7PqrAbqlc1ONKaaGcNuAhsIMBdeDxOSGfoXmnKJFGWNEOXGumojWz4DOhP1x6YZyjiHumXrCd04vQd7")then local IllIIIlllIIIllIII=lIIlIIIlIIlIlIIIlllII[#("N2")]local IlIllIIIIll={IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII](IIlIIIllIIlIIIlllI[IllIIIlllIIIllIII+1])};local IlIlIIllIlII=0;for lIIlIIIlIIlIlIIIlllII=IllIIIlllIIIllIII,lIIlIIIlIIlIlIIIlllII[#("n1oi")]do IlIlIIllIlII=IlIlIIllIlII+1;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII]=IlIllIIIIll[IlIlIIllIlII];end else IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("u9")]][lIIlIIIlIIlIlIIIlllII[#("Fz6")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IHuE")]];end;elseif llIIllllIlIIllIIl<=#("HUpiF5glWjeJTmIR7ouGqkiz6SSJag8dRnZmJQ3nbvJcTSS1smzCSCxxL0lWnHkPla1GxuhquhE4LfQn91qXSGvp0CLTFgaEk31S1mE7ehgL7CVGj7Wxqx6PPMQ5")then if llIIllllIlIIllIIl<=#("zWnh9URo8xXxsSKAVryQfKHtOnX7mcoHJoQv2E7SerkL998Oxp4uroNZp3EW6Ub6hqYdcnHrtPMYz5uOojK7i4ouL1g89lWtpoDSk4MiSNaMMYAtJZHXjeXnbE")then if llIIllllIlIIllIIl>#("lhIri3sJkDMDuHCoF3MSXBXAkO8jkBpQRCBajv2Tspo06vmpS0rtzVPUtigF4izUn6W2gBejb3zHm6EZBTCui5q5WRQboxYj0FNaJtiqVirGviHyOrdlReLrP")then IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cA")]]=lIIlIIIlIIlIlIIIlllII[#("4pV")];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("iK")]]=lIIlIIIlIIlIlIIIlllII[#("X5T")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("yo")]]=lIIlIIIlIIlIlIIIlllII[#("yv7")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("jR")]]=lIIlIIIlIIlIlIIIlllII[#{{595;337;203;144};{684;439;293;252};{556;76;383;300};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("reL")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OW")]][lIIlIIIlIIlIlIIIlllII[#("4PN")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{202;650;376;784};"1 + 1 = 111";{861;545;93;796};"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("47")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QZ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6kQ")]][lIIlIIIlIIlIlIIIlllII[#("XQd1")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("k7")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("eut")]][lIIlIIIlIIlIlIIIlllII[#("jSYe")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nl")]][lIIlIIIlIIlIlIIIlllII[#("5zC")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6Eud")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fZ")]][lIIlIIIlIIlIlIIIlllII[#("uWt")]]=lIIlIIIlIIlIlIIIlllII[#("GdJu")];end;elseif llIIllllIlIIllIIl==#("gAUd5PfoQRsEpgKlJaOVKOjsy7tNDW3vuTnTGSmNAgC0fkb7LFFLN3qCqCQ7vDW4X6iG21Q1XbvDmsnm5xb7rsTCDWDdcpr7uHcicGeUZOXMIXp7oDb9BYNFnQd")then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gy")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xn9")]][lIIlIIIlIIlIlIIIlllII[#("Mlfj")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("8l")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{822;655;448;565};"1 + 1 = 111";{699;972;393;295};}]][lIIlIIIlIIlIlIIIlllII[#{{355;429;345;316};{850;260;606;837};{24;24;70;682};{597;874;908;494};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("sy")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("X7q")]][lIIlIIIlIIlIlIIIlllII[#("Cmqy")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{241;793;236;899};{739;371;699;685};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("MRg")]][lIIlIIIlIIlIlIIIlllII[#("BMWu")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("zm")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("r2n")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#("FcjC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("z8")]]=lIIlIIIlIIlIlIIIlllII[#("QE5")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("8B")]IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("AFE")]))else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{167;116;396;63};"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("MTO")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("B7")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("uAq")]][lIIlIIIlIIlIlIIIlllII[#("dlq9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("NV")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QMd")]][lIIlIIIlIIlIlIIIlllII[#("ROSZ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{350;239;1;826};{700;364;493;26};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("kpQ")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{816;317;197;406};{238;31;804;599};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Xk")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dfM")]][lIIlIIIlIIlIlIIIlllII[#("g7Zv")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2P")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("ssL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("mL")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("JgH")]][lIIlIIIlIIlIlIIIlllII[#("Un7e")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("NO")]]=lIIlIIIlIIlIlIIIlllII[#("soL")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{449;748;23;984};{482;233;359;818};}]]=lIIlIIIlIIlIlIIIlllII[#("jgY")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Nn")]]=lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{779;997;405;470};}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("gh")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("AUD")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ok")]][lIIlIIIlIIlIlIIIlllII[#("Y5c")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{773;180;691;831};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];do return end;end;elseif llIIllllIlIIllIIl<=#("zMZHUyhPpekArrhNFh3PHFZJnsGH4I5vC8vnZq2jQKRjsLRjQ99gWyK3WpsB2KUSjY8t64YopU86XQqNLx15IZJezCCJ7BrfZ9aENymWkV0czNfg8Q0FTZjup35EDo")then if llIIllllIlIIllIIl>#("ZD3gYPX9njeUX8GPVvuKqKWvaZQnTCTs5DbJGHrBlQMuOfvvTojhhOaoQHg89JpVBWYu67joe3zK8CS5DtEFsLlqDX39AsCMA032qbAWf5dnpApoZlGPeVD0KH1id")then local llIIllllIlIIllIIl;local IlIllIIIIll;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("XXR")]][lIIlIIIlIIlIlIIIlllII[#("KbNS")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("aQ")]]=lIIlIIIlIIlIlIIIlllII[#("3pK")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("at")]]=lIIlIIIlIIlIlIIIlllII[#("hlJ")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dM")]]=lIIlIIIlIIlIlIIIlllII[#("37d")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#{{220;94;927;51};"1 + 1 = 111";}]IIlIIIllIIlIIIlllI[IlIllIIIIll]=IIlIIIllIIlIIIlllI[IlIllIIIIll](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,IlIllIIIIll+1,lIIlIIIlIIlIlIIIlllII[#("aWi")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("GW")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{162;130;891;314};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("QWWC")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Cs")]][lIIlIIIlIIlIlIIIlllII[#("lAY")]]=lIIlIIIlIIlIlIIIlllII[#{{821;796;690;229};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("KE")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("05O")]][lIIlIIIlIIlIlIIIlllII[#("0S79")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll=lIIlIIIlIIlIlIIIlllII[#("1a")];llIIllllIlIIllIIl=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("egG")]];IIlIIIllIIlIIIlllI[IlIllIIIIll+1]=llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[IlIllIIIIll]=llIIllllIlIIllIIl[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{305;237;553;582};"1 + 1 = 111";}]];else local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ZM")]]=lIIlIIIlIIlIlIIIlllII[#("Iqy")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("EI")]]=lIIlIIIlIIlIlIIIlllII[#("GF6")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{708;910;714;299};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("LPs")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("xl")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("RbP")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("6N")]][lIIlIIIlIIlIlIIIlllII[#{{981;315;199;744};{412;393;994;706};{228;220;552;489};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Zom4")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("p4")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("8Wj")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("TJ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("BbD")]][lIIlIIIlIIlIlIIIlllII[#("AzHL")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("3K")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("H5j")]][lIIlIIIlIIlIlIIIlllII[#("K7l0")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("IW")]][lIIlIIIlIIlIlIIIlllII[#("BH3")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tlxu")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("tW")]][lIIlIIIlIIlIlIIIlllII[#("zoJ")]]=lIIlIIIlIIlIlIIIlllII[#("pWMQ")];end;elseif llIIllllIlIIllIIl<=#("YWCWjhIZOC4SAyI7bcHOkoXWIPydsTjqS5gqWEqiQ9HdVxufsMGZLz9J9PoFUFH4rN9FqqlHWz7kSTbktsVQnuPs5HrgpVzlDNWhx0YcB8dmCZ1pOdkBU1R77QJU8er")then local llIIllllIlIIllIIl;IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{649;617;274;424};"1 + 1 = 111";}]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("QRs")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("fl")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gv1")]][lIIlIIIlIIlIlIIIlllII[#("luoh")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("YK")]]=lIIlIIIlIIlIlIIIlllII[#("qM0")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{{883;359;376;837};"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("hvI")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lIIlIIIlIIlIlIIIlllII[#("g3D")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("5G")]]=lIIlIIIlIIlIlIIIlllII[#("cUL")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("xt")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("FHb")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ai")]][lIIlIIIlIIlIlIIIlllII[#("h4N")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("xnA9")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("05")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("zcF")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{645;492;268;557};}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("DMy")]][lIIlIIIlIIlIlIIIlllII[#("CK1Y")]];elseif llIIllllIlIIllIIl>#{{283;837;786;383};{884;11;298;444};{88;700;311;345};{758;391;63;326};{496;481;938;164};{421;153;910;924};{648;740;84;83};"1 + 1 = 111";"1 + 1 = 111";{511;181;895;255};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{623;699;955;848};{211;263;728;5};{687;186;137;36};{425;587;944;732};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{414;517;755;403};"1 + 1 = 111";"1 + 1 = 111";{733;129;691;776};{384;387;330;148};"1 + 1 = 111";{488;288;60;741};"1 + 1 = 111";{322;855;560;53};{197;129;349;633};"1 + 1 = 111";{499;823;463;288};{221;854;366;459};"1 + 1 = 111";{567;975;460;108};"1 + 1 = 111";{417;314;786;609};"1 + 1 = 111";{289;718;223;297};"1 + 1 = 111";{152;545;28;832};{960;967;839;491};{491;176;90;254};"1 + 1 = 111";"1 + 1 = 111";{840;851;122;830};"1 + 1 = 111";{440;854;909;178};"1 + 1 = 111";{638;216;342;544};{168;286;558;802};"1 + 1 = 111";{386;741;467;252};"1 + 1 = 111";{419;49;903;153};"1 + 1 = 111";{626;2;635;704};"1 + 1 = 111";"1 + 1 = 111";{5;73;643;582};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{69;697;651;787};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{533;431;546;865};{888;490;23;925};{35;451;654;655};{586;829;845;851};{540;475;164;333};{881;926;717;75};{382;998;664;659};"1 + 1 = 111";{689;120;716;15};"1 + 1 = 111";"1 + 1 = 111";{911;241;132;937};{803;5;997;478};{321;536;80;974};{267;702;228;255};"1 + 1 = 111";{395;589;678;548};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{114;323;926;338};"1 + 1 = 111";"1 + 1 = 111";{774;336;989;217};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{318;592;923;137};{830;19;177;237};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{840;85;280;416};"1 + 1 = 111";"1 + 1 = 111";{396;885;188;841};{142;315;647;64};"1 + 1 = 111";"1 + 1 = 111";{174;494;568;866};{184;552;185;729};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{223;873;788;508};{899;437;204;784};"1 + 1 = 111";"1 + 1 = 111";{268;793;309;495};{63;410;970;135};"1 + 1 = 111";"1 + 1 = 111";}then local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("iD")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";{136;220;229;5};}]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("dt")]][lIIlIIIlIIlIlIIIlllII[#("ecO")]]=lIIlIIIlIIlIlIIIlllII[#("z704")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{429;825;70;310};}]][lIIlIIIlIIlIlIIIlllII[#{{752;591;670;263};"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("2Hhu")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("OB")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("Ve4")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hS")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("gNb")]][lIIlIIIlIIlIlIIIlllII[#("x0DW")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("RS")]]=lIIlIIIlIIlIlIIIlllII[#("tSS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("VM")]]=lIIlIIIlIIlIlIIIlllII[#("8rS")];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("l7")]]=lIIlIIIlIIlIlIIIlllII[#{{237;377;388;313};"1 + 1 = 111";"1 + 1 = 111";}];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Fc")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("Fxt")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";}]][lIIlIIIlIIlIlIIIlllII[#("ZPL")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("cMGQ")]];else local IlIlllIllllIIIIlIlllI;local llIIllllIlIIllIIl;llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("Pn")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIIIlIIlIIlIll(IIlIIIllIIlIIIlllI,llIIllllIlIIllIIl+1,lIIlIIIlIIlIlIIIlllII[#("26j")]))IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("q2")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("riX")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qh")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("hKk")]][lIIlIIIlIIlIlIIIlllII[#("fkA6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("HQ")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("KYW")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{770;894;991;549};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("4I7")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("oT")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("o2")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("uJp")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("ii")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("1i9")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("UuJT")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("L0")]IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl](IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1])IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("VGf")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("G6")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("qJ")]]=IlIllIIIIll[lIIlIIIlIIlIlIIIlllII[#("cKQ")]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ba")]]=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("ITe")]][lIIlIIIlIIlIlIIIlllII[#{"1 + 1 = 111";{324;958;579;59};{445;109;36;225};{766;169;549;769};}]];IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;lIIlIIIlIIlIlIIIlllII=IlIlIIllIlII[IllIIIlllIIIllIII];llIIllllIlIIllIIl=lIIlIIIlIIlIlIIIlllII[#("l9")];IlIlllIllllIIIIlIlllI=IIlIIIllIIlIIIlllI[lIIlIIIlIIlIlIIIlllII[#("Ey8")]];IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl+1]=IlIlllIllllIIIIlIlllI;IIlIIIllIIlIIIlllI[llIIllllIlIIllIIl]=IlIlllIllllIIIIlIlllI[lIIlIIIlIIlIlIIIlllII[#("Pn4z")]];end;IllIIIlllIIIllIII=IllIIIlllIIIllIII+1;end;end);end;return llIllIlIlIIlIlllllIIlI(true,{},IllIlIlIllIlIIllllIIll())();end)(string.byte,table.insert,setmetatable);

Leave a Comment

Your email address will not be published.

%d bloggers like this: